User:Catrope/babaco.diff
Appearance
Property changes on: .
___________________________________________________________________
Modified: svn:mergeinfo
Merged /trunk/extensions/UsabilityInitiative:r56151-56206,56208,56210-56295,56297-56332,56334-56354,56356-56416,56418-56587,56589,56591-56990
Index: SimpleSearch/SimpleSearch.i18n.php
===================================================================
--- SimpleSearch/SimpleSearch.i18n.php (revision 56989)
+++ SimpleSearch/SimpleSearch.i18n.php (working copy)
@@ -21,8 +21,10 @@
/** Message documentation (Message documentation)
* @author Bennylin
* @author Mormegil
+ * @author Umherirrender
*/
$messages['qqq'] = array(
+ 'simplesearch-desc' => '{{desc}}',
'simplesearch-search' => 'Greyed out default text in the simple search box in the Vector skin. (It disappears and lets the user enter the requested search terms when the search box receives focus.)
{{Identical|Search}}',
@@ -36,6 +38,7 @@
'simplesearch' => 'Eenvoudige soek',
'simplesearch-desc' => 'Voeg ekstra funksionaliteit by die vereenvoudigde soek in Vector',
'simplesearch-search' => 'Soek',
+ 'simplesearch-containing' => 'bevat...',
);
/** Arabic (العربية)
@@ -63,6 +66,7 @@
'simplesearch' => 'ПроÑÑ‚Ñ‹ пошук',
'simplesearch-desc' => 'Дадае Ð´Ð°Ð´Ð°Ñ‚ÐºÐ¾Ð²Ñ‹Ñ Ð¼Ð°Ð³Ñ‡Ñ‹Ð¼Ð°Ñьці да Ñпрошчанага пошуку Ñž афармленьні «ВÑктар»',
'simplesearch-search' => 'Пошук',
+ 'simplesearch-containing' => 'утрымлівае...',
);
/** Bengali (বাংলা)
@@ -80,6 +84,7 @@
'simplesearch' => 'Klask eeun',
'simplesearch-desc' => "Ouzhpennañ a ra arc'hwelioù all d'ar c'hlask eeunaet Vector",
'simplesearch-search' => 'Klask',
+ 'simplesearch-containing' => 'ennañ...',
);
/** Bosnian (Bosanski)
@@ -89,6 +94,7 @@
'simplesearch' => 'Jednostavna pretraga',
'simplesearch-desc' => 'Dodaje dodatnu funkcionalnost u Vector jednostavnu pretragu',
'simplesearch-search' => 'Traži',
+ 'simplesearch-containing' => 'sadrži...',
);
/** Catalan (Català )
@@ -108,6 +114,7 @@
'simplesearch' => 'ZjednoduÅ¡ené hledánÃ',
'simplesearch-desc' => 'Rozšiřuje funkcionalitu zjednodušeného hledánà ve vzhledu Vektor',
'simplesearch-search' => 'Hledat',
+ 'simplesearch-containing' => 'obsahujÃcÃ…',
);
/** Danish (Dansk)
@@ -126,6 +133,7 @@
'simplesearch' => 'Einfache Suche',
'simplesearch-desc' => 'Fügt Extra-Funktionalität zur vereinfachten Suche des Vektor-Skins hinzu',
'simplesearch-search' => 'Suche',
+ 'simplesearch-containing' => 'enthält …',
);
/** Lower Sorbian (Dolnoserbski)
@@ -135,6 +143,7 @@
'simplesearch' => 'Jadnore pytanje',
'simplesearch-desc' => 'Pśidawa zjadnorjonemu pytanjeju Vectora wósebnu funkcionalnosć.',
'simplesearch-search' => 'PytaÅ›',
+ 'simplesearch-containing' => 'wopśimujo...',
);
/** Greek (Ελληνικά)
@@ -145,6 +154,7 @@
'simplesearch' => 'Απλή αναζήτηση',
'simplesearch-desc' => 'Î ÏοσθÎτει ÎξτÏα λειτουÏγικότητα στην απλοποιημÎνη αναζήτηση του Vector',
'simplesearch-search' => 'Αναζήτηση',
+ 'simplesearch-containing' => 'πεÏιÎχει...',
);
/** Esperanto (Esperanto)
@@ -154,10 +164,12 @@
'simplesearch' => 'Simpla serĉo',
'simplesearch-desc' => 'Aldonas pluan funkciadon al la simpligita serĉo de Vector.',
'simplesearch-search' => 'Serĉi',
+ 'simplesearch-containing' => 'enhavas...',
);
/** Spanish (Español)
* @author Antur
+ * @author Crazymadlover
* @author Locos epraix
* @author Omnipaedista
*/
@@ -165,6 +177,7 @@
'simplesearch' => 'Búsqueda simple',
'simplesearch-desc' => 'Agrega funcionalidades extra al vector de búsqueda simple',
'simplesearch-search' => 'Búsqueda',
+ 'simplesearch-containing' => 'conteniendo...',
);
/** Estonian (Eesti)
@@ -185,22 +198,34 @@
'simplesearch-search' => 'Bilatu',
);
+/** Persian (Ùارسی)
+ * @author Mardetanha
+ */
+$messages['fa'] = array(
+ 'simplesearch' => 'جستجوی ساده',
+ 'simplesearch-search' => 'جستجو',
+);
+
/** Finnish (Suomi)
+ * @author Cimon Avaro
* @author Str4nd
*/
$messages['fi'] = array(
'simplesearch' => 'Yksinkertainen haku',
'simplesearch-desc' => 'Lisää lisätoimintoja Vectorin yksinkertaistettuun hakuun.',
'simplesearch-search' => 'Etsi',
+ 'simplesearch-containing' => 'sisältää...',
);
/** French (Français)
* @author IAlex
+ * @author PieRRoMaN
*/
$messages['fr'] = array(
'simplesearch' => 'Recherche simple',
'simplesearch-desc' => "Ajoute des fonctionnalités à la recherche simplifiée de l'habillage Vector",
'simplesearch-search' => 'Rechercher',
+ 'simplesearch-containing' => 'contenant...',
);
/** Franco-Provençal (Arpetan)
@@ -218,8 +243,18 @@
'simplesearch' => 'Busca sinxela',
'simplesearch-desc' => 'Engade a funcionalidade adicional á busca simplificada do Vector',
'simplesearch-search' => 'Procurar',
+ 'simplesearch-containing' => 'que conteña...',
);
+/** Ancient Greek (ἈÏχαία ἑλληνικὴ)
+ * @author Crazymadlover
+ * @author Omnipaedista
+ */
+$messages['grc'] = array(
+ 'simplesearch-search' => 'Ζητεῖν',
+ 'simplesearch-containing' => 'πεÏιÎχον...',
+);
+
/** Swiss German (Alemannisch)
* @author Als-Holder
*/
@@ -227,6 +262,7 @@
'simplesearch' => 'Eifachi Suechi',
'simplesearch-desc' => 'Fiegt e extra Funktionswys zue dr vereifachte Suechi vum Vekter derzue',
'simplesearch-search' => 'Suechi',
+ 'simplesearch-containing' => 'din het s …',
);
/** Hebrew (עברית)
@@ -235,8 +271,9 @@
*/
$messages['he'] = array(
'simplesearch' => 'חיפוש פשוט',
- 'simplesearch-desc' => 'הוספת ×ª×›×•× ×•×ª × ×•×¡×¤×•×ª לחיפוש המפושט של וקטור',
+ 'simplesearch-desc' => 'הוספת ×ª×›×•× ×•×ª × ×•×¡×¤×•×ª לחיפוש המפושט של העיצוב "וקטור"',
'simplesearch-search' => 'חיפוש',
+ 'simplesearch-containing' => 'כולל...',
);
/** Croatian (Hrvatski)
@@ -255,6 +292,7 @@
'simplesearch' => 'Jednore pytanje',
'simplesearch-desc' => 'Přidawa wosebitu funkcionalnosć k zjednorjenej pytanju Vectora.',
'simplesearch-search' => 'Pytać',
+ 'simplesearch-containing' => 'wobsahuje...',
);
/** Hungarian (Magyar)
@@ -273,15 +311,18 @@
'simplesearch' => 'Recerca simple',
'simplesearch-desc' => 'Adde functionalitate extra al recerca simplificate del Vector',
'simplesearch-search' => 'Cercar',
+ 'simplesearch-containing' => 'continente...',
);
/** Indonesian (Bahasa Indonesia)
* @author Bennylin
+ * @author Irwangatot
*/
$messages['id'] = array(
'simplesearch' => 'Pencarian sederhana',
'simplesearch-desc' => 'Tambahkan fungsionalitas tambahan untuk pencarian sederhana Vector',
'simplesearch-search' => 'Cari',
+ 'simplesearch-containing' => 'isian ...',
);
/** Italian (Italiano)
@@ -295,11 +336,13 @@
/** Japanese (日本語)
* @author Aotake
+ * @author Fryed-peach
*/
$messages['ja'] = array(
'simplesearch' => '基本検索',
'simplesearch-desc' => 'ベクターã®ç°¡ç•¥åŒ–ã•ã‚ŒãŸæ¤œç´¢æ©Ÿèƒ½ã«è¿½åŠ æ©Ÿèƒ½ã‚’è¿½åŠ ã™ã‚‹',
'simplesearch-search' => '検索',
+ 'simplesearch-containing' => 'ã“ã®èªžå¥ã‚’全文検索',
);
/** Javanese (Basa Jawa)
@@ -343,6 +386,7 @@
'simplesearch' => 'Eifach Söhke',
'simplesearch-desc' => 'Deiht extra Müjjeleschkeijte beim „{{int:simplesearch}}“ vun de Bedeen-Bovverfläsh „Vektor“ bei.',
'simplesearch-search' => 'Söhke',
+ 'simplesearch-containing' => 'dren änthallde…',
);
/** Latin (Latina)
@@ -359,6 +403,7 @@
'simplesearch' => 'Einfach Sich',
'simplesearch-desc' => 'Setzt eng extra Fonctionalitéit bäi déi einfach Sich derbäi.',
'simplesearch-search' => 'Sich',
+ 'simplesearch-containing' => 'mat ...',
);
/** Lithuanian (Lietuvių)
@@ -410,8 +455,17 @@
'simplesearch' => 'Eenvoudig zoeken',
'simplesearch-desc' => 'Voegt extra functionaliteit toe aan het vereenvoudigd zoeken in Vector',
'simplesearch-search' => 'Zoeken',
+ 'simplesearch-containing' => 'bevat...',
);
+/** Norwegian Nynorsk (‪Norsk (nynorsk)‬)
+ * @author Gunnernett
+ */
+$messages['nn'] = array(
+ 'simplesearch-search' => 'Søk',
+ 'simplesearch-containing' => 'inneheld ...',
+);
+
/** Norwegian (bokmål)‬ (‪Norsk (bokmål)‬)
* @author Laaknor
*/
@@ -428,15 +482,18 @@
'simplesearch' => 'Recèrca simpla',
'simplesearch-desc' => "Apond de foncionalitats a la recèrca simplificada de l'abilhatge Vector",
'simplesearch-search' => 'Recercar',
+ 'simplesearch-containing' => 'que conten...',
);
/** Polish (Polski)
* @author Leinad
+ * @author Sp5uhe
*/
$messages['pl'] = array(
'simplesearch' => 'Proste wyszukiwanie',
'simplesearch-desc' => 'Dodaje dodatkową funkcjonalność prostego wyszukiwania w skórce Vector',
'simplesearch-search' => 'Szukaj',
+ 'simplesearch-containing' => 'zawierajÄ…ce...',
);
/** Piedmontese (Piemontèis)
@@ -446,6 +503,7 @@
'simplesearch' => 'Arserca sempia',
'simplesearch-desc' => "A gionta funsionalità extra a l'arserca semplifià ëd Vector",
'simplesearch-search' => 'Arserca',
+ 'simplesearch-containing' => 'contenent ...',
);
/** Pontic (Ποντιακά)
@@ -466,12 +524,14 @@
/** Portuguese (Português)
* @author Giro720
+ * @author Malafaya
* @author Waldir
*/
$messages['pt'] = array(
'simplesearch' => 'Pesquisa simples',
'simplesearch-desc' => 'Adiciona funcionalidades extra à pesquisa simplificada do Vector.',
'simplesearch-search' => 'Pesquisa',
+ 'simplesearch-containing' => 'contendo...',
);
/** Brazilian Portuguese (Português do Brasil)
@@ -507,15 +567,18 @@
'simplesearch' => 'Ricerca semblice',
'simplesearch-desc' => "Aggiunge 'na funzione extra a 'u vettore d'a ricerche semblificate",
'simplesearch-search' => 'Cirche',
+ 'simplesearch-containing' => 'tène...',
);
/** Russian (РуÑÑкий)
* @author Ferrer
+ * @author ÐлекÑандр Сигачёв
*/
$messages['ru'] = array(
'simplesearch' => 'ПроÑтой поиÑк',
'simplesearch-desc' => 'ДобавлÑет больше функциональноÑти в проÑтой поиÑк Vector',
'simplesearch-search' => 'ПоиÑк',
+ 'simplesearch-containing' => 'Ñодержащие…',
);
/** Yakut (Саха тыла)
@@ -525,6 +588,7 @@
'simplesearch' => 'Судургу көрдөөһүн',
'simplesearch-desc' => 'Vector диÑн Ñудургу ÐºÓ©Ñ€Ð´Ó©Ó©Ñ‡Ñ‡Ò¯Ð³Ñ Ñбии кыахтары биÑÑ€ÑÑ€',
'simplesearch-search' => 'Көрдөөһүн',
+ 'simplesearch-containing' => 'иһинÑÑҕи...',
);
/** Sicilian (Sicilianu)
@@ -543,6 +607,7 @@
'simplesearch' => 'Jednoduché vyhľadávanie',
'simplesearch-desc' => 'Pridáva ÄalÅ¡iu funkcionalitu k zjednoduÅ¡enému vyhľadávaniu témy vzhľadu Vector',
'simplesearch-search' => 'Hľadať',
+ 'simplesearch-containing' => 'obsahuje...',
);
/** Slovenian (SlovenÅ¡Äina)
@@ -555,11 +620,13 @@
);
/** Serbian Cyrillic ekavian (СрпÑки (ћирилица))
+ * @author Sasa Stefanovic
* @author Михајло Ðнђелковић
*/
$messages['sr-ec'] = array(
'simplesearch' => 'ЈедноÑтавна претрага',
'simplesearch-search' => 'Претрага',
+ 'simplesearch-containing' => 'Ñадржи...',
);
/** Serbian Latin ekavian (Srpski (latinica))
@@ -585,6 +652,7 @@
$messages['sw'] = array(
'simplesearch' => 'Tafuti sahili',
'simplesearch-search' => 'Kutafuta',
+ 'simplesearch-containing' => 'ya maneno...',
);
/** Telugu (తెలà±à°—à±)
@@ -603,6 +671,7 @@
'simplesearch' => 'Basit arama',
'simplesearch-desc' => "Vector'un basitleştirilmiş aramasına ilave işlevler ekler",
'simplesearch-search' => 'Ara',
+ 'simplesearch-containing' => 'içeren...',
);
/** Tatar (Cyrillic) (Татарча/Tatarça (Cyrillic))
@@ -630,8 +699,19 @@
'simplesearch' => 'Riserca sènplise',
'simplesearch-desc' => 'Zonta funsionalità agiuntive a la riserca senplificà de Vector',
'simplesearch-search' => 'Serca',
+ 'simplesearch-containing' => 'che contien...',
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'simplesearch' => 'Järgeline ecind',
+ 'simplesearch-desc' => 'Ližadab enambad funkcionaližust Vektoran järgeližhe ecindha',
+ 'simplesearch-search' => 'Ectä',
+ 'simplesearch-containing' => 'mülütajad...',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Vinhtantran
*/
@@ -639,8 +719,23 @@
'simplesearch' => 'Tìm kiếm đơn giản',
'simplesearch-desc' => 'Thêm chức năng phụ cho bộ tìm kiếm đơn giản của BỠngoà i Vector',
'simplesearch-search' => 'Tìm kiếm',
+ 'simplesearch-containing' => 'có chứa...',
);
+/** Mingrelian (მáƒáƒ გáƒáƒšáƒ£áƒ ი)
+ * @author Lika2672
+ */
+$messages['xmf'] = array(
+ 'simplesearch-search' => 'გáƒáƒ უáƒ',
+);
+
+/** Yiddish (ייִדיש)
+ * @author פוילישער
+ */
+$messages['yi'] = array(
+ 'simplesearch-search' => 'זוכן',
+);
+
/** Yue (粵語)
* @author Shinjiman
*/
Index: SimpleSearch/SimpleSearch.js
===================================================================
--- SimpleSearch/SimpleSearch.js (revision 56989)
+++ SimpleSearch/SimpleSearch.js (working copy)
@@ -80,27 +80,31 @@
render: function( query ) {
var perfectMatch = false;
$j(this).closest( '.suggestions' ).find( '.suggestions-results div' ).each( function() {
- if ( $j(this).text() == query ) {
+ if ( $j(this).data( 'text' ) == query ) {
perfectMatch = true;
}
} );
if ( perfectMatch ) {
if ( $j(this).children().size() == 0 ) {
- $j(this).append(
- $j( '<div />' )
- .addClass( 'special-label' )
- .text( gM( 'simplesearch-containing' ) )
- );
- $j(this).append(
- $j( '<span />' ).addClass( 'special-query' ).text( query )
- );
$j(this).show();
+ $label = $j( '<div />' )
+ .addClass( 'special-label' )
+ .text( gM( 'simplesearch-containing' ) )
+ .appendTo( $j(this) );
+ $query = $j( '<div />' )
+ .addClass( 'special-query' )
+ .text( query )
+ .appendTo( $j(this) );
+ $query.autoEllipse();
} else {
- $j(this).find( '.special-query' ).text( query );
+ $j(this).find( '.special-query' )
+ .empty()
+ .text( query )
+ .autoEllipse();
}
} else {
+ $j(this).hide();
$j(this).empty();
- $j(this).hide();
}
},
select: function( $textbox ) {
Index: combine.sh
===================================================================
--- combine.sh (revision 56989)
+++ combine.sh (working copy)
@@ -4,8 +4,8 @@
rm css/combined.*
echo "Merging raw scripts and styles"
# Explicitly including scripts is important, because loading order is important
-cat js/js2/jquery-1.3.2.js js/js2/js2.js > js/js2.combined.js
-cat js/plugins/jquery.async.js js/plugins/jquery.browser.js js/plugins/jquery.cookie.js js/plugins/jquery.textSelection.js js/plugins/jquery.wikiEditor.js js/plugins/jquery.wikiEditor.toolbar.js js/plugins/jquery.wikiEditor.toc.js > js/plugins.combined.js
+cat js/js2/jquery-1.3.2.js js/js2/jquery-ui-1.7.2.js js/js2/js2.js > js/js2.combined.js
+cat js/plugins/jquery.async.js js/plugins/jquery.autoEllipse.js js/plugins/jquery.browser.js js/plugins/jquery.cookie.js js/plugins/jquery.delayedBind.js js/plugins/jquery.namespaceSelect.js js/plugins/jquery.suggestions.js js/plugins/jquery.textSelection.js js/plugins/jquery.wikiEditor.js js/plugins/jquery.wikiEditor.dialogs.js js/plugins/jquery.wikiEditor.toolbar.js js/plugins/jquery.wikiEditor.toc.js > js/plugins.combined.js
# Styles can be loaded in any order
cat css/*.css > css/combined.css
# For more info on JSMin, see: http://www.crockford.com/javascript/jsmin.html
Index: css/suggestions.css
===================================================================
--- css/suggestions.css (revision 56989)
+++ css/suggestions.css (working copy)
@@ -36,10 +36,13 @@
.suggestions-result {
color: black;
color: WindowText;
- padding: 0.25em 0.25em;
- line-height: 1.25em;
margin: 0;
+ width: 100%;
}
+.suggestions-result span {
+ line-height: 1.5em;
+ padding: 0.25em 0.25em;
+}
.suggestions-result-current {
background-color: #4C59A6;
background-color: Highlight;
Property changes on: css/suggestions.css
___________________________________________________________________
Added: svn:eol-style
+ native
Index: css/wikiEditor.dialogs.css
===================================================================
--- css/wikiEditor.dialogs.css (revision 56989)
+++ css/wikiEditor.dialogs.css (working copy)
@@ -5,6 +5,6 @@
}
/* Put suggestions (default z-index 99) on top of dialogs (z-index 1002) */
-div.os-suggest {
+div.suggestions {
z-index: 1099;
}
Index: css/combined.css
===================================================================
--- css/combined.css (revision 56989)
+++ css/combined.css (working copy)
@@ -36,10 +36,13 @@
.suggestions-result {
color: black;
color: WindowText;
- padding: 0.25em 0.25em;
- line-height: 1.25em;
margin: 0;
+ width: 100%;
}
+.suggestions-result span {
+ line-height: 1.5em;
+ padding: 0.25em 0.25em;
+}
.suggestions-result-current {
background-color: #4C59A6;
background-color: Highlight;
@@ -92,7 +95,7 @@
}
/* Put suggestions (default z-index 99) on top of dialogs (z-index 1002) */
-div.os-suggest {
+div.suggestions {
z-index: 1099;
}
/* wikiEditor toc module */
Index: css/combined.min.css
===================================================================
--- css/combined.min.css (revision 56989)
+++ css/combined.min.css (working copy)
@@ -34,10 +34,13 @@
.suggestions-result{
color:black;
color:WindowText;
-padding:0.25em 0.25em;
-line-height:1.25em;
margin:0;
+width:100%;
}
+.suggestions-result span{
+line-height:1.5em;
+padding:0.25em 0.25em;
+}
.suggestions-result-current{
background-color:#4C59A6;
background-color:Highlight;
@@ -83,7 +86,7 @@
.ui-widget table td{
padding:0.5em;
}
-div.os-suggest{
+div.suggestions{
z-index:1099;
}
.wikiEditor-ui-text{
Index: OptIn/OptInLink.i18n.php
===================================================================
--- OptIn/OptInLink.i18n.php (revision 56989)
+++ OptIn/OptInLink.i18n.php (working copy)
@@ -139,8 +139,11 @@
*/
$messages['da'] = array(
'optin-try' => 'Prøv Beta',
+ 'tooltip-pt-optin-try' => 'Afprøv nye funktioner',
'optin-leave' => 'Forlad Beta',
+ 'tooltip-pt-optin-leave' => 'Slå de nye funktioner fra igen',
'optin-feedback' => 'Tilbagemelding om Beta',
+ 'tooltip-pt-optin-feedback' => 'Giv en tilbagemelding om dine oplevelser med de nye funktioner',
);
/** German (Deutsch)
@@ -190,7 +193,7 @@
'tooltip-pt-optin-try' => 'Δοκιμάστε νÎα χαÏακτηÏιστικά',
'optin-leave' => 'Εγκαταλείψτε την Beta',
'tooltip-pt-optin-leave' => 'ΑπενεÏγοποίηση νÎων χαÏακτηÏιστικών',
- 'optin-feedback' => 'ΑνατÏοφοδότηση Beta',
+ 'optin-feedback' => 'ΑνάδÏαση πεÏί της Beta',
'tooltip-pt-optin-feedback' => 'ΠαÏοχή ανάδÏασης πεÏί της εμπειÏίας σας με τις νÎες λειτουÏγίες',
);
@@ -240,10 +243,22 @@
*/
$messages['eu'] = array(
'optin-try' => 'Beta probatu',
+ 'tooltip-pt-optin-try' => 'Eginbide berriak probatu',
'optin-leave' => 'Beta utzi',
+ 'tooltip-pt-optin-leave' => 'Eginbide berriak ezgaitu',
'optin-feedback' => 'Beta feedbacka',
);
+/** Persian (Ùارسی)
+ * @author Ladsgroup
+ */
+$messages['fa'] = array(
+ 'optin-try' => 'استÙاده از بتا',
+ 'tooltip-pt-optin-try' => 'خروج از امکانات جدید',
+ 'optin-leave' => 'خروج از بتا',
+ 'tooltip-pt-optin-leave' => 'خاموش کردن امکانات جدید',
+);
+
/** Finnish (Suomi)
* @author Cimon Avaro
* @author Crt
@@ -255,7 +270,9 @@
'optin-try' => 'Kokeile Betaa',
'tooltip-pt-optin-try' => 'Kokeile uusia ominaisuuksia',
'optin-leave' => 'Poistu Betasta',
+ 'tooltip-pt-optin-leave' => 'Poista käytöstä uudet omaisuudet',
'optin-feedback' => 'Anna palautetta',
+ 'tooltip-pt-optin-feedback' => 'Tarjoa palautetta kokemuksistasi uusien ominaisuuksien osalta',
);
/** French (Français)
@@ -298,6 +315,18 @@
'tooltip-pt-optin-feedback' => 'Gib Ruckmäldige iber Dyni Erfahrige mit dr neje Funktione',
);
+/** Hebrew (עברית)
+ * @author Rotem Liss
+ */
+$messages['he'] = array(
+ 'optin-try' => 'הרשמה לגרסת בט×',
+ 'tooltip-pt-optin-try' => '× ×™×¡×•×™ ×ª×›×•× ×•×ª חדשות',
+ 'optin-leave' => 'עזיבת גרסת הבט×',
+ 'tooltip-pt-optin-leave' => 'כיבוי ×”×ª×›×•× ×•×ª החדשות',
+ 'optin-feedback' => 'משוב על גרסת הבט×',
+ 'tooltip-pt-optin-feedback' => 'כתבו משוב על × ×¡×™×•× ×›× ×¢× ×”×ª×›×•× ×•×ª החדשות',
+);
+
/** Croatian (Hrvatski)
* @author Suradnik13
*/
@@ -330,6 +359,7 @@
'optin-leave' => 'A bétateszt befejezése',
'tooltip-pt-optin-leave' => 'Új lehetőségek kikapcsolása',
'optin-feedback' => 'Visszajelzés a bétáról',
+ 'tooltip-pt-optin-feedback' => 'Adj visszajelzést az új funkciókkal kapcsolatos tapasztalataidról',
);
/** Interlingua (Interlingua)
@@ -441,7 +471,7 @@
*/
$messages['lb'] = array(
'optin-try' => 'Probéiert Beta aus',
- 'tooltip-pt-optin-try' => 'Probéiert déi nei Fonctionalitéiten aus',
+ 'tooltip-pt-optin-try' => 'Probéiert déi nei Fonctionalitéiten aus',
'optin-leave' => 'Beta verloossen',
'tooltip-pt-optin-leave' => 'Schalt déi nei Fonctionalitéiten aus',
'optin-feedback' => 'Gitt eis Är Meenung',
@@ -474,6 +504,18 @@
'optin-feedback' => 'МиÑлења за Бета',
);
+/** Malayalam (മലയാളം)
+ * @author Praveenp
+ */
+$messages['ml'] = array(
+ 'optin-try' => 'ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•àµà´•',
+ 'tooltip-pt-optin-try' => 'à´ªàµà´¤à´¿à´¯ സവിശേഷതകളàµâ€ പരിശോധികàµà´•àµà´•',
+ 'optin-leave' => 'ബീറàµà´± വിടàµà´•',
+ 'tooltip-pt-optin-leave' => 'à´ªàµà´¤à´¿à´¯ സവിശേഷതകളàµâ€ വേണàµà´Ÿ',
+ 'optin-feedback' => 'ബീറàµà´±à´¯àµà´Ÿàµ† ഉപയോഗാനàµà´à´µà´®à´±à´¿à´¯à´¿à´•àµà´•àµà´•',
+ 'tooltip-pt-optin-feedback' => 'à´ªàµà´¤à´¿à´¯ സവിശേഷതകളàµà´®à´¾à´¯àµà´³àµà´³ താങàµà´•à´³àµà´Ÿàµ† à´…à´¨àµà´à´µà´‚ പങàµà´•àµ വെയàµà´•àµà´•àµà´•',
+);
+
/** Malay (Bahasa Melayu)
* @author Diagramma Della Verita
* @author Kurniasan
@@ -515,6 +557,17 @@
'tooltip-pt-optin-feedback' => 'Terugkoppeling geven over uw ervaringen met de nieuwe functionaliteit',
);
+/** Norwegian Nynorsk (‪Norsk (nynorsk)‬)
+ * @author Gunnernett
+ */
+$messages['nn'] = array(
+ 'optin-try' => 'Prøv Beta',
+ 'tooltip-pt-optin-try' => 'Prøv ut nye funksjonar',
+ 'optin-leave' => 'GÃ¥ ut av Beta',
+ 'tooltip-pt-optin-leave' => 'Slå av nye funksjonar',
+ 'optin-feedback' => 'Beta tilbakemelding',
+);
+
/** Norwegian (bokmål)‬ (‪Norsk (bokmål)‬)
* @author Jon Harald Søby
* @author Laaknor
@@ -533,8 +586,11 @@
*/
$messages['oc'] = array(
'optin-try' => 'Ensajar la Bèta',
+ 'tooltip-pt-optin-try' => 'Ensajatz las foncionalitats novèlas',
'optin-leave' => 'Quitar la Bèta',
+ 'tooltip-pt-optin-leave' => 'Desactivar las foncionalitats novèlas',
'optin-feedback' => 'Balhatz vòstre vejaire',
+ 'tooltip-pt-optin-feedback' => "Balhatz vòstras impressions sus l'utilizacion de las foncionalitats novèlas",
);
/** Deitsch (Deitsch)
@@ -639,8 +695,11 @@
*/
$messages['sah'] = array(
'optin-try' => 'Beta-ны тургутуу',
+ 'tooltip-pt-optin-try' => 'Саҥа кыахтары тургут',
'optin-leave' => 'Beta-ттан тахÑÑ‹Ñ‹',
+ 'tooltip-pt-optin-leave' => 'Саҥа кыахтары туһанары араар',
'optin-feedback' => 'Сыанабылы ыытарга',
+ 'tooltip-pt-optin-feedback' => 'Саҥаны туттубутуҥ туһунан кÑпÑÑÑ',
);
/** Slovak (SlovenÄina)
@@ -665,11 +724,14 @@
);
/** Serbian Cyrillic ekavian (СрпÑки (ћирилица))
+ * @author Sasa Stefanovic
* @author Михајло Ðнђелковић
*/
$messages['sr-ec'] = array(
'optin-try' => 'Пробајте бета-верзију',
+ 'tooltip-pt-optin-try' => 'Пробајте нове могућноÑти',
'optin-leave' => 'ÐапуÑтите бета-верзију',
+ 'tooltip-pt-optin-leave' => 'УгаÑите нове могућноÑти',
'optin-feedback' => 'Повратна информација о бета-верзији',
);
@@ -737,6 +799,15 @@
'tooltip-pt-optin-feedback' => "Dane la to inpression su l'utiliso de ste funsionalità nove",
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'optin-try' => 'Kodvi bata',
+ 'tooltip-pt-optin-try' => 'Kodvgat uded voindad',
+ 'optin-leave' => 'Lähtta Betaspäi',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Minh Nguyen
* @author Vinhtantran
Index: OptIn/OptIn.i18n.php
===================================================================
--- OptIn/OptIn.i18n.php (revision 56989)
+++ OptIn/OptIn.i18n.php (working copy)
@@ -730,6 +730,14 @@
Děkujeme a budeme se těšit na vaše názory!',
);
+/** Welsh (Cymraeg)
+ * @author Lloffiwr
+ */
+$messages['cy'] = array(
+ 'optin-accept-long' => 'Rhoi cynnig ar Beta',
+ 'optin-submit-out' => 'Gadael Beta',
+);
+
/** Danish (Dansk)
* @author Byrial
*/
@@ -1030,7 +1038,7 @@
'optin-title-optedin' => 'Εγκαταλείψτε την Beta',
'optin-title-justoptedin' => 'ΚαλωσήÏθατε στην Beta',
'optin-title-justoptedout' => 'Σας ευχαÏιστοÏμε που δοκιμάσατε την Beta μας',
- 'optin-title-feedback' => 'ΑνατÏοφοδότηση Beta',
+ 'optin-title-feedback' => 'ΑνάδÏαση πεÏί της Beta',
'optin-needlogin' => 'Î ÏÎπει να [$1 συνδεθείς] για να δοκιμάσεις την Beta',
'optin-intro' => 'Η Î Ïωτοβουλία ΧÏηστικότητας της Wikipedia Îχει δουλÎψει σκληÏά για τη βελτίωση της χÏηστικότητας της Wikipedia.
Θα θÎλατε να δοκιμάσετε τη Beta;',
@@ -1042,14 +1050,14 @@
'optin-leave-cancel' => 'Αν θα θÎλατε να συνεχίσετε να χÏησιμοποιείτε τη Beta, μποÏείτε να επιστÏÎψετε στο $1.',
'optin-success-out' => 'Εγκαταλείψατε επιτυχώς τη Beta.
ΜποÏείτε να τη δοκιμάσετε πάλι ανά πάσα στιγμή κάνοντας κλικ στο σÏνδεσμο "{{int:optin-try}}" στο πάνω μÎÏος της οθόνης.',
- 'optin-success-feedback' => 'Σας ευχαÏιστοÏμε για την ανατÏοφοδότησή σας!',
+ 'optin-success-feedback' => 'Σας ευχαÏιστοÏμε για την γνώμη σας!',
'optin-accept-short' => 'Ας το κάνουμε!',
'optin-accept-long' => 'Δοκιμάστε την Beta',
'optin-accept-long-anon' => 'Συνδεθείτε και δοκιμάστε το Beta',
'optin-deny-short' => 'Όχι, ευχαÏιστώ.',
'optin-deny-long' => 'ΕπιστÏοφή στην Ï€ÏοηγοÏμενη σελίδα',
'optin-submit-out' => 'Εγκαταλείψτε την Beta',
- 'optin-submit-feedback' => 'Δώστε ανατÏοφοδότηση',
+ 'optin-submit-feedback' => 'Δώστε ανάδÏαση',
'optin-survey-yes' => 'Îαι',
'optin-survey-no' => 'Όχι',
'optin-survey-intro' => 'ΕυχαÏιστοÏμε για την δοκιμή της Beta.
@@ -1397,6 +1405,25 @@
Milesker eta zure berri izateko irrikan gaude!',
);
+/** Persian (Ùارسی)
+ * @author Ladsgroup
+ * @author Mardetanha
+ */
+$messages['fa'] = array(
+ 'optin-title-optedout' => 'استÙاده از بتا',
+ 'optin-title-optedin' => 'خروج از بتا',
+ 'optin-title-justoptedin' => 'به نسخه بتا خوش‌آمدید',
+ 'optin-title-justoptedout' => 'ممنونیم از اینکه نسخه بتا را امتØان کردید',
+ 'optin-needlogin' => 'شما برای استÙاده از نسخه بتا باید [$1 وارد شوید].',
+ 'optin-accept-long' => 'خروج از بتا',
+ 'optin-deny-short' => 'نه ممنون!',
+ 'optin-deny-long' => 'بازگشت به صÙØÙ‡ قبلی',
+ 'optin-submit-out' => 'خروج از بتا',
+ 'optin-survey-yes' => 'بله',
+ 'optin-survey-no' => 'نه',
+ 'optin-survey-answer-whyoptout-other' => 'دلایل دیگر:',
+);
+
/** Finnish (Suomi)
* @author Cimon Avaro
* @author Crt
@@ -1668,6 +1695,7 @@
);
/** Ancient Greek (ἈÏχαία ἑλληνικὴ)
+ * @author Crazymadlover
* @author Omnipaedista
*/
$messages['grc'] = array(
@@ -1675,6 +1703,7 @@
'optin-survey-no' => 'Οá½',
'optin-survey-answer-whyoptout-other' => 'Αἰτία ἄλλη:',
'optin-survey-answer-os-other' => 'Ἄλλον λειτουÏγικὸν σÏστημα:',
+ 'optin-survey-answer-changes-other' => 'Ἄλλον:',
);
/** Swiss German (Alemannisch)
@@ -1766,51 +1795,102 @@
);
/** Hebrew (עברית)
- * @author Rotem Liss
* @author Rotemliss
* @author YaronSh
*/
$messages['he'] = array(
'optin' => 'הרשמה ליוזמת השימושיות',
- 'optin-desc' => '×פשרות ×œ×ž×©×ª×ž×©×™× ×œ×”×™×¨×©× ×›×“×™ לקבל ×ת שיפורי השימושיות של יוזמת השימושיות',
- 'optin-needlogin' => '×¢×œ×™×›× [$1 ×œ×”×™×›× ×¡ לחשבון] כדי ×œ×”×™×¨×©× ×œ×§×‘×œ×ª שיפורי השימושיות של יוזמת השימושיות.',
- 'optin-intro' => 'יוזמת השימושיות של ויקיפדיה פיתחה עיצוב חדש וסרגל עריכה חדש כדי לשפר ×ת השימושיות של ויקיפדיה. ×©×™×¤×•×¨×™× ×לה ×˜×¨× ×”×•×¤×¢×œ×• לכל המשתמשי×, ×בל ב××¤×©×¨×•×ª×›× ×œ×”×™×¨×©× ××œ×™×”× ×‘×מצעות לחיצה על הכפתור "{{int:optin-submit-in}}" שלהלן.',
- 'optin-success-in' => '× ×¨×©×ž×ª× ×‘×”×¦×œ×—×” לקבלת שיפורי השימושיות של יוזמת השימושיות.
-ב××¤×©×¨×•×ª×›× ×œ×‘×˜×œ ×ת ×”×¨×©×ž×ª×›× ×‘×›×œ זמן ב×מצעות לחיצה על הכפתור "{{int:optin-submit-out}}" שלהלן.',
- 'optin-success-out' => '×‘×™×˜×œ×ª× ×‘×”×¦×œ×—×” ×ת ×”×¨×©×ž×ª×›× ×œ×§×‘×œ×ª שיפורי השימושיות של יוזמת השימושיות.
-ב××¤×©×¨×•×ª×›× ×œ×”×™×¨×©× ×©×•×‘ בכל זמן ב×מצעות לחיצה על הכפתור "{{int:optin-submit-out}}" שלהלן.',
+ 'optin-desc' => '×פשרות ×œ×ž×©×ª×ž×©×™× ×œ×”×™×¨×©× ×œ×’×¨×¡×ª הבט×, הכוללת ×ת שיפורי השימושיות ×”××—×¨×•× ×™× ×©×œ יוזמת השימושיות.',
+ 'optin-title-optedout' => 'הרשמה לגרסת הבט×',
+ 'optin-title-optedin' => 'עזיבת גרסת הבט×',
+ 'optin-title-justoptedin' => '×‘×¨×•×›×™× ×”×‘××™× ×œ×’×¨×¡×ª הבט×',
+ 'optin-title-justoptedout' => 'תודה ×œ×›× ×¢×œ ×©× ×™×¡×™×ª× ×ת גרסת הבט×',
+ 'optin-title-feedback' => 'משוב על גרסת הבט×',
+ 'optin-needlogin' => '×¢×œ×™×›× [$1 ×œ×”×™×›× ×¡ לחשבון] כדי ×œ×”×™×¨×©× ×œ×’×¨×¡×ª הבט×.',
+ 'optin-intro' => 'יוזמת השימוש של ויקיפדיה עבדה ועובדת קשה כדי לשפר ×ת השימושיות של ויקיפדיה.
+×”×× ×ª×¨×¦×• ×œ× ×¡×•×ª ×ת גרסת ×”×‘×˜× ×©×œ× ×•?',
+ 'optin-feedback-intro' => "תודה ×œ×›× ×¢×œ ×©× ×™×¡×™×ª× ×ת גרסת הבט×.
+× ×©×ž×— לדעת מה ××ª× ×—×•×©×‘×™× ×¢×œ הממשק החדש ×©×œ× ×•, לכן × ×¢×¨×™×š ×–×ת ×× ×ª×ž×œ×ו ×ת הש×לון (×”××•×¤×¦×™×•× ×œ×™) שלהלן.",
+ 'optin-feedback-back' => '×× ××™× ×›× ×¨×•×¦×™× ×œ×ž×œ× ×ת הש×לון, ב××¤×©×¨×•×ª×›× ×œ×—×–×•×¨ ל$1.',
+ 'optin-success-in' => 'כעת ××ª× ×ž× ×¡×™× ×ת גרסת הבט×.
+ב××¤×©×¨×•×ª×›× ×œ×¢×–×•×‘ ×ותה בכל עת ב×מצעות לחיצה על הקישור "{{int:optin-leave}}" בר×ש הדף.',
+ 'optin-leave-cancel' => '×× ×ª×¨×¦×• להמשיך להשתמש בגרסת הבט×, ב××¤×©×¨×•×ª×›× ×œ×—×–×•×¨ ל$1.',
+ 'optin-success-out' => '×‘×™×˜×œ×ª× ×‘×”×¦×œ×—×” ×ת ×”×¨×©×ž×ª×›× ×œ×’×¨×¡×ª הבט×.
+ב××¤×©×¨×•×ª×›× ×œ× ×¡×•×ª ×ותה שוב בכל עת ב×מצעות לחיצה על הקישור "{{int:optin-try}}" בר×ש הדף.',
'optin-success-feedback' => 'תודה על המשוב!',
+ 'optin-accept-short' => 'בו×ו × ×¢×©×” ×ת ×–×”!',
+ 'optin-accept-long' => '× ×¡×• ×ת גרסת הבט×',
+ 'optin-accept-long-anon' => '×”×™×›× ×¡×• לחשבון ×•× ×¡×• ×ת גרסת הבט×',
'optin-deny-short' => '×œ× ×ª×•×“×”',
'optin-deny-long' => 'חזרה לדף הקוד×',
- 'optin-submit-out' => 'ביטול הרשמה',
+ 'optin-submit-out' => 'עזיבת גרסת הבט×',
+ 'optin-submit-feedback' => 'מתן משוב',
'optin-survey-yes' => 'כן',
'optin-survey-no' => 'ל×',
- 'optin-survey-intro' => 'תודה ×œ×›× ×¢×œ ש××ª× ×ž× ×¡×™× ×ת שיפורי השימושיות של יוזמת השימושיות.
-ב××¤×©×¨×•×ª×›× ×œ×‘×˜×œ ×ת ×”×¨×©×ž×ª×›× ×‘×מצעות לחיצה על הכפתור "{{int:optin-submit-out}}" בתחתית הדף.
-
-× ×¨×¦×” לדעת מה ××ª× ×—×•×©×‘×™× ×¢×œ הממשק החדש, לכן × ×¢×¨×™×š ×–×ת ×× ×ª×ž×œ×ו ×ת הסקר ×”××•×¤×¦×™×•× ×œ×™ שלהלן ×œ×¤× ×™ לחיצה על הכפתור "{{int:optin-submit-out}}".',
- 'optin-survey-question-whyoptout' => 'למה ××ª× ×ž×‘×˜×œ×™× ×ת ×”×¨×©×ž×ª×›× ×œ×ž×ž×©×§ ×–×”?',
- 'optin-survey-answer-whyoptout-hard' => 'היה קשה מדי לשימוש.',
+ 'optin-survey-intro' => "תודה ×œ×›× ×¢×œ ×©× ×™×¡×™×ª× ×ת גרסת הבט×.
+×× ×• ×¨×•×¦×™× ×œ×“×¢×ª מה ××ª× ×—×•×©×‘×™× ×¢×œ הממשק החדש ×©×œ× ×•, לכן × ×¢×¨×™×š ×–×ת ×× ×ª×ž×œ×ו ×ת הסקר ×”××•×¤×¦×™×•× ×œ×™ שלהלן ×œ×¤× ×™ שתלחצו על הכפתור \"[[#leave|{{int:optin-submit-out}}]]\".",
+ 'optin-survey-question-likedislike' => 'מה ××”×‘×ª× ×‘×’×¨×¡×ª הבט×? מה ×œ× ××”×‘×ª× ×‘×’×¨×¡×ª הבט×?',
+ 'optin-survey-question-whyoptout' => 'למה ××ª× ×¢×•×–×‘×™× ×ת גרסת הבט×? (×× × ×‘×—×¨×• ×ת כל ×”×פשרויות המת×ימות.)',
+ 'optin-survey-answer-whyoptout-hard' => '×”×•× ×”×™×” קשה מדי לשימוש.',
'optin-survey-answer-whyoptout-didntwork' => '×”×•× ×œ× ×¤×¢×œ כפי שצריך.',
'optin-survey-answer-whyoptout-notpredictable' => '×”×תר פעל ב×ופן בלתי צפוי.',
'optin-survey-answer-whyoptout-didntlike-look' => '×œ× ×הבתי ×ת ×יך ×©×”×•× × ×¨××”.',
'optin-survey-answer-whyoptout-didntlike-layout' => '×œ× ×הבתי ×ת הפריסה ×•×”×œ×©×•× ×™×•×ª החדשי×.',
'optin-survey-answer-whyoptout-didntlike-toolbar' => '×œ× ×הבתי ×ת סרגל ×”×›×œ×™× ×”×—×“×©.',
'optin-survey-answer-whyoptout-other' => 'סיבה ×חרת:',
+ 'optin-survey-question-explain' => '×× × ×”×¡×‘×™×¨×• ×ו פרטו ×ת ×ª×©×•×‘×ª×›× ×œ×¢×™×œ:',
+ 'optin-survey-question-techfail' => '×”×× ×ירעו תקלות ×˜×›× ×™×•×ª כלשהן בעת השימוש בגרסת הבט×?',
'optin-survey-question-techfail-ifyes' => '×× ×›×Ÿ, ×× × ×¤×¨×˜×• ×ו הסבירו:',
'optin-survey-question-usedtoolbar' => '×”×× ×”×©×ª×ž×©×ª× ×‘×¡×¨×’×œ ×”×›×œ×™× ×”×—×“×© המתרחב החדש כדי לערוך דף?',
- 'optin-survey-question-feedback' => '×× × ×”×¢×‘×™×¨×• ×œ× ×• משוב:',
+ 'optin-survey-question-usedtoolbar-ifyes' => '×× ×›×Ÿ, מה ××”×‘×ª× ×œ×’×‘×™×•? מה ×œ× ××”×‘×ª× ×œ×’×‘×™×•?',
+ 'optin-survey-question-usedtoolbar-ifno' => '×× ×œ×, למה ל×? ×”×× ×ª×©×ª×ž×©×• בו בעתיד? ×× × ×”×¡×‘×™×¨×•.',
+ 'optin-survey-question-different' => 'מה ×™×›×•×œ× ×• לעשות ×חרת כדי שתמשיכו להשתמש בגרסת הבט×?',
+ 'optin-survey-question-feedback' => '×× × ×›×ª×‘×• ×œ× ×• ×ת כל ההערות ×”×חרות, התהיות ×ו המחשבות שיש ×œ×›× ×‘×©×‘×™×œ× ×• - כל משוב ×”×•× ×©×™×ž×•×©×™:',
'optin-survey-question-browser' => 'ב××™×–×” דפדפן ××ª× ×ž×©×ª×ž×©×™×?',
'optin-survey-answer-browser-other' => 'דפדפן ×חר:',
'optin-survey-question-os' => 'ב×יזו מערכת הפעלה ××ª× ×ž×©×ª×ž×©×™×?',
'optin-survey-answer-os-other' => 'מערכת הפעלה ×חרת:',
'optin-survey-question-res' => 'מהי רזולוציית המסך שלכ×?',
+ 'optin-survey-question-changes' => '×ילו ×©×™× ×•×™×™× ×ª×¨×¦×• לר×ות בגרסת ×”×‘×˜× ×‘×¢×ª×™×“ (×× × ×‘×—×¨×• ×ת כל ×”×פשרויות המת×ימות)?',
+ 'optin-survey-answer-changes-nav' => 'הפיכת ×”× ×™×•×•×˜ הכולל ב×תר לקל יותר לשימוש.',
+ 'optin-survey-answer-changes-edittools' => 'הרחבת ושיפור כלי העריכה.',
'optin-survey-answer-changes-upload' => 'שיפור התוכן והעל×ות המדיה.',
'optin-survey-answer-changes-richtext' => 'פיתוח כלי עריכה ×”×“×•×ž×™× ×œ×¢×•×¨×›×™ טקסט עשיר.',
'optin-survey-answer-changes-lookfeel' => 'עדכון "המר××” והתחושה" של ×”×תר.',
+ 'optin-survey-answer-changes-predictability' => 'שיפור ×פשרויות החיזוי של הביצועי×.',
+ 'optin-survey-answer-changes-custom' => 'הוספת ×פשרויות רבות יותר להת×מה ×ישית.',
'optin-survey-answer-changes-other' => '×חר:',
+ 'optin-improvements' => "== מה השתפר? ==
+[[File:UsabilityNavigation.png|left|link=]]
+;× ×™×•×•×˜ משופר
+מערכת ×”× ×™×•×•×˜ החדשה מקלה ×¢×œ×™×›× ×œ×¨×ות ×יפה ××ª× ×•×ž×” ××ª× ×¢×•×©×™×, ×•×’× ×œ×ן ××ª× ×™×›×•×œ×™× ×œ×”×’×™×¢ ו×יך לעשות ×–×ת. ×›×שר תיבת החיפוש ממוקמת ×‘×¤×™× ×” השמ×לית ×”×¢×œ×™×•× ×”, קל יותר ×œ×ž×¦×•× ×ת ×פשרות החיפוש והשימוש בה מהיר יותר.
+<div style=\"clear:both;\"></div>
+
+[[File:UsabilityToolbar.png|left|link=]]
+;×©×™×¤×•×¨×™× ×‘×¡×¨×’×œ העריכה
+×¡×ž×œ×™× ×—×“×©×™× ×•×ž×©×•×¤×¨×™× ×ž×‘×”×™×¨×™× ×ת הפעולה שמבצע כל כלי עריכה. ×—×œ×§×™× ×ž×ª×¨×—×‘×™× ×ž×§×˜×™× ×™× ×ת הבלגן ×ך מ××¤×©×¨×™× ×œ×©×ž×•×¨ ×ת ×”×›×œ×™× ×©×ž×©×ª×ž×©×™× ×‘×”× ×¤×—×•×ª במרחק לחיצה ×חת בלבד.
+חלק העזרה מ×פשר גישה מהירה לתיעוד רוב ×”×©×™×ž×•×©×™× ×”× ×¤×•×¦×™× ×©×œ תחביר ויקי.
+<div style=\"clear:both;\"></div>
+== ×יך להצטרף ==
+כדי ללמוד עוד על ×”×ž×™×–× ×ו כדי להצטרף ×ליו, ×× × ×‘×§×¨×• ב[http://usability.wikimedia.org ×תר הוויקי של יוזמת השימושיות]. ×©× ×ª×•×›×œ×• ×œ×ž×¦×•× ×ת כל המידע על ×”×ž×¢× ×§, המחקר, העיצוב והפיתוח, ושחרורי הגרס×ות ×©×œ× ×•. כדי לש×ול ש×לות ×ו להש×יר משוב כללי, ×× × ×”×©×ª×ž×©×• ב[http://usability.wikimedia.org/wiki/Talk:Prototype דף השיחה על ×ב הטיפוס] ×©×œ× ×•. כדי לדון ×‘× ×•×©××™× ×ž×¡×•×™×ž×™×, ×× × ×”×©×ª×ž×©×• בדפי השיחה המת×ימי×. ×× ××ª× ×ž×•×¦××™× ×‘××’×™×, ×× × ×”×©×ירו ×ת ×”×¢×¨×•×ª×™×›× ×‘[http://usability.wikimedia.org/wiki/Talk:Releases/Acai דף השיחה של הגרסה Acai] ×ו ב[https://bugzilla.wikimedia.org ב×גזילה].
+
+תודה, ו×× ×—× ×• ×ž×§×•×•×™× ×œ×©×ž×•×¢ מכ×!",
);
+/** Hindi (हिनà¥à¤¦à¥€)
+ * @author आलोक
+ */
+$messages['hi'] = array(
+ 'optin-accept-short' => 'चलो करते हैं!',
+ 'optin-deny-short' => 'नहीं, शà¥à¤•à¥à¤°à¤¿à¤¯à¤¾',
+ 'optin-survey-yes' => 'हाà¤',
+ 'optin-survey-no' => 'नहीं',
+ 'optin-survey-question-browser' => 'आप कौन से विचरक का इसà¥à¤¤à¥‡à¤®à¤¾à¤² करते हैं?',
+ 'optin-survey-answer-browser-other' => 'अनà¥à¤¯ विचरक।',
+ 'optin-survey-question-os' => 'आपक कौन सी पà¥à¤°à¤šà¤¾à¤²à¤¨ पà¥à¤°à¤£à¤¾à¤²à¥€ का इसà¥à¤¤à¥‡à¤®à¤¾à¤² करते हैं?',
+ 'optin-survey-answer-os-other' => 'अनà¥à¤¯ पà¥à¤°à¤šà¤¾à¤²à¤¨ पà¥à¤°à¤£à¤¾à¤²à¥€:',
+);
+
/** Croatian (Hrvatski)
* @author Suradnik13
*/
@@ -1997,7 +2077,7 @@
'optin-submit-feedback' => 'Visszajelzés küldése',
'optin-survey-yes' => 'Igen',
'optin-survey-no' => 'Nem',
- 'optin-survey-answer-whyoptout-didntlike-look' => 'Nem tetszik ahogy kinéz.',
+ 'optin-survey-answer-whyoptout-didntlike-look' => 'Nem tetszik, ahogy kinéz.',
'optin-survey-answer-whyoptout-didntlike-layout' => 'Nem tetszenek az új fülek és az elrendezés.',
'optin-survey-answer-whyoptout-didntlike-toolbar' => 'Nem tetszik az új szerkesztő-eszköztár.',
'optin-survey-answer-whyoptout-other' => 'Más indok:',
@@ -2007,7 +2087,7 @@
'optin-improvements' => '== Mit fejlesztettünk? ==
[[File:UsabilityNavigation.png|left|link=]]
;Fejlettebb navigáció
-Az új navigációs rendszer könnyebbé teszi, hogy lásd, hol vagy és mit csinálsz éppen, továbbá azt is, hogy hová mehetsz továb, és hogy hogyan juthatsz el oda. A keresőmező jobb felső sarokba való áthelyezésével könnyebbé válik a keresés.
+Az új navigációs rendszer könnyebbé teszi, hogy lásd, hol vagy és mit csinálsz éppen, továbbá azt is, hogy hová mehetsz tovább, és hogy hogyan juthatsz el oda. A keresőmező jobb felső sarokba való áthelyezésével könnyebbé válik a keresés.
<div style="clear:both;"></div>
[[File:UsabilityToolbar.png|left|link=]]
@@ -2081,7 +2161,7 @@
'optin-survey-answer-changes-nav' => 'Rende le navigation general del sito plus facile a usar.',
'optin-survey-answer-changes-edittools' => 'Augmenta e meliora le instrumentos de modification.',
'optin-survey-answer-changes-upload' => 'Meliora le cargamento de contento e multimedia.',
- 'optin-survey-answer-changes-richtext' => 'Disveloppa instrumentos de modification similar al editores de texto inricchite.',
+ 'optin-survey-answer-changes-richtext' => 'Disveloppar instrumentos de modification similar al editores de texto inricchite.',
'optin-survey-answer-changes-lookfeel' => 'Renova le apparentia general del sito.',
'optin-survey-answer-changes-predictability' => 'Meliorar le previsibilitate del prestationes.',
'optin-survey-answer-changes-custom' => 'Permitter un personalisation plus ample al usator.',
@@ -2119,7 +2199,7 @@
'optin-needlogin' => 'Anda harus [$1 masuk log] untuk mencoba Beta.',
'optin-intro' => 'Proyek Inisiatif Kebergunaan Wikipedia berusaha untuk mengembangkan kegunaan dari Wikipedia. Apakah Anda ingin mencoba Beta?',
'optin-feedback-intro' => 'Terima kasih telah mencoba Beta.
-Kami ingin tahu apa pendapat Anda tentang antarmuka baru kami, sehingga kami sangat menghargai jika Anda mengisi survei opsional di bawah ini .',
+Kami ingin tahu apa pendapat Anda tentang antarmuka baru kami, sehingga kami sangat menghargai jika Anda mengisi jajak pendapat manasuka di bawah ini .',
'optin-feedback-back' => 'Jika Anda tidak ingin mengisi survei, Anda dapat kembali ke $1.',
'optin-success-in' => 'Anda saat ini sedang mencoba Beta.
Anda dapat keluar kapan saja dengan menekan pranala "{{int:optin-submit-out}}" di bagian atas halaman.',
@@ -2202,8 +2282,8 @@
* @author Stefano-c
*/
$messages['it'] = array(
- 'optin' => 'Adesione al Progetto usabilità ',
- 'optin-desc' => 'Consente agli utenti di provare Beta, gli ultimi miglioramenti del Progetto usabilità .',
+ 'optin' => 'Adesione al progetto usabilità ',
+ 'optin-desc' => 'Consente agli utenti di provare la beta, gli ultimi miglioramenti del progetto usabilità .',
'optin-title-optedout' => 'Prova la Beta',
'optin-title-optedin' => 'Lascia Beta',
'optin-title-justoptedin' => 'Benvenuto in Beta',
@@ -2211,7 +2291,7 @@
'optin-title-feedback' => 'Feedback della Beta',
'optin-needlogin' => "È necessario [$1 effettuare l'accesso] per provare Beta",
'optin-intro' => "Il progetto usabilità di Wikipedia sta lavorando intensamente per migliorare l'usabilità di Wikipedia.
-Si desidera provare Beta?",
+Vuoi provare la nostra beta?",
'optin-feedback-intro' => 'Ti ringraziamo per aver provato la Beta.
Vorremmo sapere cosa ne pensi della nostra nuova interfaccia, quindi apprezzeremmo se compilassi il sondaggio facoltativo qui sotto.',
'optin-feedback-back' => 'Se non si desidera compilare il sondaggio, si può tornare a $1.',
@@ -2274,7 +2354,7 @@
Le icone nuove e migliorate rendono più chiare le azioni che ciascuno strumento esegue. Le sezioni espandibili riducono l\'ingombro mantenendo gli strumenti usati di rado a un clic di distanza. La sezione di aiuto fornisce un rapido accesso a un riferimento per gli usi comuni della sintassi wiki.
<div style="clear:both;"></div>
== Come aiutare ==
-Per saperne di più sul progetto o aiutare, visita il [http://usability.wikimedia.org sito del Progetto usabilità ]. Lì potrai trovare informazioni sulla nostra sovvenzione, ricerca, progettazione e sviluppo e nuove versioni. Per porre domande o lasciare un commento generale, usa la nostra [http://usability.wikimedia.org/wiki/Talk:Prototype pagina di discussione sui prototipi]. Per discutere di specifici argomenti, usa le pagine di discussione relative. Se trovi degli errori, lascia un commento nella [http://usability.wikimedia.org/wiki/Talk:Releases/Acai pagina di discussione delle versioni di Acai] o usa [https://bugzilla.wikimedia.org Bugzilla].
+Per saperne di più sul progetto o aiutare, visita il [http://usability.wikimedia.org sito del progetto usabilità ]. Lì potrai trovare informazioni sulla nostra sovvenzione, ricerca, progettazione e sviluppo e nuove versioni. Per porre domande o lasciare un commento generale, usa la nostra [http://usability.wikimedia.org/wiki/Talk:Prototype pagina di discussione sui prototipi]. Per discutere di specifici argomenti, usa le pagine di discussione relative. Se trovi degli errori, lascia un commento nella [http://usability.wikimedia.org/wiki/Talk:Releases/Acai pagina di discussione delle versioni di Acai] o usa [https://bugzilla.wikimedia.org Bugzilla].
Grazie; non vediamo l\'ora di sentirti.',
);
@@ -2712,6 +2792,13 @@
Mer freue uns, vun Üsch ze hüüre!',
);
+/** Cornish (Kernowek)
+ * @author Kw-Moon
+ */
+$messages['kw'] = array(
+ 'optin-title-optedout' => 'Previ Beta',
+);
+
/** Latin (Latina)
* @author Omnipaedista
*/
@@ -2737,7 +2824,7 @@
'optin-intro' => "D'Benotzerfrëndlechkeets-Initiative vu Wikipedia huet vill geschafft fir d'Benotzerfrëndlechkeet vu Wikipedia ze verbesseren.
Wëllt Dir Beta ausprobéieren?",
'optin-feedback-intro' => 'Merci datt Dir Beta ausprobéiert hutt.
-Mir wëlle wëssen wat Dir vun dem neien Interface halt, dofir wiere mir frou wann Dir bei der fräiwëlleger Ëmfro hei ënnedrënner matmaache géift.',
+Mir wëlle wësse wat Dir vun dem neien Interface halt, dofir wiere mir frou wann Dir bei der fräiwëlleger Ëmfro hei ënnedrënner matmaache géift.',
'optin-feedback-back' => "Wann Dir d'Ëmfro net ausfëlle wëllt, da kënnt dir op $1 zréckgoen.",
'optin-success-in' => 'Dir probéiert elo Beta aus.
Dir kënnt dës zu jidder Zäit nees ausschalten andeem datt Dir op de Link "{{int:optin-leave}}" uewen um Ecran klickt.',
@@ -2757,7 +2844,7 @@
'optin-survey-intro' => 'Merci datt Dir Beta ausprobéiert.
Mir wiere frou fir ze wëssen wat Dir vun deem neien Interface denkt, dofir wiere mir frou wann Dir déi fräiwëlleg Ëmfro hei ënnendrënner géift ausfëllen ier Dir op "[[#leave|{{int:optin-submit-out}}]]" klickt.',
'optin-survey-question-likedislike' => 'Wat hutt dir bäi Beta gutt finnt? Wat huet Iech u Beta net gefall?',
- 'optin-survey-question-whyoptout' => 'Firwat Verloost Dir dës Beta? (wielt w.e.g. alles aus wat zoutrëfft)',
+ 'optin-survey-question-whyoptout' => 'Firwat verloost Dir dës Beta? (wielt w.e.g. alles aus wat zoutrëfft)',
'optin-survey-answer-whyoptout-hard' => 'Et war ze komplizéiert fir ze benotzen.',
'optin-survey-answer-whyoptout-didntwork' => 'Et huet net richteg fonctionnéiert.',
'optin-survey-answer-whyoptout-notpredictable' => 'Et huet net esou fonctionnéiert wéi virgesinn.',
@@ -2951,18 +3038,59 @@
/** Malayalam (മലയാളം)
* @author Junaidpv
+ * @author Praveenp
* @author Sadik Khalid
*/
$messages['ml'] = array(
+ 'optin-title-optedout' => 'ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•àµ‚',
+ 'optin-title-optedin' => 'ബീറàµà´± ഉപേകàµà´·à´¿à´•àµà´•àµ‚',
+ 'optin-title-justoptedin' => 'ബീറàµà´±à´¯à´¿à´²àµ‡à´¯àµà´•àµà´•àµ à´¸àµà´µà´¾à´—തം',
+ 'optin-title-justoptedout' => 'ബീറàµà´± പരീകàµà´·à´¿à´šàµà´šàµ നോകàµà´•àµà´¨àµà´¨à´¤à´¿à´¨àµ നനàµà´¦à´¿',
+ 'optin-title-feedback' => 'ബീറàµà´±à´¯àµ† à´•àµà´±à´¿à´šàµà´šàµà´³àµà´³ à´…à´à´¿à´ªàµà´°à´¾à´¯à´‚',
+ 'optin-needlogin' => 'ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•à´¾àµ» താങàµà´•àµ¾ [$1 ലോഗിൻ] ചെയàµà´¯àµ‡à´£àµà´Ÿà´¤à´¾à´£àµ.',
+ 'optin-feedback-intro' => 'ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•àµà´¨àµà´¨à´¤à´¿à´¨àµ നനàµà´¦à´¿.
+à´ªàµà´¤à´¿à´¯ ദൃശàµà´¯à´°àµ‚പതàµà´¤àµ†à´•àµà´•àµà´±à´¿à´šàµà´šàµ താങàµà´•à´³àµ†à´¨àµà´¤à´¾à´£àµ à´•à´°àµà´¤àµà´¨àµà´¨à´¤àµ†à´¨àµà´¨à´±à´¿à´¯à´¾àµ» à´žà´™àµà´™à´³à´¾à´—àµà´°à´¹à´¿à´•àµà´•àµà´¨àµà´¨àµ, à´…à´¤àµà´•àµŠà´£àµà´Ÿàµ ദയവായി താഴെ കൊടàµà´¤àµà´¤à´¿à´°à´¿à´•àµà´•àµà´¨àµà´¨ സർവേയിൽ പങàµà´•àµ†à´Ÿàµà´•àµà´•à´¾àµ» താതàµà´ªà´°àµà´¯à´ªàµà´ªàµ†à´Ÿàµà´¨àµà´¨àµ.',
+ 'optin-feedback-back' => 'താങàµà´•àµ¾à´•àµà´•àµ സർവേയിൽ പങàµà´•àµ†à´Ÿàµà´•àµà´•àµ‡à´£àµà´Ÿà´¯àµ†à´™àµà´•à´¿àµ½, $1-ലേയàµà´•àµà´•àµ തിരിചàµà´šàµ പോകാവàµà´¨àµà´¨à´¤à´¾à´£àµ.',
+ 'optin-success-in' => 'താങàµà´•àµ¾ ഇപàµà´ªàµ‹àµ¾ ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•àµà´¨àµà´¨àµ.
+താളിനàµà´±àµ† à´®àµà´•à´³à´¿à´²à´¾à´¯à´¿ കാണàµà´¨àµà´¨ "{{int:optin-leave}}" à´Žà´¨àµà´¨ à´•à´£àµà´£à´¿ ഞെകàµà´•à´¿ താങàµà´•àµ¾à´•àµà´•àµ à´à´¤àµŠà´°àµ സമയതàµà´¤àµà´‚ ഇതൊഴിവാകàµà´•à´¾à´µàµà´¨àµà´¨à´¤à´¾à´£àµ.',
+ 'optin-leave-cancel' => 'താങàµà´•àµ¾ ബീറàµà´± à´¤àµà´Ÿàµ¼à´¨àµà´¨àµà´‚ ഉപയോഗികàµà´•à´¾àµ» ആഗàµà´°à´¹à´¿à´•àµà´•àµà´¨àµà´¨àµà´µàµ†à´™àµà´•à´¿àµ½, $1-ലേയàµà´•àµà´•àµ തിരിചàµà´šàµ പോകാവàµà´¨àµà´¨à´¤à´¾à´£àµ.',
+ 'optin-success-out' => 'താങàµà´•àµ¾ വിജയകരമായി ബീറàµà´±à´¯à´¿àµ½ നിനàµà´¨àµ à´ªàµà´±à´¤àµà´¤àµà´•à´Ÿà´¨àµà´¨à´¿à´°à´¿à´•àµà´•àµà´¨àµà´¨àµ.
+താളിനàµà´±àµ† à´®àµà´•à´³à´¿à´²à´¾à´¯à´¿ കൊടàµà´¤àµà´¤à´¿à´°à´¿à´•àµà´•àµà´¨àµà´¨ "{{int:optin-try}}" à´Žà´¨àµà´¨ à´•à´£àµà´£à´¿ ഞെകàµà´•à´¿ താങàµà´•àµ¾à´•àµà´•àµ à´à´¤àµŠà´°àµ സമയതàµà´¤àµà´‚ ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•à´¾à´µàµà´¨àµà´¨à´¤à´¾à´£àµ.',
+ 'optin-success-feedback' => 'താങàµà´•à´³àµà´Ÿàµ† à´…à´à´¿à´ªàµà´°à´¾à´¯à´‚ അറിയിചàµà´šà´¤à´¿à´¨àµ നനàµà´¦à´¿!',
+ 'optin-accept-short' => 'à´…à´™àµà´™à´¿à´¨àµ†à´¯à´¾à´Ÿàµà´Ÿàµ†!!',
+ 'optin-accept-long' => 'ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•àµà´•',
+ 'optin-accept-long-anon' => 'ലോഗിൻ ചെയàµà´¤à´¶àµ‡à´·à´‚ ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•àµà´•',
'optin-deny-short' => 'വേണàµà´Ÿ, നനàµà´¦à´¿',
+ 'optin-deny-long' => 'പഴയ താളിലേയàµà´•àµà´•àµ തിരിചàµà´šàµ പോവàµà´•',
+ 'optin-submit-out' => 'ബീറàµà´± ഉപേകàµà´·à´¿à´•àµà´•àµà´•',
+ 'optin-submit-feedback' => 'à´…à´à´¿à´ªàµà´°à´¾à´¯à´‚ അറിയികàµà´•àµà´•',
'optin-survey-yes' => 'ഉണàµà´Ÿàµ',
'optin-survey-no' => 'ഇലàµà´²',
+ 'optin-survey-intro' => 'ബീറàµà´± പരീകàµà´·à´¿à´•àµà´•àµà´¨àµà´¨à´¤à´¿à´¨àµ നനàµà´¦à´¿.
+à´ªàµà´¤à´¿à´¯ ദൃശàµà´¯à´°àµ‚പതàµà´¤àµ† à´•àµà´±à´¿à´šàµà´šàµ താങàµà´•àµ¾ à´Žà´¨àµà´¤à´¾à´£àµ വിചാരികàµà´•àµà´¨àµà´¨à´¤àµ†à´¨àµà´¨à´±à´¿à´¯à´¾àµ» à´žà´™àµà´™àµ¾à´•àµà´•à´¾à´—àµà´°à´¹à´®àµà´£àµà´Ÿàµ, "[[#leave|{{int:optin-submit-out}}]]" à´Žà´¨àµà´¨à´¤àµ ഞെകàµà´•àµà´¨àµà´¨à´¤à´¿à´¨àµ à´®àµà´®àµà´ªàµ താങàµà´•àµ¾ താഴെ കൊടàµà´¤àµà´¤à´¿à´°à´¿à´•àµà´•àµà´¨àµà´¨ സർവേയിൽ പങàµà´•àµ†à´Ÿàµà´•àµà´•à´¾àµ» താതàµà´ªà´°àµà´¯à´ªàµà´ªàµ†à´Ÿàµà´¨àµà´¨àµ.',
+ 'optin-survey-question-likedislike' => 'ബീറàµà´±à´¯à´¿àµ½ താങàµà´•àµ¾à´•àµà´•àµ à´Žà´¨àµà´¤àµŠà´•àµà´•àµ† ഇഷàµà´Ÿà´ªàµà´ªàµ†à´Ÿàµà´Ÿàµ? à´Žà´¨àµà´¤àµŠà´•àµà´•àµ† ഇഷàµà´Ÿà´ªàµà´ªàµ†à´Ÿàµà´Ÿà´¿à´²àµà´²?',
+ 'optin-survey-question-whyoptout' => 'താങàµà´•àµ¾ à´Žà´¨àµà´¤àµà´•àµŠà´£àµà´Ÿàµ ബീറàµà´± ഉപേകàµà´·à´¿à´•àµà´•àµà´¨àµà´¨àµ? (കാരണമാകàµà´¨àµà´¨ à´Žà´²àµà´²à´¾à´‚ ദയവായി തിരഞàµà´žàµ†à´Ÿàµà´•àµà´•àµà´•.)',
+ 'optin-survey-answer-whyoptout-hard' => 'ഉപയോഗികàµà´•à´¾àµ» à´à´±àµ† à´¬àµà´¦àµà´§à´¿à´®àµà´Ÿàµà´Ÿàµà´³àµà´³ à´’à´¨àµà´¨à´¾à´£à´¿à´¤àµ.',
+ 'optin-survey-answer-whyoptout-didntwork' => 'ഇതൠശരിയായി à´ªàµà´°à´µàµ¼à´¤àµà´¤à´¿à´•àµà´•àµà´¨àµà´¨à´¿à´²àµà´².',
+ 'optin-survey-answer-whyoptout-notpredictable' => 'ഇതെങàµà´™à´¿à´¨àµ† à´ªàµà´°à´µàµ¼à´¤àµà´¤à´¿à´•àµà´•àµà´®àµ†à´¨àµà´¨àµ പറയാൻ പറàµà´±àµà´¨àµà´¨à´¿à´²àµà´².',
+ 'optin-survey-answer-whyoptout-didntlike-look' => 'ഇതൠകാണപàµà´ªàµ†à´Ÿàµà´¨àµà´¨ രൂപം എനികàµà´•à´¿à´·àµà´Ÿà´ªàµà´ªàµ†à´Ÿàµà´¨àµà´¨à´¿à´²àµà´².',
+ 'optin-survey-answer-whyoptout-didntlike-layout' => 'à´ªàµà´¤à´¿à´¯ à´±àµà´±à´¾à´¬àµà´•à´³àµà´‚ ദൃശàµà´¯à´µà´¿à´¨àµà´¯à´¾à´¸à´µàµà´‚ എനികàµà´•à´¿à´·àµà´Ÿà´ªàµà´ªàµ†à´Ÿàµà´Ÿà´¿à´²àµà´².',
+ 'optin-survey-answer-whyoptout-didntlike-toolbar' => 'à´ªàµà´¤à´¿à´¯ à´±àµà´±àµ‚ൾബാർ എനികàµà´•à´¿à´·àµà´Ÿà´ªàµà´ªàµ†à´Ÿàµà´Ÿà´¿à´²àµà´².',
'optin-survey-answer-whyoptout-other' => 'മറàµà´±àµ കാരണം:',
+ 'optin-survey-question-explain' => 'താങàµà´•àµ¾ à´®àµà´•à´³à´¿àµ½ നൽകിയ ഉതàµà´¤à´°à´‚ ദയവായി വിശദീകരികàµà´•àµà´•à´¯àµ‹ വികസിപàµà´ªà´¿à´•àµà´•àµà´•à´¯àµ‹ ചെയàµà´¯àµà´•:',
'optin-survey-question-techfail' => 'ബീറàµà´± ഉപയോഗികàµà´•àµà´®àµà´ªàµ‹à´³àµâ€ à´à´¨àµà´¤àµ†à´™àµà´•à´¿à´²àµà´‚ സാങàµà´•àµ‡à´¤à´¿à´• തകരാറàµà´•à´³àµâ€ താങàµà´•à´³àµâ€à´•àµà´•àµ à´…à´¨àµà´à´µà´ªàµà´ªàµ†à´Ÿàµà´Ÿà´¿à´Ÿàµà´Ÿàµà´£àµà´Ÿàµ‹?',
+ 'optin-survey-question-techfail-ifyes' => 'അതെ à´Žà´™àµà´•à´¿àµ½, ദയവായി വികസിപàµà´ªà´¿à´•àµà´•àµà´• à´…à´²àµà´²à´™àµà´•à´¿àµ½ വിശദീകരികàµà´•àµà´•:',
'optin-survey-question-usedtoolbar' => 'ഒരൠതാളàµâ€ തിരàµà´¤àµà´¤àµà´µà´¾à´¨àµâ€ വേണàµà´Ÿà´¿ വിപàµà´²àµ€à´•à´°à´¿à´•àµà´•à´¾à´µàµà´¨àµà´¨ ടൂളàµâ€à´¬à´¾à´°àµâ€ താങàµà´•à´³àµâ€ ഉപയോഗിചàµà´šà´¿à´Ÿàµà´Ÿàµà´£àµà´Ÿàµ‹?',
+ 'optin-survey-question-usedtoolbar-ifyes' => 'അതെ à´Žà´™àµà´•à´¿àµ½, താങàµà´•àµ¾à´•àµà´•àµ ഇതിൽ à´Žà´¨àµà´¤à´¾à´£àµ ഇഷàµà´Ÿà´ªàµà´ªàµ†à´Ÿàµà´Ÿà´¤àµ? ഇതിൽ à´Žà´¨àµà´¤à´¾à´£àµ ഇഷàµà´Ÿà´ªàµà´ªàµ†à´Ÿà´¾à´¤àµ† പോയതàµ?',
+ 'optin-survey-question-usedtoolbar-ifno' => 'ഇലàµà´² à´Žà´™àµà´•à´¿àµ½, à´Žà´¨àµà´¤àµà´•àµŠà´£àµà´Ÿàµ ഇലàµà´²? à´à´¾à´µà´¿à´¯à´¿à´²àµ‹? ദയവായി വിശദീകരികàµà´•àµà´•.',
+ 'optin-survey-question-different' => 'താങàµà´•à´³àµ† ബീറàµà´±à´¯à´¿àµ½ തനàµà´¨àµ† പിടിചàµà´šàµ നിർതàµà´¤à´¾àµ» à´Žà´¨àµà´¤àµ†à´¨àµà´¤àµ മാറàµà´±à´™àµà´™à´³à´¾à´¯à´¿à´°àµà´¨àµà´¨àµ à´žà´™àµà´™àµ¾ വരàµà´¤àµà´¤àµ‡à´£àµà´Ÿà´¿à´¯à´¿à´°àµà´¨àµà´¨à´¤àµ?',
+ 'optin-survey-question-feedback' => 'ദയവായി താങàµà´•à´³àµà´Ÿàµ† à´•àµà´±à´¿à´ªàµà´ªàµà´•à´³àµà´‚, ഉതàµà´•à´£àµà´ à´•à´³àµà´‚, à´šà´¿à´¨àµà´¤à´•à´³àµà´‚ à´žà´™àµà´™à´³àµ† അറിയികàµà´•àµà´• - à´Žà´²àµà´²à´¾ à´…à´à´¿à´ªàµà´°à´¾à´¯à´™àµà´™à´³àµà´‚ ഉപകാരപàµà´°à´¦à´™àµà´™à´³à´¾à´£àµ:',
'optin-survey-question-browser' => 'à´à´¤àµ à´¬àµà´°àµŒà´¸à´±à´¾à´£àµ താങàµà´•à´³àµâ€ ഉപയോഗികàµà´•àµà´¨àµà´¨à´¤àµ?',
+ 'optin-survey-answer-browser-other' => 'മറàµà´±àµ à´¬àµà´°àµ—സർ:',
'optin-survey-question-os' => 'à´à´¤àµ ഓപറേറàµà´±à´¿à´™àµà´™àµ സിസàµà´±àµà´±à´®à´¾à´£àµ താങàµà´•à´³àµâ€ ഉപയോഗികàµà´•àµà´¨àµà´¨à´¤àµ?',
+ 'optin-survey-answer-os-other' => 'മറàµà´±àµ ഓപറേറàµà´±à´¿à´™àµ സിസàµà´±àµà´±à´‚:',
'optin-survey-question-res' => 'താങàµà´•à´³àµà´Ÿàµ† à´¸àµà´•àµà´°àµ€à´¨àµâ€ റെസ‌ലàµà´¯àµ‚à´·à´¨àµâ€ à´Žà´¨àµà´¤à´¾à´£àµ?',
+ 'optin-survey-question-changes' => 'à´à´¾à´µà´¿à´¯à´¿àµ½ ബീറàµà´±à´¯à´¿àµ½ à´Žà´¨àµà´¤àµ മാറàµà´±à´™àµà´™àµ¾ ഉണàµà´Ÿà´¾à´¯à´¿à´°à´¿à´•àµà´•à´¾àµ» താങàµà´•àµ¾ ആഗàµà´°à´¹à´¿à´•àµà´•àµà´¨àµà´¨àµ (ബാധകമാകàµà´¨àµà´¨ à´Žà´²àµà´²à´¾à´‚ തിരഞàµà´žàµ†à´Ÿàµà´•àµà´•àµà´•)?',
);
/** Mongolian (Монгол)
@@ -3339,17 +3467,31 @@
'optin-title-justoptedout' => 'Takk for at du prøver betautgåva',
'optin-title-feedback' => 'Tilbakemelding om betautgåva',
'optin-needlogin' => 'Du må [$1 logga inn] for å prøve betautgåva.',
+ 'optin-success-feedback' => 'Takk for di tilbakemelding!',
+ 'optin-accept-short' => 'Lat oss gjera det!',
+ 'optin-accept-long-anon' => 'Logg inn og prøv Beta',
+ 'optin-deny-short' => 'Nei takk',
+ 'optin-deny-long' => 'Gå attende til førre sida',
+ 'optin-submit-out' => 'GÃ¥ ut av Beta',
+ 'optin-submit-feedback' => 'Gje tilbakemelding',
+ 'optin-survey-yes' => 'Ja',
'optin-survey-no' => 'Nei',
'optin-survey-question-whyoptout' => 'Kvifor går du ut av Beta! (Ver venleg å vél alle aktuelle grunnar.)',
'optin-survey-answer-whyoptout-hard' => 'Det var for vanskeleg å bruka.',
'optin-survey-answer-whyoptout-didntwork' => 'Det fungerte ikkje på rett vis.',
+ 'optin-survey-answer-whyoptout-didntlike-look' => 'Eg likte ikkje utsjånaden.',
'optin-survey-answer-whyoptout-other' => 'Anna årsak:',
+ 'optin-survey-question-different' => "Kva kunne me ha gjort annleis for at du skulle ha halda fram med å bruka denne betaversjonen ''(tilbakemelding på engelsk)''?",
'optin-survey-question-feedback' => 'Ver venleg og send ei tilbakemelding:',
'optin-survey-question-browser' => 'Kva for ein nettlesar nyttar du?',
'optin-survey-answer-browser-other' => 'Annan nettlesar:',
'optin-survey-question-os' => 'Kva for operativsystem nyttar du?',
'optin-survey-answer-os-other' => 'Anna operativsystem:',
'optin-survey-question-res' => 'Kva er oppløysinga på skjermen din?',
+ 'optin-survey-answer-changes-nav' => 'Gjera det lettare å navigera på denne nettsida.',
+ 'optin-survey-answer-changes-upload' => 'Forbetra systemet for opplasting av innhald og media.',
+ 'optin-survey-answer-changes-lookfeel' => 'Oppdatera utsjånad og presentasjon av nettsidene.',
+ 'optin-survey-answer-changes-other' => 'Andre:',
);
/** Norwegian (bokmål)‬ (‪Norsk (bokmål)‬)
@@ -3646,6 +3788,11 @@
* @author Ahmed-Najib-Biabani-Ibrahimkhel
*/
$messages['ps'] = array(
+ 'optin-title-optedout' => 'آزمÛښتي بڼه کارول',
+ 'optin-accept-short' => 'راÚÙ‡ Ú†Û ÙˆÛ Ø¢Ø²Ù…ÙˆÙŠÙˆ!',
+ 'optin-deny-short' => 'نه مننه',
+ 'optin-survey-yes' => 'هو',
+ 'optin-survey-no' => 'نه',
'optin-survey-answer-whyoptout-other' => 'بل سبب:',
'optin-survey-question-browser' => 'ØªØ§Ø³Û Ú©ÙˆÙ… کتنمل کاروÛØŸ',
'optin-survey-answer-browser-other' => 'بل کتنمل:',
@@ -3994,12 +4141,16 @@
* @author HalanTul
*/
$messages['sah'] = array(
+ 'optin' => 'Ð¢Ð°Ð±Ñ‹Ð³Ð°Ñ Ð¡Ð¸Ñ‚Ð¸Ò»Ð¸Ð¸Ñ‚Ð¸Ð³ÑÑ€ кыттыы',
+ 'optin-desc' => 'Бета-барылы туһанары хааччыйар, «Beta» — Табыгаһы Ситиһии иһинÑн оҥоһуллубут бүтÑһик тупÑарыы.',
'optin-title-optedout' => 'Beta-ны тургутуу',
'optin-title-optedin' => 'Beta-ттан тахÑÑ‹Ñ‹',
'optin-title-justoptedin' => 'Beta-ҕа нөрүөн нөргүй!',
'optin-title-justoptedout' => 'Beta-ны тургутан көрбүккÑÑ€ махтал',
'optin-title-feedback' => 'Сыанабылы ыытарга',
'optin-needlogin' => 'Beta тургутарга [$1 ааккын билиһиннÑриÑххин] наада.',
+ 'optin-intro' => 'Табыгаһы Ситиһии иһинÑн оҥоһуллубут Ò¯Ð»Ñ Ð‘Ð¸ÐºÐ¸Ð¿Ð¸ÑдьийÑни туһаныы чÑпчÑки уонна табыгаÑтаах буоларыгар туһаайыллыбыта.
+Beta-ны боруобалаары гынаҕын дуо?',
'optin-feedback-intro' => 'Beta-ны туттубуккар махтанабыт.
Саҥа Ð¸Ð½Ñ‚ÐµÑ€Ñ„ÐµÐ¹Ñ Ñ‚ÑƒÒ»ÑƒÐ½Ð°Ð½ туох Ñанаалааххын билиÑхпитин баҕарабыт, онон аллара баар ыйытыыларга хоруйдууруҥ буоллар наһаа Ò¯Ó©Ñ€Ò¯Ó© Ñтибит.',
'optin-feedback-back' => 'Ыйытыкка кыттыаххын баҕарбат буоллаххына, төннүөххүн Ñөп $1.',
@@ -4728,6 +4879,21 @@
Grassie e sperémo che ne riva presto qualche to messagio!',
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'optin-title-optedout' => 'Kodvi Betad',
+ 'optin-title-optedin' => 'Lähtta Betaspäi',
+ 'optin-title-justoptedin' => 'Tulgat tervhin Betaha!',
+ 'optin-accept-short' => 'Tehkam se!',
+ 'optin-survey-yes' => 'Ka',
+ 'optin-survey-no' => 'Ei',
+ 'optin-survey-answer-whyoptout-other' => 'Toine sü:',
+ 'optin-survey-answer-browser-other' => 'Toine kaclim:',
+ 'optin-survey-answer-changes-other' => 'Toine:',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Minh Nguyen
* @author Vinhtantran
Index: NavigableTOC/NavigableTOC.i18n.php
===================================================================
--- NavigableTOC/NavigableTOC.i18n.php (revision 56989)
+++ NavigableTOC/NavigableTOC.i18n.php (working copy)
@@ -17,6 +17,13 @@
'navigabletoc-preference' => 'Enable navigable table of contents',
);
+/** Message documentation (Message documentation)
+ * @author Umherirrender
+ */
+$messages['qqq'] = array(
+ 'navigabletoc-desc' => '{{desc}}',
+);
+
/** Afrikaans (Afrikaans)
* @author Naudefj
*/
@@ -38,6 +45,7 @@
$messages['be-tarask'] = array(
'navigabletoc' => 'Табліца зьмеÑту з навігацыÑй',
'navigabletoc-desc' => 'Дадае табліцу зьмеÑту Ð´Ð»Ñ Ñ€ÑÐ´Ð°Ð³Ð°Ð²Ð°Ð½ÑŒÐ½Ñ Ñ„Ð¾Ñ€Ð¼Ñ‹ ÑÐºÐ°Ñ Ð¿Ñ€Ð°ÐºÑ€ÑƒÑ‡Ð²Ð°Ðµ Ñ‚ÑкÑтавае поле пад Ñ‡Ð°Ñ Ð²Ñ‹Ð±Ð°Ñ€Ñƒ ÑÑкцыі',
+ 'navigabletoc-preference' => 'Дазволіць Ð½Ð°Ð²Ñ–Ð³Ð°Ñ†Ñ‹Ð¹Ð½Ñ‹Ñ Ñ‚Ð°Ð±Ð»Ñ–Ñ†Ñ‹ зьмеÑту',
);
/** Breton (Brezhoneg)
@@ -46,6 +54,7 @@
$messages['br'] = array(
'navigabletoc' => 'Taolenn verdeeus',
'navigabletoc-desc' => "Ouzhpennañ a ra taolenn an titloù d'ar furmskrid kemmañ a zibun an destenn pa vez kliket war ur rann.",
+ 'navigabletoc-preference' => 'Gweredekaat an daolenn verdeus an danvezioù',
);
/** Bosnian (Bosanski)
@@ -54,6 +63,7 @@
$messages['bs'] = array(
'navigabletoc' => 'Sadržaj sa navigacijom',
'navigabletoc-desc' => 'Dodaje sadržaj u obrazac za uređivanje koji pomjera kutiju tekst kada se klikne na sekciju',
+ 'navigabletoc-preference' => 'Omogući navigacijski sadržaj',
);
/** Czech (ÄŒesky)
@@ -65,6 +75,14 @@
'navigabletoc-desc' => 'PÅ™idává na editaÄnà stránku obsah, pomocà kterého se lze pohybovat v editovaném textu',
);
+/** Welsh (Cymraeg)
+ * @author Lloffiwr
+ */
+$messages['cy'] = array(
+ 'navigabletoc' => 'Taflen gynnwys mordwyol',
+ 'navigabletoc-desc' => "Yn ychwanegu taflen gynnwys wrth olygu, sy'n rholio'r blwch golygu wrth glicio ar bennawd yn y daflen",
+);
+
/** Danish (Dansk)
* @author Byrial
*/
@@ -87,13 +105,16 @@
$messages['dsb'] = array(
'navigabletoc' => 'Nawigěrujobny zapis wopśimjeśa',
'navigabletoc-desc' => 'Pśidawa zapis wopśimjeśa wobźěłowańskemu formularoju, kótaryž kula tekstowe pólo, gaž se na wótrězk kliknjo',
+ 'navigabletoc-preference' => 'Nawigěrujobny zapis wopśimjeśa zmóžniś',
);
/** Greek (Ελληνικά)
+ * @author Omnipaedista
* @author ZaDiak
*/
$messages['el'] = array(
'navigabletoc' => 'ΠεÏιηγήσιμος πίνακας πεÏιεχομÎνων',
+ 'navigabletoc-desc' => 'Î ÏοσθÎτει Îναν πίνακα πεÏιεχομÎνων στη φόÏμα επεξεÏγασίας η οποία ξετυλίγει το κουτί κειμÎνου όταν γίνεται κλικ πάνω στο τμήμα',
);
/** Esperanto (Esperanto)
@@ -130,10 +151,12 @@
/** French (Français)
* @author IAlex
+ * @author PieRRoMaN
*/
$messages['fr'] = array(
'navigabletoc' => 'Sommaire navigable',
'navigabletoc-desc' => 'Ajoute le sommaire au formulaire de modification qui défile le texte quand une section est cliquée',
+ 'navigabletoc-preference' => 'Activer la table des matières navigable',
);
/** Galician (Galego)
@@ -142,6 +165,7 @@
$messages['gl'] = array(
'navigabletoc' => 'Táboa de contidos navegable',
'navigabletoc-desc' => 'Engade unha táboa de contidos para editar o formulario que contrae o cadro de texto cando se preme nunha sección',
+ 'navigabletoc-preference' => 'Activar a táboa de contidos navegable',
);
/** Swiss German (Alemannisch)
@@ -150,14 +174,16 @@
$messages['gsw'] = array(
'navigabletoc' => 'Navigierbari Tabälle vum Inhalt',
'navigabletoc-desc' => 'Fiegt e Inhalts-Tabälle zue in s Bearbeitigsformat, wu ne Tekschtchaschte gscrollt wird, wänn e abschitt aaklickt wird.',
+ 'navigabletoc-preference' => 'Navigierbari Inhaltstabälle megli mache',
);
/** Hebrew (עברית)
- * @author Rotemliss
+ * @author Rotem Liss
*/
$messages['he'] = array(
'navigabletoc' => 'תוכן ×¢× ×™×™× ×™× ×¢× ×פשרות × ×™×•×•×˜',
'navigabletoc-desc' => 'הוספת תוכן ×¢× ×™×™× ×™× ×œ×“×£ העריכה, המ×פשר לגלול ×ת תיבת הטקסט בעת לחיצה על פסקה',
+ 'navigabletoc-preference' => 'הפעלת תוכן ×¢× ×™×™× ×™× ×¢× ×פשרות × ×™×•×•×˜',
);
/** Upper Sorbian (Hornjoserbsce)
@@ -166,14 +192,17 @@
$messages['hsb'] = array(
'navigabletoc' => 'Nawigěrujomny zapis wobsaha',
'navigabletoc-desc' => 'Přidawa zapis wobsaha wobdźěłowanskemu formularej, kotaryž tekstowe polo kula, hdyž so na wotrězk kliknje.',
+ 'navigabletoc-preference' => 'Nawigěrujomny zapis wobsaha zmóžnić',
);
/** Hungarian (Magyar)
+ * @author Glanthor Reviol
* @author Tgr
*/
$messages['hu'] = array(
'navigabletoc' => 'Navigálható tartalomjegyzék',
'navigabletoc-desc' => 'Egy tartalomjegyzéket ad a szerkesztési űrlaphoz, amivel a szerkesztőablakban az egyes szakaszok elejére lehet ugrani',
+ 'navigabletoc-preference' => 'Tartalomjegyzék megjelenÃtése szerkesztéskor',
);
/** Interlingua (Interlingua)
@@ -182,6 +211,7 @@
$messages['ia'] = array(
'navigabletoc' => 'Tabula de contento navigabile',
'navigabletoc-desc' => 'Adde un tabula de contento al formulario de modification que face rolar le quadro de texto quando on clicca super un section',
+ 'navigabletoc-preference' => 'Activar le tabula de contento navigabile',
);
/** Indonesian (Bahasa Indonesia)
@@ -189,7 +219,8 @@
*/
$messages['id'] = array(
'navigabletoc' => 'Daftar isi yang dapat dinavigasi',
- 'navigabletoc-desc' => 'Menambahkan sebuah daftar isi pada formulir penyuntingan yang jika diklik dapat langsung menuju bagian yang dimaksud',
+ 'navigabletoc-desc' => 'Menambahkan sebuah daftar isi pada formulir penyuntingan yang jika diklik dapat langsung menuju ke bagian yang dimaksud',
+ 'navigabletoc-preference' => 'Daftar isi yang dapat dinavigasi',
);
/** Italian (Italiano)
@@ -202,10 +233,12 @@
/** Japanese (日本語)
* @author Fryed-peach
+ * @author Whym
*/
$messages['ja'] = array(
- 'navigabletoc' => 'ナビゲーションå¯èƒ½ãªç›®æ¬¡',
+ 'navigabletoc' => '編集用目次',
'navigabletoc-desc' => 'クリックã—ãŸéš›ã«ãƒ†ã‚ストボックスをスクãƒãƒ¼ãƒ«ã•ã›ã‚‹ç›®æ¬¡ã‚’編集フォームã«åŠ ãˆã‚‹',
+ 'navigabletoc-preference' => '編集用目次を有効化ã™ã‚‹',
);
/** Georgian (ქáƒáƒ თული)
@@ -222,6 +255,7 @@
$messages['ksh'] = array(
'navigabletoc' => 'Ennhaltsverzeichnes beim Ändere',
'navigabletoc-desc' => 'Määt e Ennhaltsverzeichnes op de Sigge zom Ändere, wat dat Feld zom Ändere metnemmp, wann mer op enem Afschnett sing Övverschreff kleck.',
+ 'navigabletoc-preference' => 'Schalld e Enhaltsverzeischnes aan, woh mer dren eröm wandere kann',
);
/** Luxembourgish (Lëtzebuergesch)
@@ -231,6 +265,7 @@
$messages['lb'] = array(
'navigabletoc' => 'Inhaltsverzeechnes fir ze navigéieren',
'navigabletoc-desc' => 'Setzt en Inhaltsverzeechnes op den Ännerungsformulaire derbäi, deen den Text scrollt, wann en Abschnitt ugeklickt gëtt',
+ 'navigabletoc-preference' => 'Navigabelbart Inhaltsverzeechness aschalten',
);
/** Macedonian (МакедонÑки)
@@ -256,6 +291,7 @@
$messages['nl'] = array(
'navigabletoc' => 'Navigeerbare inhoudsopgave',
'navigabletoc-desc' => 'Voegt een inhoudsopgave toe aan het bewerkingsformulier waarmee het tekstvak verschoven kan worden als er op een kopje wordt geklikt',
+ 'navigabletoc-preference' => 'Navigeerbare inhoudsopgave inschakelen',
);
/** Norwegian (bokmål)‬ (‪Norsk (bokmål)‬)
@@ -271,6 +307,7 @@
$messages['oc'] = array(
'navigabletoc' => 'Somari navigable',
'navigabletoc-desc' => 'Apond lo somari al formulari de modificacion que desfila lo tèxte quand una seccion es clicada',
+ 'navigabletoc-preference' => "Activar l'ensenhador navigable",
);
/** Polish (Polski)
@@ -287,6 +324,7 @@
$messages['pms'] = array(
'navigabletoc' => 'Tà ula dij contnù navigà bil',
'navigabletoc-desc' => "A gionta na tà ula dij contnù a la form ëd modìfica ch'a scor la casela quand che as clica na session",
+ 'navigabletoc-preference' => 'Abìlita a scanucié la tà ula dij contnù',
);
/** Portuguese (Português)
@@ -318,6 +356,7 @@
$messages['roa-tara'] = array(
'navigabletoc' => 'Taggele de le condenute navigabbile',
'navigabletoc-desc' => "Aggiunge 'na taggelle de condenute a 'a schermata de cangiamende ca face muvè 'a sckatole de teste quanne 'na seziona è cazzate",
+ 'navigabletoc-preference' => 'Abbilite le tabbele navigabbele de condenute',
);
/** Russian (РуÑÑкий)
@@ -327,14 +366,23 @@
$messages['ru'] = array(
'navigabletoc' => 'Оглавление Ñ Ð½Ð°Ð²Ð¸Ð³Ð°Ñ†Ð¸ÐµÐ¹',
'navigabletoc-desc' => 'ДобавлÑет на форму правки оглавление, прокручивающее текÑÑ‚ в поле Ñ€ÐµÐ´Ð°ÐºÑ‚Ð¸Ñ€Ð¾Ð²Ð°Ð½Ð¸Ñ Ð¿Ñ€Ð¸ выборе Ð½Ð°Ð·Ð²Ð°Ð½Ð¸Ñ Ñ€Ð°Ð·Ð´ÐµÐ»Ð°',
+ 'navigabletoc-preference' => 'Включить оглавление Ñ Ð²Ð¾Ð·Ð¼Ð¾Ð¶Ð½Ð¾Ñтью навигации',
);
+/** Yakut (Саха тыла)
+ * @author HalanTul
+ */
+$messages['sah'] = array(
+ 'navigabletoc' => 'ИһинÑÑҕитин навигациÑлаах тиһигÑ',
+);
+
/** Slovak (SlovenÄina)
* @author Helix84
*/
$messages['sk'] = array(
'navigabletoc' => 'Navigovateľný Obsah',
'navigabletoc-desc' => 'Pridáva do formulára úprav Obsah, ktorý sa posunie na správne miesto po kliknutà na sekciu',
+ 'navigabletoc-preference' => 'PovoliÅ¥ obsah s odkazmi na Äasti',
);
/** Slovenian (SlovenÅ¡Äina)
@@ -362,11 +410,13 @@
);
/** Vietnamese (Tiếng Việt)
+ * @author Minh Nguyen
* @author Vinhtantran
*/
$messages['vi'] = array(
'navigabletoc' => 'Mục lục dễ duyệt tìm',
'navigabletoc-desc' => 'Thêm bảng mục lục và o khung sá»a đổi để cuá»™n há»™p văn bản khi nhấn và o má»™t Ä‘á» mục',
+ 'navigabletoc-preference' => 'SỠdụng mục lục dễ duyệt tìm',
);
/** Yue (粵語)
Index: UsabilityInitiative.i18n.php
===================================================================
--- UsabilityInitiative.i18n.php (revision 56989)
+++ UsabilityInitiative.i18n.php (working copy)
@@ -16,6 +16,13 @@
'usabilityinitiative-desc' => 'Features developed by the Wikipedia Usability Initiative to enhance the usability of MediaWiki',
);
+/** Message documentation (Message documentation)
+ * @author Umherirrender
+ */
+$messages['qqq'] = array(
+ 'usabilityinitiative-desc' => '{{desc}}',
+);
+
/** Afrikaans (Afrikaans)
* @author Naudefj
*/
@@ -221,10 +228,11 @@
/** Italian (Italiano)
* @author Darth Kule
+ * @author Nemo bis
*/
$messages['it'] = array(
- 'usabilityinitiative' => 'Iniziativa di usabilità ',
- 'usabilityinitiative-desc' => "Caratteristiche sviluppate dall'Iniziativa di usabilità di Wikipedia per migliorare l'usabilità di MediaWiki",
+ 'usabilityinitiative' => 'Progetto usabilità ',
+ 'usabilityinitiative-desc' => "Caratteristiche sviluppate dal progetto usabilità di Wikipedia per migliorare l'usabilità di MediaWiki",
);
/** Japanese (日本語)
@@ -265,7 +273,7 @@
*/
$messages['lb'] = array(
'usabilityinitiative' => "Initiativ fir d'Benotzerfrëndlechkeet",
- 'usabilityinitiative-desc' => "Fonctinnalitéiten déi vun der Wikipedia Benotzerfrëndlechkeets-Initiative entwécklet goufe fir d'Benotzerfrëndleckeetvu MediWiki ze verbesseren",
+ 'usabilityinitiative-desc' => "Fonctinnalitéiten déi vun der Wikipedia Benotzerfrëndlechkeets-Initiative entwéckelt goufe fir d'Benotzerfrëndleckeet vu MediaWiki ze verbesseren",
);
/** Lithuanian (Lietuvių)
@@ -373,6 +381,14 @@
'usabilityinitiative-desc' => 'ВозможноÑти движка MediaWiki, разработанные в рамках Инициативы юзабилити Википедии и направленные на улучшение его удобÑтва и проÑтоты иÑпользованиÑ',
);
+/** Yakut (Саха тыла)
+ * @author HalanTul
+ */
+$messages['sah'] = array(
+ 'usabilityinitiative' => 'Ð¢Ð°Ð±Ñ‹Ð³Ð°Ñ Ð¡Ð¸Ñ‚Ð¸Ò»Ð¸Ð¸Ñ‚Ñ',
+ 'usabilityinitiative-desc' => 'Ð¢Ð°Ð±Ñ‹Ð³Ð°Ñ Ð¡Ð¸Ñ‚Ð¸Ò»Ð¸Ð¸Ñ‚Ð¸Ð½ иһинÑн Ñбиллибит MediaWiki движогун Ñаҥа кыахтара; Ò¯Ð»Ñ Ñудургу уонна табыгаÑтаах буоларыгар аналлаахтар.',
+);
+
/** Slovak (SlovenÄina)
* @author Helix84
*/
@@ -422,6 +438,14 @@
'usabilityinitiative-desc' => "Carateristiche svilupà da l'Inissiativa par l'Usabilità de Wikipedia par mejorar l'usabilità de MediaWiki",
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'usabilityinitiative' => 'Kävutamižen Iniciativ',
+ 'usabilityinitiative-desc' => 'MediaWikin likutimen voindad, kudambad sätihe Wikipedia Usability Initiative, miše paremboita MediaWikin rad.',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Vinhtantran
*/
Index: UsabilityInitiative.hooks.php
===================================================================
--- UsabilityInitiative.hooks.php (revision 56989)
+++ UsabilityInitiative.hooks.php (working copy)
@@ -18,7 +18,7 @@
private static $styleFiles = array(
'base_sets' => array(
'raw' => array(
- array( 'src' => 'css/suggestions.css', 'version' => 5 ),
+ array( 'src' => 'css/suggestions.css', 'version' => 6 ),
array( 'src' => 'css/wikiEditor.css', 'version' => 4 ),
array( 'src' => 'css/wikiEditor.toolbar.css', 'version' => 5 ),
array( 'src' => 'css/wikiEditor.dialogs.css', 'version' => 1 ),
@@ -26,11 +26,11 @@
array( 'src' => 'css/vector/jquery-ui-1.7.2.css', 'version' => '1.7.2' ),
),
'combined' => array(
- array( 'src' => 'css/combined.css', 'version' => 7 ),
+ array( 'src' => 'css/combined.css', 'version' => 8 ),
array( 'src' => 'css/vector/jquery-ui-1.7.2.css', 'version' => '1.7.2' ),
),
'minified' => array(
- array( 'src' => 'css/combined.min.css', 'version' => 7 ),
+ array( 'src' => 'css/combined.min.css', 'version' => 8 ),
array( 'src' => 'css/vector/jquery-ui-1.7.2.css', 'version' => '1.7.2' ),
),
)
@@ -47,32 +47,37 @@
array( 'src' => 'js/js2/js2.js', 'version' => 3 ),
),
'combined' => array(
- array( 'src' => 'js/js2.combined.js', 'version' => 5 ),
+ array( 'src' => 'js/js2.combined.js', 'version' => 6 ),
),
'minified' => array(
- array( 'src' => 'js/js2.combined.min.js', 'version' => 5 ),
+ array( 'src' => 'js/js2.combined.min.js', 'version' => 6 ),
),
),
// Core functionality of extension
'base_sets' => array(
'raw' => array(
array( 'src' => 'js/plugins/jquery.async.js', 'version' => 3 ),
+ array( 'src' => 'js/plugins/jquery.autoEllipse.js', 'version' => 2 ),
array( 'src' => 'js/plugins/jquery.browser.js', 'version' => 3 ),
array( 'src' => 'js/plugins/jquery.cookie.js', 'version' => 3 ),
- array( 'src' => 'js/plugins/jquery.namespaceSelect.js', 'version' => 0 ),
- array( 'src' => 'js/plugins/jquery.suggestions.js', 'version' => 2 ),
- array( 'src' => 'js/plugins/jquery.textSelection.js', 'version' => 9 ),
- array( 'src' => 'js/plugins/jquery.wikiEditor.js', 'version' => 5 ),
+ array( 'src' => 'js/plugins/jquery.delayedBind.js', 'version' => 1 ),
+ array( 'src' => 'js/plugins/jquery.namespaceSelect.js', 'version' => 1 ),
+ array( 'src' => 'js/plugins/jquery.suggestions.js', 'version' => 4 ),
+ array( 'src' => 'js/plugins/jquery.textSelection.js', 'version' => 11 ),
+ array( 'src' => 'js/plugins/jquery.wikiEditor.js', 'version' => 6 ),
array( 'src' => 'js/plugins/jquery.wikiEditor.dialogs.js', 'version' => 3 ),
- array( 'src' => 'js/plugins/jquery.wikiEditor.toc.js', 'version' => 6 ),
- array( 'src' => 'js/js2/jquery-ui-1.7.2.js', 'version' => '1.7.2x' ),
+ array( 'src' => 'js/plugins/jquery.wikiEditor.toc.js', 'version' => 9 ),
+ // FIXME: jQuery UI doesn't belong here, should move to no_js2
+ // once we figure out how to do jQuery UI properly in JS2
+ array( 'src' => 'js/js2/jquery-ui-1.7.2.js', 'version' => '1.7.2y' ),
),
'combined' => array(
- array( 'src' => 'js/plugins.combined.js', 'version' => 23 ),
+ array( 'src' => 'js/plugins.combined.js', 'version' => 27 ),
),
'minified' => array(
- array( 'src' => 'js/plugins.combined.min.js', 'version' => 23 ),
+ array( 'src' => 'js/plugins.combined.min.js', 'version' => 27 ),
),
),
);
Index: UserDailyContribs/UserDailyContribs.i18n.php
===================================================================
--- UserDailyContribs/UserDailyContribs.i18n.php (revision 56354)
+++ UserDailyContribs/UserDailyContribs.i18n.php (working copy)
@@ -16,9 +16,214 @@
);
/** Message documentation (Message documentation)
+ * @author Purodha
* @author Raimond Spekking
*/
$messages['qqq'] = array(
- 'userdailycontribs-desc' => '{{desc}}',
+ 'userdailycontribs-desc' => '{{desc}}
+"user" is a plural here.',
);
+/** Belarusian (TaraÅ¡kievica orthography) (БеларуÑÐºÐ°Ñ (тарашкевіца))
+ * @author Jim-by
+ */
+$messages['be-tarask'] = array(
+ 'userdailycontribs-desc' => 'Штодзённы ўнёÑак удзельнікаў Ð´Ð»Ñ Ð¿Ð°ÑˆÑ‹Ñ€ÑÐ½ÑŒÐ½Ñ ÑачÑÐ½ÑŒÐ½Ñ Ð·Ð° націÑкамі мышшу',
+);
+
+/** Breton (Brezhoneg)
+ * @author Fulup
+ */
+$messages['br'] = array(
+ 'userdailycontribs-desc' => "Degasadennoù pemdeziek dre implijer evit an astenn heuliañ ar c'hlikoù",
+);
+
+/** Bosnian (Bosanski)
+ * @author CERminator
+ */
+$messages['bs'] = array(
+ 'userdailycontribs-desc' => 'Dnevni doprinosi korisnka za proširenje praćenja klikova',
+);
+
+/** German (Deutsch)
+ * @author Metalhead64
+ */
+$messages['de'] = array(
+ 'userdailycontribs-desc' => 'Benutzertagesbeiträge für die Klickverfolgungs-Erweiterung',
+);
+
+/** Lower Sorbian (Dolnoserbski)
+ * @author Michawiki
+ */
+$messages['dsb'] = array(
+ 'userdailycontribs-desc' => 'Wšědne wužywarske pśinoski za rozšyrjenje Clicktracking',
+);
+
+/** Greek (Ελληνικά)
+ * @author Omnipaedista
+ */
+$messages['el'] = array(
+ 'userdailycontribs-desc' => 'ΗμεÏήσιες συνεισφοÏÎÏ‚ χÏήστη για την επÎκταση παÏακολοÏθησης κλικ',
+);
+
+/** Esperanto (Esperanto)
+ * @author Yekrats
+ */
+$messages['eo'] = array(
+ 'userdailycontribs-desc' => 'Ĉiutagaj kontribuoj de uzantoj por la klak-sekvada modulo.',
+);
+
+/** French (Français)
+ * @author PieRRoMaN
+ */
+$messages['fr'] = array(
+ 'userdailycontribs-desc' => "Contributions quotidiennes par utilisateur pour l'extension de suivi des clics",
+);
+
+/** Galician (Galego)
+ * @author Toliño
+ */
+$messages['gl'] = array(
+ 'userdailycontribs-desc' => 'Contribucións diarias por usuario para a extensión de seguimento de clics',
+);
+
+/** Swiss German (Alemannisch)
+ * @author Als-Holder
+ */
+$messages['gsw'] = array(
+ 'userdailycontribs-desc' => 'Tägligi Byytreg fir d Klickverfolgigs-Erwyterig verwände',
+);
+
+/** Hebrew (עברית)
+ * @author Rotem Liss
+ */
+$messages['he'] = array(
+ 'userdailycontribs-desc' => 'התרומה היומית של כל משתמש להרחבת מעקב הלחיצות',
+);
+
+/** Upper Sorbian (Hornjoserbsce)
+ * @author Michawiki
+ */
+$messages['hsb'] = array(
+ 'userdailycontribs-desc' => 'Wšědne wužiwarske přinoški za rozšěrjenje Clicktracking',
+);
+
+/** Hungarian (Magyar)
+ * @author Glanthor Reviol
+ */
+$messages['hu'] = array(
+ 'userdailycontribs-desc' => 'Felhasználók napi közreműködéseinek megjelenÃtése a kattintásszámlálóban',
+);
+
+/** Interlingua (Interlingua)
+ * @author McDutchie
+ */
+$messages['ia'] = array(
+ 'userdailycontribs-desc' => 'Contributiones quotidian de usatores pro le extension de traciamento de clics',
+);
+
+/** Indonesian (Bahasa Indonesia)
+ * @author Bennylin
+ */
+$messages['id'] = array(
+ 'userdailycontribs-desc' => 'Kontribusi harian pengguna untuk pengaya pelacak klik',
+);
+
+/** Japanese (日本語)
+ * @author Fryed-peach
+ */
+$messages['ja'] = array(
+ 'userdailycontribs-desc' => 'クリック追跡拡張機能ã®ãŸã‚ã®åˆ©ç”¨è€…ã®ä¸€æ—¥ã‚ãŸã‚Šã®æŠ•ç¨¿',
+);
+
+/** Ripoarisch (Ripoarisch)
+ * @author Purodha
+ */
+$messages['ksh'] = array(
+ 'userdailycontribs-desc' => 'De dääschlesch Beidrääsch vun de Metmacher, för de <i lang="en">Wikipedia Usability Initiative</i> ier Kleckverfolljung.',
+);
+
+/** Luxembourgish (Lëtzebuergesch)
+ * @author Robby
+ */
+$messages['lb'] = array(
+ 'userdailycontribs-desc' => "Ännerunge pro Dag a Bentzer fir d'Erweiderung vum Suivi vun de Clicken",
+);
+
+/** Dutch (Nederlands)
+ * @author Siebrand
+ */
+$messages['nl'] = array(
+ 'userdailycontribs-desc' => 'Dagelijkse gebruikersbijdragen voor de uitbreiding om gebruikerskliks mee te volgen',
+);
+
+/** Occitan (Occitan)
+ * @author Cedric31
+ */
+$messages['oc'] = array(
+ 'userdailycontribs-desc' => "Contribucions jornalièras per utilizaire per l'extension de seguit dels clics",
+);
+
+/** Polish (Polski)
+ * @author Sp5uhe
+ */
+$messages['pl'] = array(
+ 'userdailycontribs-desc' => 'Codzienny wkład użytkowników wyśledzony przez rozszerzenie monitorujące kliknięcia',
+);
+
+/** Piedmontese (Piemontèis)
+ * @author Dragonòt
+ */
+$messages['pms'] = array(
+ 'userdailycontribs-desc' => "Contribussion giornaliere dl'utent për l'estension dla trassadura dij click",
+);
+
+/** TarandÃne (TarandÃne)
+ * @author Joetaras
+ */
+$messages['roa-tara'] = array(
+ 'userdailycontribs-desc' => "Utinde ca ogne sciurne condrebbuiscene pe 'u cazzaminde de l'estenzione de tracciamende",
+);
+
+/** Russian (РуÑÑкий)
+ * @author ÐлекÑандр Сигачёв
+ */
+$messages['ru'] = array(
+ 'userdailycontribs-desc' => 'Ежедневный вклад учаÑтников Ð´Ð»Ñ Ñ€Ð°ÑÑˆÐ¸Ñ€ÐµÐ½Ð¸Ñ Ð¾Ñ‚ÑÐ»ÐµÐ¶Ð¸Ð²Ð°Ð½Ð¸Ñ Ð½Ð°Ð¶Ð°Ñ‚Ð¸Ð¹',
+);
+
+/** Yakut (Саха тыла)
+ * @author HalanTul
+ */
+$messages['sah'] = array(
+ 'userdailycontribs-desc' => 'Баттааһыны кÑтиири кÑÒ¥ÑÑ‚ÑÑ€ кыттааччылар Ñуруйууларын күнүнÑн наардааһын',
+);
+
+/** Slovak (SlovenÄina)
+ * @author Helix84
+ */
+$messages['sk'] = array(
+ 'userdailycontribs-desc' => 'Denné prÃspevky použÃvateľa rozÅ¡Ãrenia na sledovanie kliknutÃ',
+);
+
+/** Turkish (Türkçe)
+ * @author Joseph
+ */
+$messages['tr'] = array(
+ 'userdailycontribs-desc' => 'Tıklama izleme eklentisi için günlük kullanıcı katkıları',
+);
+
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'userdailycontribs-desc' => 'Jogapäiväline kävutajiden tond painmižid kaceltes',
+);
+
+/** Vietnamese (Tiếng Việt)
+ * @author Vinhtantran
+ */
+$messages['vi'] = array(
+ 'userdailycontribs-desc' => 'Äóng góp hà ng ngà y của thà nh viên dà nh cho bá»™ mở rá»™ng theo dõi nhấn chuá»™t',
+);
+
Property changes on: EditToolbar
___________________________________________________________________
Deleted: svn:mergeinfo
Reverse-merged /branches/REL1_15/phase3/extensions/UsabilityInitiative/EditToolbar:r51646
Reverse-merged /trunk/extensions/UsabilityInitiative/EditToolbar:r56207,56209,56296,56333,56355,56424,56426,56588,56590
Reverse-merged /trunk/phase3/extensions/UsabilityInitiative/EditToolbar:r56213,56215-56216,56218,56325,56334-56336,56338,56340,56343,56345,56347,56350
Index: EditToolbar/EditToolbar.hooks.php
===================================================================
--- EditToolbar/EditToolbar.hooks.php (revision 56989)
+++ EditToolbar/EditToolbar.hooks.php (working copy)
@@ -59,6 +59,7 @@
'edittoolbar-tool-link-int-target-status-invalid',
'edittoolbar-tool-link-int-target-status-loading',
'edittoolbar-tool-link-int-invalid',
+ 'edittoolbar-tool-link-ext-invalid',
'edittoolbar-tool-file',
'edittoolbar-tool-file-pre',
'edittoolbar-tool-file-example',
@@ -114,6 +115,7 @@
'edittoolbar-tool-replace-button',
'edittoolbar-tool-replace-close',
'edittoolbar-tool-replace-nomatch',
+ 'edittoolbar-tool-replace-success',
/* Special Characters Section */
'edittoolbar-section-characters',
'edittoolbar-characters-page-latin',
@@ -219,7 +221,7 @@
);
}
- if ( !$wgEditToolbarCGDGlobalEnable && $wgEditToolbarCGDGlobalEnable ) {
+ if ( !$wgEditToolbarCGDGlobalEnable && $wgEditToolbarCGDUserEnable ) {
wfLoadExtensionMessages( 'EditToolbar' );
$defaultPreferences['usebetatoolbar-cgd'] = array(
'type' => 'toggle',
Index: EditToolbar/EditToolbar.js
===================================================================
--- EditToolbar/EditToolbar.js (revision 56989)
+++ EditToolbar/EditToolbar.js (working copy)
@@ -757,7 +757,7 @@
<li><a href="#edittoolbar-link-dialog-tab-int" rel="edittoolbar-tool-link-int"></a></li>\
<li><a href="#edittoolbar-link-dialog-tab-ext" rel="edittoolbar-tool-link-ext"></a></li>\
</ul>\
- <div id="edittoolbar-link-dialog-tab-int"><form><fieldset><table><tr>\
+ <div id="edittoolbar-link-dialog-tab-int"><fieldset><table><tr>\
<td><label for="edittoolbar-link-int-target" rel="edittoolbar-tool-link-int-target"></label></td>\
<td>\
<input type="text" id="edittoolbar-link-int-target" />\
@@ -766,14 +766,14 @@
</tr><tr>\
<td><label for="edittoolbar-link-int-text" rel="edittoolbar-tool-link-int-text"></label></td>\
<td><input type="text" id="edittoolbar-link-int-text" /></td>\
- </table></fieldset></form></div>\
- <div id="edittoolbar-link-dialog-tab-ext"><form><fieldset><table><tr>\
+ </table></fieldset></div>\
+ <div id="edittoolbar-link-dialog-tab-ext"><fieldset><table><tr>\
<td><label for="edittoolbar-link-ext-target" rel="edittoolbar-tool-link-ext-target"></label></td>\
<td><input type="text" id="edittoolbar-link-ext-target" /></td>\
</tr><tr>\
<td><label for="edittoolbar-link-ext-text" rel="edittoolbar-tool-link-ext-text"></label></td>\
<td><input type="text" id="edittoolbar-link-ext-text" /></td>\
- </table></fieldset></form></div>\
+ </table></fieldset></div>\
</div>',
init: function() {
// Updates the UI to show if the page title being inputed by the user exists or not
@@ -940,13 +940,12 @@
},
cancel: function() {
var request = $j(this).data( 'request' );
- if ( request.abort )
+ if ( request )
request.abort();
}
});
},
dialog: {
- width: 550, // FIXME: autoresize width
buttons: {
'edittoolbar-tool-link-insert': function() {
function escapeInternalText( s ) {
@@ -963,14 +962,15 @@
var whitespace = [ '', '' ];
switch ( $j( '#edittoolbar-link-tabs' ).tabs( 'option', 'selected' ) ) {
case 0: // Internal link
+ var target = $j( '#edittoolbar-link-int-target' ).val();
+ var text = $j( '#edittoolbar-link-int-text' ).val();
// FIXME: Exactly how fragile is this?
- if ( $j( '#edittoolbar-link-int-target-status-invalid' ).is( ':visible' ) ) {
+ if ( $j( '#edittoolbar-link-int-target-status-invalid' ).is( ':visible' ) ||
+ target == '' ) {
// Refuse to add links to invalid titles
alert( gM( 'edittoolbar-tool-link-int-invalid' ) );
return;
}
- var target = $j( '#edittoolbar-link-int-target' ).val();
- var text = $j( '#edittoolbar-link-int-text' ).val();
whitespace = $j( '#edittoolbar-link-dialog-tab-int' ).data( 'whitespace' );
if ( target == text )
insertText = '[[' + target + ']]';
@@ -983,6 +983,12 @@
var escTarget = escapeExternalTarget( target );
var escText = escapeExternalText( text );
whitespace = $j( '#edittoolbar-link-dialog-tab-ext' ).data( 'whitespace' );
+ if ( target == '' || target == 'http://' ) {
+ // Refuse to add links to invalid URLs
+ // TODO: More elaborate regex here?
+ alert( gM( 'edittoolbar-tool-link-ext-invalid' ) );
+ return;
+ }
if ( escTarget == escText )
insertText = escTarget;
else if ( text == '' )
@@ -1008,8 +1014,8 @@
open: function() {
// Pre-fill the text fields based on the current selection
var selection = $j(this).data( 'context' ).$textarea.getSelection();
- $j( '#edittoolbar-link-dialog-tab-int' ).data( 'whitespace', [ '', '' ] );
- $j( '#edittoolbar-link-dialog-tab-ext' ).data( 'whitespace', [ '', '' ] );
+ $j( '#edittoolbar-link-dialog-tab-int' ).data( 'whitespace', [ '', '' ] );
+ $j( '#edittoolbar-link-dialog-tab-ext' ).data( 'whitespace', [ '', '' ] );
if ( selection != '' ) {
var intText, intTarget, extText, extTarget;
var matches;
@@ -1048,6 +1054,19 @@
$j( '#edittoolbar-link-int-text' ).val() == $j( '#edittoolbar-link-int-target' ).val()
);
$j( '#edittoolbar-link-int-target' ).suggestions();
+
+ if ( !( $j(this).data( 'dialogkeypressset' ) ) ) {
+ $j(this).data( 'dialogkeypressset', true );
+ // Execute the action associated with the first button
+ // when the user presses Enter
+ $j(this).closest( '.ui-dialog' ).keypress( function( e ) {
+ if ( ( e.keyCode || e.which ) == 13 ) {
+ $j(this)
+ .find( 'button:first' )
+ .click();
+ }
+ });
+ }
}
}
},
@@ -1055,7 +1074,7 @@
titleMsg: 'edittoolbar-tool-table-title',
id: 'edittoolbar-table-dialog',
html: '\
- <form><fieldset><legend rel="edittoolbar-tool-table-dimensions"></legend><table><tr>\
+ <fieldset><legend rel="edittoolbar-tool-table-dimensions"></legend><table><tr>\
<td><input type="checkbox" id="edittoolbar-table-dimensions-header" value="1" /></td>\
<td class="label"><label for="edittoolbar-table-dimensions-header"\
rel="edittoolbar-tool-table-dimensions-header"></label></td>\
@@ -1066,16 +1085,24 @@
<td class="label"><label for="edittoolbar-table-dimensions-rows"\
rel="edittoolbar-tool-table-dimensions-rows"></label></td>\
<td><input type="text" id="edittoolbar-table-dimensions-rows" size="2" /></td>\
- </tr></table></fieldset></form>',
+ </tr></table></fieldset>',
init: function() {
$j(this).find( '[rel]' ).each( function() {
$j(this).text( gM( $j(this).attr( 'rel' ) ) );
});
+ // Execute the action associated with the first button
+ // when the user presses Enter
+ $j(this).closest( '.ui-dialog' ).keypress( function( e ) {
+ if ( ( e.keyCode || e.which ) == 13 ) {
+ $j(this)
+ .find( 'button:first' )
+ .click();
+ }
+ });
$j( '#edittoolbar-table-dimensions-rows' ).val( 2 );
$j( '#edittoolbar-table-dimensions-columns' ).val( 2 );
},
dialog: {
- width: 350, // FIXME: autoresize
buttons: {
'edittoolbar-tool-table-insert': function() {
var rows = parseInt( $j( '#edittoolbar-table-dimensions-rows' ).val() );
@@ -1116,6 +1143,20 @@
'edittoolbar-tool-table-cancel': function() {
$j(this).dialog( 'close' );
}
+ },
+ open: function() {
+ if ( !( $j(this).data( 'dialogkeypressset' ) ) ) {
+ $j(this).data( 'dialogkeypressset', true );
+ // Execute the action associated with the first button
+ // when the user presses Enter
+ $j(this).closest( '.ui-dialog' ).keypress( function( e ) {
+ if ( ( e.keyCode || e.which ) == 13 ) {
+ $j(this)
+ .find( 'button:first' )
+ .click();
+ }
+ });
+ }
}
}
},
@@ -1123,7 +1164,7 @@
titleMsg: 'edittoolbar-tool-replace-title',
id: 'edittoolbar-replace-dialog',
html: '\
- <form><fieldset><table><tr>\
+ <fieldset><table><tr>\
<td><label for="edittoolbar-replace-search" rel="edittoolbar-tool-replace-search"></label></td>\
<td><input type="text" id="edittoolbar-replace-search" /></td>\
</tr><tr>\
@@ -1138,16 +1179,58 @@
</tr><tr>\
<td><input type="checkbox" id="edittoolbar-replace-all" /></td>\
<td><label for="edittoolbar-replace-all" rel="edittoolbar-tool-replace-all"></label></td>\
- </tr></table></fieldset></form>',
+ </tr></table></fieldset>',
init: function() {
$j(this).find( '[rel]' ).each( function() {
$j(this).text( gM( $j(this).attr( 'rel' ) ) );
});
+ // Execute the action associated with the first button
+ // when the user presses Enter
+ $j(this).closest( '.ui-dialog' ).keypress( function( e ) {
+ if ( ( e.keyCode || e.which ) == 13 ) {
+ $j(this)
+ .find( 'button:first' )
+ .click();
+ }
+ });
},
dialog: {
- width: 350, // FIXME: autoresize width
buttons: {
'edittoolbar-tool-replace-button': function() {
+ function fixOperaBrokenness( s ) {
+ // This function works around Opera's
+ // broken newline handling in textareas.
+ // .val() has \n while selection functions
+ // treat newlines as \r\n
+
+ if ( typeof $j.isOperaBroken == 'undefined' ) {
+ // Create a textarea inside a div
+ // with zero area, to hide it properly
+ var div = $j( '<div />' )
+ .height( 0 )
+ .width( 0 )
+ .insertBefore( $textarea );
+ var textarea = $j( '<textarea></textarea' )
+ .height( 0 )
+ .appendTo( div )
+ .val( "foo\r\nbar" );
+
+ // Try to search&replace bar --> BAR
+ var index = textarea.val().indexOf( 'bar' );
+ textarea.select();
+ textarea.setSelection( index, index + 3 );
+ textarea.encapsulateSelection( '', 'BAR', '', false, true );
+ if ( textarea.val().substr( -1 ) == 'R' )
+ $j.isOperaBroken = false;
+ else
+ $j.isOperaBroken = true;
+ div.remove();
+ }
+ if ( $j.isOperaBroken )
+ s = s.replace( /\n/g, "\r\n" );
+ return s;
+ }
+
var searchStr = $j( '#edittoolbar-replace-search' ).val();
var replaceStr = $j( '#edittoolbar-replace-replace' ).val();
var flags = '';
@@ -1162,16 +1245,45 @@
}
var regex = new RegExp( searchStr, flags );
var $textarea = $j(this).data( 'context' ).$textarea;
- if ( !$textarea.val().match( regex ) ) {
+ var text = fixOperaBrokenness( $textarea.val() );
+ var matches = text.match( regex );
+ if ( !matches ) {
alert( gM( 'edittoolbar-tool-replace-nomatch' ) );
} else {
- $textarea.val( $textarea.val().replace( regex, replaceStr ) );
+ var start, end;
+ for ( var i = 0; i < matches.length; i++ ) {
+ start = text.indexOf( matches[i] );
+ end = start + matches[i].length;
+ $textarea.setSelection( start, end );
+ $textarea.encapsulateSelection( '', replaceStr, '', false, true );
+
+ // $textarea.val() has changed
+ text = fixOperaBrokenness( $textarea.val() );
+ }
+ if ( $j( '#edittoolbar-replace-all' ).is( ':checked' ) )
+ alert( gM( 'edittoolbar-tool-replace-success', i ) );
+ $textarea.scrollToCaretPosition( start );
+ $textarea.setSelection( start, start + replaceStr.length );
}
- // TODO: Hook for wikEd
},
'edittoolbar-tool-replace-close': function() {
$j(this).dialog( 'close' );
+ $j(this).data( 'context' ).$textarea.focus();
}
+ },
+ open: function() {
+ if ( !( $j(this).data( 'dialogkeypressset' ) ) ) {
+ $j(this).data( 'dialogkeypressset', true );
+ // Execute the action associated with the first button
+ // when the user presses Enter
+ $j(this).closest( '.ui-dialog' ).keypress( function( e ) {
+ if ( ( e.keyCode || e.which ) == 13 ) {
+ $j(this)
+ .find( 'button:first' )
+ .click();
+ }
+ });
+ }
}
}
}
Property changes on: EditToolbar/EditToolbar.js
___________________________________________________________________
Deleted: svn:mergeinfo
Reverse-merged /branches/REL1_15/phase3/extensions/UsabilityInitiative/EditToolbar/EditToolbar.js:r51646
Reverse-merged /trunk/extensions/UsabilityInitiative/EditToolbar/EditToolbar.js:r56207,56209,56226,56296,56333,56355,56417,56424,56426,56588,56590
Reverse-merged /trunk/phase3/extensions/UsabilityInitiative/EditToolbar/EditToolbar.js:r56213,56215-56216,56218,56325,56334-56336,56338,56340,56343,56345,56347,56350
Index: EditToolbar/EditToolbar.i18n.php
===================================================================
--- EditToolbar/EditToolbar.i18n.php (revision 56989)
+++ EditToolbar/EditToolbar.i18n.php (working copy)
@@ -15,7 +15,7 @@
'edittoolbar' => 'Editing toolbar',
'edittoolbar-desc' => 'Edit page toolbar with enhanced usability',
'edittoolbar-preference' => 'Enable enhanced editing toolbar',
- 'edittoolbar-cgd-preference' => 'Enable content generation dialogs in enhanced editing toolbar',
+ 'edittoolbar-cgd-preference' => 'Enable help for adding advanced wiki text',
'edittoolbar-loading' => 'Loading...',
/* Main Section */
'edittoolbar-tool-bold' => 'Bold',
@@ -41,6 +41,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Invalid title',
'edittoolbar-tool-link-int-target-status-loading' => 'Checking page existence...',
'edittoolbar-tool-link-int-invalid' => 'The title you specified is invalid.',
+ 'edittoolbar-tool-link-ext-invalid' => 'The URL you specified is invalid.',
'edittoolbar-tool-file' => 'Embedded file',
'edittoolbar-tool-file-pre' => '$1{{ns:file}}:',
'edittoolbar-tool-file-example' => 'Example.jpg',
@@ -98,7 +99,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Include header row',
'edittoolbar-tool-table-insert' => 'Insert',
'edittoolbar-tool-table-cancel' => 'Cancel',
- 'edittoolbar-tool-replace' => 'Replace',
+ 'edittoolbar-tool-replace' => 'Search and replace',
'edittoolbar-tool-replace-title' => 'Search and replace',
'edittoolbar-tool-replace-search' => 'Search for:',
'edittoolbar-tool-replace-replace' => 'Replace with:',
@@ -106,8 +107,9 @@
'edittoolbar-tool-replace-regex' => 'Treat search string as a regular expression',
'edittoolbar-tool-replace-all' => 'Replace all occurences',
'edittoolbar-tool-replace-button' => 'Replace',
- 'edittoolbar-tool-replace-close' => 'Close',
+ 'edittoolbar-tool-replace-close' => 'Cancel',
'edittoolbar-tool-replace-nomatch' => 'Your search did not match anything.',
+ 'edittoolbar-tool-replace-success' => '$1 replacement(s) made.',
/* Special characters Section */
'edittoolbar-section-characters' => 'Special characters',
'edittoolbar-characters-page-latin' => 'Latin',
@@ -169,7 +171,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>List item</li><li>List item</li></ol>',
'edittoolbar-help-content-file-description' => 'Embedded file',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Caption text]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Caption text</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Caption text</div></div>",
'edittoolbar-help-content-reference-description' => 'Reference',
'edittoolbar-help-content-reference-syntax' => 'Page text.<ref name="test">[http://www.example.org Link text], additional text.</ref>',
'edittoolbar-help-content-reference-result' => "Page text.<sup><a href='#'>[1]</a></sup>",
@@ -192,44 +194,59 @@
/** Message documentation (Message documentation)
* @author Bennylin
+ * @author Darth Kule
* @author EugeneZelenko
* @author Fryed-peach
+ * @author Lloffiwr
* @author McDutchie
* @author Minh Nguyen
* @author Mormegil
* @author Purodha
* @author SMP
* @author Siebrand
+ * @author Umherirrender
*/
$messages['qqq'] = array(
+ 'edittoolbar-desc' => '{{desc}}',
'edittoolbar-preference' => 'Option in [[Special:Preferences]]',
+ 'edittoolbar-cgd-preference' => "Caption of a checkbox on [[Special:Preferences]] (''editing'' tab), enabling helper dialogs for various features of the advanced edit toolbar (e.g. inserting links or tables).",
'edittoolbar-loading' => '{{Identical|Loading}}',
'edittoolbar-tool-bold' => '{{Identical|Bold}}',
'edittoolbar-tool-bold-example' => '{{Identical|Bold text}}',
'edittoolbar-tool-italic' => '{{Identical|Italic}}',
'edittoolbar-tool-italic-example' => '{{Identical|Italic text}}',
+ 'edittoolbar-tool-ilink' => '{{Identical|Internal link}}',
'edittoolbar-tool-link' => '{{Identical|Link}}',
'edittoolbar-tool-link-cancel' => '{{Identical|Cancel}}',
'edittoolbar-tool-link-int-target-status-exists' => 'alt text and title text for the image shown when the title the user entered exists',
'edittoolbar-tool-link-int-target-status-notexists' => 'alt text and title text for the image shown when the title the user entered does not exist',
'edittoolbar-tool-link-int-target-status-invalid' => 'alt text and title text for the image shown when the title the user entered is invalid',
'edittoolbar-tool-link-int-target-status-loading' => 'alt text and title text for the image shown while the title the user entered is being checked for existence',
+ 'edittoolbar-tool-file' => '{{Identical|Embedded file}}',
'edittoolbar-tool-reference' => '{{Identical|Reference}}',
'edittoolbar-group-list' => '{{Identical|List}}',
+ 'edittoolbar-tool-ulist' => '{{Identical|Bulleted list}}',
+ 'edittoolbar-tool-olist' => '{{Identical|Numbered list}}',
'edittoolbar-group-size' => '{{Identical|Size}}',
+ 'edittoolbar-group-insert' => '{{Identical|Insert}}',
+ 'edittoolbar-tool-table-insert' => '{{Identical|Insert}}',
'edittoolbar-tool-table-cancel' => '{{Identical|Cancel}}',
- 'edittoolbar-tool-replace' => '{{Identical|Replace}}',
+ 'edittoolbar-tool-replace' => '{{Identical|Search and replace}}',
+ 'edittoolbar-tool-replace-title' => '{{Identical|Search and replace}}',
'edittoolbar-tool-replace-search' => '{{Identical|Search}}',
'edittoolbar-tool-replace-case' => 'This could as well be translated as "case sensitive search" -
"case" refers to character case, that is upper case, or lower case.',
'edittoolbar-tool-replace-button' => '{{Identical|Replace}}',
- 'edittoolbar-tool-replace-close' => '{{Identical|Close}}',
+ 'edittoolbar-tool-replace-close' => '{{Identical|Cancel}}',
+ 'edittoolbar-tool-replace-success' => '[[file:Bulbgraph.png|left|22px]]
+This message does not support PLURAL on $1.',
'edittoolbar-characters-page-latin' => 'This is the name of a script, or alphabet, not a language',
'edittoolbar-characters-page-ipa' => 'IPA means a script: "international phonetic alphabet" here, and not "international phonetic association", the organization behind it.',
'edittoolbar-characters-page-greek' => 'This is the name of a script, or alphabet, not a language.',
'edittoolbar-characters-page-cyrillic' => 'This is the name of a script, or a group of alphabets, used mainly in Eastern Europe and North and Central Asia.',
'edittoolbar-characters-page-arabic' => 'This is the name of a script, or alphabet, not a language.',
'edittoolbar-characters-page-hebrew' => 'This is the name of a script, or alphabet, not a language.',
+ 'edittoolbar-section-help' => '{{Identical|Help}}',
'edittoolbar-help-heading-description' => '{{Identical|Description}}',
'edittoolbar-help-page-link' => '{{Identical|Links}}',
'edittoolbar-help-page-list' => '{{Identical|List}}',
@@ -242,6 +259,8 @@
'edittoolbar-help-content-bold-description' => '{{Identical|Bold}}',
'edittoolbar-help-content-bold-syntax' => '{{Identical|Bold text}}',
'edittoolbar-help-content-bold-result' => '{{Identical|Bold text}}',
+ 'edittoolbar-help-content-ilink-description' => '{{Identical|Internal link}}',
+ 'edittoolbar-help-content-xlink-syntax' => "www.example.org is not a real website. If you go to this page on the web it says that it cannot be registered as a real domain. If you translate the word example and try to go to that web address then you might get a message that it doesn't exist. But somebody may have created a web page for that address, such as www.Beispiel.org, using the German word for example. So it is worth checking where the translated link takes you when translating this.",
'edittoolbar-help-content-heading1-syntax' => '{{Identical|Heading text}}',
'edittoolbar-help-content-heading1-result' => '{{Identical|Heading text}}',
'edittoolbar-help-content-heading2-syntax' => '{{Identical|Heading text}}',
@@ -252,6 +271,10 @@
'edittoolbar-help-content-heading4-result' => '{{Identical|Heading text}}',
'edittoolbar-help-content-heading5-syntax' => '{{Identical|Heading text}}',
'edittoolbar-help-content-heading5-result' => '{{Identical|Heading text}}',
+ 'edittoolbar-help-content-ulist-description' => '{{Identical|Bulleted list}}',
+ 'edittoolbar-help-content-olist-description' => '{{Identical|Numbered list}}',
+ 'edittoolbar-help-content-file-description' => '{{Identical|Embedded file}}',
+ 'edittoolbar-help-content-file-syntax' => "{{doc-important|''thumb'' is a magic word. Leave it untranslated!}}",
'edittoolbar-help-content-file-result' => 'Do not translate anything except "Caption text" (twice) and "Enlarge" (to "{{int:thumbnail-more}}").',
'edittoolbar-help-content-reference-description' => '{{Identical|Reference}}',
'edittoolbar-help-content-reference-syntax' => 'I suggest leaving the <code>name="test"</code> string in English',
@@ -271,9 +294,12 @@
'edittoolbar-tool-bold' => 'Vet',
'edittoolbar-tool-bold-example' => 'Vetgedrukte teks',
'edittoolbar-tool-italic' => 'Kursief',
+ 'edittoolbar-tool-ilink' => 'Interne skakel',
'edittoolbar-tool-link' => 'Skakel',
'edittoolbar-tool-link-cancel' => 'kanselleer',
+ 'edittoolbar-tool-file' => 'Ingebedde lêer',
'edittoolbar-tool-file-example' => 'Voorbeeld.jpg',
+ 'edittoolbar-section-advanced' => 'Gevorderde funksies',
'edittoolbar-tool-heading' => 'Opskrif',
'edittoolbar-tool-heading-1' => 'Vlak 1',
'edittoolbar-tool-heading-2' => 'Vlak 2',
@@ -282,14 +308,26 @@
'edittoolbar-tool-heading-5' => 'Vlak 5',
'edittoolbar-tool-heading-example' => 'Opskrifteks',
'edittoolbar-group-list' => 'Lys',
+ 'edittoolbar-tool-ulist' => 'Ongenommerde lys',
+ 'edittoolbar-tool-olist' => 'Genommerde lys',
'edittoolbar-group-size' => 'Grootte',
'edittoolbar-tool-big' => 'Groot',
+ 'edittoolbar-tool-big-example' => 'Groot gedrukte teks',
'edittoolbar-tool-small' => 'Klein',
+ 'edittoolbar-tool-small-example' => 'Klein gedrukte teks',
+ 'edittoolbar-group-insert' => 'Invoeg',
+ 'edittoolbar-tool-table' => 'Tabel',
+ 'edittoolbar-tool-table-dimensions' => 'Dimensies',
+ 'edittoolbar-tool-table-dimensions-rows' => 'Rye',
+ 'edittoolbar-tool-table-dimensions-columns' => 'Kolomme',
+ 'edittoolbar-tool-table-insert' => 'Invoeg',
'edittoolbar-tool-table-cancel' => 'Kanselleer',
- 'edittoolbar-tool-replace' => 'Vervang',
+ 'edittoolbar-tool-replace' => 'Soek en vervang',
+ 'edittoolbar-tool-replace-title' => 'Soek en vervang',
'edittoolbar-tool-replace-search' => 'Soek na:',
'edittoolbar-tool-replace-button' => 'Vervang',
- 'edittoolbar-tool-replace-close' => 'Sluit',
+ 'edittoolbar-tool-replace-close' => 'Kanselleer',
+ 'edittoolbar-tool-replace-success' => '$1 vervangings gemaak.',
'edittoolbar-section-characters' => 'Spesiale karakters',
'edittoolbar-characters-page-ipa' => 'IFA',
'edittoolbar-characters-page-symbols' => 'Simbole',
@@ -311,17 +349,27 @@
'edittoolbar-help-content-bold-description' => 'Vet',
'edittoolbar-help-content-bold-syntax' => "'''Vetgedrukte teks'''",
'edittoolbar-help-content-bold-result' => '<strong>Vetgedrukte teks</strong>',
+ 'edittoolbar-help-content-ilink-description' => 'Interne skakel',
+ 'edittoolbar-help-content-heading1-description' => 'Vlak 1 opskrif',
'edittoolbar-help-content-heading1-syntax' => '= Opskrifteks =',
'edittoolbar-help-content-heading1-result' => '<h1>Opskrifteks</h1>',
+ 'edittoolbar-help-content-heading2-description' => 'Vlak 2 opskrif',
'edittoolbar-help-content-heading2-syntax' => '== Opskrifteks ==',
'edittoolbar-help-content-heading2-result' => '<h2>Opskrifteks</h2>',
+ 'edittoolbar-help-content-heading3-description' => 'Vlak 3 opskrif',
'edittoolbar-help-content-heading3-syntax' => '=== Opskrifteks ===',
'edittoolbar-help-content-heading3-result' => '<h3>Opskrifteks</h3>',
+ 'edittoolbar-help-content-heading4-description' => 'Vlak 4 opskrif',
'edittoolbar-help-content-heading4-syntax' => '==== Opskrifteks ====',
'edittoolbar-help-content-heading4-result' => '<h4>Opskrifteks</h4>',
+ 'edittoolbar-help-content-heading5-description' => 'Vlak 5 opskrif',
'edittoolbar-help-content-heading5-syntax' => '===== Opskrifteks =====',
'edittoolbar-help-content-heading5-result' => '<h5>Opskrifteks</h5>',
+ 'edittoolbar-help-content-ulist-description' => 'Ongenommerde lys',
+ 'edittoolbar-help-content-olist-description' => 'Genommerde lys',
+ 'edittoolbar-help-content-file-description' => 'Ingebedde lêer',
'edittoolbar-help-content-reference-description' => 'Verwysing',
+ 'edittoolbar-help-content-signature-description' => 'Handtekening',
);
/** Arabic (العربية)
@@ -338,6 +386,10 @@
'edittoolbar-tool-bold-example' => 'نص عريض',
'edittoolbar-tool-italic' => 'مائل',
'edittoolbar-tool-italic-example' => 'نص مائل',
+ 'edittoolbar-tool-ilink' => 'وصلة داخلية',
+ 'edittoolbar-tool-ilink-example' => 'عنوان الوصلة',
+ 'edittoolbar-tool-xlink' => 'وصلة خارجية (تذكر البدء بhttp://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com عنوان الوصلة',
'edittoolbar-tool-link' => 'وصلة',
'edittoolbar-tool-link-title' => 'إدراج وصلة',
'edittoolbar-tool-link-int' => 'لصÙØØ© ويكي',
@@ -389,18 +441,16 @@
'edittoolbar-tool-table-dimensions' => 'الأبعاد',
'edittoolbar-tool-table-dimensions-rows' => 'الصÙÙˆÙ',
'edittoolbar-tool-table-dimensions-columns' => 'الأعمدة',
- 'edittoolbar-tool-table-dimensions-headerrows' => 'صÙو٠العناوين',
- 'edittoolbar-tool-table-dimensions-headercolumns' => 'عواميد العناوين',
'edittoolbar-tool-table-insert' => 'إدراج',
'edittoolbar-tool-table-cancel' => 'إلغاء',
- 'edittoolbar-tool-replace' => 'استبدال',
+ 'edittoolbar-tool-replace' => 'ابØØ« واستبدل',
'edittoolbar-tool-replace-title' => 'ابØØ« واستبدل',
'edittoolbar-tool-replace-search' => 'إبØØ« عن:',
'edittoolbar-tool-replace-replace' => 'استبدل ب:',
'edittoolbar-tool-replace-case' => 'مطابقة الØالة',
'edittoolbar-tool-replace-all' => 'استبدل كل المطابقات',
'edittoolbar-tool-replace-button' => 'استبدال',
- 'edittoolbar-tool-replace-close' => 'إغلاق',
+ 'edittoolbar-tool-replace-close' => 'إلغاء',
'edittoolbar-tool-replace-nomatch' => 'بØثك لم يطابق أي شيء.',
'edittoolbar-section-characters' => 'Ù…Øار٠خاصة',
'edittoolbar-characters-page-latin' => 'اللاتينية',
@@ -461,7 +511,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>عنصر قائمة</li><li>عنصر قائمة</li></ol>',
'edittoolbar-help-content-file-description' => 'مل٠مضمّن',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|تصغير|نص الشرØ]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='نص التعليق' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='تكبير' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>نص التعليق</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='نص التعليق' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='تكبير' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>نص التعليق</div></div>",
'edittoolbar-help-content-reference-description' => 'مرجع',
'edittoolbar-help-content-reference-syntax' => 'نص الصÙØØ©.<ref name="test">[http://www.example.org نص الوصلة]ØŒ نص إضاÙÙŠ.</ref>',
'edittoolbar-help-content-reference-result' => "نص الصÙØØ©.<sup><a href='#'>[1]</a></sup>",
@@ -486,6 +536,8 @@
'edittoolbar-tool-bold-example' => 'ÜŸÜ¬Ü’Ü¬Ü Ü¥Ü’ÜܬÜ',
'edittoolbar-tool-italic' => 'Ü¦Ü ÜܡܬÜ',
'edittoolbar-tool-italic-example' => 'ÜŸÜ¬Ü’Ü¬Ü Ü¦Ü ÜܡܬÜ',
+ 'edittoolbar-tool-ilink' => 'ÜÜ£Ü˜ÜªÜ Ü“Ü˜ÜÜ',
+ 'edittoolbar-tool-xlink' => 'ÜÜ£Ü˜ÜªÜ Ü’ÜªÜÜ (ܕܟܘܪ http:// Ü©Ü•Ü¡ÜܬÜ)',
'edittoolbar-tool-heading-1' => 'ܫܘÜÜ 1',
'edittoolbar-tool-heading-2' => 'ܫܘÜÜ 2',
'edittoolbar-tool-heading-3' => 'ܫܘÜÜ 3',
@@ -512,11 +564,16 @@
'edittoolbar' => 'ПанÑль інÑтрумÑнтаў Ð´Ð»Ñ Ñ€ÑдагаваньнÑ',
'edittoolbar-desc' => 'ПанÑль інÑтрумÑнтаў Ð´Ð»Ñ Ñ€ÑÐ´Ð°Ð³Ð°Ð²Ð°Ð½ÑŒÐ½Ñ Ð· палепшанай зручнаÑьцю',
'edittoolbar-preference' => 'Уключыць палепшаную панÑль інÑтрумÑнтаў Ð´Ð»Ñ Ñ€ÑдагаваньнÑ',
- 'edittoolbar-loading' => 'Загрузка...',
+ 'edittoolbar-cgd-preference' => 'Дазволіць дапамогу Ð´Ð»Ñ Ð´Ð°Ð´Ð°Ð½ÑŒÐ½Ñ Ñкладанага вікі-Ñ‚ÑкÑту',
+ 'edittoolbar-loading' => 'Загрузка…',
'edittoolbar-tool-bold' => 'ТлуÑÑ‚Ñ‹',
'edittoolbar-tool-bold-example' => 'ТлуÑÑ‚Ñ‹ Ñ‚ÑкÑÑ‚',
'edittoolbar-tool-italic' => 'КурÑÑ–Ñž',
'edittoolbar-tool-italic-example' => 'КурÑіўны Ñ‚ÑкÑÑ‚',
+ 'edittoolbar-tool-ilink' => 'Ð£Ð½ÑƒÑ‚Ñ€Ð°Ð½Ð°Ñ ÑпаÑылка',
+ 'edittoolbar-tool-ilink-example' => 'Ðазва ÑпаÑылкі',
+ 'edittoolbar-tool-xlink' => 'Ð’Ð¾Ð½ÐºÐ°Ð²Ð°Ñ ÑпаÑылка (не забывайцеÑÑ Ð¿Ð°Ñ‡Ñ‹Ð½Ð°Ñ†ÑŒ з http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com назва ÑпаÑылкі',
'edittoolbar-tool-link' => 'СпаÑылка',
'edittoolbar-tool-link-title' => 'УÑтавіць ÑпаÑылку',
'edittoolbar-tool-link-int' => 'Ðа вікі-Ñтаронку',
@@ -532,6 +589,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'ÐÑÑÐ»ÑƒÑˆÐ½Ð°Ñ Ð½Ð°Ð·Ð²Ð°',
'edittoolbar-tool-link-int-target-status-loading' => 'Ідзе праверка Ñ–ÑÐ½Ð°Ð²Ð°Ð½ÑŒÐ½Ñ Ñтаронкі…',
'edittoolbar-tool-link-int-invalid' => 'Ðазва, Ñкую Ð’Ñ‹ пазначылі, — нÑÑлушнаÑ.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Ð’Ñ‹ пазначылі нÑÑлушны URL-адраÑ.',
'edittoolbar-tool-file' => 'Укладзены файл',
'edittoolbar-tool-file-example' => 'Прыклад.jpg',
'edittoolbar-tool-reference' => 'ЗноÑка',
@@ -566,6 +624,18 @@
{{ns:file}}:Example.jpg|ПодпіÑ2',
'edittoolbar-tool-newline' => 'Ðовы радок',
'edittoolbar-tool-table' => 'Табліца',
+ 'edittoolbar-tool-table-example-old' => '-
+! загаловак 1
+! загаловак 2
+! загаловак 3
+|-
+| радок 1, ÑчÑйка 1
+| радок 1, ÑчÑйка 2
+| радок 1, ÑчÑйка 3
+|-
+| радок 2, ÑчÑйка 1
+| радок 2, ÑчÑйка 2
+| радок 2, ÑчÑйка 3',
'edittoolbar-tool-table-example' => 'Радок $1, ÑчÑйка $2',
'edittoolbar-tool-table-example-header' => 'Радок $1, ÑчÑйка $2 (назва)',
'edittoolbar-tool-table-title' => 'УÑтавіць табліцу',
@@ -575,7 +645,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Дадаць радок загалоўку',
'edittoolbar-tool-table-insert' => 'УÑтавіць',
'edittoolbar-tool-table-cancel' => 'ÐдмÑніць',
- 'edittoolbar-tool-replace' => 'ЗамÑніць',
+ 'edittoolbar-tool-replace' => 'ЗнайÑьці Ñ– замÑніць',
'edittoolbar-tool-replace-title' => 'Пошук і замена',
'edittoolbar-tool-replace-search' => 'Шукаць:',
'edittoolbar-tool-replace-replace' => 'ЗамÑніць на:',
@@ -583,8 +653,9 @@
'edittoolbar-tool-replace-regex' => 'Лічыць радок пошуку Ñ€ÑгулÑрным выразам',
'edittoolbar-tool-replace-all' => 'ЗамÑніць уÑе Ñупадзеньні',
'edittoolbar-tool-replace-button' => 'ЗамÑніць',
- 'edittoolbar-tool-replace-close' => 'Закрыць',
+ 'edittoolbar-tool-replace-close' => 'ÐдмÑніць',
'edittoolbar-tool-replace-nomatch' => 'Па Вашаму запыту нічога Ð½Ñ Ð·Ð½Ð¾Ð¹Ð´Ð·ÐµÐ½Ð°.',
+ 'edittoolbar-tool-replace-success' => 'КолькаÑьць зробленых заменаў: $1.',
'edittoolbar-section-characters' => 'СпÑцыÑÐ»ÑŒÐ½Ñ‹Ñ Ñымбалі',
'edittoolbar-characters-page-latin' => 'ЛацінÑкіÑ',
'edittoolbar-characters-page-latinextended' => 'ЛацінÑкі пашыраны',
@@ -644,7 +715,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>ÐлемÑнт ÑьпіÑу</li><li>ÐлемÑнт ÑьпіÑу</li></ol>',
'edittoolbar-help-content-file-description' => 'Укладзены файл',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|міні|ТÑкÑÑ‚ подпіÑу]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='ТÑкÑÑ‚ подпіÑу' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>ТÑкÑÑ‚ подпіÑу</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='ТÑкÑÑ‚ подпіÑу' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>ТÑкÑÑ‚ подпіÑу</div></div>",
'edittoolbar-help-content-reference-description' => 'ЗноÑка',
'edittoolbar-help-content-reference-syntax' => 'ТÑкÑÑ‚ Ñтаронкі.<ref name="test">[http://www.example.org ТÑкÑÑ‚ ÑпаÑылкі], дадатковы Ñ‚ÑкÑÑ‚.</ref>',
'edittoolbar-help-content-reference-result' => "ТÑкÑÑ‚ Ñтаронкі.<sup><a href='#'>[1]</a></sup>",
@@ -673,6 +744,8 @@
'edittoolbar-tool-bold-example' => 'ТекÑÑ‚ в получер',
'edittoolbar-tool-italic' => 'КурÑив',
'edittoolbar-tool-italic-example' => 'ТекÑÑ‚ в курÑив',
+ 'edittoolbar-tool-ilink' => 'Вътрешна препратка',
+ 'edittoolbar-tool-xlink' => 'Външна препратка (не забравÑйте http:// )',
'edittoolbar-tool-file-example' => 'Пример.jpg',
'edittoolbar-group-list' => 'СпиÑък',
'edittoolbar-tool-table' => 'Таблица',
@@ -702,6 +775,10 @@
'edittoolbar-tool-bold-example' => 'গাঢ় লেখা',
'edittoolbar-tool-italic' => 'ইটালিক',
'edittoolbar-tool-italic-example' => 'ইটালিক লেখা',
+ 'edittoolbar-tool-ilink' => 'আà¦à§à¦¯à¦¨à§à¦¤à¦°à§€à¦£ সংযোগ',
+ 'edittoolbar-tool-ilink-example' => 'সংযোগের শিরোনাম',
+ 'edittoolbar-tool-xlink' => 'বহিঃসংযোগ (মনে রাখবেন http:// উপসরà§à¦— থাকবে)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com সংযোগের শিরোনাম',
'edittoolbar-tool-link' => 'লিংক',
'edittoolbar-tool-link-title' => 'লিংক যোগ করà§à¦¨',
'edittoolbar-tool-link-int-target' => 'পাতার শিরোনাম:',
@@ -796,11 +873,16 @@
'edittoolbar' => 'Barrenn ostilhoù kemmañ',
'edittoolbar-desc' => "Barrenn ostilhoù kemmañ aesoc'h da implijout",
'edittoolbar-preference' => 'Gweredekaat ar varrenn ostilhoù kemmañ gwellaet',
+ 'edittoolbar-cgd-preference' => "Aotren ar skoazell evit ouzhpennañ tammoù skrid wiki kempleshoc'h",
'edittoolbar-loading' => 'O kargañ...',
'edittoolbar-tool-bold' => 'Tev',
'edittoolbar-tool-bold-example' => 'Testenn dev',
'edittoolbar-tool-italic' => 'Italek',
'edittoolbar-tool-italic-example' => 'Testenn italek',
+ 'edittoolbar-tool-ilink' => 'Liamm diabarzh',
+ 'edittoolbar-tool-ilink-example' => 'Anv al liamm',
+ 'edittoolbar-tool-xlink' => 'Liamm diavaez (arabat disoñjal ar rakger http:// )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com anv al liamm',
'edittoolbar-tool-link' => 'Liamm',
'edittoolbar-tool-link-title' => "Ensoc'hañ ul liamm",
'edittoolbar-tool-link-int' => 'war-du ur bajenn wiki',
@@ -816,6 +898,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Titl direizh',
'edittoolbar-tool-link-int-target-status-loading' => 'O wiriañ hag-eñ ez eus eus ar bajenn...',
'edittoolbar-tool-link-int-invalid' => "Kamm eo an titl hoc'h eus merket.",
+ 'edittoolbar-tool-link-ext-invalid' => "Direizh eo an URL merket ganeoc'h.",
'edittoolbar-tool-file' => 'Restr enframmet',
'edittoolbar-tool-file-example' => 'Skouer.jpg',
'edittoolbar-tool-reference' => 'Daveenn',
@@ -850,6 +933,18 @@
{{ns:file}}:Skouer.jpg|Deskrivadur2',
'edittoolbar-tool-newline' => 'Linenn nevez',
'edittoolbar-tool-table' => 'Taolenn',
+ 'edittoolbar-tool-table-example-old' => '-
+! talbenn 1
+! talbenn 2
+! talbenn 3
+|-
+| linenn 1, kellig 1
+| linenn 1, kellig 2
+| linenn 1, kellig 3
+|-
+| linenn 2, kellig 1
+| linenn 2, kellig 2
+| linenn 2, kellig 3',
'edittoolbar-tool-table-example' => 'Linenn $1, kellig $2',
'edittoolbar-tool-table-example-header' => 'Linenn $1, kellig $2 (talbenn)',
'edittoolbar-tool-table-title' => "Ensoc'hañ un daolenn",
@@ -859,7 +954,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Lakaat al linenn dalbenn e-barzh',
'edittoolbar-tool-table-insert' => "Ensoc'hañ",
'edittoolbar-tool-table-cancel' => 'Nullañ',
- 'edittoolbar-tool-replace' => "Erlec'hiañ",
+ 'edittoolbar-tool-replace' => "Klask hag erlec'hiañ",
'edittoolbar-tool-replace-title' => "Klask hag erlec'hiañ",
'edittoolbar-tool-replace-search' => 'Klask :',
'edittoolbar-tool-replace-replace' => "Erlec'hiañ gant :",
@@ -867,8 +962,9 @@
'edittoolbar-tool-replace-regex' => 'Sellet ouzh ar chadennad klask evel ouzh un droienn reoliek',
'edittoolbar-tool-replace-all' => "Erlec'hiañ an holl okurañsoù",
'edittoolbar-tool-replace-button' => "Erlec'hiañ",
- 'edittoolbar-tool-replace-close' => 'Serriñ',
+ 'edittoolbar-tool-replace-close' => 'Nullañ',
'edittoolbar-tool-replace-nomatch' => "N'eus bet kavet netra o klotañ gant ar pezh a glaskit.",
+ 'edittoolbar-tool-replace-success' => "$1 erlec'hiadenn graet",
'edittoolbar-section-characters' => 'Arouezennoù dibar',
'edittoolbar-characters-page-latin' => 'Latin',
'edittoolbar-characters-page-latinextended' => 'Latin astennet',
@@ -928,7 +1024,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Elfenn eus ar roll</li><li>Elfenn eus ar roll</li></ol>',
'edittoolbar-help-content-file-description' => 'Restr enframmet',
'edittoolbar-help-content-file-syntax' => "[[{{ns:file}}:Example.png|thumb|Alc'hwez ar skeudenn]]",
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Testenn an alc'hwez' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Brasaat' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Testenn an alc'hwez</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Testenn an alc'hwez' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Brasaat' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Testenn an alc'hwez</div></div>",
'edittoolbar-help-content-reference-description' => 'Daveenn',
'edittoolbar-help-content-reference-syntax' => 'Testenn ar bajenn.<ref name="test">[http://www.example.org testenn al liamm], testenn ouzhpenn.</ref>',
'edittoolbar-help-content-reference-result' => "Testenn ar bajenn.<sup><a href='#'>[1]</a></sup>",
@@ -953,11 +1049,16 @@
'edittoolbar' => 'Uređivanje alatne trake',
'edittoolbar-desc' => 'Alatna traka stranice za uređivanje sa poboljšanom upotrebljivošću',
'edittoolbar-preference' => 'Omogući naprednu traku za uređivanje',
+ 'edittoolbar-cgd-preference' => 'Omogući pomoć za dodavanje naprednog wiki teksta',
'edittoolbar-loading' => 'Punjenje...',
'edittoolbar-tool-bold' => 'Podebljano',
'edittoolbar-tool-bold-example' => 'Podebljan tekst',
'edittoolbar-tool-italic' => 'Ukošeno',
'edittoolbar-tool-italic-example' => 'Ukošeni tekst',
+ 'edittoolbar-tool-ilink' => 'Unutrašnji link',
+ 'edittoolbar-tool-ilink-example' => 'Naslov linka',
+ 'edittoolbar-tool-xlink' => 'Vanjski link (zapamtite prefiks http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com naslov linka',
'edittoolbar-tool-link' => 'Link',
'edittoolbar-tool-link-title' => 'Ubaci link',
'edittoolbar-tool-link-int' => 'Na wiki stranicu',
@@ -973,6 +1074,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Nevaljan naslov',
'edittoolbar-tool-link-int-target-status-loading' => 'Provjeravam postojanje stranice...',
'edittoolbar-tool-link-int-invalid' => 'Naslov koji ste unijeli je nevaljan.',
+ 'edittoolbar-tool-link-ext-invalid' => 'URL koji ste naveli je nevaljan',
'edittoolbar-tool-file' => 'Uklopljena datoteka',
'edittoolbar-tool-file-example' => 'Primjer.jpg',
'edittoolbar-tool-reference' => 'Reference',
@@ -1007,6 +1109,18 @@
{{ns:file}}:Example.jpg|Opis2',
'edittoolbar-tool-newline' => 'Nova linija',
'edittoolbar-tool-table' => 'Tabela',
+ 'edittoolbar-tool-table-example-old' => '-
+! naslov 1
+! naslov 2
+! naslov 3
+|-
+| red 1, ćelija 1
+| red 1, ćelija 2
+| red 1, ćelija 3
+|-
+| red 2, ćelija 1
+| red 2, ćelija 2
+| red 2, ćelija 3',
'edittoolbar-tool-table-example' => 'Red $1, ćelija $2',
'edittoolbar-tool-table-example-header' => 'Red $1, ćelija $2 (naslov)',
'edittoolbar-tool-table-title' => 'Ubaci tabelu',
@@ -1016,7 +1130,7 @@
'edittoolbar-tool-table-dimensions-header' => 'UkljuÄi red zaglavlja',
'edittoolbar-tool-table-insert' => 'Ubaci',
'edittoolbar-tool-table-cancel' => 'Odustani',
- 'edittoolbar-tool-replace' => 'Zamijeni',
+ 'edittoolbar-tool-replace' => 'Pronađi i zamijeni',
'edittoolbar-tool-replace-title' => 'Nađi i zamijeni',
'edittoolbar-tool-replace-search' => 'Pretraži:',
'edittoolbar-tool-replace-replace' => 'Zamijeni sa:',
@@ -1024,8 +1138,9 @@
'edittoolbar-tool-replace-regex' => 'Smatraj traženi pojam kao regularni izraz',
'edittoolbar-tool-replace-all' => 'Zamijeni sve pronađeno',
'edittoolbar-tool-replace-button' => 'Zamijeni',
- 'edittoolbar-tool-replace-close' => 'Zatvori',
+ 'edittoolbar-tool-replace-close' => 'Odustani',
'edittoolbar-tool-replace-nomatch' => 'Vaša pretraga nije dala nijedan rezultat.',
+ 'edittoolbar-tool-replace-success' => 'NaÄinjeno $1 izmjena.',
'edittoolbar-section-characters' => 'Posebni znakovi',
'edittoolbar-characters-page-latin' => 'Latinica',
'edittoolbar-characters-page-latinextended' => 'Prošireni latinski',
@@ -1085,7 +1200,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Stavka spiska</li><li>Stavka spiska</li></ol>',
'edittoolbar-help-content-file-description' => 'Uklopljena datoteka',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Opis slike]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Opis slike' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Uvećajte' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Opis slike</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Opis slike' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Uvećajte' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Opis slike</div></div>",
'edittoolbar-help-content-reference-description' => 'Reference',
'edittoolbar-help-content-reference-syntax' => 'Tekst stranice.<ref name="test">[http://www.example.org Tekst linka], dodatni tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Tekst stranice.<sup><a href='#'>[1]</a></sup>",
@@ -1103,8 +1218,10 @@
);
/** Catalan (Català )
+ * @author Oç
* @author Paucabot
* @author SMP
+ * @author Vriullop
*/
$messages['ca'] = array(
'edittoolbar' => "Editant la barra d'eines",
@@ -1115,6 +1232,10 @@
'edittoolbar-tool-bold-example' => 'Text en negreta',
'edittoolbar-tool-italic' => 'Cursiva',
'edittoolbar-tool-italic-example' => 'Text en cursiva',
+ 'edittoolbar-tool-ilink' => 'Enllaç intern',
+ 'edittoolbar-tool-ilink-example' => "TÃtol de l'enllaç",
+ 'edittoolbar-tool-xlink' => 'Enllaç extern (recordeu el prefix http://)',
+ 'edittoolbar-tool-xlink-example' => "http://www.example.org tÃtol de l'enllaç",
'edittoolbar-tool-link' => 'Enllaç',
'edittoolbar-tool-link-title' => 'Insereix un enllaç',
'edittoolbar-tool-link-int' => 'A una pà gina del wiki',
@@ -1164,14 +1285,13 @@
{{ns:file}}:Example.jpg|Peu2',
'edittoolbar-tool-newline' => 'Nova lÃnia',
'edittoolbar-tool-table' => 'Taula',
+ 'edittoolbar-tool-table-example' => 'Fila $1, cel·la $2',
'edittoolbar-tool-table-title' => 'Insereix taula',
'edittoolbar-tool-table-dimensions-rows' => 'Files',
'edittoolbar-tool-table-dimensions-columns' => 'Columnes',
- 'edittoolbar-tool-table-dimensions-headerrows' => "Files d'encapçalament",
- 'edittoolbar-tool-table-dimensions-headercolumns' => "Columnes d'encapçalament",
'edittoolbar-tool-table-insert' => 'Insereix',
'edittoolbar-tool-table-cancel' => 'Canceŀla',
- 'edittoolbar-tool-replace' => 'Reemplaça',
+ 'edittoolbar-tool-replace' => 'Cerca i reemplaça',
'edittoolbar-tool-replace-title' => 'Cerca i reemplaça',
'edittoolbar-tool-replace-search' => 'Cerca:',
'edittoolbar-tool-replace-replace' => 'Reemplaça per:',
@@ -1179,7 +1299,7 @@
'edittoolbar-tool-replace-regex' => 'Tracta la cadena de cerca com una expressió regular',
'edittoolbar-tool-replace-all' => 'Reemplaça totes les coincidències',
'edittoolbar-tool-replace-button' => 'Reemplaça',
- 'edittoolbar-tool-replace-close' => 'Tanca',
+ 'edittoolbar-tool-replace-close' => 'Anul·la',
'edittoolbar-tool-replace-nomatch' => 'La vostra cerca no ha trobat cap coincidència.',
'edittoolbar-section-characters' => 'Carà cters especials',
'edittoolbar-characters-page-latin' => 'LlatÃ',
@@ -1239,7 +1359,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Element de la llista</li><li>Element de la llista</li></ol>',
'edittoolbar-help-content-file-description' => 'Fitxer incrustat',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Exemple.png|thumb|Text descriptiu de la imatge]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Llegenda</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Llegenda</div></div>",
'edittoolbar-help-content-reference-description' => 'Referències',
'edittoolbar-help-content-reference-syntax' => 'Text de la pà gina.<ref name="test">[http://www.exemple.cat Nom de l\'enllaç], text addicional.</ref>',
'edittoolbar-help-content-reference-result' => "Text de la pà gina.<sup><a href='#'>[1]</a></sup>",
@@ -1268,6 +1388,8 @@
'edittoolbar-tool-bold-example' => 'دەقی تۆخ',
'edittoolbar-tool-italic' => 'لار',
'edittoolbar-tool-italic-example' => 'دەقی لار',
+ 'edittoolbar-tool-ilink' => 'بەستەری ناوەکی',
+ 'edittoolbar-tool-ilink-example' => 'سەردێڕی بەستەر',
'edittoolbar-tool-reference' => 'سەرچاوە',
'edittoolbar-section-advanced' => 'پەرەسەندوو',
'edittoolbar-tool-heading' => 'سەردێڕ',
@@ -1354,11 +1476,16 @@
'edittoolbar' => 'EditaÄnà panel nástrojů',
'edittoolbar-desc' => 'EditaÄnà panel nástrojů s vylepÅ¡enou použitelnostÃ',
'edittoolbar-preference' => 'Zapnout vylepšený panel nástrojů',
+ 'edittoolbar-cgd-preference' => 'Zobrazovat pomocnÃky pro pÅ™idávánà pokroÄilejÅ¡Ã wikisyntaxe',
'edittoolbar-loading' => 'NaÄÃtá se…',
'edittoolbar-tool-bold' => 'TuÄnÄ›',
'edittoolbar-tool-bold-example' => 'TuÄný text',
'edittoolbar-tool-italic' => 'KurzÃva',
'edittoolbar-tool-italic-example' => 'Text kurzÃvou',
+ 'edittoolbar-tool-ilink' => 'Vnitřnà odkaz',
+ 'edittoolbar-tool-ilink-example' => 'Název odkazu',
+ 'edittoolbar-tool-xlink' => 'Externà odkaz (nezapomeňte na předponu http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com Titulek odkazu',
'edittoolbar-tool-link' => 'Odkaz',
'edittoolbar-tool-link-title' => 'Vložit odkaz',
'edittoolbar-tool-link-int' => 'Na wiki stránku',
@@ -1374,6 +1501,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Neplatný název',
'edittoolbar-tool-link-int-target-status-loading' => 'Zjišťovánà existence stránky…',
'edittoolbar-tool-link-int-invalid' => 'Vámi zadaný název je neplatný.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Uvedené URL je neplatné.',
'edittoolbar-tool-file' => 'Vložený soubor',
'edittoolbar-tool-file-example' => 'PÅ™Ãklad.jpg',
'edittoolbar-tool-reference' => 'Poznámky',
@@ -1408,6 +1536,18 @@
{{ns:file}}:PÅ™Ãklad.jpg|Titulek 2',
'edittoolbar-tool-newline' => 'Nový řádek',
'edittoolbar-tool-table' => 'Tabulka',
+ 'edittoolbar-tool-table-example-old' => '-
+! hlaviÄka 1
+! hlaviÄka 2
+! hlaviÄka 3
+|-
+| řádek 1, buňka 1
+| řádek 1, buňka 2
+| řádek 1, buňka 3
+|-
+| řádek 2, buňka 1
+| řádek 2, buňka 2
+| řádek 2, buňka 3',
'edittoolbar-tool-table-example' => 'Řádek $1, buňka $2',
'edittoolbar-tool-table-example-header' => 'Řádek $1, buňka $2 (záhlavÃ)',
'edittoolbar-tool-table-title' => 'Vloženà tabulky',
@@ -1417,7 +1557,7 @@
'edittoolbar-tool-table-dimensions-header' => 'PÅ™idat řádek s hlaviÄkou',
'edittoolbar-tool-table-insert' => 'Vložit',
'edittoolbar-tool-table-cancel' => 'Storno',
- 'edittoolbar-tool-replace' => 'Nahradit',
+ 'edittoolbar-tool-replace' => 'NajÃt a nahradit',
'edittoolbar-tool-replace-title' => 'NajÃt a nahradit',
'edittoolbar-tool-replace-search' => 'NajÃt:',
'edittoolbar-tool-replace-replace' => 'Nahradit za:',
@@ -1425,8 +1565,9 @@
'edittoolbar-tool-replace-regex' => 'Hledat pomocà regulárnÃho výrazu',
'edittoolbar-tool-replace-all' => 'Nahradit všechny výskyty',
'edittoolbar-tool-replace-button' => 'Nahradit',
- 'edittoolbar-tool-replace-close' => 'ZavÅ™Ãt',
+ 'edittoolbar-tool-replace-close' => 'Storno',
'edittoolbar-tool-replace-nomatch' => 'Zadanému hledánà nic neodpovÃdá.',
+ 'edittoolbar-tool-replace-success' => 'Nahrazeno $1krát.',
'edittoolbar-section-characters' => 'Zvláštnà znaky',
'edittoolbar-characters-page-latin' => 'Latinka',
'edittoolbar-characters-page-latinextended' => 'RozÅ¡ÃÅ™enà latinky',
@@ -1486,7 +1627,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Položka seznamu</li><li>Položka seznamu</li></ol>',
'edittoolbar-help-content-file-description' => 'Vloženà souboru',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:PÅ™Ãklad.png|thumb|Text titulku]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Text titulku' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Zvětšit' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Text titulku</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Text titulku' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Zvětšit' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Text titulku</div></div>",
'edittoolbar-help-content-reference-description' => 'Poznámka',
'edittoolbar-help-content-reference-syntax' => 'Text stránky.<ref name="test">[http://www.example.org Text odkazu], dalšà text.</ref>',
'edittoolbar-help-content-reference-result' => "Text stránky.<sup><a href='#'>[1]</a></sup>",
@@ -1503,6 +1644,175 @@
'edittoolbar-help-content-indent-result' => 'Základnà text<dl><dd>Odsazený text<dl><dd>Odsazený text</dd></dl></dd></dl>',
);
+/** Welsh (Cymraeg)
+ * @author Lloffiwr
+ */
+$messages['cy'] = array(
+ 'edittoolbar' => 'Bar offer golygu',
+ 'edittoolbar-preference' => "Defnyddio'r bar offer golygu estynedig",
+ 'edittoolbar-loading' => "Wrthi'n llwytho...",
+ 'edittoolbar-tool-bold' => 'Praff',
+ 'edittoolbar-tool-bold-example' => 'Testun praff',
+ 'edittoolbar-tool-italic' => 'Italig',
+ 'edittoolbar-tool-italic-example' => 'Testun italig',
+ 'edittoolbar-tool-ilink' => 'Cyswllt mewnol',
+ 'edittoolbar-tool-ilink-example' => 'Teitl y cyswllt',
+ 'edittoolbar-tool-xlink' => 'Cyswllt allanol (cofiwch rhagddodi http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com teitl y cyswllt',
+ 'edittoolbar-tool-link' => 'Cyswllt',
+ 'edittoolbar-tool-link-title' => 'Mewnosod cyswllt',
+ 'edittoolbar-tool-link-int' => 'At dudalen wici',
+ 'edittoolbar-tool-link-int-target' => 'Teitl y dudalen:',
+ 'edittoolbar-tool-link-int-text' => 'Testun y cyswllt:',
+ 'edittoolbar-tool-link-ext' => 'At dudalen we allanol',
+ 'edittoolbar-tool-link-ext-target' => 'URL y cyswllt:',
+ 'edittoolbar-tool-link-ext-text' => 'Ysgrifen y cyswllt:',
+ 'edittoolbar-tool-link-insert' => 'Mewnosod cyswllt',
+ 'edittoolbar-tool-link-cancel' => 'Diddymu',
+ 'edittoolbar-tool-link-int-target-status-exists' => 'Y dudalen ar gael',
+ 'edittoolbar-tool-link-int-target-status-notexists' => "Nid yw'r dudalen ar gael",
+ 'edittoolbar-tool-link-int-target-status-invalid' => 'Teitl annilys',
+ 'edittoolbar-tool-link-int-target-status-loading' => "Wrthi'n gwirio a yw'r dudalen ar gael...",
+ 'edittoolbar-tool-link-int-invalid' => 'Ysgrifennwyd teitl annilys.',
+ 'edittoolbar-tool-link-ext-invalid' => "Nid yw'r URL a nodwyd yn ddilys.",
+ 'edittoolbar-tool-file' => 'Ffeil mewnosodol',
+ 'edittoolbar-tool-file-example' => 'Enghraifft.jpg',
+ 'edittoolbar-tool-reference' => 'Troednodyn',
+ 'edittoolbar-tool-reference-example' => 'Ysgrifennwch droednodyn fan hyn',
+ 'edittoolbar-tool-signature' => 'Llofnod a stamp amser',
+ 'edittoolbar-section-advanced' => 'Uwch',
+ 'edittoolbar-tool-heading' => 'Pennawd',
+ 'edittoolbar-tool-heading-1' => 'Lefel 1',
+ 'edittoolbar-tool-heading-2' => 'Lefel 2',
+ 'edittoolbar-tool-heading-3' => 'Lefel 3',
+ 'edittoolbar-tool-heading-4' => 'Lefel 4',
+ 'edittoolbar-tool-heading-5' => 'Lefel 5',
+ 'edittoolbar-tool-heading-example' => 'Ysgrifennwch y pennawd fan hyn',
+ 'edittoolbar-group-list' => 'Rhestr',
+ 'edittoolbar-tool-ulist' => 'Rhestr gyda bwledi',
+ 'edittoolbar-tool-ulist-example' => 'Eitem ar restr gyda bwledi',
+ 'edittoolbar-tool-olist' => "Rhestr wedi'i rhifo",
+ 'edittoolbar-tool-olist-example' => "Eitem ar restr wedi'i rhifo",
+ 'edittoolbar-group-size' => 'Maint',
+ 'edittoolbar-tool-big' => 'Mawr',
+ 'edittoolbar-tool-big-example' => 'Llythrennau mawr',
+ 'edittoolbar-tool-small' => 'Bach',
+ 'edittoolbar-tool-small-example' => 'Ysgrifen bach',
+ 'edittoolbar-group-baseline' => 'Gwaelodlin',
+ 'edittoolbar-tool-superscript' => 'Uwchysgrif',
+ 'edittoolbar-tool-superscript-example' => 'Ysgrifennwch uwchysgrif fan hyn',
+ 'edittoolbar-tool-subscript' => 'Isysgrif',
+ 'edittoolbar-tool-subscript-example' => 'Ysgrifennwch isysgrif fan hyn',
+ 'edittoolbar-group-insert' => 'Mewnosod',
+ 'edittoolbar-tool-gallery' => 'Galeri lluniau',
+ 'edittoolbar-tool-gallery-example' => '{{ns:file}}:Enghraifft.jpg|Disgrifiad1
+{{ns:file}}:Enghraifft.jpg|Disgrifiad2',
+ 'edittoolbar-tool-newline' => 'Llinell newydd',
+ 'edittoolbar-tool-table' => 'Tabl',
+ 'edittoolbar-tool-table-example-old' => '-
+! pennawd 1
+! pennawd 2
+! pennawd 3
+|-
+| rhes 1, cell 1
+| rhes 1, cell 2
+| rhes 1, cell 3
+|-
+| rhes 2, cell 1
+| rhes 2, cell 2
+| rhes 2, cell 3',
+ 'edittoolbar-tool-table-example' => 'Rhes $1, cell $2',
+ 'edittoolbar-tool-table-example-header' => 'Rhes $1, cell $2 (pennawd)',
+ 'edittoolbar-tool-table-title' => 'Mewnosod tabl',
+ 'edittoolbar-tool-table-dimensions' => 'Hyd a lled',
+ 'edittoolbar-tool-table-dimensions-rows' => 'Rhesi',
+ 'edittoolbar-tool-table-dimensions-columns' => 'Colofnau',
+ 'edittoolbar-tool-table-dimensions-header' => 'Cynhwysir rhes y penawdau',
+ 'edittoolbar-tool-table-insert' => 'Mewnosod',
+ 'edittoolbar-tool-table-cancel' => 'Diddymu',
+ 'edittoolbar-tool-replace' => 'Canfod a disodli',
+ 'edittoolbar-tool-replace-title' => 'Canfod a disodli',
+ 'edittoolbar-tool-replace-search' => 'Chwilier am:',
+ 'edittoolbar-tool-replace-replace' => 'Gosoder yn ei le:',
+ 'edittoolbar-tool-replace-case' => 'Trin llythrennau mawr a bach fel llythrennau gwahanol',
+ 'edittoolbar-tool-replace-all' => 'Disodler y cyfan',
+ 'edittoolbar-tool-replace-button' => 'Disodler',
+ 'edittoolbar-tool-replace-close' => 'Diddymu',
+ 'edittoolbar-tool-replace-nomatch' => 'Ni chanfyddwyd yr hyn a chwiliwyd amdano.',
+ 'edittoolbar-tool-replace-success' => 'Gwnaethpwyd $1 amnewidiad.',
+ 'edittoolbar-section-characters' => 'Nodau arbennig',
+ 'edittoolbar-characters-page-latin' => 'Lladin',
+ 'edittoolbar-characters-page-latinextended' => 'Lladin estynedig',
+ 'edittoolbar-characters-page-ipa' => 'Yr wyddor phonetig rhyngwladol (IPA)',
+ 'edittoolbar-characters-page-symbols' => 'Symbolau',
+ 'edittoolbar-characters-page-greek' => 'Groeg',
+ 'edittoolbar-characters-page-cyrillic' => 'Cyrilig',
+ 'edittoolbar-characters-page-arabic' => 'Arabeg',
+ 'edittoolbar-characters-page-hebrew' => 'Hebraeg',
+ 'edittoolbar-characters-page-telugu' => 'Telugu',
+ 'edittoolbar-section-help' => 'Cymorth',
+ 'edittoolbar-help-heading-description' => 'Disgrifiad',
+ 'edittoolbar-help-heading-syntax' => 'Pan deipiwch hyn',
+ 'edittoolbar-help-heading-result' => 'fe gewch',
+ 'edittoolbar-help-page-format' => 'Fformatio',
+ 'edittoolbar-help-page-link' => 'Cysylltau',
+ 'edittoolbar-help-page-heading' => 'Penawdau',
+ 'edittoolbar-help-page-list' => 'Rhestri',
+ 'edittoolbar-help-page-file' => 'Ffeiliau',
+ 'edittoolbar-help-page-reference' => 'Troednodion',
+ 'edittoolbar-help-page-discussion' => 'Sgwrs',
+ 'edittoolbar-help-content-italic-description' => 'Italig',
+ 'edittoolbar-help-content-italic-syntax' => "''Ysgrifen italig''",
+ 'edittoolbar-help-content-italic-result' => '<em>Ysgrifen italig</em>',
+ 'edittoolbar-help-content-bold-description' => 'Praff',
+ 'edittoolbar-help-content-bold-syntax' => "'''Testun praff'''",
+ 'edittoolbar-help-content-bold-result' => '<strong>Testun praff</strong>',
+ 'edittoolbar-help-content-bolditalic-description' => 'Praff & italig',
+ 'edittoolbar-help-content-bolditalic-syntax' => "'''''Ysgrifen praff & italig'''''",
+ 'edittoolbar-help-content-bolditalic-result' => '<strong><em>Ysgrifen praff & italig</em></strong>',
+ 'edittoolbar-help-content-ilink-description' => 'Cyswllt mewnol',
+ 'edittoolbar-help-content-ilink-syntax' => '[[Page title|Label y cyswllt]]<br />[[Teitl y dudalen]]',
+ 'edittoolbar-help-content-ilink-result' => "<a href='#'>Label y cyswllt</a><br /><a href='#'>Teitl y dudalen</a>",
+ 'edittoolbar-help-content-xlink-description' => 'Cyswllt allanol',
+ 'edittoolbar-help-content-xlink-syntax' => '[http://www.enghraifft.org Label y cyswllt]<br />[http://www.enghraifft.org]<br />http://www.enghraifft.org',
+ 'edittoolbar-help-content-heading1-description' => 'pennawd ar lefel 1',
+ 'edittoolbar-help-content-heading1-syntax' => '= Y pennawd =',
+ 'edittoolbar-help-content-heading1-result' => '<h1>Y pennawd</h1>',
+ 'edittoolbar-help-content-heading2-description' => 'pennawd ar lefel 2',
+ 'edittoolbar-help-content-heading2-syntax' => '== Y pennawd ==',
+ 'edittoolbar-help-content-heading2-result' => '<h2>Y pennawd</h2>',
+ 'edittoolbar-help-content-heading3-description' => 'pennawd ar lefel 3',
+ 'edittoolbar-help-content-heading3-syntax' => '=== Y pennawd ===',
+ 'edittoolbar-help-content-heading3-result' => '<h3>Y pennawd</h3>',
+ 'edittoolbar-help-content-heading4-description' => 'pennawd ar lefel 4',
+ 'edittoolbar-help-content-heading4-syntax' => '==== Y pennawd ====',
+ 'edittoolbar-help-content-heading4-result' => '<h4>Y pennawd</h4>',
+ 'edittoolbar-help-content-heading5-description' => 'pennawd ar lefel 5',
+ 'edittoolbar-help-content-heading5-syntax' => '===== Y pennawd =====',
+ 'edittoolbar-help-content-heading5-result' => '<h5>Y pennawd</h5>',
+ 'edittoolbar-help-content-ulist-description' => 'Rhestr gyda bwledi',
+ 'edittoolbar-help-content-ulist-syntax' => '* Eitem ar y rhestr<br />* Eitem ar y rhestr',
+ 'edittoolbar-help-content-ulist-result' => '<ul><li>Eitem ar y rhestr</li><li>Eitem ar y rhestr</li></ul>',
+ 'edittoolbar-help-content-olist-description' => "Rhestr wedi'i rhifo",
+ 'edittoolbar-help-content-olist-syntax' => '# Eitem ar y rhestr<br /># Eitem ar y rhestr',
+ 'edittoolbar-help-content-olist-result' => '<ol><li>Eitem ar y rhestr</li><li>Eitem ar y rhestr</li></ol>',
+ 'edittoolbar-help-content-file-description' => 'Ffeil mewnosodol',
+ 'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Enghraifft.png|mân-lun|Disgrifiad]]',
+ 'edittoolbar-help-content-reference-description' => 'Troednodyn',
+ 'edittoolbar-help-content-reference-syntax' => 'Testun y dudalen.<ref name="test">[http://www.enghraifft.org ysgrifen y cyswllt], ysgrifen ychwanegol.</ref>',
+ 'edittoolbar-help-content-reference-result' => 'Testun y dudalen.',
+ 'edittoolbar-help-content-rereference-description' => 'Ail-ddefnyddio troednodyn',
+ 'edittoolbar-help-content-rereference-result' => "Testun y dudalen.<sup><a href='#'>[1]</a></sup>",
+ 'edittoolbar-help-content-showreferences-description' => 'Dangos y troednodion',
+ 'edittoolbar-help-content-signaturetimestamp-description' => 'Llofnod gyda stamp amser',
+ 'edittoolbar-help-content-signaturetimestamp-result' => "<a href='#' title='{{#special:mypage}}'>Enw defnyddiwr</a> (<a href='#' title='{{#special:mytalk}}'>sgwrs</a>) 15:54, 10 Mehefin 2009 (UTC)",
+ 'edittoolbar-help-content-signature-description' => 'Llofnod',
+ 'edittoolbar-help-content-signature-result' => "<a href='#' title='{{#special:mypage}}'>Enw defnyddiwr</a> (<a href='#' title='{{#special:mytalk}}'>sgwrs</a>)",
+ 'edittoolbar-help-content-indent-description' => 'Mewnoli',
+ 'edittoolbar-help-content-indent-syntax' => "Ysgrifen rheolaidd<br />:Ysgrifen wedi'i mewnoli<br />::Ysgrifen wedi'i mewnoli",
+ 'edittoolbar-help-content-indent-result' => "Ysgrifen rheolaidd<dl><dd>Ysgrifen wedi'i mewnoli<dl><dd>Ysgrifen wedi'i mewnoli</dd></dl></dd></dl>",
+);
+
/** Danish (Dansk)
* @author Byrial
* @author Leolaursen
@@ -1516,6 +1826,10 @@
'edittoolbar-tool-bold-example' => 'Fed tekst',
'edittoolbar-tool-italic' => 'Kursiv',
'edittoolbar-tool-italic-example' => 'Kursiv tekst',
+ 'edittoolbar-tool-ilink' => 'Intern henvisning',
+ 'edittoolbar-tool-ilink-example' => 'Henvisningstekst',
+ 'edittoolbar-tool-xlink' => 'Ekstern henvisning (husk http:// først)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com henvisningstekst',
'edittoolbar-tool-link' => 'Henvisning',
'edittoolbar-tool-link-title' => 'Indsæt henvisning',
'edittoolbar-tool-link-int' => 'Til en wikiartikel/-side',
@@ -1531,6 +1845,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Ugyldig titel',
'edittoolbar-tool-link-int-target-status-loading' => 'Kontrollerer om siden findes ...',
'edittoolbar-tool-link-int-invalid' => 'Titlen du gav, er ugyldig.',
+ 'edittoolbar-tool-link-ext-invalid' => "URL'en som du angav, er ugyldig.",
'edittoolbar-tool-file' => 'Indlejret fil',
'edittoolbar-tool-file-example' => 'Eksempel.jpg',
'edittoolbar-tool-reference' => 'Fodnote',
@@ -1571,11 +1886,9 @@
'edittoolbar-tool-table-dimensions' => 'Dimensioner',
'edittoolbar-tool-table-dimensions-rows' => 'Rækker',
'edittoolbar-tool-table-dimensions-columns' => 'Kolonner',
- 'edittoolbar-tool-table-dimensions-headerrows' => 'Overskriftsrækker',
- 'edittoolbar-tool-table-dimensions-headercolumns' => 'Overskriftskolonner',
'edittoolbar-tool-table-insert' => 'Indsæt',
'edittoolbar-tool-table-cancel' => 'Annullér',
- 'edittoolbar-tool-replace' => 'Erstat',
+ 'edittoolbar-tool-replace' => 'Søg og erstat',
'edittoolbar-tool-replace-title' => 'Søg og erstat',
'edittoolbar-tool-replace-search' => 'Søg efter:',
'edittoolbar-tool-replace-replace' => 'Erstat med:',
@@ -1583,7 +1896,7 @@
'edittoolbar-tool-replace-regex' => 'Behandl søgestrengen som et regulært udtryk',
'edittoolbar-tool-replace-all' => 'Erstat alle forekomster',
'edittoolbar-tool-replace-button' => 'Erstat',
- 'edittoolbar-tool-replace-close' => 'Luk',
+ 'edittoolbar-tool-replace-close' => 'Annullér',
'edittoolbar-tool-replace-nomatch' => 'Din søgning gav ingen resultater',
'edittoolbar-section-characters' => 'Specialtegn',
'edittoolbar-characters-page-latin' => 'Latin',
@@ -1644,7 +1957,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Listeelement</li><li>Listeelement</li></ol>',
'edittoolbar-help-content-file-description' => 'Indlejret fil',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Billedtekst]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Billedtekst' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Forstør' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Billedtekst</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Billedtekst' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Forstør' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Billedtekst</div></div>",
'edittoolbar-help-content-reference-description' => 'Fodnote',
'edittoolbar-help-content-reference-syntax' => 'Sidetekst.<ref name="test">[http://www.example.org Henvisningstekst], yderligere tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Sidetekst.<sup><a href='#'>[1]</a></sup>",
@@ -1676,11 +1989,16 @@
'edittoolbar' => 'Bearbeiten-Werkzeugleiste',
'edittoolbar-desc' => 'Bearbeiten-Werkzeugleiste mit erweiterter Benutzerfreundlichkeit',
'edittoolbar-preference' => 'Erweiterte Bearbeiten-Werkzeugleiste aktivieren',
+ 'edittoolbar-cgd-preference' => 'Hilfe für erweiterte Wikisyntax aktivieren',
'edittoolbar-loading' => 'Laden …',
'edittoolbar-tool-bold' => 'Fett',
'edittoolbar-tool-bold-example' => 'Fetter Text',
'edittoolbar-tool-italic' => 'Kursiv',
'edittoolbar-tool-italic-example' => 'Kursiver Text',
+ 'edittoolbar-tool-ilink' => 'Interner Link',
+ 'edittoolbar-tool-ilink-example' => 'Linktitel',
+ 'edittoolbar-tool-xlink' => 'Externer Link (http:// beachten)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com Link-Text',
'edittoolbar-tool-link' => 'Link',
'edittoolbar-tool-link-title' => 'Link einfügen',
'edittoolbar-tool-link-int' => 'Zu einer Wiki-Seite',
@@ -1696,6 +2014,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Ungültiger Titel',
'edittoolbar-tool-link-int-target-status-loading' => 'Prüfe, ob Seite existiert …',
'edittoolbar-tool-link-int-invalid' => 'Der von dir angegebene Seitenname ist ungültig.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Die angegebene URL ist ungültig.',
'edittoolbar-tool-file' => 'Eingebettete Datei',
'edittoolbar-tool-file-example' => 'Beispiel.jpg',
'edittoolbar-tool-reference' => 'Quellennachweis',
@@ -1730,6 +2049,18 @@
{{ns:file}}:Beispiel.jpg|Beschreibung2',
'edittoolbar-tool-newline' => 'Neue Zeile',
'edittoolbar-tool-table' => 'Tabelle',
+ 'edittoolbar-tool-table-example-old' => '-
+! Ãœberschrift 1
+! Ãœberschrift 2
+! Ãœberschrift 3
+|-
+| Zeile 1, Zelle 1
+| Zeile 1, Zelle 2
+| Zeile 1, Zelle 3
+|-
+| Zeile 2, Zelle 1
+| Zeile 2, Zelle 2
+| Zeile 2, Zelle 3',
'edittoolbar-tool-table-example' => 'Zeile $1, Zelle $2',
'edittoolbar-tool-table-example-header' => 'Zeile $1, Zelle $2 (Ãœberschrift)',
'edittoolbar-tool-table-title' => 'Tabelle einfügen',
@@ -1739,7 +2070,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Kopfzeile einschließen',
'edittoolbar-tool-table-insert' => 'Einfügen',
'edittoolbar-tool-table-cancel' => 'Abbrechen',
- 'edittoolbar-tool-replace' => 'Ersetzen',
+ 'edittoolbar-tool-replace' => 'Suchen und Ersetzen',
'edittoolbar-tool-replace-title' => 'Suchen und Ersetzen',
'edittoolbar-tool-replace-search' => 'Suche nach:',
'edittoolbar-tool-replace-replace' => 'Ersetze durch:',
@@ -1747,8 +2078,9 @@
'edittoolbar-tool-replace-regex' => 'Suchzeichenkette als regulären Ausdruck behandeln',
'edittoolbar-tool-replace-all' => 'Ersetze alle Vorkommen',
'edittoolbar-tool-replace-button' => 'Ersetzen',
- 'edittoolbar-tool-replace-close' => 'Schließen',
+ 'edittoolbar-tool-replace-close' => 'Abbrechen',
'edittoolbar-tool-replace-nomatch' => 'Deine Suche hat keine Ergebnisse erzielt.',
+ 'edittoolbar-tool-replace-success' => '$1 Ersetzung(en) durchgeführt.',
'edittoolbar-section-characters' => 'Sonderzeichen',
'edittoolbar-characters-page-latin' => 'Lateinisch',
'edittoolbar-characters-page-latinextended' => 'Lateinisch, erweitert',
@@ -1808,7 +2140,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Listeneintrag</li><li>Listeneintrag</li></ol>',
'edittoolbar-help-content-file-description' => 'Eingebettete Datei',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Beispiel.png|thumb|Beschreibung]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Beschreibung' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Vergrößern' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Beschreibung</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Beschreibung' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Vergrößern' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Beschreibung</div></div>",
'edittoolbar-help-content-reference-description' => 'Quellennachweis',
'edittoolbar-help-content-reference-syntax' => 'Seitentext.<ref name="test">[http://www.beispiel.org Linktext], zusätzlicher Text.</ref>',
'edittoolbar-help-content-reference-result' => "Seitentext.<sup><a href='#'>[1]</a></sup>",
@@ -1841,11 +2173,16 @@
'edittoolbar' => 'Wobźěłowańska rědowa kšoma',
'edittoolbar-desc' => 'Rědowa kšoma za wobźěłowanje bokow z pólěpšoneju wužywajobnosću',
'edittoolbar-preference' => 'Pólěpšonu wobźěłowańsku rědowu kšomu aktiwěrowaś',
+ 'edittoolbar-cgd-preference' => 'Pomoc za pśidawanje rozšyrjonego wikiteksta zmóžniś',
'edittoolbar-loading' => 'Zacytujo se...',
'edittoolbar-tool-bold' => 'Tucny',
'edittoolbar-tool-bold-example' => 'Tucny tekst',
'edittoolbar-tool-italic' => 'Kursiwny',
'edittoolbar-tool-italic-example' => 'Kursiwny tekst',
+ 'edittoolbar-tool-ilink' => 'Interny wótkaz',
+ 'edittoolbar-tool-ilink-example' => 'Titel wótkaza',
+ 'edittoolbar-tool-xlink' => 'Eksterny wótkaz (njezabydni prefiks http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.pśikład.de titel wótkaza',
'edittoolbar-tool-link' => 'Wótkaz',
'edittoolbar-tool-link-title' => 'Wótkaz zasunuś',
'edittoolbar-tool-link-int' => 'K wikijowemu nastawkoju/bokoju',
@@ -1861,6 +2198,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Njepłaśiwy titel',
'edittoolbar-tool-link-int-target-status-loading' => 'Eksistenca boka se pśekontrolěrujo...',
'edittoolbar-tool-link-int-invalid' => 'Titel, kótaryž sy pódał, jo njepłaśiwy.',
+ 'edittoolbar-tool-link-ext-invalid' => 'URL, kótaryž sy pódał, jo njepłaśiwy.',
'edittoolbar-tool-file' => 'Zasajźona dataja',
'edittoolbar-tool-file-example' => 'Psikład.jpg',
'edittoolbar-tool-reference' => 'Referenca',
@@ -1895,6 +2233,18 @@
{{ns:file}}:Pśikład.jpg|Pópisanje2',
'edittoolbar-tool-newline' => 'Nowa smužka',
'edittoolbar-tool-table' => 'Tabela',
+ 'edittoolbar-tool-table-example-old' => '-
+! głowa 1
+! głowa 2
+! głowa 3
+|-
+| smužka 1, cela 1
+| smužka 1, cela 2
+| smužka 1, cela 3
+|-
+| smužka 2, cela 1
+| smužka 2, cela 2
+| smužka 2, cela 3',
'edittoolbar-tool-table-example' => 'Smužka $1, cela $2',
'edittoolbar-tool-table-example-header' => 'Smužka $1, cela $2 (głowa)',
'edittoolbar-tool-table-title' => 'Tabelu zasunuÅ›',
@@ -1904,7 +2254,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Smužku głowy zapśěgnuś',
'edittoolbar-tool-table-insert' => 'ZasunuÅ›',
'edittoolbar-tool-table-cancel' => 'Pśetergnuś',
- 'edittoolbar-tool-replace' => 'Wuměniś',
+ 'edittoolbar-tool-replace' => 'Pytaś a wuměniś',
'edittoolbar-tool-replace-title' => 'Pytaś a wuměniś',
'edittoolbar-tool-replace-search' => 'PytaÅ› za:',
'edittoolbar-tool-replace-replace' => 'Wuměniś pśez:',
@@ -1912,8 +2262,9 @@
'edittoolbar-tool-replace-regex' => 'Z pytańskim teksto ako z regularnym wurazom wobchadaś',
'edittoolbar-tool-replace-all' => 'Wšykne wustupowanja wuměniś',
'edittoolbar-tool-replace-button' => 'Wuměniś',
- 'edittoolbar-tool-replace-close' => 'ZacyniÅ›',
+ 'edittoolbar-tool-replace-close' => 'Pśetergnuś',
'edittoolbar-tool-replace-nomatch' => 'Twójo pytanje njejo žedne wustupowanje namakało.',
+ 'edittoolbar-tool-replace-success' => '$1 {{PLURAL:$1|wuměnjenje pśewjeźone|wuměnjeni pśewjeźonej|wuměnjenja pśewjeźone|wuměnjenjow pśewjeźonych}}.',
'edittoolbar-section-characters' => 'Specialne znamješka',
'edittoolbar-characters-page-latin' => 'ÅatyÅ„ske',
'edittoolbar-characters-page-latinextended' => 'ÅatyÅ„ske rozÅ¡yrjone',
@@ -1973,7 +2324,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Lisćinowy zapisk</li><li>Lisćinowy zapisk</li></ol>',
'edittoolbar-help-content-file-description' => 'Zasajźona dataja',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Pśikład.png|thumb|Wobrazowe pópisanje]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Wobrazowe pópisanje' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Powětšyś' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Wobrazowe pópisanje</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Wobrazowe pópisanje' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Powětšyś' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Wobrazowe pópisanje</div></div>",
'edittoolbar-help-content-reference-description' => 'Referenca',
'edittoolbar-help-content-reference-syntax' => 'Tekst boka.<ref name="test">[http://www.example.org Tekst wótkaza], pśidatny tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Tekst boka.<sup><a href='#'>[1]</a></sup>",
@@ -1992,6 +2343,7 @@
/** Greek (Ελληνικά)
* @author Consta
+ * @author Crazymadlover
* @author Omnipaedista
* @author ZaDiak
*/
@@ -2004,6 +2356,10 @@
'edittoolbar-tool-bold-example' => 'Έντονο κείμενο',
'edittoolbar-tool-italic' => 'Πλάγια',
'edittoolbar-tool-italic-example' => 'Κείμενο με πλάγιους χαÏακτήÏες',
+ 'edittoolbar-tool-ilink' => 'ΕσωτεÏικός σÏνδεσμος',
+ 'edittoolbar-tool-ilink-example' => 'Τίτλος συνδÎσμου',
+ 'edittoolbar-tool-xlink' => 'ΕξωτεÏικός σÏνδεσμος (μην ξεχάστε το Ï€Ïόθεμα http:// )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com τίτλος συνδÎσμου',
'edittoolbar-tool-link' => 'ΣÏνδεσμος',
'edittoolbar-tool-link-title' => 'Εισαγωγή συνδÎσμου',
'edittoolbar-tool-link-int' => 'Σε μία σελίδα wiki',
@@ -2019,6 +2375,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'ΆκυÏος τίτλος',
'edittoolbar-tool-link-int-target-status-loading' => 'Έλεγχος ÏπαÏξης σελίδας...',
'edittoolbar-tool-link-int-invalid' => 'Ο τίτλος που καθοÏίσατε είναι μη ÎγκυÏος.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Το URL που καθοÏίσατε είναι μη ÎγκυÏο.',
'edittoolbar-tool-file' => 'ΕνσωματωμÎνο αÏχείο',
'edittoolbar-tool-file-example' => 'Paradeigma.jpg',
'edittoolbar-tool-reference' => 'ΠαÏαπομπή',
@@ -2062,7 +2419,7 @@
'edittoolbar-tool-table-dimensions-header' => 'ΠεÏίληψη σειÏάς επικεφαλίδας',
'edittoolbar-tool-table-insert' => 'Εισαγωγή',
'edittoolbar-tool-table-cancel' => 'ΆκυÏο',
- 'edittoolbar-tool-replace' => 'Αντικατάσταση',
+ 'edittoolbar-tool-replace' => 'Αναζήτηση και αντικατάσταση',
'edittoolbar-tool-replace-title' => 'Αναζήτηση και αντικατάσταση',
'edittoolbar-tool-replace-search' => 'Αναζήτηση για:',
'edittoolbar-tool-replace-replace' => 'Αντικατάσταση από:',
@@ -2070,8 +2427,9 @@
'edittoolbar-tool-replace-regex' => 'Αντιμετώπιση του "αναζήτηση οÏμαθοÏ" ως τακτικής ÎκφÏασης',
'edittoolbar-tool-replace-all' => 'Αντικατάσταση όλων',
'edittoolbar-tool-replace-button' => 'Αντικατάσταση',
- 'edittoolbar-tool-replace-close' => 'Κλείσιμο',
+ 'edittoolbar-tool-replace-close' => 'ΑκÏÏωση',
'edittoolbar-tool-replace-nomatch' => 'Η αναζήτηση δεν ταίÏιαξε με κάτι.',
+ 'edittoolbar-tool-replace-success' => 'Έγιναν $1 αντικαταστάσεις.',
'edittoolbar-section-characters' => 'Ειδικοί χαÏακτήÏες',
'edittoolbar-characters-page-latin' => 'Λατινικό',
'edittoolbar-characters-page-latinextended' => 'Î ÏοÎκταση του λατινικοÏ',
@@ -2131,7 +2489,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Στοιχείο λίστας</li><li>Στοιχείο λίστας</li></ol>',
'edittoolbar-help-content-file-description' => 'ΕνσωματωμÎνο αÏχείο',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Κείμενο πεÏιγÏαφής]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Κείμενο τίτλων' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Κείμενο τίτλων</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Κείμενο τίτλων' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Κείμενο τίτλων</div></div>",
'edittoolbar-help-content-reference-description' => 'ΠαÏαπομπή',
'edittoolbar-help-content-reference-syntax' => 'Κείμενο σελίδας.<ref name="test">[http://www.example.org Κείμενο συνδÎσμου], επιπλÎον κείμενο.</ref>',
'edittoolbar-help-content-reference-result' => "Κείμενο σελίδας.<sup><a href='#'>[1]</a></sup>",
@@ -2155,11 +2513,16 @@
'edittoolbar' => 'Redakta ilobreto',
'edittoolbar-desc' => 'Redakta ilobreto kun plibonigita uzebleco',
'edittoolbar-preference' => 'Åœalti plibonigitan redaktan ilobreton',
+ 'edittoolbar-cgd-preference' => 'Åœalti helpon por aldoni progresan vikitekston',
'edittoolbar-loading' => 'ÅœarÄante...',
'edittoolbar-tool-bold' => 'Grasa',
'edittoolbar-tool-bold-example' => 'Grasa teksto',
'edittoolbar-tool-italic' => 'Kursiva',
'edittoolbar-tool-italic-example' => 'Kursiva teksto',
+ 'edittoolbar-tool-ilink' => 'Interna ligilo',
+ 'edittoolbar-tool-ilink-example' => 'Ligila titolo',
+ 'edittoolbar-tool-xlink' => 'Ekstera ligilo (Memoru prefikson http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.ekzemplo.com ligila titolo',
'edittoolbar-tool-link' => 'Ligilo',
'edittoolbar-tool-link-title' => 'Enmeti ligilon',
'edittoolbar-tool-link-int' => 'Iri vikian paÄon',
@@ -2175,6 +2538,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Malvalida titolo',
'edittoolbar-tool-link-int-target-status-loading' => 'Kontrolante ekziston de paÄo...',
'edittoolbar-tool-link-int-invalid' => 'La titolo kiun vi enmetis estas malvalida.',
+ 'edittoolbar-tool-link-ext-invalid' => 'La URL-o kiun vi enigis estas malvalida.',
'edittoolbar-tool-file' => 'Enmetata dosiero',
'edittoolbar-tool-file-example' => 'Ekzemplo.jpg',
'edittoolbar-tool-reference' => 'Referenco',
@@ -2209,6 +2573,18 @@
{{ns:file}}:Ekzemplo.jpg|Teksto2 pri dosiero',
'edittoolbar-tool-newline' => 'Nova linio',
'edittoolbar-tool-table' => 'Tabelo',
+ 'edittoolbar-tool-table-example-old' => '-
+! titolo 1
+! titolo 2
+! titolo 3
+|-
+| vico 1, ĉelo 1
+| vico 1, ĉelo 2
+| vico 1, ĉelo 3
+|-
+| vico 2, ĉelo 1
+| vico 2, ĉelo 2
+| vico 2, ĉelo 3',
'edittoolbar-tool-table-example' => 'Vico $1, ĉelo $2',
'edittoolbar-tool-table-example-header' => 'Vico $1, ĉelo $2 (titolo)',
'edittoolbar-tool-table-title' => 'Enmeti tabelon',
@@ -2218,7 +2594,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Inkluzivi titolan vicon',
'edittoolbar-tool-table-insert' => 'Enmeti',
'edittoolbar-tool-table-cancel' => 'Nuligi',
- 'edittoolbar-tool-replace' => 'AnstataÅigi',
+ 'edittoolbar-tool-replace' => 'Serĉi kaj anstataÅigi',
'edittoolbar-tool-replace-title' => 'Serĉi kaj anstataÅigi',
'edittoolbar-tool-replace-search' => 'Serĉi:',
'edittoolbar-tool-replace-replace' => 'AnstataÅigi kun:',
@@ -2226,8 +2602,9 @@
'edittoolbar-tool-replace-regex' => 'Trakti signoĉenon kiel regularan esprimon',
'edittoolbar-tool-replace-all' => 'AnstataÅigi ĉiujn aperojn',
'edittoolbar-tool-replace-button' => 'AnstataÅigi',
- 'edittoolbar-tool-replace-close' => 'Fermi',
+ 'edittoolbar-tool-replace-close' => 'Nuligi',
'edittoolbar-tool-replace-nomatch' => 'Via serĉo trafis nenion.',
+ 'edittoolbar-tool-replace-success' => '$1 anstataÅigoj fariÄis.',
'edittoolbar-section-characters' => 'Specialaj signoj',
'edittoolbar-characters-page-latin' => 'Latina',
'edittoolbar-characters-page-latinextended' => 'Latina etendita',
@@ -2287,7 +2664,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Listero</li><li>Listero</li></ol>',
'edittoolbar-help-content-file-description' => 'Enmetita dosiero',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Ekzemplo.png|thumb|Teksto pri dosiero]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Pligrandigi' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Teksto pri dosiero</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Pligrandigi' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Teksto pri dosiero</div></div>",
'edittoolbar-help-content-reference-description' => 'Referenco',
'edittoolbar-help-content-reference-syntax' => 'PaÄa teksto.<ref name="test">[http://www.ekzemplo.org Ligila teksto], aldona teksto.</ref>',
'edittoolbar-help-content-reference-result' => "PaÄa teksto.<sup><a href='#'>[1]</a></sup>",
@@ -2315,11 +2692,16 @@
'edittoolbar' => 'Editando barra de herramientas',
'edittoolbar-desc' => 'Barra de herramientas de página de edición con usabilidad mejorada',
'edittoolbar-preference' => 'Habilitar barra de herramientas de edición mejorada',
+ 'edittoolbar-cgd-preference' => 'Habilitar ayuda para agregar texto wiki avanzado',
'edittoolbar-loading' => 'Cargando...',
'edittoolbar-tool-bold' => 'Negrita',
'edittoolbar-tool-bold-example' => 'Texto en negrita',
'edittoolbar-tool-italic' => 'Itálico',
'edittoolbar-tool-italic-example' => 'Texto itálico',
+ 'edittoolbar-tool-ilink' => 'VÃnculo interno',
+ 'edittoolbar-tool-ilink-example' => 'TÃtulo del vÃnculo',
+ 'edittoolbar-tool-xlink' => 'VÃnculo externo (recordar prefijo http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com tÃtulo del vÃnculo',
'edittoolbar-tool-link' => 'Enlace',
'edittoolbar-tool-link-title' => 'Insertar enlace',
'edittoolbar-tool-link-int' => 'A una página wiki',
@@ -2335,6 +2717,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'TÃtulo inválido',
'edittoolbar-tool-link-int-target-status-loading' => 'Revisando existencia de la página...',
'edittoolbar-tool-link-int-invalid' => 'El tÃtulo que ha especificado no es válido.',
+ 'edittoolbar-tool-link-ext-invalid' => 'El URL que especificaste es inválido.',
'edittoolbar-tool-file' => 'Archivo empotrado',
'edittoolbar-tool-file-example' => 'Example.jpg',
'edittoolbar-tool-reference' => 'Referencia',
@@ -2369,6 +2752,18 @@
{{ns:file}}:Ejemplo.jpg|Descripción2',
'edittoolbar-tool-newline' => 'Nueva lÃnea',
'edittoolbar-tool-table' => 'Tabla',
+ 'edittoolbar-tool-table-example-old' => '-
+! encabezado 1
+! encabezado 2
+! encabezado 3
+|-
+| fila 1, celda 1
+| fila 1, celda 2
+| fila 1, celda 3
+|-
+| fila 2, celda 1
+| fila 2, celda 2
+| fila 2, celda 3',
'edittoolbar-tool-table-example' => 'Fila $1, celda $2',
'edittoolbar-tool-table-example-header' => 'Fila $1, celda $2 (encabezado)',
'edittoolbar-tool-table-title' => 'Inserte tabla',
@@ -2378,7 +2773,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Incluir encabezado de fila',
'edittoolbar-tool-table-insert' => 'Insertar',
'edittoolbar-tool-table-cancel' => 'Cancelar',
- 'edittoolbar-tool-replace' => 'Reemplazar',
+ 'edittoolbar-tool-replace' => 'Buscar y reemplazar',
'edittoolbar-tool-replace-title' => 'Buscar y reemplazar',
'edittoolbar-tool-replace-search' => 'Buscar:',
'edittoolbar-tool-replace-replace' => 'Reemplazar por:',
@@ -2386,8 +2781,9 @@
'edittoolbar-tool-replace-regex' => 'Tratar la cadena de búsqueda como expresión regular.',
'edittoolbar-tool-replace-all' => 'Reemplazar todas las coincidencias',
'edittoolbar-tool-replace-button' => 'Reemplazar',
- 'edittoolbar-tool-replace-close' => 'Cerrar',
+ 'edittoolbar-tool-replace-close' => 'Cancelar',
'edittoolbar-tool-replace-nomatch' => 'Su búsqueda no halló resultados.',
+ 'edittoolbar-tool-replace-success' => '$1 reemplazos hechos',
'edittoolbar-section-characters' => 'Carácteres especiales',
'edittoolbar-characters-page-latin' => 'LatÃn',
'edittoolbar-characters-page-latinextended' => 'LatÃn extendido',
@@ -2447,7 +2843,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Listar item</li><li>Listar item</li></ol>',
'edittoolbar-help-content-file-description' => 'Archivo empotrado',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Texto leyenda]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Texto leyenda</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Texto leyenda</div></div>",
'edittoolbar-help-content-reference-description' => 'Referencia',
'edittoolbar-help-content-reference-syntax' => 'Texto de página.<ref name="test">[http://www.example.org Texto de vÃnculo], texto adicional.</ref>',
'edittoolbar-help-content-reference-result' => "Texto de página.<sup><a href='#'>[1]</a></sup>",
@@ -2477,6 +2873,10 @@
'edittoolbar-tool-bold-example' => 'Rasvane kiri',
'edittoolbar-tool-italic' => 'Kursiiv',
'edittoolbar-tool-italic-example' => 'Kaldkiri',
+ 'edittoolbar-tool-ilink' => 'Siselink',
+ 'edittoolbar-tool-ilink-example' => 'Lingi pealkiri',
+ 'edittoolbar-tool-xlink' => 'Välislink (ära unusta eesliidet http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.näide.ee lingi pealkiri',
'edittoolbar-tool-link-title' => 'Lingi lisamine',
'edittoolbar-tool-link-int' => 'Vikileheküljele',
'edittoolbar-tool-link-int-target' => 'Lehekülje pealkiri:',
@@ -2491,6 +2891,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Vigane pealkiri',
'edittoolbar-tool-link-int-target-status-loading' => 'Lehekülje olemasolu kindlakstegemine...',
'edittoolbar-tool-link-int-invalid' => 'Määratud pealkiri on vigane.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Esitatud internetiaadress on vigane.',
'edittoolbar-tool-file' => 'Manusfail',
'edittoolbar-tool-file-example' => 'Näide.jpg',
'edittoolbar-tool-reference' => 'Viide',
@@ -2525,24 +2926,34 @@
{{ns:file}}:Näide.jpg|Pildiallkiri2',
'edittoolbar-tool-newline' => 'Uus rida',
'edittoolbar-tool-table' => 'Tabel',
+ 'edittoolbar-tool-table-example-old' => '-
+! päis 1
+! päis 2
+! päis 3
+|-
+| 1. rida, 1. lahter
+| 1. rida, 2. lahter
+| 1. rida, 3. lahter
+|-
+| 2. rida, 1. lahter
+| 2. rida, 2. lahter
+| 2. rida, 3. lahter',
'edittoolbar-tool-table-example' => '$1. rida, $2. lahter',
'edittoolbar-tool-table-example-header' => '$1. rida, $2. lahter (päis)',
'edittoolbar-tool-table-title' => 'Tabeli lisamine',
'edittoolbar-tool-table-dimensions' => 'Suurus',
'edittoolbar-tool-table-dimensions-rows' => 'Ridu',
'edittoolbar-tool-table-dimensions-columns' => 'Veerge',
- 'edittoolbar-tool-table-dimensions-headerrows' => 'Päiseridu',
- 'edittoolbar-tool-table-dimensions-headercolumns' => 'Päiseveerge',
'edittoolbar-tool-table-insert' => 'Lisa',
'edittoolbar-tool-table-cancel' => 'Loobu',
- 'edittoolbar-tool-replace' => 'Asenda',
+ 'edittoolbar-tool-replace' => 'Otsi ja asenda',
'edittoolbar-tool-replace-title' => 'Otsimine ja asendus',
'edittoolbar-tool-replace-search' => 'Otsitav:',
'edittoolbar-tool-replace-replace' => 'Asendaja:',
'edittoolbar-tool-replace-case' => 'Erista suurtähti',
'edittoolbar-tool-replace-all' => 'Asenda kõik',
'edittoolbar-tool-replace-button' => 'Asenda',
- 'edittoolbar-tool-replace-close' => 'Sule',
+ 'edittoolbar-tool-replace-close' => 'Loobu',
'edittoolbar-tool-replace-nomatch' => 'Ãœhtegi otsitavat ei leitud.',
'edittoolbar-section-characters' => 'Erimärgid',
'edittoolbar-characters-page-latin' => 'Ladina',
@@ -2603,7 +3014,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Loendi liige</li><li>Loendi liige</li></ol>',
'edittoolbar-help-content-file-description' => 'Manusfail',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Näide.png|thumb|Pildiallkiri]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Pildiallkiri' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Suurenda' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Pildiallkiri</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Pildiallkiri' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Suurenda' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Pildiallkiri</div></div>",
'edittoolbar-help-content-reference-description' => 'Viide',
'edittoolbar-help-content-reference-syntax' => 'Lehekülje tekst.<ref name="test">[http://www.näide.ee Lingi tekst], täiendav tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Lehekülje tekst.<sup><a href='#'>[1]</a></sup>",
@@ -2633,6 +3044,10 @@
'edittoolbar-tool-bold-example' => 'Testu beltza',
'edittoolbar-tool-italic' => 'Etzana',
'edittoolbar-tool-italic-example' => 'Testu etzana',
+ 'edittoolbar-tool-ilink' => 'Barne lotura',
+ 'edittoolbar-tool-ilink-example' => 'Loturaren izenburua',
+ 'edittoolbar-tool-xlink' => 'Kanpo lotura (gogoratu http:// aurrizkia)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.adibidea.com lotura izenburua',
'edittoolbar-tool-link' => 'Lotura',
'edittoolbar-tool-link-title' => 'Sartu lotura',
'edittoolbar-tool-link-int' => 'Wiki orrialde batera',
@@ -2677,13 +3092,33 @@
{{ns:file}}:Adibidea.jpg|Epigrafea2',
'edittoolbar-tool-newline' => 'Lerro berria',
'edittoolbar-tool-table' => 'Taula',
- 'edittoolbar-tool-replace' => 'Aldatu',
+ 'edittoolbar-tool-table-example-old' => '-
+! goiburua 1
+! goiburua 2
+! goiburua 3
+|-
+| errenkada 1, gela 1
+| errenkada 1, gela 2
+| errenkada 1, gela 3
+|-
+| errenkada 2, gela 1
+| errenkada 2, gela 2
+| errenkada 2, gela 3',
+ 'edittoolbar-tool-table-example' => 'Errenkada $1, gela $2',
+ 'edittoolbar-tool-table-example-header' => 'Errenkada $1, gela $2 (goiburua)',
+ 'edittoolbar-tool-table-title' => 'Taula txertatu',
+ 'edittoolbar-tool-table-dimensions-rows' => 'Errenkadak',
+ 'edittoolbar-tool-table-dimensions-columns' => 'Zutabeak',
+ 'edittoolbar-tool-table-insert' => 'Txertatu',
+ 'edittoolbar-tool-table-cancel' => 'Ezeztatu',
+ 'edittoolbar-tool-replace' => 'Bilatu eta ordezkatu',
'edittoolbar-tool-replace-title' => 'Bilatu eta aldatu',
'edittoolbar-tool-replace-search' => 'Honakoa bilatu:',
'edittoolbar-tool-replace-replace' => 'Honegatik aldatu:',
'edittoolbar-tool-replace-all' => 'Aldatu agertzen den guztietan',
'edittoolbar-tool-replace-button' => 'Aldatu',
- 'edittoolbar-tool-replace-close' => 'Itxi',
+ 'edittoolbar-tool-replace-close' => 'Ezeztatu',
+ 'edittoolbar-tool-replace-success' => '$1 ordezkapen eginda.',
'edittoolbar-section-characters' => 'Karaktere bereziak',
'edittoolbar-characters-page-latin' => 'Latinoa',
'edittoolbar-characters-page-latinextended' => 'Latin hedatua',
@@ -2713,7 +3148,10 @@
'edittoolbar-help-content-bolditalic-syntax' => "'''''Testu beltza eta etzana'''''",
'edittoolbar-help-content-bolditalic-result' => '<strong><em>Testu beltza eta etzana</em></strong>',
'edittoolbar-help-content-ilink-description' => 'Barne lotura',
+ 'edittoolbar-help-content-ilink-syntax' => '[[Orriaren titulua|Loturaren izena]]<br />[[Orriaren titulua]]',
+ 'edittoolbar-help-content-ilink-result' => "<a href='#'>Loturaren izena</a><br /><a href='#'>Orriaren titulua</a>",
'edittoolbar-help-content-xlink-description' => 'Kanpo lotura',
+ 'edittoolbar-help-content-xlink-syntax' => '[http://www.adibidea.org Loturaren izena]<br />[http://www.adibidea.org]<br />http://www.adibidea.org',
'edittoolbar-help-content-heading1-description' => '1. mailako goiburua',
'edittoolbar-help-content-heading1-syntax' => '= Izenburuaren testua =',
'edittoolbar-help-content-heading1-result' => '<h1>Izenburuaren testua</h1>',
@@ -2744,6 +3182,53 @@
'edittoolbar-help-content-indent-syntax' => 'Testu normala<br />:Koskadun testua<br />::Koskadun testua',
);
+/** Persian (Ùارسی)
+ * @author Ladsgroup
+ */
+$messages['fa'] = array(
+ 'edittoolbar-tool-italic' => 'ایتالیک',
+ 'edittoolbar-tool-italic-example' => 'متن ایتالیک',
+ 'edittoolbar-tool-ilink' => 'پیوند داخلی',
+ 'edittoolbar-tool-ilink-example' => 'عنوان پیوند',
+ 'edittoolbar-tool-xlink' => 'پیوند به بیرون (پیشوند http:// Ùراموش نشود)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com عنوان پیوند',
+ 'edittoolbar-tool-link' => 'پیوند',
+ 'edittoolbar-tool-link-title' => 'اÙزودن پیوند',
+ 'edittoolbar-tool-link-int' => 'به یک صÙØÙ‡ ویکی',
+ 'edittoolbar-tool-link-int-target' => 'عنوان صÙØÙ‡:',
+ 'edittoolbar-tool-link-int-text' => 'متن عنوان:',
+ 'edittoolbar-tool-link-ext' => 'به یک صÙØÙ‡ وب خارج از ویکی',
+ 'edittoolbar-tool-link-ext-target' => 'آدرس اینترنتی پیوند:',
+ 'edittoolbar-tool-link-ext-text' => 'متن پیوند:',
+ 'edittoolbar-tool-link-insert' => 'اÙزودن پیوند',
+ 'edittoolbar-tool-link-cancel' => 'لغو',
+ 'edittoolbar-tool-link-int-target-status-exists' => 'صÙØÙ‡ وجود دارد',
+ 'edittoolbar-tool-link-int-target-status-notexists' => 'صÙØÙ‡ وجود ندارد',
+ 'edittoolbar-tool-link-int-target-status-invalid' => 'عنوان نادرست',
+ 'edittoolbar-tool-file-example' => 'مثال.jpg',
+ 'edittoolbar-tool-reference' => 'منبع',
+ 'edittoolbar-tool-signature' => 'امضا و زمان',
+ 'edittoolbar-section-advanced' => 'پیشرÙته',
+ 'edittoolbar-tool-heading-example' => 'عنوان سطØ',
+ 'edittoolbar-group-list' => 'Ùهرست',
+ 'edittoolbar-group-size' => 'اندازه',
+ 'edittoolbar-tool-big' => 'بزرگ',
+ 'edittoolbar-tool-big-example' => 'متن بزرگ',
+ 'edittoolbar-tool-small' => 'Ú©ÙˆÚ†Ú©',
+ 'edittoolbar-tool-small-example' => 'متن کوچک',
+ 'edittoolbar-tool-newline' => 'خط جدید',
+ 'edittoolbar-tool-table' => 'جدول',
+ 'edittoolbar-tool-table-cancel' => 'لغو',
+ 'edittoolbar-characters-page-greek' => 'یونانی',
+ 'edittoolbar-characters-page-cyrillic' => 'سیریلیک',
+ 'edittoolbar-characters-page-arabic' => 'عربی',
+ 'edittoolbar-characters-page-hebrew' => 'عبری',
+ 'edittoolbar-characters-page-telugu' => 'تالوگو',
+ 'edittoolbar-section-help' => 'راهنما',
+ 'edittoolbar-help-content-italic-description' => 'ایتالیک',
+ 'edittoolbar-help-content-signature-description' => 'امضا',
+);
+
/** Finnish (Suomi)
* @author Cimon Avaro
* @author Crt
@@ -2759,6 +3244,10 @@
'edittoolbar-tool-bold-example' => 'Lihavoitu teksti',
'edittoolbar-tool-italic' => 'Kursiivi',
'edittoolbar-tool-italic-example' => 'Kursivoitu teksti',
+ 'edittoolbar-tool-ilink' => 'Sisäinen linkki',
+ 'edittoolbar-tool-ilink-example' => 'Linkin otsikko',
+ 'edittoolbar-tool-xlink' => 'Ulkoinen linkki (muista http://-etuliite)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com linkin otsikko',
'edittoolbar-tool-link' => 'Linkki',
'edittoolbar-tool-link-title' => 'Lisää linkki',
'edittoolbar-tool-link-int' => 'Wikisivuun',
@@ -2815,7 +3304,7 @@
'edittoolbar-tool-table-dimensions-columns' => 'Sarakkeet',
'edittoolbar-tool-table-insert' => 'Lisää',
'edittoolbar-tool-table-cancel' => 'Peruuta',
- 'edittoolbar-tool-replace' => 'Korvaa',
+ 'edittoolbar-tool-replace' => 'Etsi ja korvaa',
'edittoolbar-tool-replace-title' => 'Etsi ja korvaa',
'edittoolbar-tool-replace-search' => 'Etsi seuraavaa:',
'edittoolbar-tool-replace-replace' => 'Korvaa seuraavalla:',
@@ -2823,7 +3312,7 @@
'edittoolbar-tool-replace-regex' => 'Kohtele hakuarvoa säännöllisenä lausekkeena',
'edittoolbar-tool-replace-all' => 'Korvaa kaikki esiintymät',
'edittoolbar-tool-replace-button' => 'Korvaa',
- 'edittoolbar-tool-replace-close' => 'Sulje',
+ 'edittoolbar-tool-replace-close' => 'Peruuta',
'edittoolbar-tool-replace-nomatch' => 'Hakusi ei tuottanut osumia.',
'edittoolbar-section-characters' => 'Erikoismerkit',
'edittoolbar-characters-page-latin' => 'Latinalainen kirjaimisto',
@@ -2884,7 +3373,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Luettelon kohta</li><li>Luettelon kohta</li></ol>',
'edittoolbar-help-content-file-description' => 'Tallennettu tiedosto',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Esimerkki.png|thumb|Kuvateksti]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Kuvateksti' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Kuvateksti</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Kuvateksti' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Kuvateksti</div></div>",
'edittoolbar-help-content-reference-description' => 'Lähde',
'edittoolbar-help-content-reference-syntax' => 'Sivun teksti.<ref name="testi">[http://www.example.org Linkin teksti], lisäteksti.</ref>',
'edittoolbar-help-content-reference-result' => "Sivun teksti.<sup><a href='#'>[1]</a></sup>",
@@ -2909,6 +3398,7 @@
* @author McDutchie
* @author Mormegil
* @author Omnipaedista
+ * @author Peter17
* @author PieRRoMaN
* @author Verdy p
*/
@@ -2916,11 +3406,16 @@
'edittoolbar' => 'Barre d’outils de modification',
'edittoolbar-desc' => "Barre d'outils de modification avec l'utilisabilité améliorée",
'edittoolbar-preference' => "Activer la barre d'outils améliorée",
+ 'edittoolbar-cgd-preference' => "Activer l'aide pour ajouter du texte wiki avancé",
'edittoolbar-loading' => 'Chargement ...',
'edittoolbar-tool-bold' => 'Gras',
'edittoolbar-tool-bold-example' => 'Texte en gras',
'edittoolbar-tool-italic' => 'Italique',
'edittoolbar-tool-italic-example' => 'Texte en italique',
+ 'edittoolbar-tool-ilink' => 'Lien interne',
+ 'edittoolbar-tool-ilink-example' => 'Titre du lien',
+ 'edittoolbar-tool-xlink' => 'Lien externe ( n’oubliez pas le préfixe http:// )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com titre du lien',
'edittoolbar-tool-link' => 'Lien',
'edittoolbar-tool-link-title' => 'Insérer un lien',
'edittoolbar-tool-link-int' => 'Vers un article / une page wiki',
@@ -2936,6 +3431,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Titre invalide',
'edittoolbar-tool-link-int-target-status-loading' => "Vérification de l'existence de la page...",
'edittoolbar-tool-link-int-invalid' => 'Le titre que vous avez spécifié est incorrect.',
+ 'edittoolbar-tool-link-ext-invalid' => "L'URL que vous avez spécifiée est invalide.",
'edittoolbar-tool-file' => 'Fichier inséré',
'edittoolbar-tool-file-example' => 'Exemple.jpg',
'edittoolbar-tool-reference' => 'Référence',
@@ -2970,6 +3466,18 @@
{{ns:file}}:Exemple.jpg|Description 2',
'edittoolbar-tool-newline' => 'Saut de ligne',
'edittoolbar-tool-table' => 'Tableau',
+ 'edittoolbar-tool-table-example-old' => '-
+! en-tête 1
+! en-tête 2
+! en-tête 3
+|-
+| ligne 1, case 1
+| ligne 1, case 2
+| ligne 1, case 3
+|-
+| ligne 2, case 1
+| ligne 2, case 2
+| ligne 2, case 3',
'edittoolbar-tool-table-example' => 'Ligne $1, cellule $2',
'edittoolbar-tool-table-example-header' => 'Ligne $1, cellule $2 (en-tête)',
'edittoolbar-tool-table-title' => 'Insérer un tableau',
@@ -2979,7 +3487,7 @@
'edittoolbar-tool-table-dimensions-header' => "Inclure la ligne d'en-tête",
'edittoolbar-tool-table-insert' => 'Insérer',
'edittoolbar-tool-table-cancel' => 'Annuler',
- 'edittoolbar-tool-replace' => 'Remplacer',
+ 'edittoolbar-tool-replace' => 'Rechercher et remplacer',
'edittoolbar-tool-replace-title' => 'Rechercher et remplacer',
'edittoolbar-tool-replace-search' => 'Rechercher :',
'edittoolbar-tool-replace-replace' => 'Remplacer avec :',
@@ -2987,8 +3495,9 @@
'edittoolbar-tool-replace-regex' => 'Traiter la chaîne de recherche comme une expression régulière',
'edittoolbar-tool-replace-all' => 'Remplacer toutes les occurrences',
'edittoolbar-tool-replace-button' => 'Remplacer',
- 'edittoolbar-tool-replace-close' => 'Fermer',
+ 'edittoolbar-tool-replace-close' => 'Annuler',
'edittoolbar-tool-replace-nomatch' => 'Votre recherche n’a abouti à aucune correspondance.',
+ 'edittoolbar-tool-replace-success' => '$1 remplacements faits.',
'edittoolbar-section-characters' => 'Caractères spéciaux',
'edittoolbar-characters-page-latin' => 'latin',
'edittoolbar-characters-page-latinextended' => 'latin étendu',
@@ -3048,7 +3557,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Élément de la liste</li><li>Élément de la liste</li></ol>',
'edittoolbar-help-content-file-description' => 'Fichier inséré',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Exemple.png|thumb|Texte affiché]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Texte affiché' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Texte affiché</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Texte affiché' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Texte affiché</div></div>",
'edittoolbar-help-content-reference-description' => 'Référence',
'edittoolbar-help-content-reference-syntax' => 'Texte de la page.<ref name="test">[http://www.example.org texte du lien], texte additionnel.</ref>',
'edittoolbar-help-content-reference-result' => "Texte de la page <sup><a href='#'>[1]</a></sup>",
@@ -3075,6 +3584,10 @@
'edittoolbar-tool-bold-example' => 'Tèxto grâs',
'edittoolbar-tool-italic' => 'Étalico',
'edittoolbar-tool-italic-example' => 'Tèxto étalico',
+ 'edittoolbar-tool-ilink' => 'Lim de dedens',
+ 'edittoolbar-tool-ilink-example' => 'Titro du lim',
+ 'edittoolbar-tool-xlink' => 'Lim de defôr (oubliâd pas lo prèfixo http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.ègzemplo.com titro du lim',
'edittoolbar-tool-link' => 'Lim',
'edittoolbar-tool-link-int-text' => 'Tèxto du lim :',
'edittoolbar-tool-link-ext-text' => 'Tèxto du lim :',
@@ -3143,11 +3656,16 @@
'edittoolbar' => 'Barra de ferramentas de edición',
'edittoolbar-desc' => 'Editar a páxina da barra de ferramentas cunha mellor usabilidade',
'edittoolbar-preference' => 'Activar a barra de ferramentas de edición mellorada',
+ 'edittoolbar-cgd-preference' => 'Activar a axuda para engadir texto wiki avanzado',
'edittoolbar-loading' => 'Cargando...',
'edittoolbar-tool-bold' => 'Negra',
'edittoolbar-tool-bold-example' => 'Texto en negra',
'edittoolbar-tool-italic' => 'Cursiva',
'edittoolbar-tool-italic-example' => 'Texto en cursiva',
+ 'edittoolbar-tool-ilink' => 'Ligazón interna',
+ 'edittoolbar-tool-ilink-example' => 'TÃtulo de ligazón',
+ 'edittoolbar-tool-xlink' => 'Ligazón externa (lembre o prefixo http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com tÃtulo de ligazón',
'edittoolbar-tool-link' => 'Ligazón',
'edittoolbar-tool-link-title' => 'Inserir unha ligazón',
'edittoolbar-tool-link-int' => 'Cara a unha páxina wiki',
@@ -3163,6 +3681,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'TÃtulo non válido',
'edittoolbar-tool-link-int-target-status-loading' => 'Comprobando a existencia da páxina...',
'edittoolbar-tool-link-int-invalid' => 'O tÃtulo que especificou non é válido.',
+ 'edittoolbar-tool-link-ext-invalid' => 'O enderezo URL que especificou é incorrecto.',
'edittoolbar-tool-file' => 'Ficheiro embelecido',
'edittoolbar-tool-file-example' => 'Exemplo.jpg',
'edittoolbar-tool-reference' => 'Referencia',
@@ -3197,6 +3716,18 @@
{{ns:file}}:Example.jpg|Pé_de_foto_2',
'edittoolbar-tool-newline' => 'Nova liña',
'edittoolbar-tool-table' => 'Táboa',
+ 'edittoolbar-tool-table-example-old' => '-
+! cabeceira 1
+! cabeceira 2
+! cabeceira 3
+|-
+| liña 1, cela 1
+| liña 1, cela 2
+| liña 1, cela 3
+|-
+| liña 2, cela 1
+| liña 2, cela 2
+| liña 2, cela 3',
'edittoolbar-tool-table-example' => 'Fila $1, cela $2',
'edittoolbar-tool-table-example-header' => 'Fila $1, cela $2 (cabeceira)',
'edittoolbar-tool-table-title' => 'Inserir unha táboa',
@@ -3206,7 +3737,7 @@
'edittoolbar-tool-table-dimensions-header' => 'IncluÃr a liña de cabeceira',
'edittoolbar-tool-table-insert' => 'Inserir',
'edittoolbar-tool-table-cancel' => 'Cancelar',
- 'edittoolbar-tool-replace' => 'SubstituÃr',
+ 'edittoolbar-tool-replace' => 'Buscar e substituÃr',
'edittoolbar-tool-replace-title' => 'Buscar e substituÃr',
'edittoolbar-tool-replace-search' => 'Buscar:',
'edittoolbar-tool-replace-replace' => 'SubstituÃr por:',
@@ -3214,8 +3745,9 @@
'edittoolbar-tool-replace-regex' => 'Tratar a secuencia de busca como unha expresión regular',
'edittoolbar-tool-replace-all' => 'SubstituÃr todas as coincidencias',
'edittoolbar-tool-replace-button' => 'SubstituÃr',
- 'edittoolbar-tool-replace-close' => 'Pechar',
+ 'edittoolbar-tool-replace-close' => 'Cancelar',
'edittoolbar-tool-replace-nomatch' => 'A súa busca non atopou nada.',
+ 'edittoolbar-tool-replace-success' => 'Fixéronse $1 substitucións.',
'edittoolbar-section-characters' => 'Caracteres especiais',
'edittoolbar-characters-page-latin' => 'LatÃn',
'edittoolbar-characters-page-latinextended' => 'LatÃn estendido',
@@ -3275,7 +3807,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Elemento da lista</li><li>Elemento da lista</li></ol>',
'edittoolbar-help-content-file-description' => 'Ficheiro embelecido',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Pé de foto.]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Pé de foto.</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Pé de foto.</div></div>",
'edittoolbar-help-content-reference-description' => 'Referencia',
'edittoolbar-help-content-reference-syntax' => 'Texto da páxina<ref name="test">[http://www.example.org Texto da ligazón], texto adicional.</ref>.',
'edittoolbar-help-content-reference-result' => "Texto da páxina<sup><a href='#'>[1]</a></sup>.",
@@ -3303,6 +3835,11 @@
'edittoolbar-tool-bold-example' => 'ΓÏάμματα παχÎα',
'edittoolbar-tool-italic' => 'πλάγιον',
'edittoolbar-tool-italic-example' => 'ΓÏάμματα πλάγια',
+ 'edittoolbar-tool-ilink' => 'ἘσωτεÏικὸς σÏνδεσμος',
+ 'edittoolbar-tool-ilink-example' => 'ΣυνδÎσμου ὄνομα',
+ 'edittoolbar-tool-xlink' => 'ἘξώτεÏος σÏνδεσμος (μÎμνησο τοῦ Ï€ÏοθÎματος http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com ὄνομα συνδÎσμου',
+ 'edittoolbar-tool-link-cancel' => 'ἈκυÏοῦν',
'edittoolbar-tool-file' => 'ἘμβεβαπτισμÎνον á¼€Ïχεῖον',
'edittoolbar-tool-reference' => 'ἈναφοÏά',
'edittoolbar-tool-reference-example' => 'Εἰσάγειν κείμενον παÏαπομπῆς ὧδε',
@@ -3325,11 +3862,13 @@
'edittoolbar-tool-gallery' => 'Πινακοθήκη',
'edittoolbar-tool-newline' => 'ÎÎα γÏαμμή',
'edittoolbar-tool-table' => 'Πίναξ',
- 'edittoolbar-tool-replace' => 'Ὑποκαθιστάναι',
+ 'edittoolbar-tool-table-cancel' => 'ἈκυÏοῦν',
+ 'edittoolbar-tool-replace' => 'Ζητεῖν καὶ ὑποκαθιστάναι',
'edittoolbar-tool-replace-title' => 'Ζητεῖν καὶ ὑποκαθιστάναι',
'edittoolbar-tool-replace-search' => 'Zήτησις πεÏί:',
'edittoolbar-tool-replace-replace' => 'Ὑποκατάστασις ὑπό:',
'edittoolbar-tool-replace-button' => 'Ὑποκαθιστάναι',
+ 'edittoolbar-tool-replace-close' => 'ἈκυÏοῦν',
'edittoolbar-section-characters' => 'Εἰδικοὶ χαÏακτῆÏες',
'edittoolbar-characters-page-latin' => 'Λατινικόν',
'edittoolbar-characters-page-latinextended' => 'Λατινικὸν Ï€ÏοεκτεταμÎνον',
@@ -3390,11 +3929,16 @@
'edittoolbar' => 'Wärchzygchäschtli bearbeite',
'edittoolbar-desc' => 'Wärchzygchäschtli mit ere verbesserete Benutzerfrejndligkeit bearbeite',
'edittoolbar-preference' => 'Verbesseret Bearbeitigs-Wärchzygchäschtli meglig mache',
+ 'edittoolbar-cgd-preference' => 'Hilf fir fortgschrittene Wikitext megli mache',
'edittoolbar-loading' => 'Am Lade ...',
'edittoolbar-tool-bold' => 'Fätt',
'edittoolbar-tool-bold-example' => 'Tekscht fätt',
'edittoolbar-tool-italic' => 'Kursiv',
'edittoolbar-tool-italic-example' => 'Tekscht kursiv',
+ 'edittoolbar-tool-ilink' => 'Intärn Gleich (Link)',
+ 'edittoolbar-tool-ilink-example' => 'Gleichtitel',
+ 'edittoolbar-tool-xlink' => 'Extärn Gleich (Link) (dänk an s Präfix http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.byschpil.com Gleichtitel',
'edittoolbar-tool-link' => 'Gleich',
'edittoolbar-tool-link-title' => 'Gleich yysetze',
'edittoolbar-tool-link-int' => 'Zuen eme Wikiartikel/ere Wikisyte',
@@ -3410,6 +3954,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Nit giltige Titel',
'edittoolbar-tool-link-int-target-status-loading' => 'Am Priefe, eb s Syte git ...',
'edittoolbar-tool-link-int-invalid' => 'Dr Titel, wu Du aagee hesch, isch nit giltig.',
+ 'edittoolbar-tool-link-ext-invalid' => 'D URL, wu Duu aagee hesch, isch nit giltig.',
'edittoolbar-tool-file' => 'Yygfiegti Datei',
'edittoolbar-tool-file-example' => 'Byschpil.jpg',
'edittoolbar-tool-reference' => 'Quälle',
@@ -3444,6 +3989,18 @@
{{ns:file}}:Byschpil.jpg|Bschriftig2',
'edittoolbar-tool-newline' => 'Neji Zeile',
'edittoolbar-tool-table' => 'Tabälle',
+ 'edittoolbar-tool-table-example-old' => '-
+! Chopf 1
+! Chopf 2
+! Chopf 3
+|-
+| Zyylete 1, Zälle 1
+| Zyylete 1, Zälle 2
+| Zyylete 1, Zälle 3
+|-
+| Zyylete 2, Zälle 1
+| Zyylete 2, Zälle 2
+| Zyylete 2, Zälle 3',
'edittoolbar-tool-table-example' => 'Zyle $1, Zälle $2',
'edittoolbar-tool-table-example-header' => 'Zyle $1, Zälle $2 (Chopf)',
'edittoolbar-tool-table-title' => 'Tabälle yyfiege',
@@ -3453,7 +4010,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Iberschrift yyfiege',
'edittoolbar-tool-table-insert' => 'Yyfiege',
'edittoolbar-tool-table-cancel' => 'Abbräche',
- 'edittoolbar-tool-replace' => 'Ersetze',
+ 'edittoolbar-tool-replace' => 'Suechen un ersetze',
'edittoolbar-tool-replace-title' => 'Sueche un ersetze',
'edittoolbar-tool-replace-search' => 'Sueche no:',
'edittoolbar-tool-replace-replace' => 'Ersetze dur:',
@@ -3461,8 +4018,9 @@
'edittoolbar-tool-replace-regex' => 'D Zeichechette wu gsuecht soll wäre as reguläre Uusdruck versueche',
'edittoolbar-tool-replace-all' => 'Alli Stelle, wu s vorchunnt, ersetze',
'edittoolbar-tool-replace-button' => 'Ersetze',
- 'edittoolbar-tool-replace-close' => 'Zuemache',
+ 'edittoolbar-tool-replace-close' => 'Abbräche',
'edittoolbar-tool-replace-nomatch' => 'Zue Dyyre Suech git s kei Träffer.',
+ 'edittoolbar-tool-replace-success' => '$1 Ersetzige durgfiert.',
'edittoolbar-section-characters' => 'Sunderzeiche',
'edittoolbar-characters-page-latin' => 'Latynisch',
'edittoolbar-characters-page-latinextended' => 'Latin Extended',
@@ -3522,7 +4080,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Lischtepunkt</li><li>Lischtepunkt</li></ol>',
'edittoolbar-help-content-file-description' => 'Yygfiegti Datei',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Bildbschriftig]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bildbschriftig' class='image' href='/wiki/Datei:Wiki.png'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='Bschriftig'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Bildbschriftig</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bildbschriftig' class='image' href='/wiki/Datei:Wiki.png'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='Bschriftig'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Bildbschriftig</div></div>",
'edittoolbar-help-content-reference-description' => 'Quälle',
'edittoolbar-help-content-reference-syntax' => 'Sytetekscht.<ref name="test">[http://www.byschpil.org Gleichtekscht], zuesätzlige Tekscht.</ref>',
'edittoolbar-help-content-reference-result' => "Sytetekscht.<sup><a href='#'>[1]</a></sup>",
@@ -3580,11 +4138,16 @@
'edittoolbar' => 'סרגל עריכה',
'edittoolbar-desc' => 'שיפור השימושיות של סרגל עריכת הדף',
'edittoolbar-preference' => 'הפעלת סרגל עריכה משופר',
+ 'edittoolbar-cgd-preference' => 'הפעלת העזרה להוספת תחביר ויקי מתקד×',
'edittoolbar-loading' => '×‘×˜×¢×™× ×”...',
'edittoolbar-tool-bold' => 'הדגשה',
'edittoolbar-tool-bold-example' => 'טקסט מודגש',
'edittoolbar-tool-italic' => 'הטיה',
'edittoolbar-tool-italic-example' => 'טקסט × ×˜×•×™',
+ 'edittoolbar-tool-ilink' => 'קישור ×¤× ×™×ž×™',
+ 'edittoolbar-tool-ilink-example' => 'כותרת הקישור',
+ 'edittoolbar-tool-xlink' => 'קישור ×—×™×¦×•× ×™ (זכרו להוסיף ×ת הקידומת http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com כותרת הקישור',
'edittoolbar-tool-link' => 'קישור',
'edittoolbar-tool-link-title' => 'הוספת קישור',
'edittoolbar-tool-link-int' => 'לדף ויקי',
@@ -3598,7 +4161,9 @@
'edittoolbar-tool-link-int-target-status-exists' => 'הדף קיי×',
'edittoolbar-tool-link-int-target-status-notexists' => 'הדף ××™× ×• קיי×',
'edittoolbar-tool-link-int-target-status-invalid' => 'כותרת בלתי ×ª×§×™× ×”',
+ 'edittoolbar-tool-link-int-target-status-loading' => 'בדיקה ×”×× ×”×“×£ קיי×...',
'edittoolbar-tool-link-int-invalid' => 'הכותרת ×©×¦×•×™× ×” ××™× ×” ×ª×§×™× ×”.',
+ 'edittoolbar-tool-link-ext-invalid' => 'הכתובת ×©×¦×•×™× ×” ××™× ×” ×ª×§×™× ×”.',
'edittoolbar-tool-file' => 'קובץ המוצג בדף',
'edittoolbar-tool-file-example' => 'דוגמה.jpg',
'edittoolbar-tool-reference' => 'הערת שוליי×',
@@ -3633,6 +4198,18 @@
{{ns:file}}:דוגמה.jpg|כותרת 2',
'edittoolbar-tool-newline' => 'שורה חדשה',
'edittoolbar-tool-table' => 'טבלה',
+ 'edittoolbar-tool-table-example-old' => '-
+! כותרת 1
+! כותרת 2
+! כותרת 3
+|-
+| שורה 1, ×ª× 1
+| שורה 1, ×ª× 2
+| שורה 1, ×ª× 3
+|-
+| שורה 2, ×ª× 1
+| שורה 2, ×ª× 2
+| שורה 2, ×ª× 3',
'edittoolbar-tool-table-example' => 'שורה $1, ×ª× $2',
'edittoolbar-tool-table-example-header' => 'שורה $1, ×ª× $2 (כותרת)',
'edittoolbar-tool-table-title' => 'הוספת טבלה',
@@ -3642,19 +4219,21 @@
'edittoolbar-tool-table-dimensions-header' => 'כולל שורת הכותרת',
'edittoolbar-tool-table-insert' => 'הוספה',
'edittoolbar-tool-table-cancel' => 'ביטול',
- 'edittoolbar-tool-replace' => 'החלפה',
+ 'edittoolbar-tool-replace' => 'חיפוש והחלפה',
'edittoolbar-tool-replace-title' => 'חיפוש והחלפה',
'edittoolbar-tool-replace-search' => 'חיפוש של:',
'edittoolbar-tool-replace-replace' => 'החלפה ב:',
'edittoolbar-tool-replace-case' => 'הת×מת רישיות',
- 'edittoolbar-tool-replace-regex' => 'התייחסות ×ל מחרוזות חיפוש ×›×ל ×‘×™×˜×•×™×™× ×¨×’×•×œ×ריי×',
+ 'edittoolbar-tool-replace-regex' => 'בדיקת מחרוזת החיפוש כביטוי רגולרי',
'edittoolbar-tool-replace-all' => 'החלפת כל המופעי×',
'edittoolbar-tool-replace-button' => 'החלפה',
- 'edittoolbar-tool-replace-close' => 'סגירה',
+ 'edittoolbar-tool-replace-close' => 'ביטול',
'edittoolbar-tool-replace-nomatch' => '×œ× ×”×ª×§×‘×œ×• הת×מות לחיפושכ×.',
+ 'edittoolbar-tool-replace-success' => 'בוצעו $1 החלפות.',
'edittoolbar-section-characters' => '×ª×•×•×™× ×ž×™×•×—×“×™×',
'edittoolbar-characters-page-latin' => '×œ×˜×™× ×™',
'edittoolbar-characters-page-latinextended' => '×œ×˜×™× ×™ מורחב',
+ 'edittoolbar-characters-page-ipa' => '×לפבית ×¤×•× ×˜×™ ×‘×™× ×œ×ומי (IPA)',
'edittoolbar-characters-page-symbols' => '×¡×™×ž× ×™×',
'edittoolbar-characters-page-greek' => '×™×•×•× ×™',
'edittoolbar-characters-page-cyrillic' => 'קירילי',
@@ -3710,7 +4289,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>פריט רשימה</li><li>פריט רשימה</li></ol>',
'edittoolbar-help-content-file-description' => 'קובץ המוצג בדף',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:דוגמה.png|ממוזער|טקסט הכותרת]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='טקסט הכותרת' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>טקסט הכותרת</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='טקסט הכותרת' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>טקסט הכותרת</div></div>",
'edittoolbar-help-content-reference-description' => 'הערת שוליי×',
'edittoolbar-help-content-reference-syntax' => 'טקסט הדף.<ref name="test">[http://www.example.org טקסט הקישור], טקסט × ×•×¡×£.</ref>',
'edittoolbar-help-content-reference-result' => "טקסט הדף.<sup><a href='#'>[1]</a></sup>",
@@ -3748,6 +4327,10 @@
'edittoolbar-tool-bold-example' => 'Podebljani tekst',
'edittoolbar-tool-italic' => 'Kurziv',
'edittoolbar-tool-italic-example' => 'Kurzivni tekst',
+ 'edittoolbar-tool-ilink' => 'Unutarnja poveznica',
+ 'edittoolbar-tool-ilink-example' => 'Naziv poveznice',
+ 'edittoolbar-tool-xlink' => 'Vanjska poveznica (nužan je prefiks http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.primjer.com naziv poveznice',
'edittoolbar-tool-link' => 'Poveznica',
'edittoolbar-tool-link-title' => 'Umetni poveznicu',
'edittoolbar-tool-link-int' => 'U wiki stranicu',
@@ -3803,8 +4386,6 @@
'edittoolbar-tool-table-dimensions' => 'Dimenzije',
'edittoolbar-tool-table-dimensions-rows' => 'Retci',
'edittoolbar-tool-table-dimensions-columns' => 'Stupci',
- 'edittoolbar-tool-table-dimensions-headerrows' => 'Zaglavlje redaka',
- 'edittoolbar-tool-table-dimensions-headercolumns' => 'Zaglavlje stupaca',
'edittoolbar-tool-table-insert' => 'Umetni',
'edittoolbar-tool-table-cancel' => 'Odustani',
'edittoolbar-tool-replace' => 'Zamijeni',
@@ -3876,7 +4457,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>stavka popisa</li><li>stavka popisa</li></ol>',
'edittoolbar-help-content-file-description' => 'Uložena datoteka',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Primjer.jpg|thumb|Tekst opisa]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Tekst opisa' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Povećaj' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Tekst opisa'</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Tekst opisa' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Povećaj' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Tekst opisa'</div></div>",
'edittoolbar-help-content-reference-description' => 'Bilješke',
'edittoolbar-help-content-reference-syntax' => 'Tekst stranice.<ref name="test">[http://www.primjer.org Tekst poveznice], dodatni tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Tekst stranice.<sup><a href='#'>[1]</a></sup>",
@@ -3900,11 +4481,16 @@
'edittoolbar' => 'Gratowa lajsta za wobdźěłowanje',
'edittoolbar-desc' => 'Gratowa lajsta za wobdźěłowanje stronow z polěpšenej wužiwajomnosću',
'edittoolbar-preference' => 'Polěpšenu gratowu lajstu za wobdźěłowanje aktiwizować',
+ 'edittoolbar-cgd-preference' => 'Pomoc za přidawanje rozšěrjeneho wikiteksta zmóžnić',
'edittoolbar-loading' => 'ÄŒita so...',
'edittoolbar-tool-bold' => 'TuÄny',
'edittoolbar-tool-bold-example' => 'TuÄny tekst',
'edittoolbar-tool-italic' => 'Kursiwny',
'edittoolbar-tool-italic-example' => 'Kursiwny tekst',
+ 'edittoolbar-tool-ilink' => 'Interny wotkaz',
+ 'edittoolbar-tool-ilink-example' => 'Titul wotkaza',
+ 'edittoolbar-tool-xlink' => 'Eksterny wotkaz (njezabudź na prefiks http://)',
+ 'edittoolbar-tool-xlink-example' => 'titul wotkaza http://www.přikład.de',
'edittoolbar-tool-link' => 'Wotkaz',
'edittoolbar-tool-link-title' => 'Wotkaz zasunyć',
'edittoolbar-tool-link-int' => 'K wikinastawkej/stronje',
@@ -3920,6 +4506,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Njepłaćiwy titul',
'edittoolbar-tool-link-int-target-status-loading' => 'Eksistenca strony so přepruwuje...',
'edittoolbar-tool-link-int-invalid' => 'Titul, kotryž sy podał, je njepłaćiwy.',
+ 'edittoolbar-tool-link-ext-invalid' => 'URL, kotryž sy podał, je njepłaćiwy.',
'edittoolbar-tool-file' => 'Zasadźena dataja',
'edittoolbar-tool-file-example' => 'Přikład.jpg',
'edittoolbar-tool-reference' => 'Referenca',
@@ -3954,6 +4541,18 @@
{{ns:file}}:Example.jpg|Popis2',
'edittoolbar-tool-newline' => 'Nowa linka',
'edittoolbar-tool-table' => 'Tabela',
+ 'edittoolbar-tool-table-example-old' => '-
+! hłowa 1
+! hłowa 2
+! hłowa 3
+|-
+| rjadka 1, cela 1
+| rjadka 1, cela 2
+| rjadka 1, cela 3
+|-
+| rjadka 2, cela 1
+| rjadka 2, cela 2
+| rjadka 2, cela 3',
'edittoolbar-tool-table-example' => 'Rjadka $1, cela $2',
'edittoolbar-tool-table-example-header' => 'Rjadka $1, cela $2 (hłowa)',
'edittoolbar-tool-table-title' => 'Tabelu zasunyć',
@@ -3963,7 +4562,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Rjadku hłowy zapřijeć',
'edittoolbar-tool-table-insert' => 'Zasunyć',
'edittoolbar-tool-table-cancel' => 'Přetorhnyć',
- 'edittoolbar-tool-replace' => 'Narunać',
+ 'edittoolbar-tool-replace' => 'Pytać a narunać',
'edittoolbar-tool-replace-title' => 'Pytać a narunać',
'edittoolbar-tool-replace-search' => 'Pytać za:',
'edittoolbar-tool-replace-replace' => 'Narunać přez:',
@@ -3971,8 +4570,9 @@
'edittoolbar-tool-replace-regex' => 'Z pytanskim tekstom kaž z regularnym wurazom wobchadźeć',
'edittoolbar-tool-replace-all' => 'Wšě wustupjenja narunać',
'edittoolbar-tool-replace-button' => 'Narunać',
- 'edittoolbar-tool-replace-close' => 'ZaÄinić',
+ 'edittoolbar-tool-replace-close' => 'Přetorhnyć',
'edittoolbar-tool-replace-nomatch' => 'Twoje pytanje njeje wotpowědnik namakał.',
+ 'edittoolbar-tool-replace-success' => '$1 {{PLURAL:$1|narunanje přewjedźene|narunani přewjedźenej|narunanja přewjedźene|narunanjow přewjedźenych}}.',
'edittoolbar-section-characters' => 'Specialne znamješka',
'edittoolbar-characters-page-latin' => 'Åaćonske',
'edittoolbar-characters-page-latinextended' => 'Åaćonske rozÅ¡Ä›rjene',
@@ -4032,7 +4632,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Lisćinowy zapisk</li><li>Lisćinowy zapisk</li></ol>',
'edittoolbar-help-content-file-description' => 'Zasadźena dataja',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Tekst wobrazoweho popisa]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Tekst wobrazeho popisa' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Powjetšić' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Tekst wobrazoweho popisa</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Tekst wobrazeho popisa' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Powjetšić' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Tekst wobrazoweho popisa</div></div>",
'edittoolbar-help-content-reference-description' => 'Referenca',
'edittoolbar-help-content-reference-syntax' => 'Tekst strony.<ref name="test">[http://www.example.org tekst wotkaza], přidatny tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Tekst strony.<sup><a href='#'>[1]</a></sup>",
@@ -4054,14 +4654,19 @@
* @author Glanthor Reviol
*/
$messages['hu'] = array(
- 'edittoolbar' => 'Szerkesztő eszköztár',
+ 'edittoolbar' => 'Szerkesztő-eszköztár',
'edittoolbar-desc' => 'Használhatóbb szerkesztő eszköztár',
'edittoolbar-preference' => 'Fejlettebb szerkesztő-eszköztár használata',
+ 'edittoolbar-cgd-preference' => 'SegÃtség haladó wikiszöveg hozzáadásához',
'edittoolbar-loading' => 'Betöltés...',
'edittoolbar-tool-bold' => 'Félkövér',
'edittoolbar-tool-bold-example' => 'Félkövér szöveg',
'edittoolbar-tool-italic' => 'DÅ‘lt',
'edittoolbar-tool-italic-example' => 'Dőlt szöveg',
+ 'edittoolbar-tool-ilink' => 'Belső hivatkozás',
+ 'edittoolbar-tool-ilink-example' => 'Hivatkozás cÃme',
+ 'edittoolbar-tool-xlink' => 'Külső hivatkozás (ne felejtkezz el a http:// előtagról)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.peldaoldal.hu hivatkozás cÃme',
'edittoolbar-tool-link' => 'Hivatkozás',
'edittoolbar-tool-link-title' => 'Hivatkozás beszúrása',
'edittoolbar-tool-link-int' => 'A wiki egy lapjára',
@@ -4077,6 +4682,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Érvénytelen cÃm',
'edittoolbar-tool-link-int-target-status-loading' => 'Ellenőrzöm, hogy létezik-e a lap…',
'edittoolbar-tool-link-int-invalid' => 'A megadott cÃm érvénytelen',
+ 'edittoolbar-tool-link-ext-invalid' => 'A megadott URL nem érvényes.',
'edittoolbar-tool-file' => 'Fájl beszúrása',
'edittoolbar-tool-file-example' => 'Egyszerikép.jpg',
'edittoolbar-tool-reference' => 'Forráshivatkozás',
@@ -4111,15 +4717,28 @@
{{ns:file}}:Példa.jpg|képaláÃrás2',
'edittoolbar-tool-newline' => 'Új sor',
'edittoolbar-tool-table' => 'Táblázat',
+ 'edittoolbar-tool-table-example-old' => '-
+! 1. fejléc
+! 2. fejléc
+! 3. fejléc
+|-
+| 1. sor, 1. cella
+| 1. sor, 2. cella
+| 1. sor, 3. cella
+|-
+| 2. sor, 1. cella
+| 2. sor, 2. cella
+| 2. sor, 3. cella',
'edittoolbar-tool-table-example' => '$1. sor, $2. cella',
'edittoolbar-tool-table-example-header' => '$1. sor, $2. cella (fejléc)',
'edittoolbar-tool-table-title' => 'Tábla beszúrása',
'edittoolbar-tool-table-dimensions' => 'Méret',
'edittoolbar-tool-table-dimensions-rows' => 'Sorok száma',
'edittoolbar-tool-table-dimensions-columns' => 'Oszlopok száma',
+ 'edittoolbar-tool-table-dimensions-header' => 'A fejlécet is beleértve',
'edittoolbar-tool-table-insert' => 'Beszúrás',
'edittoolbar-tool-table-cancel' => 'Mégse',
- 'edittoolbar-tool-replace' => 'Csere',
+ 'edittoolbar-tool-replace' => 'Keresés és csere',
'edittoolbar-tool-replace-title' => 'Keresés és csere',
'edittoolbar-tool-replace-search' => 'Keresendő szöveg:',
'edittoolbar-tool-replace-replace' => 'Csere:',
@@ -4127,8 +4746,9 @@
'edittoolbar-tool-replace-regex' => 'A beÃrt szöveg egy reguláris kifejezés',
'edittoolbar-tool-replace-all' => 'Az összes előfordulás lecserélése',
'edittoolbar-tool-replace-button' => 'Csere',
- 'edittoolbar-tool-replace-close' => 'Bezárás',
+ 'edittoolbar-tool-replace-close' => 'Mégse',
'edittoolbar-tool-replace-nomatch' => 'Nincs egyetlen találat sem.',
+ 'edittoolbar-tool-replace-success' => '$1 csere történt.',
'edittoolbar-section-characters' => 'Különleges karakterek',
'edittoolbar-characters-page-latin' => 'Latin',
'edittoolbar-characters-page-latinextended' => 'BÅ‘vÃtett latin',
@@ -4188,7 +4808,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Listaelem</li><li>Listaelem</li></ol>',
'edittoolbar-help-content-file-description' => 'Beszúrt fájl',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|bélyegkép|KépaláÃrás]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='A kép nagyÃtása' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>KépaláÃrás</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='A kép nagyÃtása' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>KépaláÃrás</div></div>",
'edittoolbar-help-content-reference-description' => 'Forráshivatkozás',
'edittoolbar-help-content-reference-syntax' => 'Lap szövege.<ref name="test">[http://www.példaoldal.hu Hivatkozás szövege], további szöveg.</ref>',
'edittoolbar-help-content-reference-result' => "Lap szövege.<sup><a href='#'>[1]</a></sup>",
@@ -4212,11 +4832,16 @@
'edittoolbar' => 'Instrumentario de modification',
'edittoolbar-desc' => 'Barra con instrumentos de modification con augmento de usabilitate',
'edittoolbar-preference' => 'Activar le instrumentario de modification meliorate',
+ 'edittoolbar-cgd-preference' => 'Activar le adjuta pro adder texto wiki avantiate',
'edittoolbar-loading' => 'Cargamento in curso…',
'edittoolbar-tool-bold' => 'Grasse',
'edittoolbar-tool-bold-example' => 'Texto grasse',
- 'edittoolbar-tool-italic' => 'Cursive',
- 'edittoolbar-tool-italic-example' => 'Texto cursive',
+ 'edittoolbar-tool-italic' => 'Italic',
+ 'edittoolbar-tool-italic-example' => 'Texto italic',
+ 'edittoolbar-tool-ilink' => 'Ligamine interne',
+ 'edittoolbar-tool-ilink-example' => 'Titulo del ligamine',
+ 'edittoolbar-tool-xlink' => 'Ligamine externe (non oblida le prefixo http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com titulo del ligamine',
'edittoolbar-tool-link' => 'Ligamine',
'edittoolbar-tool-link-title' => 'Inserer ligamine',
'edittoolbar-tool-link-int' => 'A un pagina wiki',
@@ -4232,25 +4857,26 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Titulo invalide',
'edittoolbar-tool-link-int-target-status-loading' => 'Verifica existentia del pagina...',
'edittoolbar-tool-link-int-invalid' => 'Le titulo que tu specificava es invalide.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Le URL que tu specificava es invalide.',
'edittoolbar-tool-file' => 'File incastrate',
'edittoolbar-tool-file-example' => 'Exemplo.jpg',
'edittoolbar-tool-reference' => 'Referentia',
'edittoolbar-tool-reference-example' => 'Inserer hic le texto del nota',
'edittoolbar-tool-signature' => 'Signatura con data e hora',
'edittoolbar-section-advanced' => 'Avantiate',
- 'edittoolbar-tool-heading' => 'Capite',
+ 'edittoolbar-tool-heading' => 'Titulo',
'edittoolbar-tool-heading-1' => 'Nivello 1',
'edittoolbar-tool-heading-2' => 'Nivello 2',
'edittoolbar-tool-heading-3' => 'Nivello 3',
'edittoolbar-tool-heading-4' => 'Nivello 4',
'edittoolbar-tool-heading-5' => 'Nivello 5',
- 'edittoolbar-tool-heading-example' => 'Texto del capite',
+ 'edittoolbar-tool-heading-example' => 'Texto del titulo',
'edittoolbar-group-list' => 'Lista',
'edittoolbar-tool-ulist' => 'Lista a punctos',
'edittoolbar-tool-ulist-example' => 'Elemento de lista a punctos',
'edittoolbar-tool-olist' => 'Lista numerate',
'edittoolbar-tool-olist-example' => 'Elemento de lista numerate',
- 'edittoolbar-group-size' => 'Dimension',
+ 'edittoolbar-group-size' => 'Grandor',
'edittoolbar-tool-big' => 'Grande',
'edittoolbar-tool-big-example' => 'Texto grande',
'edittoolbar-tool-small' => 'Micre',
@@ -4266,6 +4892,18 @@
{{ns:file}}:Exemplo.jpg|Legenda2',
'edittoolbar-tool-newline' => 'Nove linea',
'edittoolbar-tool-table' => 'Tabella',
+ 'edittoolbar-tool-table-example-old' => '-
+! capite 1
+! capite 2
+! capite 3
+|-
+| linea 1, cellula 1
+| linea 1, cellula 2
+| linea 1, cellula 3
+|-
+| linea 2, cellula 1
+| linea 2, cellula 2
+| linea 2, cellula 3',
'edittoolbar-tool-table-example' => 'Linea $1, cellula $2',
'edittoolbar-tool-table-example-header' => 'Linea $1, cellula $2 (capite)',
'edittoolbar-tool-table-title' => 'Inserer tabella',
@@ -4275,7 +4913,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Includer linea de capite',
'edittoolbar-tool-table-insert' => 'Inserer',
'edittoolbar-tool-table-cancel' => 'Cancellar',
- 'edittoolbar-tool-replace' => 'Reimplaciar',
+ 'edittoolbar-tool-replace' => 'Cercar e reimplaciar',
'edittoolbar-tool-replace-title' => 'Cercar e reimplaciar',
'edittoolbar-tool-replace-search' => 'Cercar:',
'edittoolbar-tool-replace-replace' => 'Reimplaciar per:',
@@ -4283,8 +4921,9 @@
'edittoolbar-tool-replace-regex' => 'Tractar le catena de recerca como un expression regular',
'edittoolbar-tool-replace-all' => 'Reimplaciar tote le occurrentias',
'edittoolbar-tool-replace-button' => 'Reimplaciar',
- 'edittoolbar-tool-replace-close' => 'Clauder',
+ 'edittoolbar-tool-replace-close' => 'Cancellar',
'edittoolbar-tool-replace-nomatch' => 'Tu recerca non ha producite resultatos.',
+ 'edittoolbar-tool-replace-success' => '$1 reimplaciamentos facite.',
'edittoolbar-section-characters' => 'Characteres special',
'edittoolbar-characters-page-latin' => 'Latin',
'edittoolbar-characters-page-latinextended' => 'Latin extendite',
@@ -4293,49 +4932,49 @@
'edittoolbar-characters-page-greek' => 'Grec',
'edittoolbar-characters-page-cyrillic' => 'Cyrillic',
'edittoolbar-characters-page-arabic' => 'Arabe',
- 'edittoolbar-characters-page-hebrew' => 'Hebreo',
+ 'edittoolbar-characters-page-hebrew' => 'Hebree',
'edittoolbar-characters-page-telugu' => 'Telugu',
'edittoolbar-section-help' => 'Adjuta',
'edittoolbar-help-heading-description' => 'Description',
- 'edittoolbar-help-heading-syntax' => 'Lo que tu scribe',
- 'edittoolbar-help-heading-result' => 'Lo que tu obtene',
- 'edittoolbar-help-page-format' => 'Formatation',
+ 'edittoolbar-help-heading-syntax' => 'Entrata',
+ 'edittoolbar-help-heading-result' => 'Resultato',
+ 'edittoolbar-help-page-format' => 'Typographia',
'edittoolbar-help-page-link' => 'Ligamines',
- 'edittoolbar-help-page-heading' => 'Capites',
+ 'edittoolbar-help-page-heading' => 'Titulos',
'edittoolbar-help-page-list' => 'Listas',
'edittoolbar-help-page-file' => 'Files',
'edittoolbar-help-page-reference' => 'Referentias',
'edittoolbar-help-page-discussion' => 'Discussion',
- 'edittoolbar-help-content-italic-description' => 'Cursive',
- 'edittoolbar-help-content-italic-syntax' => "''Texto cursive''",
- 'edittoolbar-help-content-italic-result' => '<em>Texto cursive</em>',
+ 'edittoolbar-help-content-italic-description' => 'Italic',
+ 'edittoolbar-help-content-italic-syntax' => "''Texto italic''",
+ 'edittoolbar-help-content-italic-result' => '<em>Texto italic</em>',
'edittoolbar-help-content-bold-description' => 'Grasse',
'edittoolbar-help-content-bold-syntax' => "'''Texto grasse'''",
'edittoolbar-help-content-bold-result' => '<strong>Texto grasse</strong>',
- 'edittoolbar-help-content-bolditalic-description' => 'Grasse & cursive',
- 'edittoolbar-help-content-bolditalic-syntax' => "'''''Texto grasse & cursive'''''",
- 'edittoolbar-help-content-bolditalic-result' => '<strong><em>Texto grasse & cursive</em></strong>',
+ 'edittoolbar-help-content-bolditalic-description' => 'Grasse & italic',
+ 'edittoolbar-help-content-bolditalic-syntax' => "'''''Texto grasse & italic'''''",
+ 'edittoolbar-help-content-bolditalic-result' => '<strong><em>Texto grasse & italic</em></strong>',
'edittoolbar-help-content-ilink-description' => 'Ligamine interne',
'edittoolbar-help-content-ilink-syntax' => '[[Titulo del pagina|Texto del ligamine]]<br />[[Titulo del pagina]]',
'edittoolbar-help-content-ilink-result' => "<a href='#'>Texto del ligamine</a><br /><a href='#'>Titulo del pagina</a>",
'edittoolbar-help-content-xlink-description' => 'Ligamine externe',
'edittoolbar-help-content-xlink-syntax' => '[http://www.example.org Texto del ligamine]<br />[http://www.example.org]<br />http://www.example.org',
'edittoolbar-help-content-xlink-result' => "<a href='#' class='external'>Texto del ligamine</a><br /><a href='#' class='external autonumber'>[1]</a><br /><a href='#' class='external'>http://www.example.org</a>",
- 'edittoolbar-help-content-heading1-description' => 'Capite de prime nivello',
- 'edittoolbar-help-content-heading1-syntax' => '= Texto del capite =',
- 'edittoolbar-help-content-heading1-result' => '<h1>Texto del capite</h1>',
- 'edittoolbar-help-content-heading2-description' => 'Capite del secunde nivello',
- 'edittoolbar-help-content-heading2-syntax' => '== Texto del capite ==',
- 'edittoolbar-help-content-heading2-result' => '<h2>Texto del capite</h2>',
- 'edittoolbar-help-content-heading3-description' => 'Capite del tertie nivello',
- 'edittoolbar-help-content-heading3-syntax' => '=== Texto del capite ===',
- 'edittoolbar-help-content-heading3-result' => '<h3>Texto del capite</h3>',
- 'edittoolbar-help-content-heading4-description' => 'Capite del quarte nivello',
- 'edittoolbar-help-content-heading4-syntax' => '==== Texto del capite ====',
- 'edittoolbar-help-content-heading4-result' => '<h4>Texto del capite</h4>',
- 'edittoolbar-help-content-heading5-description' => 'Capite del quinte nivello',
- 'edittoolbar-help-content-heading5-syntax' => '===== Texto del capite =====',
- 'edittoolbar-help-content-heading5-result' => '<h5>Texto del capite</h5>',
+ 'edittoolbar-help-content-heading1-description' => 'Titulo de prime nivello',
+ 'edittoolbar-help-content-heading1-syntax' => '= Texto del titulo =',
+ 'edittoolbar-help-content-heading1-result' => '<h1>Texto del titulo</h1>',
+ 'edittoolbar-help-content-heading2-description' => 'Titulo del secunde nivello',
+ 'edittoolbar-help-content-heading2-syntax' => '== Texto del titulo ==',
+ 'edittoolbar-help-content-heading2-result' => '<h2>Texto del titulo</h2>',
+ 'edittoolbar-help-content-heading3-description' => 'Titulo del tertie nivello',
+ 'edittoolbar-help-content-heading3-syntax' => '=== Texto del titulo ===',
+ 'edittoolbar-help-content-heading3-result' => '<h3>Texto del titulo</h3>',
+ 'edittoolbar-help-content-heading4-description' => 'Titulo del quarte nivello',
+ 'edittoolbar-help-content-heading4-syntax' => '==== Texto del titulo ====',
+ 'edittoolbar-help-content-heading4-result' => '<h4>Texto del titulo</h4>',
+ 'edittoolbar-help-content-heading5-description' => 'Titulo del quinte nivello',
+ 'edittoolbar-help-content-heading5-syntax' => '===== Texto del titulo =====',
+ 'edittoolbar-help-content-heading5-result' => '<h5>Texto del titulo</h5>',
'edittoolbar-help-content-ulist-description' => 'Lista a punctos',
'edittoolbar-help-content-ulist-syntax' => '* Elemento del lista<br />* Elemento del lista',
'edittoolbar-help-content-ulist-result' => '<ul><li>Elemento del lista</li><li>Elemento del lista</li></ul>',
@@ -4344,7 +4983,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Elemento del lista</li><li>Elemento del lista</li></ol>',
'edittoolbar-help-content-file-description' => 'File incastrate',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Exemplo.png|thumb|Texto del legenda]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Texto del legenda' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Texto del legenda</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Texto del legenda' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Texto del legenda</div></div>",
'edittoolbar-help-content-reference-description' => 'Referentia',
'edittoolbar-help-content-reference-syntax' => 'Texto del pagina.<ref name="test">[http://www.example.org Texto del ligamine], texto additional.</ref>',
'edittoolbar-help-content-reference-result' => "Texto del pagina.<sup><a href='#'>[1]</a></sup>",
@@ -4370,11 +5009,16 @@
'edittoolbar' => 'Batang alat penyuntingan',
'edittoolbar-desc' => 'Batang alat penyuntingan dengan kebergunaan yang ditingkatkan',
'edittoolbar-preference' => 'Aktifkan batang alat penyuntingan yang telah ditingkatkan',
+ 'edittoolbar-cgd-preference' => 'Mengaktifkan bantuan untuk menambahkan teks wiki',
'edittoolbar-loading' => 'Memuat...',
'edittoolbar-tool-bold' => 'Tebal',
'edittoolbar-tool-bold-example' => 'Teks tebal',
'edittoolbar-tool-italic' => 'Miring',
'edittoolbar-tool-italic-example' => 'Teks miring',
+ 'edittoolbar-tool-ilink' => 'Pranala internal',
+ 'edittoolbar-tool-ilink-example' => 'Judul pranala',
+ 'edittoolbar-tool-xlink' => 'Pranala luar (ingat prefiks http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.contoh.com judul pranala',
'edittoolbar-tool-link' => 'Pranala',
'edittoolbar-tool-link-title' => 'Masukkan pranala',
'edittoolbar-tool-link-int' => 'Ke halaman wiki',
@@ -4390,6 +5034,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Judul tidak sah',
'edittoolbar-tool-link-int-target-status-loading' => 'Memeriksa keberadaan halaman...',
'edittoolbar-tool-link-int-invalid' => 'Judul yang Anda berikan tidak sah.',
+ 'edittoolbar-tool-link-ext-invalid' => 'URL yang anda berikan tidak sah.',
'edittoolbar-tool-file' => 'Sisipkan berkas',
'edittoolbar-tool-file-example' => 'Contoh.jpg',
'edittoolbar-tool-reference' => 'Referensi',
@@ -4424,6 +5069,18 @@
{{ns:file}}:Contoh.jpg|Judul2',
'edittoolbar-tool-newline' => 'Baris baru',
'edittoolbar-tool-table' => 'Tabel',
+ 'edittoolbar-tool-table-example-old' => ' -
+! judul bagian 1
+! judul bagian 2
+! judul bagian 3
+|-
+| baris 1, sel 1
+| baris 1, sel 2
+| baris 1, sel 3
+|-
+| baris 2, sel 1
+| baris 2, sel 2
+| baris 2, sel 3',
'edittoolbar-tool-table-example' => 'Baris $1, sel $2',
'edittoolbar-tool-table-example-header' => 'Baris $1, sel $2 (kepala bagian)',
'edittoolbar-tool-table-title' => 'Masukkan tabel',
@@ -4433,7 +5090,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Sertakan baris',
'edittoolbar-tool-table-insert' => 'Masukkan',
'edittoolbar-tool-table-cancel' => 'Batalkan',
- 'edittoolbar-tool-replace' => 'Gantikan',
+ 'edittoolbar-tool-replace' => 'Cari dan gantikan',
'edittoolbar-tool-replace-title' => 'Cari dan ganti',
'edittoolbar-tool-replace-search' => 'Cari:',
'edittoolbar-tool-replace-replace' => 'Ganti dengan:',
@@ -4441,8 +5098,9 @@
'edittoolbar-tool-replace-regex' => "Perlakukan string pencarian sebagai ''regular expression (regex)''",
'edittoolbar-tool-replace-all' => 'Ganti semua yang cocok',
'edittoolbar-tool-replace-button' => 'Gantikan',
- 'edittoolbar-tool-replace-close' => 'Tutup',
+ 'edittoolbar-tool-replace-close' => 'Batalkan',
'edittoolbar-tool-replace-nomatch' => 'Pencarian Anda tidak membuahkan hasil.',
+ 'edittoolbar-tool-replace-success' => '$1 terjadi penggantian.',
'edittoolbar-section-characters' => 'Karakter spesial',
'edittoolbar-characters-page-latin' => 'Latin',
'edittoolbar-characters-page-latinextended' => 'Ekstensi Latin',
@@ -4502,7 +5160,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Isi daftar</li><li>Isi daftar</li></ol>',
'edittoolbar-help-content-file-description' => 'Menyisipkan berkas',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Contoh.png|thumb|Teks judul gambar]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Teks judul gambar' class='image' href='/wiki/Berkas:Wiki.png'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Perbesar' class='internal' href='/wiki/Berkas:Wiki.png'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Teks judul gambar</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Teks judul gambar' class='image' href='/wiki/Berkas:Wiki.png'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Perbesar' class='internal' href='/wiki/Berkas:Wiki.png'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Teks judul gambar</div></div>",
'edittoolbar-help-content-reference-description' => 'Referensi',
'edittoolbar-help-content-reference-syntax' => 'Teks halaman.<ref name="test">[http://www.contoh.org Teks pranala], teks tambahan.</ref>',
'edittoolbar-help-content-reference-result' => "Teks halaman.<sup><a href='#'>[1]</a></sup>",
@@ -4522,16 +5180,21 @@
/** Italian (Italiano)
* @author Darth Kule
* @author Melos
+ * @author Nemo bis
*/
$messages['it'] = array(
'edittoolbar' => 'Barra degli strumenti di modifica',
- 'edittoolbar-desc' => 'Modifica barra degli strumenti della pagina con una maggiore usabilità ',
+ 'edittoolbar-desc' => 'Barra degli strumenti di modifica della pagina con migliorata usabilità ',
'edittoolbar-preference' => 'Abilita barra degli strumenti di modifica avanzata',
'edittoolbar-loading' => 'Caricamento in corso...',
'edittoolbar-tool-bold' => 'Grassetto',
'edittoolbar-tool-bold-example' => 'Testo in grassetto',
'edittoolbar-tool-italic' => 'Corsivo',
'edittoolbar-tool-italic-example' => 'Testo in corsivo',
+ 'edittoolbar-tool-ilink' => 'Collegamento interno',
+ 'edittoolbar-tool-ilink-example' => 'Titolo del collegamento',
+ 'edittoolbar-tool-xlink' => 'Collegamento esterno (ricorda il prefisso http:// )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com titolo del collegamento',
'edittoolbar-tool-link' => 'Link',
'edittoolbar-tool-link-title' => 'Inserisci link',
'edittoolbar-tool-link-int' => 'A una pagina wiki',
@@ -4588,7 +5251,7 @@
'edittoolbar-tool-table-dimensions-columns' => 'Colonne',
'edittoolbar-tool-table-insert' => 'Inserisci',
'edittoolbar-tool-table-cancel' => 'Annulla',
- 'edittoolbar-tool-replace' => 'Sostituisci',
+ 'edittoolbar-tool-replace' => 'Cerca e sostituisci',
'edittoolbar-tool-replace-title' => 'Cerca e sostituisci',
'edittoolbar-tool-replace-search' => 'Cerca per:',
'edittoolbar-tool-replace-replace' => 'Sostituisci con:',
@@ -4596,7 +5259,7 @@
'edittoolbar-tool-replace-regex' => "Tratta la stringa di ricerca come un'espressione regolare",
'edittoolbar-tool-replace-all' => 'Sostituisci tutte le occorrenze',
'edittoolbar-tool-replace-button' => 'Sostituisci',
- 'edittoolbar-tool-replace-close' => 'Chiudi',
+ 'edittoolbar-tool-replace-close' => 'Annulla',
'edittoolbar-tool-replace-nomatch' => 'La tua ricerca non ha prodotto risultati.',
'edittoolbar-section-characters' => 'Caratteri speciali',
'edittoolbar-characters-page-latin' => 'Latino',
@@ -4657,7 +5320,7 @@
'edittoolbar-help-content-olist-result' => "<ol><li>Elemento dell'elenco</li><li>Elemento dell'elenco</li></ol>",
'edittoolbar-help-content-file-description' => 'File incorporato',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Esempio.png|thumb|Testo della didascalia]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Testo della didascalia</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Testo della didascalia</div></div>",
'edittoolbar-help-content-reference-description' => 'Nota',
'edittoolbar-help-content-reference-syntax' => 'Testo della pagina.<ref name="test">[http://www.example.org Testo del collegamento], testo aggiuntivo.</ref>',
'edittoolbar-help-content-reference-result' => "Testo della pagina.<sup><a href='#'>[1]</a></sup>",
@@ -4678,17 +5341,23 @@
* @author Aotake
* @author Fievarsty
* @author Fryed-peach
+ * @author Whym
* @author é’å守æŒ
*/
$messages['ja'] = array(
'edittoolbar' => '編集ツールãƒãƒ¼',
'edittoolbar-desc' => '使ã„ã‚„ã™ã•ã®å‘上ã—ãŸãƒšãƒ¼ã‚¸ç·¨é›†ãƒ„ールãƒãƒ¼',
'edittoolbar-preference' => '改良型編集ツールãƒãƒ¼ã‚’有効ã«ã™ã‚‹',
+ 'edittoolbar-cgd-preference' => '高度ãªã‚¦ã‚£ã‚テã‚ストã®è¿½åŠ ã«é–¢ã™ã‚‹ãƒ˜ãƒ«ãƒ—を有効化ã™ã‚‹',
'edittoolbar-loading' => 'èªã¿è¾¼ã¿ä¸â€¦',
'edittoolbar-tool-bold' => '太å—',
'edittoolbar-tool-bold-example' => '太å—テã‚スト',
'edittoolbar-tool-italic' => '斜体',
'edittoolbar-tool-italic-example' => '斜体テã‚スト',
+ 'edittoolbar-tool-ilink' => '内部リンク',
+ 'edittoolbar-tool-ilink-example' => 'リンクタイトル',
+ 'edittoolbar-tool-xlink' => '外部リンク (接é 辞 http:// を忘れãšã«)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com リンクタイトル',
'edittoolbar-tool-link' => 'リンク',
'edittoolbar-tool-link-title' => 'リンクã®æŒ¿å…¥',
'edittoolbar-tool-link-int' => 'ウィã‚ページã¸',
@@ -4704,6 +5373,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'ページåã¨ã—ã¦ç„¡åŠ¹ã§ã™',
'edittoolbar-tool-link-int-target-status-loading' => 'ページã®å˜åœ¨ã‚’確èªä¸â€¦',
'edittoolbar-tool-link-int-invalid' => '指定ã—ãŸãƒšãƒ¼ã‚¸åã¯ç„¡åŠ¹ã§ã™ã€‚',
+ 'edittoolbar-tool-link-ext-invalid' => 'ã‚ãªãŸãŒæŒ‡å®šã—㟠URL ã¯ç„¡åŠ¹ã§ã™ã€‚',
'edittoolbar-tool-file' => '埋ã‚è¾¼ã¿ãƒ•ã‚¡ã‚¤ãƒ«',
'edittoolbar-tool-file-example' => 'Example.jpg',
'edittoolbar-tool-reference' => '注釈',
@@ -4738,6 +5408,18 @@
{{ns:file}}:Example.jpg|ã‚ャプション2',
'edittoolbar-tool-newline' => '改行',
'edittoolbar-tool-table' => '表',
+ 'edittoolbar-tool-table-example-old' => '-
+! 見出㗠1
+! 見出㗠2
+! 見出㗠3
+|-
+| 行 1, セル 1
+| 行 1, セル 2
+| 行 1, セル 3
+|-
+| 行 2, セル 1
+| 行 2, セル 2
+| 行 2, セル 3',
'edittoolbar-tool-table-example' => '行 $1〠セル $2',
'edittoolbar-tool-table-example-header' => 'è¡Œ $1〠セル $2 (見出ã—)',
'edittoolbar-tool-table-title' => '表を挿入',
@@ -4747,7 +5429,7 @@
'edittoolbar-tool-table-dimensions-header' => 'ヘッダ列をå«ã‚ã‚‹',
'edittoolbar-tool-table-insert' => '挿入',
'edittoolbar-tool-table-cancel' => 'ä¸æ¢',
- 'edittoolbar-tool-replace' => 'ç½®æ›',
+ 'edittoolbar-tool-replace' => '検索ã¨ç½®æ›',
'edittoolbar-tool-replace-title' => '検索ã¨ç½®æ›',
'edittoolbar-tool-replace-search' => '検索ã™ã‚‹æ–‡å—列:',
'edittoolbar-tool-replace-replace' => 'ç½®æ›å¾Œã®æ–‡å—列:',
@@ -4755,8 +5437,9 @@
'edittoolbar-tool-replace-regex' => 'æ£è¦è¡¨ç¾ã§æ¤œç´¢ã™ã‚‹',
'edittoolbar-tool-replace-all' => 'ã™ã¹ã¦ç½®æ›ã™ã‚‹',
'edittoolbar-tool-replace-button' => 'ç½®æ›',
- 'edittoolbar-tool-replace-close' => 'é–‰ã˜ã‚‹',
+ 'edittoolbar-tool-replace-close' => 'ä¸æ¢',
'edittoolbar-tool-replace-nomatch' => '検索文å—列ã«ä¸€è‡´ã™ã‚‹ã‚‚ã®ã¯ã‚ã‚Šã¾ã›ã‚“ã§ã—ãŸã€‚',
+ 'edittoolbar-tool-replace-success' => '$1回ã®ç½®æ›ãŒè¡Œã‚ã‚Œã¾ã—ãŸã€‚',
'edittoolbar-section-characters' => '特殊文å—',
'edittoolbar-characters-page-latin' => 'ラテン文å—',
'edittoolbar-characters-page-latinextended' => '拡張ラテン文å—',
@@ -4816,7 +5499,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>箇æ¡æ›¸ãé …ç›®</li><li>箇æ¡æ›¸ãé …ç›®</li></ol>',
'edittoolbar-help-content-file-description' => '埋ã‚è¾¼ã¿ãƒ•ã‚¡ã‚¤ãƒ«',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|ã‚ャプション]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='ã‚ャプション' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>ã‚ャプション</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='ã‚ャプション' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>ã‚ャプション</div></div>",
'edittoolbar-help-content-reference-description' => '注釈',
'edittoolbar-help-content-reference-syntax' => 'ページ本文<ref name="test">[http://www.example.org リンクタイトル]ã€è¿½åŠ テã‚スト</ref>。',
'edittoolbar-help-content-reference-result' => "ページ本文<sup><a href='#'>[1]</a></sup>。",
@@ -4846,6 +5529,10 @@
'edittoolbar-tool-bold-example' => 'მუქი ტექსტი',
'edittoolbar-tool-italic' => 'კურსივი',
'edittoolbar-tool-italic-example' => 'კურსივის ტექსტი',
+ 'edittoolbar-tool-ilink' => 'შიდრბმული',
+ 'edittoolbar-tool-ilink-example' => 'ბმულის სáƒáƒ—áƒáƒ£áƒ ი',
+ 'edittoolbar-tool-xlink' => 'გáƒáƒ ე ბმული (გáƒáƒ®áƒ¡áƒáƒ•áƒ“ეთ http:// პრეფიქსი)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com ბმულის სáƒáƒ—áƒáƒ£áƒ ი',
'edittoolbar-tool-file' => 'ჩáƒáƒ¡áƒ›áƒ£áƒšáƒ˜ ფáƒáƒ˜áƒšáƒ˜',
'edittoolbar-tool-file-example' => 'მáƒáƒ’áƒáƒšáƒ˜áƒ—ი.jpg',
'edittoolbar-tool-reference' => 'მინიშნებები',
@@ -4937,7 +5624,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>სიის ელემენტი</li><li>სიის ელემენტი</li></ol>',
'edittoolbar-help-content-file-description' => 'ჩáƒáƒ¡áƒ›áƒ£áƒšáƒ˜ ფáƒáƒ˜áƒšáƒ˜',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|წáƒáƒ წერის ტექსტი]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='წáƒáƒ წერის ტექსტი' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>წáƒáƒ წერის ტექსტი</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='წáƒáƒ წერის ტექსტი' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>წáƒáƒ წერის ტექსტი</div></div>",
'edittoolbar-help-content-reference-description' => 'მინიშნებáƒ',
'edittoolbar-help-content-reference-syntax' => 'გვერდის ტექსტი<ref name="test">[http://www.example.org ბმულის ტექსტი], დáƒáƒ›áƒáƒ¢áƒ”ბითი ტექსტი.</ref>.',
'edittoolbar-help-content-reference-result' => "გვერდის ტექსტი<sup><a href='#'>[1]</a></sup>.",
@@ -4965,6 +5652,10 @@
'edittoolbar-tool-bold-example' => 'អážáŸ’ážáž”ទជាអក្សរដិáž',
'edittoolbar-tool-italic' => 'អក្សរទ្រáŸáž',
'edittoolbar-tool-italic-example' => 'អážáŸ’ážáž”ទជាអក្សរទ្រáŸáž',
+ 'edittoolbar-tool-ilink' => 'ážáŸ†ážŽáž—្ជាប់​ážáž¶áž„ក្នុង',
+ 'edittoolbar-tool-ilink-example' => 'ចំណងជើង​ážáŸ†ážŽáž—្ជាប់',
+ 'edittoolbar-tool-xlink' => 'ážáŸ†ážŽáž—្ជាប់​ážáž¶áž„ក្រៅ (កុំភ្លáŸáž…​ដាក់ http:// នៅពីមុáž)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com ចំណងជើង​ážáŸ†ážŽáž—្ជាប់',
'edittoolbar-tool-file' => 'រូបភាពបង្កប់',
'edittoolbar-tool-file-example' => 'ឧទាហរណáŸ.jpg',
'edittoolbar-tool-reference' => 'ឯកសារយោង',
@@ -5104,6 +5795,10 @@
'edittoolbar-tool-bold-example' => 'êµµì€ ê¸€ì”¨',
'edittoolbar-tool-italic' => 'ê¸°ìš¸ì¸ ê¸€ì”¨',
'edittoolbar-tool-italic-example' => 'ê¸°ìš¸ì¸ ê¸€ì”¨',
+ 'edittoolbar-tool-ilink' => '내부 ë§í¬',
+ 'edittoolbar-tool-ilink-example' => '문서 ì œëª©',
+ 'edittoolbar-tool-xlink' => '외부 ë§í¬ ( http:// 를 붙여 주세요 )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com ë§í¬ ì´ë¦„',
'edittoolbar-tool-link-ext-target' => 'ë§í¬ URL:',
'edittoolbar-tool-file' => 'íŒŒì¼ ë„£ê¸°',
'edittoolbar-tool-file-example' => 'Exemple.jpg',
@@ -5197,7 +5892,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>ëª©ë¡ í•ëª©</li><li>ëª©ë¡ í•ëª©</li></ol>',
'edittoolbar-help-content-file-description' => 'íŒŒì¼ ë„£ê¸°',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|그림 설명]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='ì‹¤ì œ í¬ê¸°ë¡œ' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>그림 설명</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='ì‹¤ì œ í¬ê¸°ë¡œ' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>그림 설명</div></div>",
'edittoolbar-help-content-reference-description' => '출처',
'edittoolbar-help-content-reference-syntax' => '문서 ë‚´ìš©.<ref name="test">[http://www.example.org ë§í¬ ì œëª©], 기타 설명.</ref>',
'edittoolbar-help-content-reference-result' => "문서 내용.<sup><a href='#'>[1]</a></sup>",
@@ -5221,11 +5916,16 @@
'edittoolbar' => 'Werkzüsh för et Ändere',
'edittoolbar-desc' => 'Verbesserte Werkzüsh för et Ändere',
'edittoolbar-preference' => 'Donn et ußföerlesh Werkzüsh för et Ändere aanzeije (bruch Java_Skripp)',
+ 'edittoolbar-cgd-preference' => 'Donn Hülp aanzeije för fottjeschredde Wikitäx ennzefööje',
'edittoolbar-loading' => 'Am Laade{{int:ellipsis}}',
'edittoolbar-tool-bold' => 'Fätte Schreff',
'edittoolbar-tool-bold-example' => 'Fätte Schreff',
'edittoolbar-tool-italic' => 'Scheive Schreff',
'edittoolbar-tool-italic-example' => 'Scheive Schreff',
+ 'edittoolbar-tool-ilink' => 'Lenk en et Wiki',
+ 'edittoolbar-tool-ilink-example' => 'Dä Tittel vun dä Sigk, woh dä Lengk drop jonn sull',
+ 'edittoolbar-tool-xlink' => 'Lengk noh Ußerhallf vum Wiki',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com Täx för Aanzezeije, för däm Lengk singe Anker',
'edittoolbar-tool-link' => 'Lenk',
'edittoolbar-tool-link-title' => 'Donn ene Lengk dobei',
'edittoolbar-tool-link-int' => 'Op en Sigg em Wiki',
@@ -5241,6 +5941,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Dat es ene onjöltijje Tittel för en Sigg',
'edittoolbar-tool-link-int-target-status-loading' => 'Ben aam Prööfe, ov et di Sigg jitt{{int:ellipsis}}',
'edittoolbar-tool-link-int-invalid' => 'Dä aanjejovve Tittel för en Sigg en onjöltesch.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Do häs ene onjültijje <i lang="en">URL</i> aanjejovve',
'edittoolbar-tool-file' => 'Enjefösh Dattei',
'edittoolbar-tool-file-example' => 'Beld_Beishpöll.jpeg',
'edittoolbar-tool-reference' => 'Fohßnoht',
@@ -5275,6 +5976,18 @@
{{ns:file}}:Beishpell.jpg|zweijte Beld-Täx',
'edittoolbar-tool-newline' => 'Neu Reih',
'edittoolbar-tool-table' => 'Tabäll',
+ 'edittoolbar-tool-table-example-old' => '-
+! 1. Shpalldekopp
+! 2. Shpalldekopp
+! 3. Shpalldekopp
+|-
+| 1. Reij, 1. Shpalldt
+| 1. Reij, 2. Shpalldt
+| 1. Reij, 3. Shpalldt
+|-
+| 2. Reij, 1. Shpalldt
+| 2. Reij, 2. Shpalldt
+| 2. Reij, 3. Shpalldt',
'edittoolbar-tool-table-example' => 'De $2. Kolommne en de $1. Reij',
'edittoolbar-tool-table-example-header' => 'De $2. Kolommne en de $1. Reij (Kopp)',
'edittoolbar-tool-table-title' => 'Tabäll ennfööje',
@@ -5292,8 +6005,9 @@
'edittoolbar-tool-replace-regex' => '„{{int:Edittoolbar-tool-replace-search}}“ es en <i lang="en">regular expression</i>',
'edittoolbar-tool-replace-all' => 'Överall Ußtuusche',
'edittoolbar-tool-replace-button' => 'Lohß Jonn!',
- 'edittoolbar-tool-replace-close' => 'Zohmaache',
+ 'edittoolbar-tool-replace-close' => 'Ophüüre!',
'edittoolbar-tool-replace-nomatch' => 'Doh ham_mer nix jefonge.',
+ 'edittoolbar-tool-replace-success' => '$1 Mohl jet <!--{{PLURAL:$1|Eijmol|$1 Mohl jet|Nix}}--> jetuusch.',
'edittoolbar-section-characters' => 'Sönderzeijsche',
'edittoolbar-characters-page-latin' => 'Lateinesch',
'edittoolbar-characters-page-latinextended' => 'Lateinesch met Extras',
@@ -5353,7 +6067,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Enndraach en de Leß</li><li>Enndraach en de Leß</li></ol>',
'edittoolbar-help-content-file-description' => 'Enjeföösch Dattei',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Beld_Ungerschreff]]',
- 'edittoolbar-help-content-file-result' => '<div style="width:104px;" class="thumbinner"><a title="Schreff unger dä Beld" class="image" href="/wiki/File:Wiki.png"><img height="50" width="100" border="0" class="thumbimage" src="extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png" alt=""/></a><div class="thumbcaption"><div class="magnify"><a title="Enlarge" class="internal" href="/wiki/File:Wiki.png"><img height="11" width="15" alt="" src="skins/common/images/magnify-clip.png"/></a></div>Schreff unger dä Beld</div></div>',
+ 'edittoolbar-help-content-file-result' => '<div style="width:104px;" class="thumbinner"><a title="Schreff unger dä Beld" class="image" href="/wiki/File:Wiki.png"><img height="50" width="100" border="0" class="thumbimage" src="extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png" alt=""/></a><div class="thumbcaption"><div class="magnify"><a title="Enlarge" class="internal" href="/wiki/File:Wiki.png"><img height="11" width="15" alt="" src="{{STYLEPATH}}/common/images/magnify-clip.png"/></a></div>Schreff unger dä Beld</div></div>',
'edittoolbar-help-content-reference-description' => 'Fohßnoht',
'edittoolbar-help-content-reference-syntax' => 'Tex en dä Sigg. <ref name="versoht">[http://www.example.org Täx för dä Lengk], un noch jät mieh Täx.</ref>',
'edittoolbar-help-content-reference-result' => 'Tex en dä Sigg. <sup><a href="#">[1]</a></sup>',
@@ -5370,11 +6084,21 @@
'edittoolbar-help-content-indent-result' => 'Nommaale Täx<dl><dd>Enjerök<dl><dd>Un norrens enjerök</dd></dl></dd></dl>',
);
+/** Cornish (Kernowek)
+ * @author Kernoweger
+ */
+$messages['kw'] = array(
+ 'edittoolbar-help-page-discussion' => 'Dadhelva',
+);
+
/** Latin (Latina)
* @author Omnipaedista
*/
$messages['la'] = array(
'edittoolbar-loading' => 'Depromens…',
+ 'edittoolbar-tool-ilink-example' => 'Titulus nexus externi',
+ 'edittoolbar-tool-xlink' => 'Nexus externus (memento praefixi http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.exemplum.com titulus nexus externi',
'edittoolbar-tool-file' => 'Fasciculus in pagina impositus',
'edittoolbar-tool-file-example' => 'Exemplum.jpg',
'edittoolbar-tool-reference' => 'Referentia bibliographica',
@@ -5433,11 +6157,16 @@
'edittoolbar' => 'Toolbar änneren',
'edittoolbar-desc' => 'Toolbar vun de Säitenännerunge mat erweiderter Benotzerfrëndlechkeet',
'edittoolbar-preference' => 'Déi erweidert Ännerungs-Toolbar aktivéieren',
+ 'edittoolbar-cgd-preference' => 'Hëllef fir erweiderte Wikitext derbäisetzen',
'edittoolbar-loading' => 'Lueden...',
'edittoolbar-tool-bold' => 'Fettgedréckt',
'edittoolbar-tool-bold-example' => 'Fettgedréckten Text',
'edittoolbar-tool-italic' => 'Kursiv',
'edittoolbar-tool-italic-example' => 'Kursiven Text',
+ 'edittoolbar-tool-ilink' => 'Interne Link',
+ 'edittoolbar-tool-ilink-example' => 'Titel vum Link',
+ 'edittoolbar-tool-xlink' => 'Externe Link (denkt un de Prefix http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com Titel vum Link',
'edittoolbar-tool-link' => 'Link',
'edittoolbar-tool-link-title' => 'Link drasetzen',
'edittoolbar-tool-link-int' => 'Op e Wikiartikel/eng Wikisäit',
@@ -5453,6 +6182,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Net valabelen Titel',
'edittoolbar-tool-link-int-target-status-loading' => "Et gëtt nogekuckt ob et d'Säit gëtt...",
'edittoolbar-tool-link-int-invalid' => 'Den Titel deen Dir uginn hutt ass net valabel.',
+ 'edittoolbar-tool-link-ext-invalid' => "D'URL déi Dir uginn hutt as net valabel.",
'edittoolbar-tool-file' => 'Agebonnene Fichier',
'edittoolbar-tool-file-example' => 'Beispill.jpg',
'edittoolbar-tool-reference' => 'Referenz',
@@ -5487,6 +6217,18 @@
{{ns:file}}:Example.jpg|Beschreiwung2',
'edittoolbar-tool-newline' => 'Nei Linn',
'edittoolbar-tool-table' => 'Tabell',
+ 'edittoolbar-tool-table-example-old' => '-
+! Iwwerschrëft 1
+! Iwwerschrëft 2
+! Iwwerschrëft 3
+|-
+| Rei 1, Zell 1
+| Rei 1, Zell 2
+| Rei 1, Zell 3
+|-
+| Rei 2, Zell 1
+| Rei 2, Zell 2
+| Rei 2, Zell 3',
'edittoolbar-tool-table-example' => 'Rei $1, Zell $2',
'edittoolbar-tool-table-example-header' => 'Rei $1, Zell $2 (Iwwerschrëft)',
'edittoolbar-tool-table-title' => 'Tabell drasetzen',
@@ -5496,7 +6238,7 @@
'edittoolbar-tool-table-dimensions-header' => "D'Rei vun der Iwwerschrëft matabezéien",
'edittoolbar-tool-table-insert' => 'Drasetzen',
'edittoolbar-tool-table-cancel' => 'Ofbriechen',
- 'edittoolbar-tool-replace' => 'Ersetzen',
+ 'edittoolbar-tool-replace' => 'Sichen an ersetzen',
'edittoolbar-tool-replace-title' => 'Sichen an ersetzen',
'edittoolbar-tool-replace-search' => 'Sichen no:',
'edittoolbar-tool-replace-replace' => 'Ersetzen duerch:',
@@ -5504,8 +6246,9 @@
'edittoolbar-tool-replace-regex' => 'Dat no deem Dir sicht als regulären Ausdrock behandelen',
'edittoolbar-tool-replace-all' => 'Iwerall (wou et fonnt gouf) ersetzen',
'edittoolbar-tool-replace-button' => 'Ersetzen',
- 'edittoolbar-tool-replace-close' => 'Zoumaachen',
+ 'edittoolbar-tool-replace-close' => 'Ofbriechen',
'edittoolbar-tool-replace-nomatch' => 'Är Sich hat kee Resultat.',
+ 'edittoolbar-tool-replace-success' => '$1 mol ersat.',
'edittoolbar-section-characters' => 'Spezialzeechen',
'edittoolbar-characters-page-latin' => 'Laténgesch',
'edittoolbar-characters-page-latinextended' => 'Laténgesch, erweidert',
@@ -5573,7 +6316,7 @@
</ol>',
'edittoolbar-help-content-file-description' => 'Agebonnene Fichier',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Ugewisenen Text]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Ugewisenen Texte' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Ugewisenen Text</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Ugewisenen Texte' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Ugewisenen Text</div></div>",
'edittoolbar-help-content-reference-description' => 'Referenz',
'edittoolbar-help-content-reference-syntax' => 'Text vun der Säit.<ref name="test">[http://www.example.org Text vum Link], zousätzlechen Text.</ref>',
'edittoolbar-help-content-reference-result' => "Text vun der Säit <sup><a href='#'>[1]</a></sup>",
@@ -5602,6 +6345,7 @@
);
/** Lithuanian (Lietuvių)
+ * @author Homo
* @author Matasg
*/
$messages['lt'] = array(
@@ -5613,6 +6357,11 @@
'edittoolbar-tool-bold-example' => 'Paryškinti tekstą',
'edittoolbar-tool-italic' => 'Kursyvas',
'edittoolbar-tool-italic-example' => 'Tekstas kursyvu',
+ 'edittoolbar-tool-ilink' => 'VidinÄ— nuoroda',
+ 'edittoolbar-tool-ilink-example' => 'Nuorodos pavadinimas',
+ 'edittoolbar-tool-xlink' => 'Išorinė nuoroda (nepamirškite http:// priedėlio)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com nuorodos pavadinimas',
+ 'edittoolbar-tool-link-cancel' => 'Atšaukti',
'edittoolbar-tool-file' => 'Įdėti failą',
'edittoolbar-tool-file-example' => 'Pavyzdys.jpg',
'edittoolbar-tool-reference' => 'Išnaša',
@@ -5697,7 +6446,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Sąrašo elementas</li><li>Sąrašo elementas</li></ol>',
'edittoolbar-help-content-file-description' => 'Įterpti failą',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Aprašymas]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Aprašymas</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Aprašymas</div></div>",
'edittoolbar-help-content-reference-description' => 'Išnaša',
'edittoolbar-help-content-reference-syntax' => 'Puslapio tekstas.<ref name="test">[http://www.example.org Nuorodos tekstas], papildomas tekstas.</ref>',
'edittoolbar-help-content-reference-result' => "Puslapio tekstas.<sup><a href='#'>[1]</a></sup>",
@@ -5717,6 +6466,7 @@
/** Latvian (Latviešu)
* @author Marozols
* @author Papuass
+ * @author Yyy
*/
$messages['lv'] = array(
'edittoolbar' => 'Rediģēšanas rīku josla',
@@ -5727,6 +6477,10 @@
'edittoolbar-tool-bold-example' => 'Pustrekns teksts',
'edittoolbar-tool-italic' => 'KursÄ«vÄ',
'edittoolbar-tool-italic-example' => 'Teksts kursÄ«vÄ',
+ 'edittoolbar-tool-ilink' => 'IekÅ¡Ä“jÄ saite',
+ 'edittoolbar-tool-ilink-example' => 'Saites teksts',
+ 'edittoolbar-tool-xlink' => 'Ä€rÄ“jÄ saite (neaizmirsti adresi sÄkt ar "http://")',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com saites teksts',
'edittoolbar-tool-link' => 'Saite',
'edittoolbar-tool-link-title' => 'Ievietot saiti',
'edittoolbar-tool-link-int' => 'Iekšēja saite',
@@ -5771,7 +6525,7 @@
{{ns:file}}:Example.jpg|Apraksts2',
'edittoolbar-tool-newline' => 'Jauna rinda',
'edittoolbar-tool-table' => 'Tabula',
- 'edittoolbar-tool-replace' => 'AizstÄt',
+ 'edittoolbar-tool-replace' => 'MeklÄ“t un aizstÄt',
'edittoolbar-tool-replace-title' => 'MeklÄ“t un aizstÄt',
'edittoolbar-tool-replace-search' => 'Meklēt:',
'edittoolbar-tool-replace-replace' => 'AizstÄt ar:',
@@ -5840,7 +6594,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Saraksta elements</li><li>Saraksta elements</li></ol>',
'edittoolbar-help-content-file-description' => 'Iekļauts fails',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Apraksts]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Apraksts' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='PalielinÄt' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Apraksts</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Apraksts' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='PalielinÄt' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Apraksts</div></div>",
'edittoolbar-help-content-reference-description' => 'Atsauce',
'edittoolbar-help-content-reference-syntax' => 'Lapas teksts.<ref name="test">[http://www.example.org Saites teksts], papildus teksts.</ref>',
'edittoolbar-help-content-reference-result' => "Lapas teksts.<sup><a href='#'>[1]</a></sup>",
@@ -5869,6 +6623,10 @@
'edittoolbar-tool-bold-example' => 'Задебелен текÑÑ‚',
'edittoolbar-tool-italic' => 'КоÑо',
'edittoolbar-tool-italic-example' => 'ЗакоÑен текÑÑ‚',
+ 'edittoolbar-tool-ilink' => 'Внатрешна врÑка',
+ 'edittoolbar-tool-ilink-example' => 'ÐаÑлов на врÑката',
+ 'edittoolbar-tool-xlink' => 'Ðадворешна врÑка (бара Ð¿Ñ€ÐµÑ„Ð¸ÐºÑ http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.пример.com наÑлов на врÑката',
'edittoolbar-tool-link' => 'Ð’Ñ€Ñка',
'edittoolbar-tool-link-title' => 'Вметни врÑка',
'edittoolbar-tool-link-int' => 'Кон вики-Ñтраница',
@@ -5923,8 +6681,6 @@
'edittoolbar-tool-table-dimensions' => 'Димензии',
'edittoolbar-tool-table-dimensions-rows' => 'Редови',
'edittoolbar-tool-table-dimensions-columns' => 'Колони',
- 'edittoolbar-tool-table-dimensions-headerrows' => 'ÐаÑловни редови',
- 'edittoolbar-tool-table-dimensions-headercolumns' => 'ÐаÑловни колони',
'edittoolbar-tool-table-insert' => 'Вметни',
'edittoolbar-tool-table-cancel' => 'Откажи',
'edittoolbar-tool-replace' => 'Замени',
@@ -5996,7 +6752,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Ставка</li><li>Ставка</li></ol>',
'edittoolbar-help-content-file-description' => 'Вметната податотека',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Пример.png|мини|ОпиÑ]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='ОпиÑ' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Зголеми' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>ОпиÑ</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='ОпиÑ' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Зголеми' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>ОпиÑ</div></div>",
'edittoolbar-help-content-reference-description' => 'Ðавод',
'edittoolbar-help-content-reference-syntax' => 'ТекÑÑ‚ во Ñтраницата.<ref name="test">[http://www.пример.org ТекÑÑ‚ на врÑката], дополнителен текÑÑ‚.</ref>',
'edittoolbar-help-content-reference-result' => "ТекÑÑ‚ во Ñтраницата.<sup><a href='#'>[1]</a></sup>",
@@ -6014,10 +6770,113 @@
);
/** Malayalam (മലയാളം)
+ * @author Praveenp
* @author Sadik Khalid
*/
$messages['ml'] = array(
+ 'edittoolbar' => 'തിരàµà´¤àµà´¤àµ½ ടൂൾബാർ',
+ 'edittoolbar-desc' => 'തിരàµà´¤àµà´¤à´¾à´¨àµà´³àµà´³ താളിൽ മെചàµà´šà´ªàµà´ªàµ†à´Ÿàµà´Ÿ ഉപയോഗതàµà´¤à´¿à´¨à´¾à´¯àµà´³àµà´³ ടൂൾബാർ',
+ 'edittoolbar-preference' => 'തിരàµà´¤àµà´¤àµà´µà´¾à´¨àµà´³àµà´³ വിശദ പണിപàµà´ªàµ†à´Ÿàµà´Ÿà´¿ ഉപയോഗപàµà´ªàµ†à´Ÿàµà´¤àµà´¤àµà´•',
+ 'edittoolbar-cgd-preference' => 'വിപàµà´²à´®à´¾à´¯ വികàµà´•à´¿ à´Žà´´àµà´¤àµà´¤àµà´•àµ¾ ചേർകàµà´•à´¾à´¨àµà´³àµà´³ സഹായം നൽകàµà´•',
+ 'edittoolbar-loading' => 'ശേഖരികàµà´•àµà´¨àµà´¨àµ...',
+ 'edittoolbar-tool-bold' => 'à´•à´Ÿàµà´ªàµà´ªà´¿à´•àµà´•àµà´•',
+ 'edittoolbar-tool-bold-example' => 'à´•à´Ÿàµà´Ÿà´¿à´•àµ‚à´Ÿàµà´Ÿà´¿à´¯ à´Žà´´àµà´¤àµà´¤àµ',
+ 'edittoolbar-tool-italic' => 'à´šà´°à´¿à´šàµà´šàµ',
+ 'edittoolbar-tool-italic-example' => 'à´šà´°à´¿à´šàµà´šàµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ',
+ 'edittoolbar-tool-ilink' => 'ആനàµà´¤à´°à´¿à´• à´•à´£àµà´£à´¿',
+ 'edittoolbar-tool-ilink-example' => 'à´•à´£àµà´£à´¿à´¯àµà´Ÿàµ† തലകàµà´•àµ†à´Ÿàµà´Ÿàµ',
+ 'edittoolbar-tool-xlink' => 'à´ªàµà´±à´¤àµà´¤àµ‡à´¯àµà´•àµà´•àµà´³àµà´³ à´•à´£àµà´£à´¿ (ആദàµà´¯à´‚ http:// കൊടàµà´•àµà´•à´¾àµ» ഓർകàµà´•àµà´•)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com à´•à´£àµà´£à´¿ തലകàµà´•àµ†à´Ÿàµà´Ÿàµ',
+ 'edittoolbar-tool-link' => 'à´•à´£àµà´£à´¿',
+ 'edittoolbar-tool-link-title' => 'à´•à´£àµà´£à´¿ ഉൾപàµà´ªàµ†à´Ÿàµà´¤àµà´¤àµà´•',
+ 'edittoolbar-tool-link-int' => 'ഒരൠവികàµà´•à´¿ താളിലേയàµà´•àµà´•àµ',
+ 'edittoolbar-tool-link-int-target' => 'താളിനàµà´±àµ† തലകàµà´•àµ†à´Ÿàµà´Ÿàµ',
+ 'edittoolbar-tool-link-int-text' => 'à´•à´£àµà´£à´¿à´¯à´¾à´µàµ‡à´£àµà´Ÿ à´Žà´´àµà´¤àµà´¤àµ:',
+ 'edittoolbar-tool-link-ext' => 'à´ªàµà´±à´¤àµà´¤àµà´³àµà´³ വെബൠതാളിലേയàµà´•àµà´•àµ',
+ 'edittoolbar-tool-link-ext-target' => 'à´•à´£àµà´£à´¿à´¯àµà´Ÿàµ† യൂആർഎൽ',
+ 'edittoolbar-tool-link-ext-text' => 'à´•à´£àµà´£à´¿à´¯à´¾à´•àµ‡à´£àµà´Ÿ à´Žà´´àµà´¤àµà´¤àµ:',
+ 'edittoolbar-tool-link-insert' => 'à´•à´£àµà´£à´¿ ഉൾപàµà´ªàµ†à´Ÿàµà´¤àµà´¤àµà´•',
+ 'edittoolbar-tool-link-cancel' => 'റദàµà´¦à´¾à´•àµà´•àµà´•',
+ 'edittoolbar-tool-link-int-target-status-exists' => 'താൾ നിലനിൽകàµà´•àµà´¨àµà´¨àµ',
+ 'edittoolbar-tool-link-int-target-status-notexists' => 'താൾ നിലനിൽകàµà´•àµà´¨àµà´¨à´¿à´²àµà´²',
+ 'edittoolbar-tool-link-int-target-status-invalid' => 'അസാധàµà´µà´¾à´¯ തലകàµà´•àµ†à´Ÿàµà´Ÿàµ',
+ 'edittoolbar-tool-link-int-target-status-loading' => 'താൾ നിലനിൽകàµà´•àµà´¨àµà´¨àµà´£àµà´Ÿàµ‹ à´Žà´¨àµà´¨àµ പരിശോധികàµà´•àµà´¨àµà´¨àµ...',
+ 'edittoolbar-tool-link-int-invalid' => 'താങàµà´•àµ¾ നൽകിയ തലകàµà´•àµ†à´Ÿàµà´Ÿàµ അസാധàµà´µà´¾à´£àµ.',
+ 'edittoolbar-tool-link-ext-invalid' => 'താങàµà´•àµ¾ നൽകിയ യൂആർഎൽ അസാധàµà´µà´¾à´£àµ.',
+ 'edittoolbar-tool-reference' => 'അവലംബം',
+ 'edittoolbar-tool-signature' => 'à´’à´ªàµà´ªàµà´‚ സമയമàµà´¦àµà´°à´¯àµà´‚',
+ 'edittoolbar-section-advanced' => 'വിപàµà´²àµ€à´•à´°à´¿à´•àµà´•à´ªàµà´ªàµ†à´Ÿàµà´Ÿà´µ',
+ 'edittoolbar-tool-heading' => 'തലകàµà´•àµ†à´Ÿàµà´Ÿàµ',
+ 'edittoolbar-tool-heading-1' => 'തലം 1',
+ 'edittoolbar-tool-heading-2' => 'തലം 2',
+ 'edittoolbar-tool-heading-3' => 'തലം 3',
+ 'edittoolbar-tool-heading-4' => 'തലം 4',
+ 'edittoolbar-tool-heading-5' => 'തലം 5',
+ 'edittoolbar-tool-heading-example' => 'തലകàµà´•àµ†à´Ÿàµà´Ÿà´¾à´•à´¾à´¨àµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ',
+ 'edittoolbar-group-size' => 'വലിപàµà´ªà´‚',
+ 'edittoolbar-tool-big' => 'വലàµà´¤àµ',
+ 'edittoolbar-tool-big-example' => 'വലിയ à´Žà´´àµà´¤àµà´¤àµ',
+ 'edittoolbar-tool-small' => 'ചെറിയതàµ',
+ 'edittoolbar-tool-small-example' => 'ചെറിയ à´Žà´´àµà´¤àµà´¤àµ',
+ 'edittoolbar-group-insert' => 'ഉൾപàµà´ªàµ†à´Ÿàµà´¤àµà´¤àµà´•',
+ 'edittoolbar-tool-gallery' => 'à´šà´¿à´¤àµà´°à´¸à´žàµà´šà´¯à´‚',
+ 'edittoolbar-tool-newline' => 'à´ªàµà´¤à´¿à´¯ വരി',
+ 'edittoolbar-tool-table-cancel' => 'റദàµà´¦à´¾à´•àµà´•àµà´•',
+ 'edittoolbar-tool-replace' => 'à´•à´£àµà´Ÿàµ†à´¤àµà´¤àµà´• മാറàµà´±àµà´•',
+ 'edittoolbar-tool-replace-title' => 'à´•à´£àµà´Ÿàµ†à´¤àµà´¤àµà´• മാറàµà´±àµà´•',
+ 'edittoolbar-tool-replace-search' => 'ഇതൠകണàµà´Ÿàµ†à´¤àµà´¤àµà´•:',
+ 'edittoolbar-tool-replace-replace' => 'ഇതàµà´•àµŠà´£àµà´Ÿàµ മാറàµà´±àµà´•',
+ 'edittoolbar-tool-replace-case' => 'à´…à´•àµà´·à´°à´®à´¾à´²à´¾ തരവàµà´‚ (case) à´’à´¤àµà´¤àµà´¨àµ‹à´•àµà´•àµà´•',
+ 'edittoolbar-tool-replace-all' => 'à´’à´¤àµà´¤àµà´ªàµ‹à´•àµà´¨àµà´¨à´¤àµ†à´²àµà´²à´¾à´‚ മാറàµà´±àµà´•',
+ 'edittoolbar-tool-replace-button' => 'പകരം മാറàµà´±àµà´•',
+ 'edittoolbar-tool-replace-close' => 'റദàµà´¦à´¾à´•àµà´•àµà´•',
+ 'edittoolbar-tool-replace-nomatch' => 'താങàµà´•à´³àµà´Ÿàµ† തിരചàµà´šà´¿à´²àµà´®à´¾à´¯à´¿ à´’à´¨àµà´¨àµà´‚ à´’à´¤àµà´¤àµà´ªàµ‹à´•àµà´¨àµà´¨à´¿à´²àµà´².',
+ 'edittoolbar-tool-replace-success' => '$1 മാറàµà´±à´¿à´µàµ†à´¯àµà´•àµà´•àµ½(കൾ) നടതàµà´¤à´¿.',
+ 'edittoolbar-section-characters' => 'à´ªàµà´°à´¤àµà´¯àµ‡à´• ലിപികൾ',
+ 'edittoolbar-characters-page-latin' => 'ലാറàµà´±à´¿àµ»',
+ 'edittoolbar-characters-page-latinextended' => 'ലാറàµà´±à´¿àµ» വിപàµà´²à´‚',
+ 'edittoolbar-characters-page-ipa' => 'à´.പി.à´Ž.',
+ 'edittoolbar-characters-page-symbols' => 'à´šà´¿à´¹àµà´¨à´¨à´™àµà´™àµ¾',
+ 'edittoolbar-characters-page-greek' => 'à´—àµà´°àµ€à´•àµà´•àµ',
+ 'edittoolbar-characters-page-cyrillic' => 'സിറിലികàµ',
+ 'edittoolbar-characters-page-arabic' => 'അറബികàµ',
+ 'edittoolbar-characters-page-hebrew' => 'ഹീബàµà´°àµ',
+ 'edittoolbar-characters-page-telugu' => 'തെലàµà´™àµà´•àµ',
+ 'edittoolbar-section-help' => 'സഹായം',
+ 'edittoolbar-help-heading-description' => 'വിവരണം',
+ 'edittoolbar-help-heading-syntax' => 'താങàµà´•àµ¾ ടൈപàµà´ªàµ ചെയàµà´¯àµà´¨àµà´¨à´¤àµ',
+ 'edittoolbar-help-heading-result' => 'താങàµà´•àµ¾à´•àµà´•àµ à´²à´à´¿à´•àµà´•àµà´¨àµà´¨à´¤àµ',
+ 'edittoolbar-help-page-link' => 'à´•à´£àµà´£à´¿à´•àµ¾',
+ 'edittoolbar-help-page-heading' => 'തലകàµà´•àµ†à´Ÿàµà´Ÿàµà´•àµ¾',
+ 'edittoolbar-help-page-file' => 'à´ªàµà´°à´®à´¾à´£à´™àµà´™àµ¾',
+ 'edittoolbar-help-page-reference' => 'അവലംബങàµà´™àµ¾',
'edittoolbar-help-page-discussion' => 'സംവാദം',
+ 'edittoolbar-help-content-italic-description' => 'à´šà´°à´¿à´šàµà´šàµà´³àµà´³à´¤àµ',
+ 'edittoolbar-help-content-italic-syntax' => "''à´šà´°à´¿à´šàµà´šàµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ''",
+ 'edittoolbar-help-content-italic-result' => '<em>à´šà´°à´¿à´šàµà´šàµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ</em>',
+ 'edittoolbar-help-content-bold-description' => 'à´•à´Ÿàµà´Ÿà´¿à´•àµ‚à´Ÿàµà´Ÿà´¿à´¯àµà´³àµà´³',
+ 'edittoolbar-help-content-bold-syntax' => "'''à´•à´Ÿàµà´Ÿà´¿à´•àµ‚à´Ÿàµà´Ÿà´¿à´¯ à´Žà´´àµà´¤àµà´¤àµ'''",
+ 'edittoolbar-help-content-bold-result' => '<strong>à´•à´Ÿàµà´Ÿà´¿à´•àµ‚à´Ÿàµà´Ÿà´¿à´¯ à´Žà´´àµà´¤àµà´¤àµ</strong>',
+ 'edittoolbar-help-content-bolditalic-description' => 'à´•à´Ÿàµà´Ÿà´¿à´•àµ‚à´Ÿàµà´Ÿà´¿ à´šà´°à´¿à´šàµà´šàµà´³àµà´³à´¤àµ',
+ 'edittoolbar-help-content-bolditalic-syntax' => "'''''à´•à´Ÿàµà´Ÿà´¿à´•àµ‚à´Ÿàµà´Ÿà´¿ à´šà´°à´¿à´šàµà´šàµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ'''''",
+ 'edittoolbar-help-content-bolditalic-result' => '<strong><em>à´•à´Ÿàµà´Ÿà´¿à´•àµ‚à´Ÿàµà´Ÿà´¿ à´šà´°à´¿à´šàµà´šàµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ</em></strong>',
+ 'edittoolbar-help-content-ilink-syntax' => '[[താളിനàµà´±àµ† തലകàµà´•àµ†à´Ÿàµà´Ÿàµ|à´•à´£àµà´£à´¿à´¯àµà´Ÿàµ† നാമം]]<br />[[താളിനàµà´±àµ† തലകàµà´•àµ†à´Ÿàµà´Ÿàµ]]',
+ 'edittoolbar-help-content-ilink-result' => "<a href='#'>à´•à´£àµà´£à´¿à´¯àµà´Ÿàµ† നാമം</a><br /><a href='#'>താളിനàµà´±àµ† തലകàµà´•àµ†à´Ÿàµà´Ÿàµ</a>",
+ 'edittoolbar-help-content-xlink-description' => 'à´ªàµà´±à´¤àµà´¤àµ‡à´¯àµà´•àµà´•àµà´³àµà´³ à´•à´£àµà´£à´¿',
+ 'edittoolbar-help-content-xlink-syntax' => '[http://www.example.org à´•à´£àµà´£à´¿à´¯àµà´Ÿàµ† പേരàµ]<br />[http://www.example.org]<br />http://www.example.org',
+ 'edittoolbar-help-content-xlink-result' => "<a href='#' class='external'>à´•à´£àµà´£à´¿à´¯àµà´Ÿàµ† പേരàµ</a><br /><a href='#' class='external autonumber'>[1]</a><br /><a href='#' class='external'>http://www.example.org</a>",
+ 'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|ലഘàµ|വിവരണ à´•àµà´±à´¿à´ªàµà´ªàµ]]',
+ 'edittoolbar-help-content-reference-description' => 'അവലംബം',
+ 'edittoolbar-help-content-reference-syntax' => 'താളിലെ à´Žà´´àµà´¤àµà´¤àµ.<ref name="test">[http://www.example.org à´•à´£àµà´£à´¿à´¯à´¾à´¯àµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ], കൂടàµà´¤àµ½ à´Žà´´àµà´¤àµà´¤àµ.</ref>',
+ 'edittoolbar-help-content-reference-result' => "താളിലെ à´Žà´´àµà´¤àµà´¤àµ.<sup><a href='#'>[1]</a></sup>",
+ 'edittoolbar-help-content-rereference-description' => 'അതേ അവലംബതàµà´¤à´¿à´¨àµà´±àµ† കൂടàµà´¤àµ½ ഉപയോഗം',
+ 'edittoolbar-help-content-rereference-result' => "താളിലെ à´Žà´´àµà´¤àµà´¤àµ.<sup><a href='#'>[1]</a></sup>",
+ 'edittoolbar-help-content-showreferences-description' => 'അവലംബങàµà´™àµ¾ à´ªàµà´°à´¦àµ¼à´¶à´¿à´ªàµà´ªà´¿à´•àµà´•àµà´•',
+ 'edittoolbar-help-content-showreferences-result' => "<ol class='references'><li id='cite_note-test-0'><b><a title='' href='#'>^</a></b> <a rel='nofollow' title='http://www.example.org' class='external text' href='#'>à´•à´£àµà´£à´¿à´¯à´¾à´¯àµà´³àµà´³ à´Žà´´àµà´¤àµà´¤àµ</a>, കൂടàµà´¤àµ½ à´Žà´´àµà´¤àµà´¤àµ.</li></ol>",
+ 'edittoolbar-help-content-signaturetimestamp-description' => 'സമയമàµà´¦àµà´°à´¯àµ‹à´Ÿàµà´•àµ‚à´Ÿà´¿à´¯ à´’à´ªàµà´ªàµ',
+ 'edittoolbar-help-content-signaturetimestamp-result' => "<a href='#' title='{{#special:mypage}}'>ഉപയോകàµà´¤àµƒà´¨à´¾à´®à´‚</a> (<a href='#' title='{{#special:mytalk}}'>സംവാദം</a>) 15:54, 10 ജൂൺ 2009 (UTC)",
+ 'edittoolbar-help-content-signature-description' => 'à´’à´ªàµà´ªàµ',
+ 'edittoolbar-help-content-signature-result' => "<a href='#' title='{{#special:mypage}}'>ഉപയോകàµà´¤àµƒà´¨à´¾à´®à´‚</a> (<a href='#' title='{{#special:mytalk}}'>സംവാദം</a>)",
);
/** Mongolian (Монгол)
@@ -6042,6 +6901,10 @@
'edittoolbar-tool-bold-example' => 'Teks tebal',
'edittoolbar-tool-italic' => 'Teks condong',
'edittoolbar-tool-italic-example' => 'Teks condong',
+ 'edittoolbar-tool-ilink' => 'Pautan dalaman',
+ 'edittoolbar-tool-ilink-example' => 'Tajuk pautan',
+ 'edittoolbar-tool-xlink' => 'Pautan luar (ingat http:// singkatan)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.contoh.com tajuk pautan',
'edittoolbar-tool-link' => 'Pautan',
'edittoolbar-tool-link-title' => 'Letakkan pautan',
'edittoolbar-tool-link-int' => 'Ke laman wiki',
@@ -6171,7 +7034,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Perkara senarai</li><li>Perkara senarai</li></ol>',
'edittoolbar-help-content-file-description' => 'Fail terbenam',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Contoh.png|thumb|Teks kapsyen]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Teks kapsyen' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Besarkan' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Teks kapsyen</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Teks kapsyen' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Besarkan' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Teks kapsyen</div></div>",
'edittoolbar-help-content-reference-description' => 'Rujukan',
'edittoolbar-help-content-reference-syntax' => 'Teks laman.<ref nama="cubaan">[http://www.contoh.org Teks pautan], teks tambahan.</ref>',
'edittoolbar-help-content-reference-result' => "Teks laman.<sup><a href='#'>[1]</a></sup>",
@@ -6194,11 +7057,17 @@
$messages['mt'] = array(
'edittoolbar' => 'Kaxxa tal-għodda għall-immodifikar',
'edittoolbar-desc' => "Immodifika l-kaxxa tal-għodda b'akbar użabilità ",
+ 'edittoolbar-preference' => 'Awtorizza l-użu tal-kaxxa tal-għodda estiża',
+ 'edittoolbar-cgd-preference' => "Awtorizza l-għajnuna għaż-żieda ta' test wiki avvanzat",
'edittoolbar-loading' => 'Tiela...',
'edittoolbar-tool-bold' => 'Tipa ħoxna',
'edittoolbar-tool-bold-example' => 'Tipa ħoxna',
'edittoolbar-tool-italic' => 'Tipa korsiva',
'edittoolbar-tool-italic-example' => 'Tipa korsiva',
+ 'edittoolbar-tool-ilink' => 'Ħolqa interna',
+ 'edittoolbar-tool-ilink-example' => 'Titlu tal-ħolqa',
+ 'edittoolbar-tool-xlink' => 'Ħolqa esterna (ftakar il-prefiss http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com titlu tal-ħolqa',
'edittoolbar-tool-link' => 'Ħolqa',
'edittoolbar-tool-link-title' => 'Daħħal ħolqa',
'edittoolbar-tool-link-int' => 'Lejn paġna wiki',
@@ -6214,6 +7083,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Titlu invalidu',
'edittoolbar-tool-link-int-target-status-loading' => 'Kontroll tal-eżistenza tal-paġna...',
'edittoolbar-tool-link-int-invalid' => 'It-titlu li speċifikjat huwa invalidu.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Il-URL li speċifikajt hi invalida.',
'edittoolbar-tool-file' => 'Fajl inkorporat',
'edittoolbar-tool-file-example' => 'Eżempju.jpg',
'edittoolbar-tool-reference' => 'Nota',
@@ -6248,21 +7118,38 @@
{{ns:file}}:Eżempju.jpg|Deskrizzjoni2',
'edittoolbar-tool-newline' => 'Linja Ä¡dida',
'edittoolbar-tool-table' => 'Tabella',
+ 'edittoolbar-tool-table-example-old' => '-
+! ras 1
+! ras 2
+! ras 3
+|-
+| filliera 1, Ä‹ellola 1
+| filliera 1, Ä‹ellola 2
+| filliera 1, Ä‹ellola 3
+|-
+| filliera 2, Ä‹ellola 1
+| filliera 2, Ä‹ellola 2
+| filliera 2, Ä‹ellola 3',
+ 'edittoolbar-tool-table-example' => 'Filliera $1, Ä‹ellola $2',
+ 'edittoolbar-tool-table-example-header' => 'Filliera $1, Ä‹ellola $2 (ras)',
'edittoolbar-tool-table-title' => 'Daħħal tabella',
'edittoolbar-tool-table-dimensions' => 'Dimensjonijiet',
'edittoolbar-tool-table-dimensions-rows' => 'Fillieri',
'edittoolbar-tool-table-dimensions-columns' => 'Kolonni',
+ 'edittoolbar-tool-table-dimensions-header' => "Inkludi l-filliera ta' fuq",
'edittoolbar-tool-table-insert' => 'Daħħal',
'edittoolbar-tool-table-cancel' => 'Annulla',
- 'edittoolbar-tool-replace' => 'Biddel',
+ 'edittoolbar-tool-replace' => 'Fittex u biddel',
'edittoolbar-tool-replace-title' => 'Fittex u biddel',
'edittoolbar-tool-replace-search' => 'Fittex għal:',
'edittoolbar-tool-replace-replace' => "Biddel ma':",
+ 'edittoolbar-tool-replace-case' => 'Ittra kapitali/żgħira',
'edittoolbar-tool-replace-regex' => 'Tratta t-test tat-tfittxija bħala espressjoni regulari',
'edittoolbar-tool-replace-all' => 'Biddel kull okkorrenza',
'edittoolbar-tool-replace-button' => 'Biddel',
- 'edittoolbar-tool-replace-close' => 'Agħlaq',
+ 'edittoolbar-tool-replace-close' => 'Annulla',
'edittoolbar-tool-replace-nomatch' => 'It-tfittxija ma tat l-ebda riżultat.',
+ 'edittoolbar-tool-replace-success' => 'saru $1 tibdila.',
'edittoolbar-section-characters' => 'Karattri speċjali',
'edittoolbar-characters-page-latin' => 'Latin',
'edittoolbar-characters-page-latinextended' => 'Latin estiż',
@@ -6322,7 +7209,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Element tal-lista</li><li>Element tal-lista</li></ol>',
'edittoolbar-help-content-file-description' => 'Fajl inkorporat',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Eżempju.png|thumb|Test tad-deskrizzjoni]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Test tad-deskrizzjoni' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Kabbar' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Test tad-deskrizzjoni</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Test tad-deskrizzjoni' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Kabbar' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Test tad-deskrizzjoni</div></div>",
'edittoolbar-help-content-reference-description' => 'Referenza',
'edittoolbar-help-content-reference-syntax' => 'Test tal-paġna.<ref name="test">[http://www.example.org Test tal-ħolqa], test addizzjonali.</ref>',
'edittoolbar-help-content-reference-result' => "Test tal-paġna.<sup><a href='#'>[1]</a></sup>",
@@ -6374,6 +7261,10 @@
'edittoolbar-tool-bold-example' => 'Vet-edrokken tekse',
'edittoolbar-tool-italic' => 'Schunedrok',
'edittoolbar-tool-italic-example' => 'Schunedrokken tekse',
+ 'edittoolbar-tool-ilink' => 'Interne verwiezing',
+ 'edittoolbar-tool-ilink-example' => 'Verwiezingsbeschrieving',
+ 'edittoolbar-tool-xlink' => "Uutgaonde verwiezing (vergeet 't veurvoegsel http:// neet)",
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com beschrieving',
'edittoolbar-tool-link' => 'Verwiezing',
'edittoolbar-tool-link-title' => 'Verwiezing derbie doon',
'edittoolbar-tool-link-int' => 'Naor een wikipagina',
@@ -6469,7 +7360,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Regel in een lieste mit nummers</li><li>Regel in een lieste mit nummers</li></ol>',
'edittoolbar-help-content-file-description' => 'Bestaand derbie doon',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Veurbeeld.png|thumb|Bieschrifte]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bieschrifte' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Vergroten' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Bieschrifte</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bieschrifte' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Vergroten' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Bieschrifte</div></div>",
'edittoolbar-help-content-reference-description' => 'Rifferentie',
'edittoolbar-help-content-reference-syntax' => 'Paginatekse.<ref name="test">[http://www.example.org Beschrieving], eventuele tekse.</ref>',
'edittoolbar-help-content-reference-result' => "Paginatekse <sup><a href='#'>[1]</a></sup>",
@@ -6487,17 +7378,23 @@
);
/** Dutch (Nederlands)
+ * @author McDutchie
* @author Siebrand
*/
$messages['nl'] = array(
'edittoolbar' => 'Bewerkingswerkbalk',
'edittoolbar-desc' => 'Bewerkingsbalk die eenvoudiger te gebruiken is',
'edittoolbar-preference' => 'Uitgebreide bewerkingsbalk inschakelen',
+ 'edittoolbar-cgd-preference' => 'Hulp voor het toevoegen van gevorderde wikitekst inschakelen',
'edittoolbar-loading' => 'Bezig met laden...',
'edittoolbar-tool-bold' => 'Vet',
'edittoolbar-tool-bold-example' => 'Vetgedrukte tekst',
'edittoolbar-tool-italic' => 'Cursief',
'edittoolbar-tool-italic-example' => 'Cursief gedrukte tekst',
+ 'edittoolbar-tool-ilink' => 'Interne verwijzing',
+ 'edittoolbar-tool-ilink-example' => 'Verwijzingsbeschrijving',
+ 'edittoolbar-tool-xlink' => 'Externe verwijzing (vergeet het voorvoegsel http:// niet)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com verwijzingsbeschrijving',
'edittoolbar-tool-link' => 'Verwijzing',
'edittoolbar-tool-link-title' => 'Verwijzing invoegen',
'edittoolbar-tool-link-int' => 'Naar een wikipagina',
@@ -6513,6 +7410,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Ongeldige paginanaam',
'edittoolbar-tool-link-int-target-status-loading' => 'Bezig met controleren of de pagina al bestaat...',
'edittoolbar-tool-link-int-invalid' => 'De opgegeven pagina is ongeldig.',
+ 'edittoolbar-tool-link-ext-invalid' => 'De opgegeven URL is ongeldig.',
'edittoolbar-tool-file' => 'Ingebed bestand',
'edittoolbar-tool-file-example' => 'Voorbeeld.jpg',
'edittoolbar-tool-reference' => 'Referentie',
@@ -6547,6 +7445,18 @@
{{ns:file}}:Voorbeeld2|Bijschrift2',
'edittoolbar-tool-newline' => 'Nieuwe regel',
'edittoolbar-tool-table' => 'Tabel',
+ 'edittoolbar-tool-table-example-old' => '-
+! kop 1
+! kop 2
+! kop 3
+|-
+| rij 1, cel 1
+| rij 1, cel 2
+| rij 1, cel 3
+|-
+| rij 2, cel 1
+| rij 2, cel 2
+| rij 2, cel 3',
'edittoolbar-tool-table-example' => 'Rij $1, cel $2',
'edittoolbar-tool-table-example-header' => 'Rij $1, cel $2 (kop)',
'edittoolbar-tool-table-title' => 'Tabel invoegen',
@@ -6556,7 +7466,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Koprij toevoegen',
'edittoolbar-tool-table-insert' => 'Invoegen',
'edittoolbar-tool-table-cancel' => 'Annuleren',
- 'edittoolbar-tool-replace' => 'Vervangen',
+ 'edittoolbar-tool-replace' => 'Zoeken en vervangen',
'edittoolbar-tool-replace-title' => 'Zoeken en vervangen',
'edittoolbar-tool-replace-search' => 'Zoeken naar:',
'edittoolbar-tool-replace-replace' => 'Vervangen door:',
@@ -6564,8 +7474,9 @@
'edittoolbar-tool-replace-regex' => 'De zoekreeks als reguliere expressie behandelen',
'edittoolbar-tool-replace-all' => 'Alles vervangen',
'edittoolbar-tool-replace-button' => 'Vervangen',
- 'edittoolbar-tool-replace-close' => 'Sluiten',
+ 'edittoolbar-tool-replace-close' => 'Annuleren',
'edittoolbar-tool-replace-nomatch' => 'Uw zoekopdracht heeft geen resultaten opgeleverd.',
+ 'edittoolbar-tool-replace-success' => 'Er zijn $1 items vervangen.',
'edittoolbar-section-characters' => 'Speciale tekens',
'edittoolbar-characters-page-latin' => 'Latijns',
'edittoolbar-characters-page-latinextended' => 'Latijns uitgebreid',
@@ -6579,7 +7490,7 @@
'edittoolbar-section-help' => 'Hulp',
'edittoolbar-help-heading-description' => 'Beschrijving',
'edittoolbar-help-heading-syntax' => 'Wat u typt',
- 'edittoolbar-help-heading-result' => 'Wat u krijgt te zien',
+ 'edittoolbar-help-heading-result' => 'Wat u te zien krijgt',
'edittoolbar-help-page-format' => 'Opmaak',
'edittoolbar-help-page-link' => 'Verwijzingen',
'edittoolbar-help-page-heading' => 'Kopjes',
@@ -6625,7 +7536,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Regel in genummerde lijst</li><li>Regel in genummerde lijst</li></ol>',
'edittoolbar-help-content-file-description' => 'Ingebed bestand',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Voorbeeld.png|thumb|Bijschrift]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bijschrift' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Vergroten' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Bijschrift</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bijschrift' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Vergroten' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Bijschrift</div></div>",
'edittoolbar-help-content-reference-description' => 'Referentie',
'edittoolbar-help-content-reference-syntax' => 'Paginatekst.<ref name="test">[http://www.example.org Verwijzingstekst], additionele tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Paginatekst <sup><a href='#'>[1]</a></sup>",
@@ -6643,6 +7554,7 @@
);
/** Norwegian Nynorsk (‪Norsk (nynorsk)‬)
+ * @author Gunnernett
* @author Harald Khan
*/
$messages['nn'] = array(
@@ -6651,8 +7563,19 @@
'edittoolbar-tool-bold-example' => 'Feit tekst',
'edittoolbar-tool-italic' => 'Kursiv',
'edittoolbar-tool-italic-example' => 'Kursiv tekst',
+ 'edittoolbar-tool-ilink' => 'Intern lenkja',
+ 'edittoolbar-tool-ilink-example' => 'Lenkjetittel',
+ 'edittoolbar-tool-xlink' => 'Ekstern lenkja (hugs http:// -forstavinga)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com lenkjetittel',
+ 'edittoolbar-tool-link-int' => 'Til ei wikiside',
+ 'edittoolbar-tool-link-int-target' => 'Sidetittel/artikkeltittel:',
+ 'edittoolbar-tool-link-ext-target' => 'Lenkeadresse URL:',
+ 'edittoolbar-tool-link-int-target-status-exists' => 'Sida finst',
'edittoolbar-tool-file-example' => 'Døme.jpg',
'edittoolbar-tool-reference' => 'Referanse',
+ 'edittoolbar-section-advanced' => 'Avansert',
+ 'edittoolbar-group-size' => 'Storleik',
+ 'edittoolbar-tool-subscript' => 'Senka skrift',
'edittoolbar-group-insert' => 'Set inn',
'edittoolbar-tool-gallery' => 'Biletgalleri',
'edittoolbar-tool-gallery-example' => '{{ns:file}}:Døme.jpg|Bilettekst1
@@ -6674,6 +7597,7 @@
);
/** Norwegian (bokmål)‬ (‪Norsk (bokmål)‬)
+ * @author Gunnernett
* @author Laaknor
* @author Nghtwlkr
* @author Simny
@@ -6688,6 +7612,10 @@
'edittoolbar-tool-bold-example' => 'Fet tekst',
'edittoolbar-tool-italic' => 'Kursiv',
'edittoolbar-tool-italic-example' => 'Kursiv tekst',
+ 'edittoolbar-tool-ilink' => 'Intern lenke',
+ 'edittoolbar-tool-ilink-example' => 'Lenketittel',
+ 'edittoolbar-tool-xlink' => 'Ekstern lenke (husk http:// først)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com lenketittel',
'edittoolbar-tool-link-int' => 'Til en wikiartikkel/-side',
'edittoolbar-tool-link-int-target' => 'Sidetittel/artikkeltittel:',
'edittoolbar-tool-link-ext' => 'Til en ekstern webside',
@@ -6732,7 +7660,7 @@
'edittoolbar-tool-newline' => 'Linjeskift',
'edittoolbar-tool-table' => 'Tabell',
'edittoolbar-tool-table-cancel' => 'Avbryt',
- 'edittoolbar-tool-replace' => 'Erstatt',
+ 'edittoolbar-tool-replace' => 'Søk og erstatt',
'edittoolbar-tool-replace-title' => 'Søk og erstatt',
'edittoolbar-tool-replace-search' => 'Søk etter:',
'edittoolbar-tool-replace-replace' => 'Erstatt med:',
@@ -6803,7 +7731,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Listeelement</li><li>Listeelement</li></ol>',
'edittoolbar-help-content-file-description' => 'Fil',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Bildetekst]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bildetekst' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Forstørr' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Bildetekst</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bildetekst' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Forstørr' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Bildetekst</div></div>",
'edittoolbar-help-content-reference-description' => 'Referanse',
'edittoolbar-help-content-reference-syntax' => 'Tekst.<ref name="test">[http://www.example.org Lenketekst], ytterligere tekst.</ref>',
'edittoolbar-help-content-reference-result' => "Tekst.<sup><a href='#'>[1]</a></sup>",
@@ -6827,11 +7755,16 @@
'edittoolbar' => 'Modificacion de la barra d’espleches',
'edittoolbar-desc' => "Modificacion de la barra d'espleches amb l'utilizabilitat melhorada",
'edittoolbar-preference' => "Activar la barra d'espleches melhorada",
+ 'edittoolbar-cgd-preference' => "Activar l'ajuda per apondre de tèxte wiki avançat",
'edittoolbar-loading' => 'Cargament ...',
'edittoolbar-tool-bold' => 'Gras',
'edittoolbar-tool-bold-example' => 'Tèxte en gras',
'edittoolbar-tool-italic' => 'Italica',
'edittoolbar-tool-italic-example' => 'Tèxte en italica',
+ 'edittoolbar-tool-ilink' => 'Ligam intèrne',
+ 'edittoolbar-tool-ilink-example' => 'TÃtol del ligam',
+ 'edittoolbar-tool-xlink' => 'Ligam extèrne ( doblidetz pas lo prefix http:// )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com tÃtol del ligam',
'edittoolbar-tool-link' => 'Ligam',
'edittoolbar-tool-link-title' => 'Inserir un ligam',
'edittoolbar-tool-link-int' => 'Cap a un article / una pagina wiki',
@@ -6847,6 +7780,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'TÃtol invalid',
'edittoolbar-tool-link-int-target-status-loading' => "Verificacion de l'existéncia de la pagina...",
'edittoolbar-tool-link-int-invalid' => "Lo tÃtol qu'avètz especificat es incorrècte.",
+ 'edittoolbar-tool-link-ext-invalid' => "L'URL qu'avètz especificada es invalida.",
'edittoolbar-tool-file' => 'Fichièr inserit',
'edittoolbar-tool-file-example' => 'Exemple.jpg',
'edittoolbar-tool-reference' => 'Referéncia',
@@ -6881,6 +7815,18 @@
{{ns:file}}:Exemple.jpg|Descripcion 2',
'edittoolbar-tool-newline' => 'Saut de linha',
'edittoolbar-tool-table' => 'Tablèu',
+ 'edittoolbar-tool-table-example-old' => '-
+! entèsta 1
+! entèsta 2
+! entèsta 3
+|-
+| linha 1, casa 1
+| linha 1, casa 2
+| linha 1, casa 3
+|-
+| linha 2, casa 1
+| linha 2, casa 2
+| linha 2, casa 3',
'edittoolbar-tool-table-example' => 'Linha $1, cellula $2',
'edittoolbar-tool-table-example-header' => 'Linha $1, cellula $2 (entèsta)',
'edittoolbar-tool-table-title' => 'Inserir un tablèu',
@@ -6890,7 +7836,7 @@
'edittoolbar-tool-table-dimensions-header' => "Inclure la linha d'entèsta",
'edittoolbar-tool-table-insert' => 'Inserir',
'edittoolbar-tool-table-cancel' => 'Anullar',
- 'edittoolbar-tool-replace' => 'Remplaçar',
+ 'edittoolbar-tool-replace' => 'Recercar & remplaçar',
'edittoolbar-tool-replace-title' => 'Recercar e remplaçar',
'edittoolbar-tool-replace-search' => 'Recercar :',
'edittoolbar-tool-replace-replace' => 'Remplaçar amb :',
@@ -6898,8 +7844,9 @@
'edittoolbar-tool-replace-regex' => 'Tractar la cadena de recèrca coma una expression regulara',
'edittoolbar-tool-replace-all' => 'remplaçar totas las occurréncias',
'edittoolbar-tool-replace-button' => 'Remplaçar',
- 'edittoolbar-tool-replace-close' => 'Tampar',
+ 'edittoolbar-tool-replace-close' => 'Anullar',
'edittoolbar-tool-replace-nomatch' => 'Vòstra recèrca a pas trobat cap de correspondéncia.',
+ 'edittoolbar-tool-replace-success' => '$1 remplaçaments faches.',
'edittoolbar-section-characters' => 'Caractèrs especials',
'edittoolbar-characters-page-latin' => 'Latin',
'edittoolbar-characters-page-latinextended' => 'Latin espandit',
@@ -6959,7 +7906,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Element de la lista</li><li>Element de la lista</li></ol>',
'edittoolbar-help-content-file-description' => 'Fichièr inserit',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Tèxte afichat]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Tèxte afichat' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Tèxte afichat</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Tèxte afichat' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Tèxte afichat</div></div>",
'edittoolbar-help-content-reference-description' => 'Referéncia',
'edittoolbar-help-content-reference-syntax' => 'Tèxte de la pagina.<ref name="test">[http://www.example.org tèxte del ligam], tèxte adicional.</ref>',
'edittoolbar-help-content-reference-result' => "Tèxte de la pagina <sup><a href='#'>[1]</a></sup>",
@@ -6982,6 +7929,8 @@
$messages['pdc'] = array(
'edittoolbar' => 'Gscharr fer Enneringe',
'edittoolbar-tool-bold' => 'Fett',
+ 'edittoolbar-tool-ilink' => 'Gleecher',
+ 'edittoolbar-tool-xlink' => 'Gewebbgleecher (acht uff http://)',
'edittoolbar-group-list' => 'Lischt',
'edittoolbar-group-size' => 'Grees',
'edittoolbar-tool-big' => 'Gross',
@@ -7006,11 +7955,16 @@
'edittoolbar' => 'Pasek narzędzi edycyjnych',
'edittoolbar-desc' => 'Ułatwiający pracę pasek narzędzi edycyjnych',
'edittoolbar-preference' => 'Włącz rozszerzony pasek narzędzi edycyjnych',
+ 'edittoolbar-cgd-preference' => 'WÅ‚Ä…cz pomoc dla dodawania zaawansowanego tekstu Wiki',
'edittoolbar-loading' => 'Åadowanie...',
'edittoolbar-tool-bold' => 'Wytłuszczenie',
'edittoolbar-tool-bold-example' => 'Tekst tłustą czcionką',
'edittoolbar-tool-italic' => 'Pochyły',
'edittoolbar-tool-italic-example' => 'Tekst pochyłą czcionką',
+ 'edittoolbar-tool-ilink' => 'Link wewnętrzny',
+ 'edittoolbar-tool-ilink-example' => 'Tytuł linku',
+ 'edittoolbar-tool-xlink' => 'Link zewnętrzny (pamiętaj o przedrostku http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.przyklad.com opis linku',
'edittoolbar-tool-link' => 'Link',
'edittoolbar-tool-link-title' => 'Wstaw link',
'edittoolbar-tool-link-int' => 'Do strony wiki',
@@ -7026,6 +7980,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Nieprawidłowy tytuł',
'edittoolbar-tool-link-int-target-status-loading' => 'Sprawdzanie czy strona istnieje…',
'edittoolbar-tool-link-int-invalid' => 'Wprowadzony tytuł jest nieprawidłowy.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Podano nieprawidłowy adres URL.',
'edittoolbar-tool-file' => 'Plik osadzony',
'edittoolbar-tool-file-example' => 'Przykład.jpg',
'edittoolbar-tool-reference' => 'Przypis',
@@ -7060,6 +8015,18 @@
{{ns:file}}:Example.jpg|Podpis2',
'edittoolbar-tool-newline' => 'Nowy wiersz',
'edittoolbar-tool-table' => 'Tabela',
+ 'edittoolbar-tool-table-example-old' => '-
+! nagłówek 1
+! nagłówek 2
+! nagłówek 3
+| -
+| wiersz 1, komórka 1
+| wiersz 1, komórka 2
+| wiersz 1, komórka 3
+| -
+| wiersz 2, komórka 1
+| wiersz 2, komórka 2
+| wiersz 2, komórka 3',
'edittoolbar-tool-table-example' => 'Wiersz $1, komórka $2',
'edittoolbar-tool-table-example-header' => 'Wiersz $1, kolumna $2 (nagłówek)',
'edittoolbar-tool-table-title' => 'Wstaw tabelÄ™',
@@ -7069,7 +8036,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Dołącz wiersz nagłówka',
'edittoolbar-tool-table-insert' => 'Wstaw',
'edittoolbar-tool-table-cancel' => 'Anuluj',
- 'edittoolbar-tool-replace' => 'ZastÄ…p',
+ 'edittoolbar-tool-replace' => 'Wyszukaj i zastÄ…p',
'edittoolbar-tool-replace-title' => 'Wyszukaj i zamień',
'edittoolbar-tool-replace-search' => 'Szukaj',
'edittoolbar-tool-replace-replace' => 'Zamień na',
@@ -7077,8 +8044,9 @@
'edittoolbar-tool-replace-regex' => 'Traktuj wyszukiwany ciąg jako wyrażenie regularne',
'edittoolbar-tool-replace-all' => 'ZastÄ…p wszystkie',
'edittoolbar-tool-replace-button' => 'ZastÄ…p',
- 'edittoolbar-tool-replace-close' => 'Zamknij',
+ 'edittoolbar-tool-replace-close' => 'Anuluj',
'edittoolbar-tool-replace-nomatch' => 'Wyszukiwanego wzorca nie odnaleziono.',
+ 'edittoolbar-tool-replace-success' => 'Wykonano $1 zamian.',
'edittoolbar-section-characters' => 'Znaki specjalne',
'edittoolbar-characters-page-latin' => 'ÅaciÅ„skie',
'edittoolbar-characters-page-latinextended' => 'ÅaciÅ„skie – rozszerzony',
@@ -7138,7 +8106,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Pozycja listy</li><li>Pozycja listy</li></ol>',
'edittoolbar-help-content-file-description' => 'Plik osadzony',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Przykład.png|mały|Podpis pod plikiem]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Tekst podpisu</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Tekst podpisu</div></div>",
'edittoolbar-help-content-reference-description' => 'Przypis',
'edittoolbar-help-content-reference-syntax' => 'Treść strony.<ref name="test"> [http://www.przyklad.org Opis linku], dodatkowy tekst. </ref>',
'edittoolbar-help-content-reference-result' => "Treść strony.<sup><a href='#'>[1]</a></sup>",
@@ -7200,6 +8168,10 @@
'edittoolbar-tool-bold-example' => 'Texto a negrito',
'edittoolbar-tool-italic' => 'Itálico',
'edittoolbar-tool-italic-example' => 'Texto em itálico',
+ 'edittoolbar-tool-ilink' => 'Ligação interna',
+ 'edittoolbar-tool-ilink-example' => 'TÃtulo da ligação',
+ 'edittoolbar-tool-xlink' => 'Ligação externa (lembre-se do prefixo http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com ligação externa',
'edittoolbar-tool-link' => 'Ligação',
'edittoolbar-tool-link-title' => 'Insere uma ligação',
'edittoolbar-tool-link-int' => 'Para uma página wiki',
@@ -7215,6 +8187,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'TÃtulo inválido',
'edittoolbar-tool-link-int-target-status-loading' => 'Verificando existência da página...',
'edittoolbar-tool-link-int-invalid' => 'O tÃtulo que você especificou é inválido.',
+ 'edittoolbar-tool-link-ext-invalid' => 'A URL que especificou é inválida.',
'edittoolbar-tool-file' => 'Ficheiro embutido',
'edittoolbar-tool-file-example' => 'Exemplo.jpg',
'edittoolbar-tool-reference' => 'Referência',
@@ -7258,7 +8231,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Inclui linha de cabeçalho',
'edittoolbar-tool-table-insert' => 'Inserir',
'edittoolbar-tool-table-cancel' => 'Cancelar',
- 'edittoolbar-tool-replace' => 'Substituir',
+ 'edittoolbar-tool-replace' => 'Pesquisar e substituir',
'edittoolbar-tool-replace-title' => 'Localizar e substituir',
'edittoolbar-tool-replace-search' => 'Procurar por:',
'edittoolbar-tool-replace-replace' => 'Substituir por:',
@@ -7266,7 +8239,7 @@
'edittoolbar-tool-replace-regex' => 'Tratar string de busca como uma expressão regular',
'edittoolbar-tool-replace-all' => 'Substituir todas as ocorrências',
'edittoolbar-tool-replace-button' => 'Substituir',
- 'edittoolbar-tool-replace-close' => 'Fechar',
+ 'edittoolbar-tool-replace-close' => 'Cancelar',
'edittoolbar-tool-replace-nomatch' => 'Sua busca não encontrou nenhum resultado.',
'edittoolbar-section-characters' => 'Carateres especiais',
'edittoolbar-characters-page-latin' => 'Latim',
@@ -7327,7 +8300,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Item de lista</li><li>Item de lista</li></ol>',
'edittoolbar-help-content-file-description' => 'Ficheiro integrado',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Exemplo.png|thumb|Legenda]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Legenda' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Aumentar' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Legenda</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Legenda' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Aumentar' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Legenda</div></div>",
'edittoolbar-help-content-reference-description' => 'Referência',
'edittoolbar-help-content-reference-syntax' => 'Texto da página.<ref name="teste">[http://www.exemplo.org Texto da ligação], texto adicional.</ref>',
'edittoolbar-help-content-reference-result' => "Texto da página.<sup><a href='#'>[1]</a></sup>",
@@ -7347,6 +8320,7 @@
/** Brazilian Portuguese (Português do Brasil)
* @author Eduardo.mps
* @author Heldergeovane
+ * @author Luckas Blade
*/
$messages['pt-br'] = array(
'edittoolbar' => 'Barra de ferramentas de edição',
@@ -7357,6 +8331,10 @@
'edittoolbar-tool-bold-example' => 'Texto em negrito',
'edittoolbar-tool-italic' => 'Itálico',
'edittoolbar-tool-italic-example' => 'Texto em itálico',
+ 'edittoolbar-tool-ilink' => 'Ligação interna',
+ 'edittoolbar-tool-ilink-example' => 'TÃtulo da ligação',
+ 'edittoolbar-tool-xlink' => 'Ligação externa (lembre-se do prefixo http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com tÃtulo da ligação',
'edittoolbar-tool-link' => 'Ligação',
'edittoolbar-tool-link-title' => 'Inserir ligação',
'edittoolbar-tool-link-int' => 'Para um artigo ou página wiki',
@@ -7372,6 +8350,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'TÃtulo inválido',
'edittoolbar-tool-link-int-target-status-loading' => 'Verificando existência da página...',
'edittoolbar-tool-link-int-invalid' => 'O tÃtulo que você especificou é inválido.',
+ 'edittoolbar-tool-link-ext-invalid' => 'A URL que você especificou é inválida.',
'edittoolbar-tool-file' => 'Arquivo embutido',
'edittoolbar-tool-file-example' => 'Exemplo.jpg',
'edittoolbar-tool-reference' => 'Referência',
@@ -7405,6 +8384,12 @@
'edittoolbar-tool-gallery-example' => '{{ns:file}}:Exemplo1.jpg|Legenda1',
'edittoolbar-tool-newline' => 'Nova linha',
'edittoolbar-tool-table' => 'Tabela',
+ 'edittoolbar-tool-table-title' => 'Inserir tabela',
+ 'edittoolbar-tool-table-dimensions' => 'Dimensões',
+ 'edittoolbar-tool-table-dimensions-rows' => 'Linhas',
+ 'edittoolbar-tool-table-dimensions-columns' => 'Colunas',
+ 'edittoolbar-tool-table-insert' => 'Inserir',
+ 'edittoolbar-tool-table-cancel' => 'Cancelar',
'edittoolbar-tool-replace' => 'Substituir',
'edittoolbar-tool-replace-title' => 'Localizar e substituir',
'edittoolbar-tool-replace-search' => 'Localizar:',
@@ -7474,7 +8459,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Item de lista</li><li>Item de lista</li></ol>',
'edittoolbar-help-content-file-description' => 'Arquivo embutido',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Exemplo.png|thumb|Legenda]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Legenda' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Aumentar' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Legenda</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Legenda' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Aumentar' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Legenda</div></div>",
'edittoolbar-help-content-reference-description' => 'Referência',
'edittoolbar-help-content-reference-syntax' => 'Texto da página.<ref name="teste">[http://www.exemplo.org Texto da ligação], texto adicional.</ref>',
'edittoolbar-help-content-reference-result' => "Texto da página.<sup><a href='#'>[1]</a></sup>",
@@ -7501,6 +8486,7 @@
'edittoolbar-tool-bold-example' => 'Text aldin',
'edittoolbar-tool-italic' => 'Cursiv',
'edittoolbar-tool-italic-example' => 'Text cursiv',
+ 'edittoolbar-tool-ilink' => 'Legătură internă',
'edittoolbar-tool-file-example' => 'Exemplu.jpg',
'edittoolbar-tool-reference' => 'Referinţă',
'edittoolbar-section-advanced' => 'Avansat',
@@ -7596,6 +8582,7 @@
'edittoolbar-tool-bold-example' => 'Teste grascette',
'edittoolbar-tool-italic' => 'Corsive',
'edittoolbar-tool-italic-example' => 'Teste corsive',
+ 'edittoolbar-tool-ilink-example' => "Titele d'u collegamende",
'edittoolbar-tool-link' => 'Collegamende',
'edittoolbar-tool-link-title' => "'Nzerisce 'nu collegamende",
'edittoolbar-tool-link-int' => "A 'na vôsce/pà gene de Uicchi",
@@ -7606,6 +8593,7 @@
'edittoolbar-tool-link-ext-text' => "Teste d'u collegamende:",
'edittoolbar-tool-link-insert' => "'Nzerisce 'nu collegamende",
'edittoolbar-tool-link-cancel' => 'Scangille',
+ 'edittoolbar-tool-link-int-target-status-invalid' => 'Titele invalide',
'edittoolbar-tool-file' => 'Fiel ingapsulate',
'edittoolbar-tool-file-example' => 'Esembie.jpg',
'edittoolbar-tool-reference' => 'Riferimende',
@@ -7617,6 +8605,7 @@
'edittoolbar-tool-heading-3' => 'Levèlle 3',
'edittoolbar-tool-heading-4' => 'Levèlle 4',
'edittoolbar-tool-heading-5' => 'Levèlle 5',
+ 'edittoolbar-group-list' => 'Liste',
'edittoolbar-group-size' => 'Dimenzione',
'edittoolbar-tool-big' => 'Granne',
'edittoolbar-tool-small' => 'Piccinne',
@@ -7624,12 +8613,14 @@
'edittoolbar-tool-gallery' => 'Gallerìe fotografeche',
'edittoolbar-tool-newline' => 'Linèa nove',
'edittoolbar-tool-table' => 'Tabbelle',
- 'edittoolbar-tool-replace' => 'Sostituisce',
+ 'edittoolbar-tool-table-example' => 'Riga $1, celle $2',
+ 'edittoolbar-tool-table-example-header' => 'Riga $1, celle $2 (testate)',
+ 'edittoolbar-tool-replace' => 'Cirche e sostituisce',
'edittoolbar-tool-replace-title' => 'Cirche e sostituisce',
'edittoolbar-tool-replace-search' => 'Cirche pe:',
'edittoolbar-tool-replace-replace' => 'Sostituisce cu:',
'edittoolbar-tool-replace-button' => 'Sostituisce',
- 'edittoolbar-tool-replace-close' => 'Achiude',
+ 'edittoolbar-tool-replace-close' => 'Annulle',
'edittoolbar-characters-page-latin' => 'Latine',
'edittoolbar-characters-page-latinextended' => 'Latine estese',
'edittoolbar-characters-page-ipa' => 'IPA',
@@ -7652,6 +8643,7 @@
'edittoolbar-help-content-bold-description' => 'Grascette',
'edittoolbar-help-content-bold-syntax' => "'''Teste Grascette'''",
'edittoolbar-help-content-bold-result' => '<strong>Teste Grascette</strong>',
+ 'edittoolbar-help-content-signature-description' => 'Firme',
);
/** Russian (РуÑÑкий)
@@ -7664,11 +8656,16 @@
'edittoolbar' => 'Панель редактированиÑ',
'edittoolbar-desc' => 'Панель Ñ€ÐµÐ´Ð°ÐºÑ‚Ð¸Ñ€Ð¾Ð²Ð°Ð½Ð¸Ñ Ñ ÑƒÐ»ÑƒÑ‡ÑˆÐµÐ½Ð½Ñ‹Ð¼ юзабилити',
'edittoolbar-preference' => 'Включить улучшенную панель редактированиÑ',
+ 'edittoolbar-cgd-preference' => 'Включите Ñправку по добавлению более Ñложного вики-текÑта',
'edittoolbar-loading' => 'Загрузка…',
'edittoolbar-tool-bold' => 'Полужирный',
'edittoolbar-tool-bold-example' => 'Полужирное начертание',
'edittoolbar-tool-italic' => 'КурÑив',
'edittoolbar-tool-italic-example' => 'КурÑивное начертание',
+ 'edittoolbar-tool-ilink' => 'ВнутреннÑÑ ÑÑылка',
+ 'edittoolbar-tool-ilink-example' => 'Заголовок ÑÑылки',
+ 'edittoolbar-tool-xlink' => 'ВнешнÑÑ ÑÑылка (не забудьте о префикÑе http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com заголовок ÑÑылки',
'edittoolbar-tool-link' => 'СÑылка',
'edittoolbar-tool-link-title' => 'Ð’Ñтавить ÑÑылку',
'edittoolbar-tool-link-int' => 'Ðа вики-Ñтраницу',
@@ -7684,6 +8681,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'ÐедопуÑтимое название',
'edittoolbar-tool-link-int-target-status-loading' => 'Проверка ÑущеÑÑ‚Ð²Ð¾Ð²Ð°Ð½Ð¸Ñ Ñтраницы…',
'edittoolbar-tool-link-int-invalid' => 'Указанное название недопуÑтимо.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Указан ошибочный URL.',
'edittoolbar-tool-file' => 'Ð’Ñтроенный файл',
'edittoolbar-tool-file-example' => 'Example.jpg',
'edittoolbar-tool-reference' => 'Примечание',
@@ -7718,6 +8716,18 @@
{{ns:file}}:Example.jpg|ОпиÑание2',
'edittoolbar-tool-newline' => 'ÐÐ¾Ð²Ð°Ñ Ñтрока',
'edittoolbar-tool-table' => 'Таблица',
+ 'edittoolbar-tool-table-example-old' => '-
+! заголовок 1
+! заголовок 2
+! заголовок 3
+|-
+| Ñтрока 1, Ñчейка 1
+| Ñтрока 1, Ñчейка 2
+| Ñтрока 1, Ñчейка 3
+|-
+| Ñтрока 2, Ñчейка 1
+| Ñтрока 2, Ñчейка 2
+| Ñтрока 2, Ñчейка 3',
'edittoolbar-tool-table-example' => 'Строка $1, Ñчейка $2',
'edittoolbar-tool-table-example-header' => 'Строка $1, Ñчейка $2 (заголовок)',
'edittoolbar-tool-table-title' => 'Ð’Ñтавить таблицу',
@@ -7727,7 +8737,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Добавить заголовочную Ñтроку',
'edittoolbar-tool-table-insert' => 'Ð’Ñтавить',
'edittoolbar-tool-table-cancel' => 'Отмена',
- 'edittoolbar-tool-replace' => 'Заменить',
+ 'edittoolbar-tool-replace' => 'ПоиÑк и замена',
'edittoolbar-tool-replace-title' => 'ПоиÑк и замена',
'edittoolbar-tool-replace-search' => 'ПоиÑк:',
'edittoolbar-tool-replace-replace' => 'Заменить на:',
@@ -7735,8 +8745,9 @@
'edittoolbar-tool-replace-regex' => 'Считать Ñтроку поиÑка регулÑрным выражением',
'edittoolbar-tool-replace-all' => 'Заменить вÑе вхождениÑ',
'edittoolbar-tool-replace-button' => 'Заменить',
- 'edittoolbar-tool-replace-close' => 'Закрыть',
+ 'edittoolbar-tool-replace-close' => 'Отмена',
'edittoolbar-tool-replace-nomatch' => 'По вашему запроÑу ничего не найдено.',
+ 'edittoolbar-tool-replace-success' => 'Произведено замен: $1.',
'edittoolbar-section-characters' => 'Специальные Ñимволы',
'edittoolbar-characters-page-latin' => 'ЛатинÑкие',
'edittoolbar-characters-page-latinextended' => 'ЛатинÑкие раÑширенные',
@@ -7797,7 +8808,7 @@
'edittoolbar-help-content-file-description' => 'Ð’Ñтроенный файл',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|ПоÑÑнительный текÑÑ‚]]',
'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='
-Ð¡Ð¾Ð¿Ñ€Ð¾Ð²Ð¾Ð´Ð¸Ñ‚ÐµÐ»ÑŒÐ½Ð°Ñ Ð½Ð°Ð´Ð¿Ð¸ÑÑŒ' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>
+Ð¡Ð¾Ð¿Ñ€Ð¾Ð²Ð¾Ð´Ð¸Ñ‚ÐµÐ»ÑŒÐ½Ð°Ñ Ð½Ð°Ð´Ð¿Ð¸ÑÑŒ' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>
Ð¡Ð¾Ð¿Ñ€Ð¾Ð²Ð¾Ð´Ð¸Ñ‚ÐµÐ»ÑŒÐ½Ð°Ñ Ð½Ð°Ð´Ð¿Ð¸ÑÑŒ</div></div>",
'edittoolbar-help-content-reference-description' => 'Примечание',
'edittoolbar-help-content-reference-syntax' => 'ТекÑÑ‚ Ñтраницы<ref name="test">[http://www.example.org ТекÑÑ‚ ÑÑылки], дополнительный текÑÑ‚.</ref>.',
@@ -7822,11 +8833,16 @@
'edittoolbar' => 'Көннөрүү хаптаһына (панель)',
'edittoolbar-desc' => 'ТупÑарыллыбыт уларытыы хаптаһына',
'edittoolbar-preference' => 'ТупÑарыллыбыт уларытыы хаптаһынын холбуурга',
+ 'edittoolbar-cgd-preference' => 'Ðрыый ууÑтук биики тиÑкиһи туһанар туһунан көмө-Ñуруктары көÑÑ‚Ó©Ñ€ гыныы',
'edittoolbar-loading' => 'КиллÑрии...',
'edittoolbar-tool-bold' => 'Модьу',
'edittoolbar-tool-bold-example' => 'Модьу бичик',
'edittoolbar-tool-italic' => 'ИҥнÑри',
'edittoolbar-tool-italic-example' => 'ИҥнÑри бичик',
+ 'edittoolbar-tool-ilink' => 'Ð˜Ñ ÑигÑ',
+ 'edittoolbar-tool-ilink-example' => 'Ð¡Ð¸Ð³Ñ Ð±Ð°Ò»Ð°',
+ 'edittoolbar-tool-xlink' => 'Ð¢Ð°Ñ ÑÐ¸Ð³Ñ (http:// диÑни умнума)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com ÑÐ¸Ð³Ñ Ð±Ñ‹Ò»Ð°Ð°Ñ€Ñ‹Ñ‹Ñ‚Ð°',
'edittoolbar-tool-link' => 'СигÑ',
'edittoolbar-tool-link-title' => 'СигÑни туруоруу',
'edittoolbar-tool-link-int' => 'Биики ÑирÑйгÑ',
@@ -7842,6 +8858,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Сатаммат баÑ',
'edittoolbar-tool-link-int-target-status-loading' => 'СирÑй баарын тургутуу...',
'edittoolbar-tool-link-int-invalid' => 'Суруллубут аат туттуллара Ñатаммат.',
+ 'edittoolbar-tool-link-ext-invalid' => 'ÐлҕаÑтаах URL ыйыллыбыт.',
'edittoolbar-tool-file' => 'ИһинÑÑҕи билÑ',
'edittoolbar-tool-file-example' => 'Example.jpg',
'edittoolbar-tool-reference' => 'Быһаарыы',
@@ -7876,6 +8893,18 @@
{{ns:file}}:Example.jpg|Сурук2',
'edittoolbar-tool-newline' => 'Кыһыл уÑтуруока',
'edittoolbar-tool-table' => 'Таабыл',
+ 'edittoolbar-tool-table-example-old' => '-
+! баһа 1
+! баһа 2
+! баһа 3
+|-
+| Ñтрока 1, Ñчейка 1
+| Ñтрока 1, Ñчейка 2
+| Ñтрока 1, Ñчейка 3
+|-
+| Ñтрока 2, Ñчейка 1
+| Ñтрока 2, Ñчейка 2
+| Ñтрока 2, Ñчейка 3',
'edittoolbar-tool-table-example' => 'УÑтуруока $1, Ñчейка $2',
'edittoolbar-tool-table-example-header' => 'УÑтуруока $1, Ñчейка $2 (баһа)',
'edittoolbar-tool-table-title' => 'ТабылыыÑÑаны угуу',
@@ -7885,14 +8914,17 @@
'edittoolbar-tool-table-dimensions-header' => 'Ð‘Ð°Ñ ÑƒÑтуруоканы Ñбии',
'edittoolbar-tool-table-insert' => 'КиллÑÑ€ÑргÑ',
'edittoolbar-tool-table-cancel' => 'БигÑргÑтимÑ',
- 'edittoolbar-tool-replace' => 'Уларыт',
+ 'edittoolbar-tool-replace' => 'Көрдөөһүн уонна уларытыы',
'edittoolbar-tool-replace-title' => 'Бул уонна уларыт',
'edittoolbar-tool-replace-search' => 'Көрдөөһүн:',
'edittoolbar-tool-replace-replace' => 'Манан уларыт:',
'edittoolbar-tool-replace-case' => 'РегиÑтрын учуоттуурга',
+ 'edittoolbar-tool-replace-regex' => 'Көрдөөһүн уÑтуруокатын регулÑрнай выражение курдук көрөргө',
+ 'edittoolbar-tool-replace-all' => 'Барытын уларыт',
'edittoolbar-tool-replace-button' => 'Уларыт',
- 'edittoolbar-tool-replace-close' => 'Сап',
+ 'edittoolbar-tool-replace-close' => 'ТаҕыÑ',
'edittoolbar-tool-replace-nomatch' => 'Ðн көрдөбүлгүнÑн туох да көÑтүбÑÑ‚Ñ.',
+ 'edittoolbar-tool-replace-success' => 'Бачча уларытыы оҥоһулунна: $1.',
'edittoolbar-section-characters' => 'Ðнал бÑлиÑлÑÑ€',
'edittoolbar-characters-page-latin' => 'Латыынныы',
'edittoolbar-characters-page-latinextended' => 'Латыынныы кÑтирÑтиллибиттÑÑ€',
@@ -7953,7 +8985,7 @@
'edittoolbar-help-content-file-description' => 'ИһинÑÑҕи билÑ',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|Быһаарыыта]]',
'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='
-Быһаарыы Ñурук' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>
+Быһаарыы Ñурук' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>
Быһаарыы Ñурук</div></div>",
'edittoolbar-help-content-reference-description' => 'Быһаарыы',
'edittoolbar-help-content-reference-syntax' => 'СирÑй тиÑкиһÑ.<ref name="test">[http://www.example.org Ð¡Ð¸Ð³Ñ Ð±Ñ‹Ò»Ð°Ð°Ñ€Ñ‹Ñ‹Ñ‚Ð°], Ñбии быһаарыы.</ref>',
@@ -8003,6 +9035,69 @@
'edittoolbar-characters-page-ipa' => 'IPA',
);
+/** Sinhala (සිංහල)
+ * @author Calcey
+ */
+$messages['si'] = array(
+ 'edittoolbar-tool-ilink' => 'අභ්â€à¶ºà¶±à·Šà¶à¶» සබà·à¶³à·”ම',
+ 'edittoolbar-tool-ilink-example' => 'සබà·à¶³à·”ම් මà·à¶à·˜à¶šà·à·€',
+ 'edittoolbar-tool-link' => 'සබà·à¶³à·”ම',
+ 'edittoolbar-tool-link-title' => 'සබà·à¶³à·”මක් අà·à¶à·”ල් කිරීම',
+ 'edittoolbar-tool-link-int' => 'විකි පිටුවක් ෙවà¶',
+ 'edittoolbar-tool-link-int-target' => 'පිටු මà·à¶à·˜à¶šà·à·€:',
+ 'edittoolbar-tool-link-int-text' => 'සබà·à¶³à·”ම් පෙළ:',
+ 'edittoolbar-tool-link-ext' => 'බà·à·„ිර ෙවබ් පිටුවක් ෙවà¶',
+ 'edittoolbar-tool-link-ext-target' => ' URL සබà·à¶³à·”ම:',
+ 'edittoolbar-tool-link-insert' => 'සබà·à¶³à·”මක් අà·à¶à·”ල් කරන්න',
+ 'edittoolbar-tool-link-int-target-status-exists' => 'පිටුව පවà¶à·“',
+ 'edittoolbar-tool-link-int-target-status-invalid' => 'වලංගු මà·à¶à·˜à¶šà·à·€à¶šà·Š ෙනà·à·™à·€à·Š.',
+ 'edittoolbar-tool-link-int-target-status-loading' => 'පිටුෙව් පà·à·€à·à¶à·Šà¶¸ පරීක්ෂ෠කරමින් පවà¶à·“...',
+ 'edittoolbar-tool-link-int-invalid' => 'ඔබ සඳහන් කළ මà·à¶à·˜à¶šà·à·€ වලංගු ෙනà·à·™à·€à·Š.',
+ 'edittoolbar-tool-reference' => 'ෙයà·à¶¸à·”à·€',
+ 'edittoolbar-section-advanced' => 'දියුණු කළ',
+ 'edittoolbar-tool-heading' => 'à·à·“ර්ෂය',
+ 'edittoolbar-tool-heading-1' => '1 මට්ටම',
+ 'edittoolbar-tool-heading-2' => '2 මට්ටම',
+ 'edittoolbar-tool-heading-3' => '3 මට්ටම',
+ 'edittoolbar-tool-heading-4' => '4 මට්ටම',
+ 'edittoolbar-tool-heading-5' => '5 මට්ටම',
+ 'edittoolbar-tool-heading-example' => 'à·à·“ර්ෂ ෙපළ',
+ 'edittoolbar-group-list' => 'ලà·à¶ºà·’ස්à¶à·”à·€',
+ 'edittoolbar-tool-ulist' => 'රට෠සහිචලà·à¶ºà·’ස්à¶à·”à·€',
+ 'edittoolbar-tool-ulist-example' => 'රට෠සහිචලයිස්à¶à·” අයිà¶à¶¸à¶º',
+ 'edittoolbar-tool-olist' => 'අංකිචලà·à¶ºà·’ස්à¶à·”à·€',
+ 'edittoolbar-group-size' => 'විà·à·à¶½à¶à·Šà·€à¶º',
+ 'edittoolbar-tool-big' => 'විà·à·à¶½',
+ 'edittoolbar-tool-big-example' => 'විà·à·à¶½ ෙපළ',
+ 'edittoolbar-tool-small' => 'කුඩà·',
+ 'edittoolbar-tool-small-example' => 'කුඩ෠ෙපළ',
+ 'edittoolbar-group-baseline' => 'පà·à¶¯ ෙර්ඛà·à·€',
+ 'edittoolbar-tool-superscript' => 'උඩු ලකුණු',
+ 'edittoolbar-tool-superscript-example' => 'උඩු ලකණු ෙපළ',
+ 'edittoolbar-tool-subscript' => 'යටි ලකුණු',
+ 'edittoolbar-tool-subscript-example' => 'යටි ලකුණු ෙපළ',
+ 'edittoolbar-tool-gallery' => 'පිංà¶à·–ර ගà·à¶½à¶»à·’ය',
+ 'edittoolbar-tool-newline' => 'නව ෙප්ළිය',
+ 'edittoolbar-tool-table' => 'වගුව',
+ 'edittoolbar-tool-table-title' => 'වගුවක් අà·à¶à·”ල් කිරීම',
+ 'edittoolbar-tool-table-dimensions' => 'මà·à¶±',
+ 'edittoolbar-tool-table-dimensions-rows' => 'ෙප්ළි',
+ 'edittoolbar-tool-table-dimensions-columns' => 'à¶à·“රු',
+ 'edittoolbar-tool-table-dimensions-header' => 'à·à·“ර්ෂ ෙප්ළියක් අà·à¶à·”ල් කරන්න',
+ 'edittoolbar-tool-table-insert' => 'අà·à¶à·”ල් කරන්න',
+ 'edittoolbar-tool-table-cancel' => 'අවලංගු කරන්න',
+ 'edittoolbar-tool-replace-title' => 'ෙසවීම හ෠ප්â€à¶»à¶à·’ස්ථà·à¶´à¶±à¶º',
+ 'edittoolbar-tool-replace-search' => 'ෙසà·à¶ºà¶±à·Šà·™à¶±à·Š',
+ 'edittoolbar-tool-replace-replace' => 'ප්â€à¶»à¶à·’ස්ථà·à¶´à¶±à¶º කළ යුà¶à·Šà·™à¶à·Š',
+ 'edittoolbar-tool-replace-case' => 'අවස්ථà·à·€ ගළපන්න',
+ 'edittoolbar-tool-replace-regex' => 'ෙසà·à¶ºà¶± පදය නියචප්â€à¶»à¶šà·à·à¶±à¶ºà¶šà·Š ෙලස සලකන්න',
+ 'edittoolbar-tool-replace-all' => 'සියලුම අවස්ථà·à·€à¶±à·Š ප්â€à¶»à¶à·’ස්ථà·à¶´à¶±à¶º කරන්න.',
+ 'edittoolbar-tool-replace-button' => 'ප්â€à¶»à¶à·’ස්ථà·à¶´à¶±à¶º කරන්න',
+ 'edittoolbar-tool-replace-nomatch' => 'ඔෙබ් ෙසවීම කිසිදු පදයක් හ෠ෙනà·à¶œà·à·…පේ',
+ 'edittoolbar-tool-replace-success' => 'ඒක් ප්â€à¶»à¶à·’ස්ථà·à¶´à¶±à¶ºà¶šà·Š සිදු කරන ලදී.',
+ 'edittoolbar-section-characters' => 'විෙà·à·Šà·‚ අනු ලකුණු',
+);
+
/** Slovak (SlovenÄina)
* @author Helix84
* @author Rudko
@@ -8011,11 +9106,16 @@
'edittoolbar' => 'Panel nástrojov na úpravy',
'edittoolbar-desc' => 'Panel nástrojov na úpravy stránky s rozÅ¡Ãrenou použiteľnosÅ¥ou',
'edittoolbar-preference' => 'Zapnúť rozÅ¡Ãrený panel nástrojov na úpravy',
+ 'edittoolbar-cgd-preference' => 'PovoliÅ¥ pomocnÃka k pridávaniu rozÅ¡Ãreného wiki textu',
'edittoolbar-loading' => 'NaÄÃtava sa...',
'edittoolbar-tool-bold' => 'Hrubý',
'edittoolbar-tool-bold-example' => 'Hrubý text',
'edittoolbar-tool-italic' => 'KurzÃva',
'edittoolbar-tool-italic-example' => 'Text kurzÃvou',
+ 'edittoolbar-tool-ilink' => 'Interný odkaz',
+ 'edittoolbar-tool-ilink-example' => 'Názov odkazu',
+ 'edittoolbar-tool-xlink' => 'Externý odkaz (pamätajte na predponu http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com názov odkazu',
'edittoolbar-tool-link' => 'Odkaz',
'edittoolbar-tool-link-title' => 'Vložiť odkaz',
'edittoolbar-tool-link-int' => 'Na wiki stránku',
@@ -8031,6 +9131,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Neplatný názov',
'edittoolbar-tool-link-int-target-status-loading' => 'Kontroluje sa existencia stránky...',
'edittoolbar-tool-link-int-invalid' => 'Názov, ktorý ste zadali nie je platný.',
+ 'edittoolbar-tool-link-ext-invalid' => 'URL, ktorý ste uviedli nie je platný.',
'edittoolbar-tool-file' => 'Vložený súbor',
'edittoolbar-tool-file-example' => 'PrÃklad.jpg',
'edittoolbar-tool-reference' => 'Referencia',
@@ -8065,6 +9166,18 @@
{{ns:file}}:PrÃklad.jpg|Popis2',
'edittoolbar-tool-newline' => 'Nový riadok',
'edittoolbar-tool-table' => 'Tabuľka',
+ 'edittoolbar-tool-table-example-old' => '-
+! hlaviÄka 1
+! hlaviÄka 2
+! hlaviÄka 3
+|-
+| riadok 1, bunka 1
+| riadok 1, bunka 2
+| riadok 1, bunka 3
+|-
+| riadok 2, bunka 1
+| riadok 2, bunka 2
+| riadok 2, bunka 3',
'edittoolbar-tool-table-example' => 'Riadok $1, bunka $2',
'edittoolbar-tool-table-example-header' => 'Riadok $1, bunka $2 (hlaviÄka)',
'edittoolbar-tool-table-title' => 'Vložiť tabuľku',
@@ -8074,7 +9187,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Vrátane hlaviÄkového riadka',
'edittoolbar-tool-table-insert' => 'Vložiť',
'edittoolbar-tool-table-cancel' => 'Zrušiť',
- 'edittoolbar-tool-replace' => 'Nahradiť',
+ 'edittoolbar-tool-replace' => 'Hľadať a nahradiť',
'edittoolbar-tool-replace-title' => 'Hľadať a nahradiť',
'edittoolbar-tool-replace-search' => 'Hľadať:',
'edittoolbar-tool-replace-replace' => 'NahradiÅ¥ ÄÃm:',
@@ -8082,8 +9195,9 @@
'edittoolbar-tool-replace-regex' => 'Vyhľadávacà reťazec je regulárny výraz',
'edittoolbar-tool-replace-all' => 'Nahradiť všetky výskyty',
'edittoolbar-tool-replace-button' => 'Nahradiť',
- 'edittoolbar-tool-replace-close' => 'Zatvoriť',
+ 'edittoolbar-tool-replace-close' => 'Zrušiť',
'edittoolbar-tool-replace-nomatch' => 'Vyhľadávanie nenašlo vyhovujúce položky.',
+ 'edittoolbar-tool-replace-success' => 'Nahradilo sa $1 výskytov.',
'edittoolbar-section-characters' => 'Špeciálne znaky',
'edittoolbar-characters-page-latin' => 'Latinka',
'edittoolbar-characters-page-latinextended' => 'Latina rozÅ¡Ãrené',
@@ -8143,7 +9257,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Položka zoznamu</li><li>Položka zoznamu</li></ol>',
'edittoolbar-help-content-file-description' => 'Vložený súbor',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:PrÃklad.png|náhľad|Text nadpisu]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Text nadpisu' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='ZväÄÅ¡iÅ¥' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Text nadpisu</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Text nadpisu' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='ZväÄÅ¡iÅ¥' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Text nadpisu</div></div>",
'edittoolbar-help-content-reference-description' => 'Referencie',
'edittoolbar-help-content-reference-syntax' => 'Text stránky.<ref name="test">[http://www.example.org Text odkazu], ÄalÅ¡Ã text.</ref>',
'edittoolbar-help-content-reference-result' => "Text stránky.<sup><a href='#'>[1]</a></sup>",
@@ -8172,6 +9286,10 @@
'edittoolbar-tool-bold-example' => 'Krepko besedilo',
'edittoolbar-tool-italic' => 'LežeÄe',
'edittoolbar-tool-italic-example' => 'LežeÄe besedilo',
+ 'edittoolbar-tool-ilink' => 'Notranja povezava',
+ 'edittoolbar-tool-ilink-example' => 'Naslov povezave',
+ 'edittoolbar-tool-xlink' => 'Zunanja povezava (ne pozabite na predpono http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com naslov povezave',
'edittoolbar-tool-link' => 'Povezava',
'edittoolbar-tool-link-title' => 'Vstavi povezavo',
'edittoolbar-tool-link-int' => 'Na wiki stran',
@@ -8227,8 +9345,6 @@
'edittoolbar-tool-table-dimensions' => 'Dimenzije',
'edittoolbar-tool-table-dimensions-rows' => 'Vrstice',
'edittoolbar-tool-table-dimensions-columns' => 'Stolpci',
- 'edittoolbar-tool-table-dimensions-headerrows' => 'Naslovna vrstica',
- 'edittoolbar-tool-table-dimensions-headercolumns' => 'Naslovni stolpec',
'edittoolbar-tool-table-insert' => 'Vstavi',
'edittoolbar-tool-table-cancel' => 'PrekliÄi',
'edittoolbar-tool-replace' => 'Zamenjaj',
@@ -8300,7 +9416,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li> Vnos a </li><li> Vnos b </li></ol>',
'edittoolbar-help-content-file-description' => 'Vgradnja slike',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Primer.jpg|thumb|Napis pod sliko]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'> <a title=\"Napis pod sliko\" class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a> <div class='thumbcaption'><div class='magnify'> <a title=\"PoveÄaj\" class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a> </div> Napis pod sliko </div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'> <a title=\"Napis pod sliko\" class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a> <div class='thumbcaption'><div class='magnify'> <a title=\"PoveÄaj\" class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a> </div> Napis pod sliko </div></div>",
'edittoolbar-help-content-reference-description' => 'Sprotna opomba',
'edittoolbar-help-content-reference-syntax' => 'Besedilo strani. <ref name="test"> [http://www.example.org Oznaka povezave], dodatno besedilo. </ref>',
'edittoolbar-help-content-reference-result' => "Besedilo strani. <a href='#'><sup>[1]</sup></a>",
@@ -8318,6 +9434,7 @@
);
/** Serbian Cyrillic ekavian (СрпÑки (ћирилица))
+ * @author Sasa Stefanovic
* @author Михајло Ðнђелковић
*/
$messages['sr-ec'] = array(
@@ -8326,6 +9443,23 @@
'edittoolbar-tool-bold-example' => 'Подебљан текÑÑ‚',
'edittoolbar-tool-italic' => 'Корзив',
'edittoolbar-tool-italic-example' => 'Курзиван текÑÑ‚',
+ 'edittoolbar-tool-ilink' => 'Унутрашња веза',
+ 'edittoolbar-tool-ilink-example' => 'ÐаÑлов везе',
+ 'edittoolbar-tool-xlink' => 'Спољашња веза (не заборавите http:// префикÑ)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com наÑлов везе',
+ 'edittoolbar-tool-link' => 'Веза',
+ 'edittoolbar-tool-link-title' => 'Убаци везу',
+ 'edittoolbar-tool-link-int-target' => 'ÐаÑлов Ñтране:',
+ 'edittoolbar-tool-link-int-text' => 'ТекÑÑ‚ везе:',
+ 'edittoolbar-tool-link-ext-target' => 'Путања везе (УРЛ):',
+ 'edittoolbar-tool-link-ext-text' => 'ТекÑÑ‚ везе:',
+ 'edittoolbar-tool-link-cancel' => 'Прекини',
+ 'edittoolbar-tool-link-int-target-status-exists' => 'Страница поÑтоји',
+ 'edittoolbar-tool-link-int-target-status-notexists' => 'Страница не поÑтоји',
+ 'edittoolbar-tool-link-int-target-status-invalid' => 'Погрешан наÑлов',
+ 'edittoolbar-tool-link-int-target-status-loading' => 'Провера поÑтојања Ñтранице...',
+ 'edittoolbar-tool-link-int-invalid' => 'ÐаÑлов који Ñте изабрали није валидан',
+ 'edittoolbar-tool-link-ext-invalid' => 'Веза коју Ñте изабрали није валидна',
'edittoolbar-tool-file-example' => 'Primer.jpg',
'edittoolbar-tool-reference' => 'Референца',
'edittoolbar-tool-reference-example' => 'УнеÑите текÑÑ‚ фуÑноте овде',
@@ -8339,6 +9473,47 @@
'edittoolbar-tool-heading-example' => 'ТекÑÑ‚ одељка',
'edittoolbar-group-list' => 'СпиÑак',
'edittoolbar-group-size' => 'Величина',
+ 'edittoolbar-tool-big' => 'Велик',
+ 'edittoolbar-tool-big-example' => 'Велик текÑÑ‚',
+ 'edittoolbar-tool-small' => 'Мали',
+ 'edittoolbar-tool-small-example' => 'Мали текÑÑ‚',
+ 'edittoolbar-group-insert' => 'Убаци',
+ 'edittoolbar-tool-gallery' => 'Галерија Ñлика',
+ 'edittoolbar-tool-newline' => 'Ðова линија',
+ 'edittoolbar-tool-table' => 'Табела',
+ 'edittoolbar-tool-table-example-old' => '-
+! наÑлов 1
+! наÑлов 2
+! наÑлов 3
+|-
+| ред 1, ћелија 1
+| ред 1, ћелија 2
+| ред 1, ћелија 3
+|-
+| ред 2, ћелија 1
+| ред 2, ћелија 2
+| ред 2, ћелија 3',
+ 'edittoolbar-tool-table-example' => 'Ред $1, ћелија $2',
+ 'edittoolbar-tool-table-example-header' => 'Ред $1, ћелија $2 (наÑлов)',
+ 'edittoolbar-tool-table-title' => 'Убаци табелу',
+ 'edittoolbar-tool-replace-button' => 'Замени',
+ 'edittoolbar-tool-replace-close' => 'одуÑтани',
+ 'edittoolbar-characters-page-latin' => 'латиница',
+ 'edittoolbar-characters-page-latinextended' => 'проширена латиница',
+ 'edittoolbar-characters-page-ipa' => 'ИПÐ',
+ 'edittoolbar-characters-page-symbols' => 'Симболи',
+ 'edittoolbar-characters-page-greek' => 'грчки',
+ 'edittoolbar-characters-page-cyrillic' => 'ћирилица',
+ 'edittoolbar-characters-page-arabic' => 'арапÑки',
+ 'edittoolbar-characters-page-telugu' => 'телугу',
+ 'edittoolbar-section-help' => 'Помоћ',
+ 'edittoolbar-help-heading-description' => 'ОпиÑ',
+ 'edittoolbar-help-heading-syntax' => 'Шта куцате',
+ 'edittoolbar-help-heading-result' => 'Шта добијете',
+ 'edittoolbar-help-page-format' => 'Форматирање',
+ 'edittoolbar-help-page-link' => 'Везе',
+ 'edittoolbar-help-page-heading' => 'ÐаÑлови',
+ 'edittoolbar-help-page-list' => 'СпиÑкови',
'edittoolbar-help-content-heading1-description' => 'одељак првог нивоа',
'edittoolbar-help-content-heading1-syntax' => '= ÐаÑлов одељка =',
'edittoolbar-help-content-heading1-result' => '<h1>ÐаÑлов одељка</h1>',
@@ -8365,6 +9540,10 @@
'edittoolbar-tool-bold-example' => 'Podebljan tekst',
'edittoolbar-tool-italic' => 'Korziv',
'edittoolbar-tool-italic-example' => 'Kurzivan tekst',
+ 'edittoolbar-tool-ilink' => 'Unutrašnja veza',
+ 'edittoolbar-tool-ilink-example' => 'Naslov veze',
+ 'edittoolbar-tool-xlink' => 'Spoljašnja veza (ne zaboravite <a href="http://">http://</a> prefiks)',
+ 'edittoolbar-tool-xlink-example' => '<a href="http://www.example.com">http://www.example.com</a> naslov veze',
'edittoolbar-tool-file-example' => 'Primer.jpg',
'edittoolbar-tool-reference' => 'Referenca',
'edittoolbar-tool-reference-example' => 'Unesite tekst fusnote ovde',
@@ -8419,6 +9598,10 @@
'edittoolbar-tool-bold-example' => 'Fet text',
'edittoolbar-tool-italic' => 'Kursiv',
'edittoolbar-tool-italic-example' => 'Kursiv text',
+ 'edittoolbar-tool-ilink' => 'Intern länk',
+ 'edittoolbar-tool-ilink-example' => 'Länktitel',
+ 'edittoolbar-tool-xlink' => 'Extern länk (kom ihåg http:// -prefixet)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.exempel.com länktitel',
'edittoolbar-tool-link' => 'Länk',
'edittoolbar-tool-link-title' => 'Lägg till länk',
'edittoolbar-tool-link-int' => 'Till en wikisida',
@@ -8540,7 +9723,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Listelement</li><li>Listelement</li></ol>',
'edittoolbar-help-content-file-description' => 'Inbäddad fil',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|miniatyr|Bildtext]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bildtext' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Förstora' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Bildtext</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Bildtext' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Förstora' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Bildtext</div></div>",
'edittoolbar-help-content-reference-description' => 'Referens',
'edittoolbar-help-content-reference-syntax' => 'Brödtext.<ref name="test">[http://www.example.org Länktext], ytterligare text.</ref>',
'edittoolbar-help-content-reference-result' => "Brödtext.<sup><a href='#'>[1]</a></sup>",
@@ -8561,7 +9744,34 @@
* @author Lloffiwr
*/
$messages['sw'] = array(
+ 'edittoolbar-loading' => 'Inapakizwa...',
+ 'edittoolbar-tool-bold' => 'Koze',
+ 'edittoolbar-tool-bold-example' => 'Maandishi ya kooze',
+ 'edittoolbar-tool-italic' => 'Italiki',
+ 'edittoolbar-tool-link' => 'Kiungo',
+ 'edittoolbar-tool-link-title' => 'Kuweka kiungo',
+ 'edittoolbar-tool-link-int-target' => 'Jina la ukurasa:',
+ 'edittoolbar-tool-link-int-text' => 'Maandishi ya kiungo:',
+ 'edittoolbar-tool-link-int-target-status-exists' => 'Ukurasa unapatikana',
+ 'edittoolbar-tool-link-int-target-status-notexists' => 'Ukurasa haupatikani',
+ 'edittoolbar-group-list' => 'Orodha',
+ 'edittoolbar-group-size' => 'Ukubwa',
+ 'edittoolbar-tool-big' => 'Kubwa',
+ 'edittoolbar-tool-big-example' => 'Maandishi makubwa',
+ 'edittoolbar-tool-small' => 'Ndogo',
+ 'edittoolbar-tool-small-example' => 'Maandishi madogo',
+ 'edittoolbar-tool-table-dimensions-rows' => 'Mistari',
+ 'edittoolbar-tool-table-dimensions-columns' => 'Safu',
+ 'edittoolbar-tool-replace-search' => 'Tafuta:',
+ 'edittoolbar-section-help' => 'Msaada',
+ 'edittoolbar-help-heading-description' => 'Elezo',
+ 'edittoolbar-help-page-link' => 'Viungo',
+ 'edittoolbar-help-page-list' => 'Orodha',
'edittoolbar-help-page-file' => 'Mafaili',
+ 'edittoolbar-help-content-italic-description' => 'Italiki',
+ 'edittoolbar-help-content-bold-description' => 'Koze',
+ 'edittoolbar-help-content-bold-syntax' => "'''Maandishi ya kooze'''",
+ 'edittoolbar-help-content-bold-result' => '<strong>Maandishi ya kooze</strong>',
);
/** Telugu (తెలà±à°—à±)
@@ -8576,6 +9786,10 @@
'edittoolbar-tool-bold-example' => 'బొదà±à°¦à± పాఠà±à°¯à°‚',
'edittoolbar-tool-italic' => 'వాలà±',
'edittoolbar-tool-italic-example' => 'వాలౠపాఠà±à°¯à°‚',
+ 'edittoolbar-tool-ilink' => 'అంతరà±à°—à°¤ లింకà±',
+ 'edittoolbar-tool-ilink-example' => 'లంకె లంకెపేరà±',
+ 'edittoolbar-tool-xlink' => 'బయటి లింకౠ(http:// ఉపసరà±à°—ని మరిచిపోకండి)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com లంకె లంకెపేరà±',
'edittoolbar-tool-link' => 'లంకె',
'edittoolbar-tool-link-title' => 'లంకె à°•à°²à±à°ªà±',
'edittoolbar-tool-link-int' => 'ఒక వికీ పేజీకి',
@@ -8588,11 +9802,14 @@
'edittoolbar-tool-link-int-target-status-notexists' => 'పేజీ ఉనికిలో లేదà±',
'edittoolbar-tool-reference' => 'సాకà±à°·à±à°¯à°¾à°²à±',
'edittoolbar-tool-signature' => 'టైంసà±à°Ÿà°¾à°‚à°ªà±à°¤à±‹ సహా మీ సంతకం',
+ 'edittoolbar-section-advanced' => 'ఉనà±à°¨à°¤',
+ 'edittoolbar-tool-heading' => 'శీరà±à°·à°¿à°•',
'edittoolbar-tool-heading-1' => '1à°µ à°¸à±à°¥à°¾à°¯à°¿',
'edittoolbar-tool-heading-2' => '2à°µ à°¸à±à°¥à°¾à°¯à°¿',
'edittoolbar-tool-heading-3' => '3à°µ à°¸à±à°¥à°¾à°¯à°¿',
'edittoolbar-tool-heading-4' => '4à°µ à°¸à±à°¥à°¾à°¯à°¿',
'edittoolbar-tool-heading-5' => '5à°µ à°¸à±à°¥à°¾à°¯à°¿',
+ 'edittoolbar-tool-heading-example' => 'శీరà±à°·à°¿à°• పాఠà±à°¯à°‚',
'edittoolbar-group-list' => 'జాబితా',
'edittoolbar-group-size' => 'పరిమాణం',
'edittoolbar-tool-big' => 'పెదà±à°¦',
@@ -8629,9 +9846,25 @@
'edittoolbar-help-content-bold-syntax' => "'''బొదà±à°¦à± పాఠà±à°¯à°‚'''",
'edittoolbar-help-content-bold-result' => '<strong>బొదà±à°¦à± పాఠà±à°¯à°‚</strong>',
'edittoolbar-help-content-bolditalic-description' => 'బొదà±à°¦à± & వాలà±',
+ 'edittoolbar-help-content-bolditalic-syntax' => "'''''బొదà±à°¦à± & వాలౠపాఠà±à°¯à°‚'''''",
'edittoolbar-help-content-bolditalic-result' => '<strong><em>బొదà±à°¦à± & వాలౠపాఠà±à°¯à°‚</em></strong>',
'edittoolbar-help-content-ilink-description' => 'అంతరà±à°—à°¤ లింకà±',
'edittoolbar-help-content-xlink-description' => 'బయటి లింకà±',
+ 'edittoolbar-help-content-heading1-description' => '1à°µ à°¸à±à°¥à°¾à°¯à°¿ శీరà±à°·à°¿à°•',
+ 'edittoolbar-help-content-heading1-syntax' => '= శీరà±à°·à°¿à°• పాఠà±à°¯à°‚ =',
+ 'edittoolbar-help-content-heading1-result' => '<h1>శీరà±à°·à°¿à°• పాఠà±à°¯à°‚</h1>',
+ 'edittoolbar-help-content-heading2-description' => '2à°µ à°¸à±à°¥à°¾à°¯à°¿ శీరà±à°·à°¿à°•',
+ 'edittoolbar-help-content-heading2-syntax' => '== శీరà±à°·à°¿à°• పాఠà±à°¯à°‚ ==',
+ 'edittoolbar-help-content-heading2-result' => '<h2>శీరà±à°·à°¿à°• పాఠà±à°¯à°‚</h2>',
+ 'edittoolbar-help-content-heading3-description' => '3à°µ à°¸à±à°¥à°¾à°¯à°¿ శీరà±à°·à°¿à°•',
+ 'edittoolbar-help-content-heading3-syntax' => '=== శీరà±à°·à°¿à°• పాఠà±à°¯à°‚ ===',
+ 'edittoolbar-help-content-heading3-result' => '<h3>శీరà±à°·à°¿à°• పాఠà±à°¯à°‚</h3>',
+ 'edittoolbar-help-content-heading4-description' => '4à°µ à°¸à±à°¥à°¾à°¯à°¿ శీరà±à°·à°¿à°•',
+ 'edittoolbar-help-content-heading4-syntax' => '==== శీరà±à°·à°¿à°• పాఠà±à°¯à°‚ ====',
+ 'edittoolbar-help-content-heading4-result' => '<h4>శీరà±à°·à°¿à°• పాఠà±à°¯à°‚</h4>',
+ 'edittoolbar-help-content-heading5-description' => '5à°µ à°¸à±à°¥à°¾à°¯à°¿ శీరà±à°·à°¿à°•',
+ 'edittoolbar-help-content-heading5-syntax' => '===== శీరà±à°·à°¿à°• పాఠà±à°¯à°‚ =====',
+ 'edittoolbar-help-content-heading5-result' => '<h5>శీరà±à°·à°¿à°• పాఠà±à°¯à°‚</h5>',
'edittoolbar-help-content-olist-description' => 'సంఖà±à°¯à°¾à°¨à±à°—à±à°£ జాబితా',
'edittoolbar-help-content-reference-description' => 'సాకà±à°·à±à°¯à°¾à°²à±',
'edittoolbar-help-content-reference-result' => "పేజీ పాఠà±à°¯à°‚.<sup><a href='#'>[1]</a></sup>",
@@ -8687,11 +9920,16 @@
'edittoolbar' => 'Araç çubuğu düzenleme',
'edittoolbar-desc' => 'Gelişmiş kullanılabilirlik ile sayfa araç çubuğunu değiştir',
'edittoolbar-preference' => 'Gelişmiş düzenleme araç çubuğunu etkinleştir',
+ 'edittoolbar-cgd-preference' => 'Gelişmiş viki metni eklemek için yardımı etkinleştir',
'edittoolbar-loading' => 'Yükleniyor...',
'edittoolbar-tool-bold' => 'Kalın',
'edittoolbar-tool-bold-example' => 'Kalın metin',
'edittoolbar-tool-italic' => 'Ä°talik',
'edittoolbar-tool-italic-example' => 'Ä°talik metin',
+ 'edittoolbar-tool-ilink' => 'İç bağlantı',
+ 'edittoolbar-tool-ilink-example' => 'Bağlantı başlığı',
+ 'edittoolbar-tool-xlink' => 'Dış bağlantı (http:// önekini unutmayın)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.ornek.com bağlantı başlığı',
'edittoolbar-tool-link' => 'Bağlantı',
'edittoolbar-tool-link-title' => 'Bağlantı ekle',
'edittoolbar-tool-link-int' => 'Bir viki sayfasına',
@@ -8707,6 +9945,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Geçersiz başlık',
'edittoolbar-tool-link-int-target-status-loading' => 'Sayfanın mevcudiyeti kontrol ediliyor...',
'edittoolbar-tool-link-int-invalid' => 'Belirttiğiniz başlık geçersiz.',
+ 'edittoolbar-tool-link-ext-invalid' => 'Belirttiğiniz URL geçersiz.',
'edittoolbar-tool-file' => 'Gömülü dosya',
'edittoolbar-tool-file-example' => 'Örnek.jpg',
'edittoolbar-tool-reference' => 'Kaynakça',
@@ -8741,6 +9980,18 @@
{{ns:file}}:Örnek.jpg|Resimyazısı2',
'edittoolbar-tool-newline' => 'Yeni satır',
'edittoolbar-tool-table' => 'Tablo',
+ 'edittoolbar-tool-table-example-old' => '-
+! başlık 1
+! başlık 2
+! başlık 3
+|-
+| satır 1, hücre 1
+| satır 1, hücre 2
+| satır 1, hücre 3
+|-
+| satır 2, hücre 1
+| satır 2, hücre 2
+| satır 2, hücre 3',
'edittoolbar-tool-table-example' => 'Satır $1, hücre $2',
'edittoolbar-tool-table-example-header' => 'Satır $1, hücre $2 (başlık)',
'edittoolbar-tool-table-title' => 'Tablo ekle',
@@ -8750,7 +10001,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Başlık satırını içer',
'edittoolbar-tool-table-insert' => 'Ekle',
'edittoolbar-tool-table-cancel' => 'Ä°ptal',
- 'edittoolbar-tool-replace' => 'DeÄŸiÅŸtir',
+ 'edittoolbar-tool-replace' => 'Ara ve deÄŸiÅŸtir',
'edittoolbar-tool-replace-title' => 'Ara ve deÄŸiÅŸtir',
'edittoolbar-tool-replace-search' => 'Şunun için ara:',
'edittoolbar-tool-replace-replace' => 'Åžununla deÄŸiÅŸtir:',
@@ -8758,8 +10009,9 @@
'edittoolbar-tool-replace-regex' => 'Arama dizesine bir düzenli ifade muamelesi yap',
'edittoolbar-tool-replace-all' => 'Tüm bulunanları değiştir',
'edittoolbar-tool-replace-button' => 'DeÄŸiÅŸtir',
- 'edittoolbar-tool-replace-close' => 'Kapat',
+ 'edittoolbar-tool-replace-close' => 'Ä°ptal',
'edittoolbar-tool-replace-nomatch' => 'Aramanız hiçbir şeyle uyuşmuyor.',
+ 'edittoolbar-tool-replace-success' => '$1 değiştirme yapıldı.',
'edittoolbar-section-characters' => 'Özel karakter',
'edittoolbar-characters-page-latin' => 'Latin',
'edittoolbar-characters-page-latinextended' => 'GeniÅŸletilmiÅŸ Latince',
@@ -8819,7 +10071,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Liste öğesi</li><li>Liste öğesi</li></ol>',
'edittoolbar-help-content-file-description' => 'Gömülü dosya',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Ornek.png|thumb|Resim yazısı]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Resim yazısı</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Resim yazısı</div></div>",
'edittoolbar-help-content-reference-description' => 'Kaynak',
'edittoolbar-help-content-reference-syntax' => 'Sayfa metni.<ref name="deneme">[http://www.ornek.org Bağlanı metni], ek metin.</ref>',
'edittoolbar-help-content-reference-result' => "Sayfa metni.<sup><a href='#'>[1]</a></sup>",
@@ -8848,6 +10100,10 @@
'edittoolbar-tool-bold-example' => 'Жирний текÑÑ‚',
'edittoolbar-tool-italic' => 'КурÑив',
'edittoolbar-tool-italic-example' => 'КурÑивний текÑÑ‚',
+ 'edittoolbar-tool-ilink' => 'Внутрішнє поÑиланнÑ',
+ 'edittoolbar-tool-ilink-example' => 'Заголовок поÑиланнÑ',
+ 'edittoolbar-tool-xlink' => "Зовнішнє поÑÐ¸Ð»Ð°Ð½Ð½Ñ (пам'Ñтайте про Ð¿Ñ€ÐµÑ„Ñ–ÐºÑ http://)",
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com заголовок поÑиланнÑ',
'edittoolbar-tool-file' => 'Вкладений файл',
'edittoolbar-tool-file-example' => 'Example.jpg',
'edittoolbar-tool-reference' => 'ВиноÑка',
@@ -8934,6 +10190,10 @@
'edittoolbar-tool-bold-example' => 'Testo in grasseto',
'edittoolbar-tool-italic' => 'Corsivo',
'edittoolbar-tool-italic-example' => 'Testo in corsivo',
+ 'edittoolbar-tool-ilink' => 'Colegamento interno',
+ 'edittoolbar-tool-ilink-example' => 'Titolo del colegamento',
+ 'edittoolbar-tool-xlink' => 'Colegamento esterno (ricòrdete el prefisso http:// )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.esenpio.com titolo del colegamento',
'edittoolbar-tool-link' => 'Colegamento',
'edittoolbar-tool-link-title' => 'Inserissi colegamento',
'edittoolbar-tool-link-int' => 'a na pagina wiki',
@@ -8949,6 +10209,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Titolo mia valido',
'edittoolbar-tool-link-int-target-status-loading' => "So' drio controlar se la pagina la esiste o no...",
'edittoolbar-tool-link-int-invalid' => "El titolo che te ghè indicà no'l xe mia valido.",
+ 'edittoolbar-tool-link-ext-invalid' => "L'indirisso indicà no'l xe mia và lido.",
'edittoolbar-tool-file' => 'File incorporado',
'edittoolbar-tool-file-example' => 'Esenpio.jpg',
'edittoolbar-tool-reference' => 'Nota',
@@ -8983,6 +10244,18 @@
{{ns:file}}:Esenpio.jpg|Didascalia2',
'edittoolbar-tool-newline' => 'Riga nova',
'edittoolbar-tool-table' => 'Tabèla',
+ 'edittoolbar-tool-table-example-old' => '-
+! intestassion 1
+! intestassion 2
+! intestassion 3
+|-
+| riga 1, casèla 1
+| riga 1, casèla 2
+| riga 1, casèla 3
+|-
+| riga 2, casèla 1
+| riga 2, casèla 2
+| riga 2, casèla 3',
'edittoolbar-tool-table-example' => 'Lìnia $1, colòna $2',
'edittoolbar-tool-table-example-header' => 'Lìnia $1, colòna $2 (intestassion)',
'edittoolbar-tool-table-title' => 'Inserissi na tabèla',
@@ -8992,7 +10265,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Includi la riga de intestassion',
'edittoolbar-tool-table-insert' => 'Inserissi',
'edittoolbar-tool-table-cancel' => 'Anùla',
- 'edittoolbar-tool-replace' => 'Sostituìssi',
+ 'edittoolbar-tool-replace' => 'Serca e sostituìssi',
'edittoolbar-tool-replace-title' => 'Serca e sostituìssi',
'edittoolbar-tool-replace-search' => 'Serca:',
'edittoolbar-tool-replace-replace' => 'Sostituìssi con:',
@@ -9000,8 +10273,9 @@
'edittoolbar-tool-replace-regex' => 'Testo de la riserca come espression regolare',
'edittoolbar-tool-replace-all' => 'Sostituìssi tute le olte che te lo cati',
'edittoolbar-tool-replace-button' => 'Sostituìssi',
- 'edittoolbar-tool-replace-close' => 'Sara',
+ 'edittoolbar-tool-replace-close' => 'Anùla',
'edittoolbar-tool-replace-nomatch' => 'No gavemo catà gnente che corisponde a quel che te serchi.',
+ 'edittoolbar-tool-replace-success' => '$1 sostitussion fate.',
'edittoolbar-section-characters' => 'Carà teri speciali',
'edittoolbar-characters-page-latin' => 'Latìn',
'edittoolbar-characters-page-latinextended' => 'Latìn esteso',
@@ -9061,7 +10335,7 @@
'edittoolbar-help-content-olist-result' => "<ol><li>Elemento de l'elenco</li><li>Elemento de l'elenco</li></ol>",
'edittoolbar-help-content-file-description' => 'File incorporado',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Esenpio.png|thumb|Testo de la didascalia]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Testo de la didascalia</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Caption text' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Enlarge' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Testo de la didascalia</div></div>",
'edittoolbar-help-content-reference-description' => 'Nota',
'edittoolbar-help-content-reference-syntax' => 'Testo de la pagina.<ref name="test">[http://www.esenpio.org Testo del colegamento], altro testo in più.</ref>',
'edittoolbar-help-content-reference-result' => "Testo de la pagina.<sup><a href='#'>[1]</a></sup>",
@@ -9078,6 +10352,64 @@
'edittoolbar-help-content-indent-result' => 'Testo normal<dl><dd>Testo rientrà <dl><dd>Testo rientrà </dd></dl></dd></dl>',
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'edittoolbar-tool-bold' => 'Lihavoitud',
+ 'edittoolbar-tool-bold-example' => 'Lihavoitud tekst',
+ 'edittoolbar-tool-link' => 'Kosketuz',
+ 'edittoolbar-tool-link-title' => 'Ližada kosketuz',
+ 'edittoolbar-tool-link-ext-target' => 'Kosketusen URL:',
+ 'edittoolbar-tool-link-ext-text' => 'Kosketusen tekst:',
+ 'edittoolbar-tool-link-cancel' => 'Heitta',
+ 'edittoolbar-tool-link-int-target-status-invalid' => 'Vär nimi',
+ 'edittoolbar-tool-file' => 'Mülütadud fail',
+ 'edittoolbar-group-list' => 'Nimikirjutez',
+ 'edittoolbar-tool-ulist-example' => 'Markiruidud nimikirjutez',
+ 'edittoolbar-tool-olist' => 'Nomeroitud nimikirjutez',
+ 'edittoolbar-group-size' => 'Suruz',
+ 'edittoolbar-tool-big' => "Sur'",
+ 'edittoolbar-tool-big-example' => 'Järed tekst',
+ 'edittoolbar-tool-small' => "Pen'",
+ 'edittoolbar-tool-small-example' => "Pen' tekst",
+ 'edittoolbar-group-insert' => 'Ližata',
+ 'edittoolbar-tool-gallery' => 'Kuviden gallerei',
+ 'edittoolbar-tool-newline' => "Uz' rivi",
+ 'edittoolbar-tool-table-title' => 'Ližada tablut',
+ 'edittoolbar-tool-table-dimensions' => 'Suruz',
+ 'edittoolbar-tool-table-dimensions-rows' => 'Rivid',
+ 'edittoolbar-tool-table-insert' => 'Ližata',
+ 'edittoolbar-tool-table-cancel' => 'Heitta',
+ 'edittoolbar-tool-replace-close' => 'Heitta',
+ 'edittoolbar-characters-page-latin' => 'Latinalaine',
+ 'edittoolbar-characters-page-latinextended' => 'Levitadud latinalaine',
+ 'edittoolbar-characters-page-ipa' => 'IPA',
+ 'edittoolbar-characters-page-symbols' => 'Simvolad',
+ 'edittoolbar-characters-page-greek' => 'Grekalaine',
+ 'edittoolbar-characters-page-cyrillic' => 'Kirilline',
+ 'edittoolbar-characters-page-arabic' => 'Arabine',
+ 'edittoolbar-characters-page-hebrew' => 'Evrejine',
+ 'edittoolbar-characters-page-telugu' => 'Telugu',
+ 'edittoolbar-section-help' => 'Abu',
+ 'edittoolbar-help-page-link' => 'Kosketused',
+ 'edittoolbar-help-page-list' => 'Nimikirjutesed',
+ 'edittoolbar-help-page-file' => 'Failad',
+ 'edittoolbar-help-content-bold-description' => 'Lihavoitud',
+ 'edittoolbar-help-content-bold-syntax' => "'''Lihavoitud tekst'''",
+ 'edittoolbar-help-content-ilink-description' => 'Südäikosketuz',
+ 'edittoolbar-help-content-xlink-description' => 'Irdkosketuz',
+ 'edittoolbar-help-content-heading1-syntax' => '= Pälkirjutesen tekst =',
+ 'edittoolbar-help-content-heading2-syntax' => '== Pälkirjutesen tekst ==',
+ 'edittoolbar-help-content-heading3-syntax' => '=== Pälkirjutesen tekst ===',
+ 'edittoolbar-help-content-heading4-syntax' => '==== Pälkirjutesen tekst ====',
+ 'edittoolbar-help-content-heading5-syntax' => '===== Pälkirjutesen tekst =====',
+ 'edittoolbar-help-content-ulist-description' => 'Markiruidud nimikirjutez',
+ 'edittoolbar-help-content-olist-description' => 'Nomeroitud nimikirjutez',
+ 'edittoolbar-help-content-file-description' => 'Mülütadud fail',
+ 'edittoolbar-help-content-signature-description' => 'Allekirjutez',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Minh Nguyen
* @author Vinhtantran
@@ -9086,11 +10418,16 @@
'edittoolbar' => 'Thanh công cụ sá»a đổi',
'edittoolbar-desc' => 'Thanh công cụ ở trang sá»a đổi được cải tiến để dá»… sá» dụng hÆ¡n',
'edittoolbar-preference' => 'Sá» dụng thanh công cụ sá»a đổi nâng cao',
+ 'edittoolbar-cgd-preference' => 'Mở trợ giúp vỠcách thêm mã wiki nâng cao',
'edittoolbar-loading' => 'Äang tải…',
'edittoolbar-tool-bold' => 'Äáºm',
'edittoolbar-tool-bold-example' => 'Chữ Ä‘áºm',
'edittoolbar-tool-italic' => 'Xiên',
'edittoolbar-tool-italic-example' => 'Chữ xiên',
+ 'edittoolbar-tool-ilink' => 'Liên kết trong',
+ 'edittoolbar-tool-ilink-example' => 'Tựa đỠliên kết',
+ 'edittoolbar-tool-xlink' => 'Liên kết ngoà i (nhớ ghi http://)',
+ 'edittoolbar-tool-xlink-example' => 'http://www.vidu.com tựa đỠliên kết',
'edittoolbar-tool-link' => 'Liên kết',
'edittoolbar-tool-link-title' => 'Chèn liên kết',
'edittoolbar-tool-link-int' => 'Äến má»™t trang wiki',
@@ -9106,6 +10443,7 @@
'edittoolbar-tool-link-int-target-status-invalid' => 'Tá»±a sai',
'edittoolbar-tool-link-int-target-status-loading' => 'Kiểm tra trang đã tồn tại chưa...',
'edittoolbar-tool-link-int-invalid' => 'Tựa trang chỉ định không hợp lệ.',
+ 'edittoolbar-tool-link-ext-invalid' => 'URL không đúng.',
'edittoolbar-tool-file' => 'Chèn táºp tin',
'edittoolbar-tool-file-example' => 'Và dụ.jpg',
'edittoolbar-tool-reference' => 'Chú thÃch tham khảo',
@@ -9140,6 +10478,18 @@
{{ns:file}}:Và dụ.jpg|Chú thÃch 2',
'edittoolbar-tool-newline' => 'Dòng mới',
'edittoolbar-tool-table' => 'Bảng',
+ 'edittoolbar-tool-table-example-old' => '-
+! tiêu đỠ1
+! tiêu đỠ2
+! tiêu đỠ3
+|-
+| hà ng 1, cột 1
+| hà ng 1, cột 2
+| hà ng 1, cột 3
+|-
+| hà ng 2, cột 1
+| hà ng 2, cột 2
+| hà ng 2, cột 3',
'edittoolbar-tool-table-example' => 'Hà ng $1, ô $2',
'edittoolbar-tool-table-example-header' => 'Hà ng $1, cá»™t $2 (tiêu Ä‘á»)',
'edittoolbar-tool-table-title' => 'Chèn bảng',
@@ -9149,7 +10499,7 @@
'edittoolbar-tool-table-dimensions-header' => 'Có hà ng tiêu Ä‘á»',
'edittoolbar-tool-table-insert' => 'Chèn',
'edittoolbar-tool-table-cancel' => 'Hủy bá»',
- 'edittoolbar-tool-replace' => 'Thay thế',
+ 'edittoolbar-tool-replace' => 'Tìm và thay thế',
'edittoolbar-tool-replace-title' => 'Tìm và thay thế',
'edittoolbar-tool-replace-search' => 'Tìm kiếm:',
'edittoolbar-tool-replace-replace' => 'Thay thế bằng:',
@@ -9157,8 +10507,9 @@
'edittoolbar-tool-replace-regex' => 'Xem chuá»—i tìm kiếm là biểu thức chÃnh quy',
'edittoolbar-tool-replace-all' => 'Thay thế má»i từ tìm thấy',
'edittoolbar-tool-replace-button' => 'Thay thế',
- 'edittoolbar-tool-replace-close' => 'Äóng',
+ 'edittoolbar-tool-replace-close' => 'Hủy bá»',
'edittoolbar-tool-replace-nomatch' => 'Không tìm thấy',
+ 'edittoolbar-tool-replace-success' => 'Äã thá»±c hiện $1 thay thế.',
'edittoolbar-section-characters' => 'Ký tự đặc biệt',
'edittoolbar-characters-page-latin' => 'La tinh',
'edittoolbar-characters-page-latinextended' => 'La tinh mở rộng',
@@ -9218,7 +10569,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>Mục danh sách</li><li>Mục danh sách</li></ol>',
'edittoolbar-help-content-file-description' => 'Chèn táºp tin',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Và dụ.png|nhá»|Văn bản chú thÃch]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Văn bản chú thÃch' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Phóng lá»›n' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>Văn bản chú thÃch</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='Văn bản chú thÃch' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='Phóng lá»›n' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>Văn bản chú thÃch</div></div>",
'edittoolbar-help-content-reference-description' => 'Tham khảo',
'edittoolbar-help-content-reference-syntax' => 'Ná»™i dung trang<ref name="thá»">[http://www.vidu.org Văn bản liên kết], văn bản bổ sung.</ref>.',
'edittoolbar-help-content-reference-result' => "Ná»™i dung trang<sup><a href='#'>[1]</a></sup>.",
@@ -9235,6 +10586,14 @@
'edittoolbar-help-content-indent-result' => 'Văn bản thÆ°á»ng<dl><dd>Văn bản được tăng lá»<dl><dd>Văn bản được tăng lá»</dd></dl></dd></dl>',
);
+/** Yiddish (ייִדיש)
+ * @author פוילישער
+ */
+$messages['yi'] = array(
+ 'edittoolbar-tool-replace-search' => 'זוכן פֿ×ַר:',
+ 'edittoolbar-section-help' => 'הילף',
+);
+
/** Yue (粵語)
* @author Shinjiman
*/
@@ -9247,6 +10606,10 @@
'edittoolbar-tool-bold-example' => 'ç²—é«”å—',
'edittoolbar-tool-italic' => '斜體',
'edittoolbar-tool-italic-example' => '斜體å—',
+ 'edittoolbar-tool-ilink' => '內連',
+ 'edittoolbar-tool-ilink-example' => '拎題',
+ 'edittoolbar-tool-xlink' => 'å¤–é€£ï¼ˆè¨˜ä½ http:// å—é )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com 連çµæ¨™é¡Œ',
'edittoolbar-tool-file' => 'çµåˆæ¨™é¡Œ',
'edittoolbar-tool-reference' => 'åƒè€ƒ',
'edittoolbar-tool-reference-example' => '響呢度æ’入底文å—',
@@ -9280,6 +10643,18 @@
{{ns:file}}:Example.jpg|標題2',
'edittoolbar-tool-newline' => '新行',
'edittoolbar-tool-table' => '表',
+ 'edittoolbar-tool-table-example-old' => '-
+! 表é 1
+! 表é 2
+! 表é 3
+|-
+| è¡Œ 1, æ ¼ 1
+| è¡Œ 1, æ ¼ 2
+| è¡Œ 1, æ ¼ 3
+|-
+| è¡Œ 2, æ ¼ 1
+| è¡Œ 2, æ ¼ 2
+| è¡Œ 2, æ ¼ 3',
'edittoolbar-tool-table-example' => '-
! 表é 1
! 表é 2
@@ -9348,7 +10723,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>ä¸€è¦½é …ç›®</li><li>ä¸€è¦½é …ç›®</li></ol>',
'edittoolbar-help-content-file-description' => 'çµåˆæª”',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|標題å—]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='標題å—' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='放大' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>標題å—</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='標題å—' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='放大' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>標題å—</div></div>",
'edittoolbar-help-content-reference-description' => 'åƒè€ƒ',
'edittoolbar-help-content-reference-syntax' => 'é å—。<ref name="test">[http://www.example.org 連å—]ï¼Œé™„åŠ å—。</ref>',
'edittoolbar-help-content-reference-result' => "é å—。<sup><a href='#'>[1]</a></sup>",
@@ -9380,6 +10755,10 @@
'edittoolbar-tool-bold-example' => '粗体文本',
'edittoolbar-tool-italic' => '斜体',
'edittoolbar-tool-italic-example' => '斜体文本',
+ 'edittoolbar-tool-ilink' => '内部链接',
+ 'edittoolbar-tool-ilink-example' => 'é“¾æŽ¥æ ‡é¢˜',
+ 'edittoolbar-tool-xlink' => '外部链接(需以“http://â€å‰ç¼€ï¼‰',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com é“¾æŽ¥æ ‡é¢˜',
'edittoolbar-tool-link' => '链接',
'edittoolbar-tool-link-title' => 'æ’入链接',
'edittoolbar-tool-link-int' => '链往wiki页é¢',
@@ -9435,8 +10814,6 @@
'edittoolbar-tool-table-dimensions' => '大å°',
'edittoolbar-tool-table-dimensions-rows' => '行',
'edittoolbar-tool-table-dimensions-columns' => '列',
- 'edittoolbar-tool-table-dimensions-headerrows' => 'æ ‡é¢˜è¡Œ',
- 'edittoolbar-tool-table-dimensions-headercolumns' => 'æ ‡é¢˜åˆ—',
'edittoolbar-tool-table-insert' => 'æ’å…¥',
'edittoolbar-tool-table-cancel' => 'å–消',
'edittoolbar-tool-replace' => '替æ¢',
@@ -9508,7 +10885,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>列表项</li><li>列表项</li></ol>',
'edittoolbar-help-content-file-description' => '嵌入文件',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|æ ‡é¢˜æ–‡æœ¬]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='æ ‡é¢˜æ–‡æœ¬' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='放大' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>æ ‡é¢˜æ–‡æœ¬</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='æ ‡é¢˜æ–‡æœ¬' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='放大' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>æ ‡é¢˜æ–‡æœ¬</div></div>",
'edittoolbar-help-content-reference-description' => 'å‚考',
'edittoolbar-help-content-reference-syntax' => '页é¢æ–‡æœ¬ã€‚<ref name="test">[http://www.example.org 链接文本]ï¼Œé™„åŠ æ–‡æœ¬ã€‚</ref>',
'edittoolbar-help-content-reference-result' => "页é¢æ–‡æœ¬ã€‚<sup><a href='#'>[1]</a></sup>",
@@ -9538,6 +10915,10 @@
'edittoolbar-tool-bold-example' => '粗體文å—',
'edittoolbar-tool-italic' => '斜體',
'edittoolbar-tool-italic-example' => '斜體文å—',
+ 'edittoolbar-tool-ilink' => '內部連çµ',
+ 'edittoolbar-tool-ilink-example' => '連çµæ¨™é¡Œ',
+ 'edittoolbar-tool-xlink' => '外部連çµï¼ˆè¨˜ä½ http:// æ–‡å—é–‹é )',
+ 'edittoolbar-tool-xlink-example' => 'http://www.example.com 連çµæ¨™é¡Œ',
'edittoolbar-tool-file' => 'çµåˆæ¨™é¡Œ',
'edittoolbar-tool-reference' => 'åƒè€ƒ',
'edittoolbar-tool-reference-example' => '在這è£æ’å…¥é 底文å—',
@@ -9571,6 +10952,18 @@
{{ns:file}}:Example.jpg|標題2',
'edittoolbar-tool-newline' => 'æ›è¡Œ',
'edittoolbar-tool-table' => 'è¡¨æ ¼',
+ 'edittoolbar-tool-table-example-old' => '-
+! 表é 1
+! 表é 2
+! 表é 3
+|-
+| è¡Œ 1, æ ¼ 1
+| è¡Œ 1, æ ¼ 2
+| è¡Œ 1, æ ¼ 3
+|-
+| è¡Œ 2, æ ¼ 1
+| è¡Œ 2, æ ¼ 2
+| è¡Œ 2, æ ¼ 3',
'edittoolbar-tool-table-example' => '-
! 表é 1
! 表é 2
@@ -9640,7 +11033,7 @@
'edittoolbar-help-content-olist-result' => '<ol><li>åˆ—è¡¨é …ç›®</li><li>åˆ—è¡¨é …ç›®</li></ol>',
'edittoolbar-help-content-file-description' => 'çµåˆæª”',
'edittoolbar-help-content-file-syntax' => '[[{{ns:file}}:Example.png|thumb|標題文å—]]',
- 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='標題文å—' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='放大' class='internal' href='#'><img height='11' width='15' alt='' src='skins/common/images/magnify-clip.png'/></a></div>標題文å—</div></div>",
+ 'edittoolbar-help-content-file-result' => "<div style='width:104px;' class='thumbinner'><a title='標題文å—' class='image' href='#'><img height='50' width='100' border='0' class='thumbimage' src='extensions/UsabilityInitiative/images/wikiEditor/toolbar/example-image.png' alt=''/></a><div class='thumbcaption'><div class='magnify'><a title='放大' class='internal' href='#'><img height='11' width='15' alt='' src='{{STYLEPATH}}/common/images/magnify-clip.png'/></a></div>標題文å—</div></div>",
'edittoolbar-help-content-reference-description' => 'åƒè€ƒ',
'edittoolbar-help-content-reference-syntax' => 'é é¢æ–‡å—。<ref name="test">[http://www.example.org 連çµæ–‡å—]ï¼Œé™„åŠ æ–‡å—。</ref>',
'edittoolbar-help-content-reference-result' => "é é¢æ–‡å—。<sup><a href='#'>[1]</a></sup>",
Index: EditToolbar/EditToolbar.php
===================================================================
--- EditToolbar/EditToolbar.php (revision 56989)
+++ EditToolbar/EditToolbar.php (working copy)
@@ -19,7 +19,7 @@
/* Configuration */
// Bump the version number every time you change any of the .css/.js files
-$wgEditToolbarStyleVersion = 34;
+$wgEditToolbarStyleVersion = 38;
// Set this to true to simply override the stock toolbar for everyone
$wgEditToolbarGlobalEnable = false;
Index: ClickTracking/SpecialClickTracking.php
===================================================================
--- ClickTracking/SpecialClickTracking.php (revision 56989)
+++ ClickTracking/SpecialClickTracking.php (working copy)
@@ -7,18 +7,345 @@
*/
class SpecialClickTracking extends SpecialPage {
+
+ //set to zero for 'all'
+ private $top_results = 10;
+ private $normalize_top_results = false;
+ private $normalize_results = false;
+ private $use_timeframes = false;
+ private $begin_timeframe = '20090815'; //YYYYMMDD (+1 for today)
+ private $end_timeframe = '20090902';
+
+
+ //array of event_id => event_name
+ public static $join_conds = " LEFT JOIN click_tracking_events ON event_id=click_tracking_events.id";
+ public static $expert_user_conds = "user_total_contribs > 10 ";
+ public static $intermediate_user_conds = "user_total_contribs < 10 AND user_total_contribs > 1 ";
+ public static $basic_user_conds = "user_total_contribs <= 1";
+
+ /*
+ * " DISTINCT session_id "
+ *
+ * " select count(*), event_id from click_tracking group by event_id order by count(*) desc limit 10;"
+ *
+ */
+
+ private $event_id_to_name = array();
+ private $name_to_event_id = array();
+ private $time_constraint_sql = "";
+
+
+
function __construct() {
parent::__construct( 'ClickTracking' );
wfLoadExtensionMessages( 'ClickTracking' );
+ UsabilityInitiativeHooks::initialize();
+ UsabilityInitiativeHooks::addStyle( 'ClickTracking/SpecialClickTracking.css' );
+ UsabilityInitiativeHooks::addScript( 'ClickTracking/SpecialClickTracking.js' );
}
-
+
+
+
+
+
function execute( $par ) {
- global $wgOut;
+ global $wgOut, $wgUser;
+
+ // Check permissions
+ if ( !$this->userCanExecute( $wgUser ) ) {
+ $this->displayRestrictionError();
+ return;
+ }
+
$this->setHeaders();
$wgOut->setPageTitle( wfMsg( 'clicktracking-title' ) );
+ $outputTable ="";
+
+
+ //grab top N
+ $events = $this->getTopEvents();
+
+ //open table
+ $outputTable .= Xml::openElement( "table", array( "class" =>"sortable click-data", "id" => "clicktrack_data_table" ) );
+
+ //create a row for every event
+ $i = 0;
+ $db_result;
+
+ //build row headers
+ $header_row = array();
+
+ $header_row["event_header"] = wfMsg( 'event-name' );
+ $header_row["expert_header"] = wfMsg( 'expert-header' );
+ $header_row["intermediate_header"] = wfMsg( 'intermediate-header' );
+ $header_row["beginner_header"] = wfMsg( 'beginner-header' );
+ $header_row["total_header"] = wfMsg( 'total-header' );
+ $outputTable .= Xml::buildTableRow( array( "class"=>"table_headers" ), $header_row );
+
+ //foreach event, build a row
+ while(($db_result = $events->fetchRow()) != null){
+ ++$i;
+ $outputTable .= $this->buildRow( $db_result, $i );
+ }
+
+
+ //close table
+ $outputTable .= Xml::closeElement("table");
+
+ $wgOut->addHTML( $outputTable );
+
+
+ //build chart
+ $wgOut->addHTML($this->buildChart("advanced.hide",10, "20090815", "20090902", 1));
+
+ $wgOut->addHTML($this->buildControlBox());
+
}
+
+ /**
+ * Gets the data to build a chart for PHP or JS purposes
+ * @param $event_id event id this chart is for
+ * @param $minTime minimum day
+ * @param $maxTime maximum day
+ * @param $increment number of day(s) to increment in units
+ * @return array with chart info
+ */
+ static function getChartData($event_id, $minTime, $maxTime, $increment){
+ //get data
+ date_default_timezone_set('UTC');
+
+ //FIXME: On PHP 5.3+, this will be MUCH cleaner
+ $currBeginDate = new DateTime( $minTime );
+ $currEndDate = new DateTime( $minTime );
+ $endDate = new DateTime( $maxTime );
+
+ $basicUserData = array();
+ $intermediateUserData = array();
+ $expertUserData = array();
+
+ // PHP 5.3...hurry!
+ $plural = ( $increment == 1 ? "" : "s" );
+
+ while( $currEndDate->format( "U" ) < $endDate->format( "U" ) ){
+ $currEndDate->modify( "+$increment day$plural" );
+ $time_constraints_statement = self::getTimeConstraintsStatement( $currBeginDate->format("Ymd"), $currEndDate->format("Ymd") );
+ $basicUserData[] = self::getTableValue( $event_id, self::$basic_user_conds, $time_constraints_statement );
+ $intermediateUserData[] = self::getTableValue( $event_id, self::$intermediate_user_conds, $time_constraints_statement );
+ $expertUserData[] = self::getTableValue( $event_id, self::$expert_user_conds, $time_constraints_statement );
+ $currBeginDate->modify( "+$increment day$plural" );
+ }
+ return array("expert" => $expertUserData, "basic" => $basicUserData, "intermediate" => $intermediateUserData);
+ }
+
+ function buildChart($event_name, $event_id, $minTime, $maxTime, $increment){
+ $chartData = self::getChartData($event_id, $minTime, $maxTime, $increment);
+ $chartSrc = $this->getGoogleChartParams( $event_id, $event_name, $minTime, $maxTime, $chartData["basic"], $chartData["intermediate"], $chartData["expert"]);
+ return Xml::element( 'img', array( 'src' => $chartSrc , 'id' => 'chart_img' ) );
+ }
+
+ function getGoogleChartParams( $event_id, $event_name, $minDate, $maxDate, $basicUserData, $intermediateUserData, $expertUserData ) {
+ $max = max( max($basicUserData), max($intermediateUserData), max($expertUserData));
+ return "http://chart.apis.google.com/chart?" . wfArrayToCGI(
+ array(
+ 'chs' => '400x400',
+ 'cht' => 'lc',
+ 'chco' => 'FF0000,0000FF,00FF00',
+ 'chtt' => "$event_name from $minDate to $maxDate",
+ 'chdl' => 'Expert|Intermediate|Beginner',
+ 'chxt' => 'x,y',
+ 'chd' => 't:' . implode( "," , $expertUserData ) . "|" .
+ implode( "," , $intermediateUserData ) . "|" . implode( "," , $basicUserData ),
+ 'chds' => "0,$max,0,$max,0,$max"
+ ));
+ }
+
+
+ function buildControlBox(){
+
+ $control = Xml::openElement("form", array("id" => "control_box_form"));
+ $control .= Xml::openElement("table", array("id" => "control_box_table"));
+ $control .= Xml::openElement("tbody", array("id" => "control_box_tbody"));
+
+
+ $control .= Xml::openElement("tr", array("id" => "start_date_row"));
+
+ $control .= Xml::openElement("td", array("id" => "start_date_label", "class" => "control_box_label"));
+ $control .= wfMsg( "start-date" );
+ $control .= Xml::closeElement("td");
+
+ $control .= Xml::openElement("td", array("id" => "start_date_textarea"));
+ $control .= Xml::openElement("input", array("type" => "text", "id" => "start_date", "class" => "control_box_input"));
+ $control .= Xml::closeElement("input");
+ $control .= Xml::closeElement("td");
+
+ $control .= Xml::closeElement("tr");
+
+
+ $control .= Xml::openElement("tr", array("id" => "end_date_row"));
+
+ $control .= Xml::openElement("td", array("id" => "end_date_label", "class" => "control_box_label"));
+ $control .= wfMsg( "end-date" );
+ $control .= Xml::closeElement("td");
+
+ $control .= Xml::openElement("td", array("id" => "end_date_textarea"));
+ $control .= Xml::openElement("input", array("type" => "text", "id" => "end_date", "class" => "control_box_input"));
+ $control .= Xml::closeElement("input");
+ $control .= Xml::closeElement("td");
+
+ $control .= Xml::closeElement("tr");
+
+
+
+ $control .= Xml::openElement("tr", array("id" => "increment_date_row"));
+
+ $control .= Xml::openElement("td", array("id" => "increment_date_label", "class" => "control_box_label"));
+ $control .= wfMsg( "increment-by" );
+ $control .= Xml::closeElement("td");
+
+ $control .= Xml::openElement("td", array("id" => "increment_date_textarea"));
+ $control .= Xml::openElement("input", array("type" => "text", "id" => "increment_date", "class" => "control_box_input"));
+ $control .= Xml::closeElement("input");
+ $control .= Xml::closeElement("td");
+
+ $control .= Xml::closeElement("tr");
+
+
+
+ $control .= Xml::openElement("tr", array("id" => "change_graph_row"));
+ $control .= Xml::openElement("td", array("id" => "change_graph_cell", "colspan" => 2));
+
+ $control .= Xml::openElement("input", array("type" => "button", "id" => "change_graph", "value" => wfMsg( "change-graph" ) ) );
+ $control .= Xml::closeElement("input");
+ $control .= Xml::closeElement("td");
+
+ $control .= Xml::closeElement("tr");
+
+ $control .= Xml::closeElement("tbody");
+ $control .= Xml::closeElement("table");
+ $control .= Xml::closeElement("form");
+
+ return $control;
+ }
+
+
+ function buildRow($data_result, $row_count){
+
+ $outputRow = Xml::openElement("tr", array("class" => "table_data_row"));
+
+ //event name
+ $outputRow .=Xml::openElement("td",
+ array("class" => "event_name", "id" => "event_name_$row_count", "value" =>$data_result['event_id']));
+ $outputRow .= $data_result['event_name'];
+ $outputRow .=Xml::closeElement("td");
+
+ //advanced users
+ $cellValue = self::getTableValue($data_result['event_id'], self::$expert_user_conds);
+ $outputRow .=Xml::openElement("td",
+ array("class" => "event_data expert_data", "id" => "event_expert_$row_count",
+ "value" => $cellValue));
+ $outputRow .= $cellValue;
+ $outputRow .=Xml::closeElement("td");
+
+ //intermediate users
+ $cellValue = self::getTableValue($data_result['event_id'], self::$intermediate_user_conds);
+ $outputRow .=Xml::openElement("td",
+ array("class" => "event_data intermediate_data", "id" => "event_intermediate_$row_count",
+ "value" => $cellValue));
+ $outputRow .= $cellValue;
+ $outputRow .=Xml::closeElement("td");
+
+ //basic users
+ $cellValue = self::getTableValue($data_result['event_id'], self::$basic_user_conds);
+ $outputRow .=Xml::openElement("td",
+ array("class" => "event_data basic_data", "id" => "event_basic_$row_count",
+ "value" => $cellValue));
+ $outputRow .= $cellValue;
+ $outputRow .=Xml::closeElement("td");
+
+ //totals
+ $cellValue = $data_result["count(event_id)"];
+ $outputRow .=Xml::openElement("td",
+ array("class" => "event_data total_data", "id" => "total_$row_count",
+ "value" => $cellValue));
+ $outputRow .= $cellValue;
+ $outputRow .=Xml::closeElement("td");
+
+
+ $outputRow .= Xml::closeElement("tr");
+
+ return $outputRow;
+
+ }
+
+ /*
+ * get time constraints
+ * @param minTime minimum day (YYYYMMDD)
+ * @param maxTime max day (YYYYMMDD)
+ * NOTE: once some of the constraints have been finalized, this will use more of the Database functions and not raw SQL
+ */
+ static function getTimeConstraintsStatement( $minTime, $maxTime ){
+ if($minTime == 0 || $maxTime == 0){
+ return '';
+ }
+ else {
+ return "WHERE action_time >= $minTime AND action_time <= $maxTime";
+ }
+
+ }
+
+
+ /**
+ * Gets the top N events as set in the page pref
+ * @param $time_constraint_statement
+ * @return unknown_type
+ * NOTE: once some of the constraints have been finalized, this will use more of the Database functions and not raw SQL
+ */
+ function getTopEvents($time_constraint_statement=''){
+ $normalize = "click_tracking";
+ $time_constraint = $time_constraint_statement;
+ if($this->normalize_top_results){
+ $normalize = "(select distinct session_id, event_id from click_tracking $time_constraint_statement) as t1";
+ $time_constraint = "";
+ }
+ $limit = $this->top_results;
+ $join = self::$join_conds;
+ $sql = "select count(event_id), event_id,event_name from $normalize $join $time_constraint group by event_id order by count(event_id) desc limit $limit";
+
+ //returns count(event_id),event_id, event_name, top one first
+ $dbr = wfGetDB( DB_SLAVE );
+ $dbresult = $dbr->query($sql);
+
+ return $dbresult;
+ }
+
+ /**
+ * Gets a table value for a given User ID
+ * NOTE: once some of the constraints have been finalized, this will use more of the Database functions and not raw SQL
+ */
+ static function getTableValue($event_id, $user_conditions, $time_constraint_statement = '', $normalize_results=false){
+
+ $normalize = "click_tracking";
+ $time_constraint = $time_constraint_statement;
+ if($normalize_results){
+ $normalize = "(select distinct session_id, event_id, user_total_contribs, user_contribs_span1, user_contribs_span2, user_contribs_span3, is_logged_in from click_tracking $time_constraint_statement) as t1";
+ $time_constraint = "";
+ }
+
+
+ $where = ($time_constraint == "" ? "where" : "");
+
+ $and = ($time_constraint == "" ? "": "and");
+
+ $sql ="select count(*) from $normalize $where $time_constraint $and $user_conditions and event_id=$event_id";
+
+ $dbr = wfGetDB( DB_SLAVE );
+ $result = $dbr->query($sql);
+ $resRow = $result->fetchRow();
+ return $resRow["count(*)"];
+ }
+
}
\ No newline at end of file
Index: ClickTracking/ClickTracking.hooks.php
===================================================================
--- ClickTracking/ClickTracking.hooks.php (revision 56989)
+++ ClickTracking/ClickTracking.hooks.php (working copy)
@@ -23,11 +23,6 @@
);
$wgExtNewTables[] = array(
- 'user_daily_contribs',
- dirname( __FILE__ ) . '/UserDailyContribs.sql'
- );
-
- $wgExtNewTables[] = array(
'click_tracking_events',
dirname( __FILE__ ) . '/ClickTrackingEvents.sql'
);
@@ -112,20 +107,6 @@
return $edits;
}
- /**
- * Stores a new contribution
- * @return true
- */
- public static function storeNewContrib(){
- global $wgUser;
- $today = gmdate( 'Ymd', time() );
- $dbw = wfGetDB( DB_MASTER );
- $sql =
- "INSERT INTO user_daily_contribs (user_id,day,contribs) VALUES ({$wgUser->getId()},$today,1) ON DUPLICATE KEY UPDATE contribs=contribs+1;";
- $dbw->query($sql, __METHOD__);
-
- return true;
- }
/**
* Get event ID from name
Index: ClickTracking/UserDailyContribs.sql
===================================================================
--- ClickTracking/UserDailyContribs.sql (revision 56989)
+++ ClickTracking/UserDailyContribs.sql (working copy)
@@ -1,19 +0,0 @@
---
--- Schema for UserDailyContribs
---
--- Used in clicktracking to determine how active the user is
---
-
-CREATE TABLE IF NOT EXISTS /*_*/user_daily_contribs (
- -- user id
- user_id integer NOT NULL default 0,
-
- -- day
- day DATE NOT NULL,
-
- -- contributions on that day by that user
- contribs integer NOT NULL default 0,
-
- -- a unique entry for a given user_id and day
- PRIMARY KEY(user_id, day)
-) /*$wgDBTableOptions*/;
\ No newline at end of file
Index: ClickTracking/ClickTracking.i18n.php
===================================================================
--- ClickTracking/ClickTracking.i18n.php (revision 56989)
+++ ClickTracking/ClickTracking.i18n.php (working copy)
@@ -13,8 +13,20 @@
*/
$messages['en'] = array(
'clicktracking' => 'Usability Initiative click tracking',
- 'clicktracking-desc' => 'Click tracking, intended for tracking events that do not cause a page refresh',
- 'clicktracking-title' => 'Aggregated user clicks'
+ 'clicktracking-desc' => 'Click tracking for tracking events that do not cause a page refresh',
+ 'clicktracking-title' => 'Aggregated user clicks',
+ 'event-name' => 'Event name',
+ 'expert-header' => '"Expert" clicks',
+ 'intermediate-header' => '"Intermediate" clicks',
+ 'beginner-header' => '"Beginner" clicks',
+ 'total-header' => 'Total clicks',
+ 'start-date' => 'Start Date (YYYYMMDD)',
+ 'end-date' => 'End Date (YYYYMMDD)',
+ 'increment-by' =>'Number of days each data point represents',
+ 'change-graph' =>'Change graph',
+ 'beginner' => 'Beginner',
+ 'intermediate' => 'Intermediate',
+ 'expert' => 'Expert',
);
/** Message documentation (Message documentation)
@@ -22,16 +34,60 @@
*/
$messages['qqq'] = array(
'clicktracking-desc' => '{{desc}}',
+ 'expert-header' => '"Expert" is a user-definable category, these will show the number of clicks that fall into that category',
+ 'intermediate-header' => '"Intermediate" is a user-definable category, these will show the number of clicks that fall into that category',
+ 'beginner-header' => '"Beginner" is a user-definable category, these will show the number of clicks that fall into that category',
+ 'total-header' => 'total',
+ 'start-date' => 'YYYYMMDD refers to the date format (4-digit year, 2-digit month, 2-digit day)
+
+{{Identical|Start date}}',
+ 'end-date' => 'YYYYMMDD refers to the date format (4-digit year, 2-digit month, 2-digit day)
+
+{{Identical|End date}}',
+ 'beginner' => 'label for a user at beginner skill level',
+ 'intermediate' => 'label for a user at intermediate skill level',
+ 'expert' => 'label for a user at expert skill level',
);
+/** Afrikaans (Afrikaans)
+ * @author Naudefj
+ */
+$messages['af'] = array(
+ 'start-date' => 'Begindatum (JJJJMMDD)',
+ 'end-date' => 'Einddatum (JJJJMMDD)',
+);
+
+/** Arabic (العربية)
+ * @author Meno25
+ */
+$messages['ar'] = array(
+ 'event-name' => 'اسم الØدث',
+ 'beginner' => 'مبتدئ',
+ 'intermediate' => 'متوسط',
+ 'expert' => 'خبير',
+);
+
/** Belarusian (TaraÅ¡kievica orthography) (БеларуÑÐºÐ°Ñ (тарашкевіца))
* @author EugeneZelenko
+ * @author Jim-by
* @author Red Winged Duck
*/
$messages['be-tarask'] = array(
'clicktracking' => 'СачÑньне за націÑкамі кампутарнай мышшу Ñž межах ініцыÑтывы па палÑпшÑньні зручнаÑьці Ñ– праÑтаты выкарыÑтаньнÑ',
'clicktracking-desc' => 'СачÑньне за націÑкамі кампутарнай мышшу, прызначанае Ð´Ð»Ñ ÑачÑÐ½ÑŒÐ½Ñ Ð·Ð° здарÑньнÑмі, ÑÐºÑ–Ñ Ð½Ðµ вÑдуць да Ð°Ð±Ð½Ð°ÑžÐ»ÐµÐ½ÑŒÐ½Ñ Ñтаронкі',
'clicktracking-title' => 'Ð“Ñ€ÑƒÐ¿Ð°Ð²Ð°Ð½Ñ‹Ñ Ð½Ð°Ñ†Ñ–Ñкі кнопак мышы ўдзельнікам',
+ 'event-name' => 'Ðазва падзеі',
+ 'expert-header' => 'ÐаціÑкі мышшу Ð´Ð»Ñ Â«ÐкÑпÑрта»',
+ 'intermediate-header' => 'ÐаціÑкі мышшу Ð´Ð»Ñ Â«Ð¡ÑÑ€ÑднÑга»',
+ 'beginner-header' => 'ÐаціÑкі мышшу Ð´Ð»Ñ Â«ÐŸÐ°Ñ‡Ñ‹Ð½Ð°ÑŽÑ‡Ð°Ð³Ð°Â»',
+ 'total-header' => 'УÑÑго націÑкаў мышшу',
+ 'start-date' => 'Дата пачатку (ГГГГММДзДз)',
+ 'end-date' => 'Дата ÑканчÑÐ½ÑŒÐ½Ñ (ГГГГММДзДз)',
+ 'increment-by' => 'КолькаÑьць дзён, ÑÐºÑ–Ñ Ð°Ð´Ð»ÑŽÑтроўваюцца Ñž кожным пункце зьвеÑтак',
+ 'change-graph' => 'ЗьмÑніць графік',
+ 'beginner' => 'Пачынаючы',
+ 'intermediate' => 'СÑÑ€Ñдні',
+ 'expert' => 'ÐкÑпÑрт',
);
/** Breton (Brezhoneg)
@@ -50,6 +106,18 @@
'clicktracking' => 'Praćenje klikova u Inicijativi upotrebljivosti',
'clicktracking-desc' => 'Praćenje klikova, napravljeno za praćenje događaja koji ne proizvode osvježavanje stanice',
'clicktracking-title' => 'Sveukupni klikovi korisnika',
+ 'event-name' => 'Naziv događaja',
+ 'expert-header' => "''StruÄnjaÄki'' klikovi",
+ 'intermediate-header' => "''Napredni'' klikovi",
+ 'beginner-header' => "''PoÄetniÄki'' klikovi",
+ 'total-header' => 'Ukupno klikova',
+ 'start-date' => 'PoÄetni datum (YYYYMMDD)',
+ 'end-date' => 'Završni datum (YYYYMMDD)',
+ 'increment-by' => 'Broj dana koje svaka taÄka podataka predstavlja',
+ 'change-graph' => 'Promijeni grafikon',
+ 'beginner' => 'PoÄetnik',
+ 'intermediate' => 'Napredni',
+ 'expert' => 'StruÄnjak',
);
/** Czech (ÄŒesky)
@@ -59,6 +127,18 @@
'clicktracking' => 'Sledovánà kliknutà pro Iniciativu použitelnosti',
'clicktracking-desc' => 'Sledovánà kliknutà pro sledovánà událostÃ, které nezpůsobujà znovunaÄtenà stránky',
'clicktracking-title' => 'Souhrn klikánà uživatelů',
+ 'event-name' => 'Název události',
+ 'expert-header' => 'Kliknutà „expertů“',
+ 'intermediate-header' => 'Kliknutà „pokroÄilých“',
+ 'beginner-header' => 'Kliknutà „zaÄáteÄnÃků“',
+ 'total-header' => 'Celkem kliknutÃ',
+ 'start-date' => 'Datum zaÄátku (RRRRMMDD)',
+ 'end-date' => 'Datum konce (RRRRMMDD)',
+ 'increment-by' => 'PoÄet dnà reprezentovaných každým bodem',
+ 'change-graph' => 'Změnit graf',
+ 'beginner' => 'ZaÄáteÄnÃk',
+ 'intermediate' => 'PokroÄilý',
+ 'expert' => 'Expert',
);
/** German (Deutsch)
@@ -68,6 +148,17 @@
'clicktracking' => 'Benutzerfreundlichkeitsinitiative Klickverfolgung',
'clicktracking-desc' => 'Klickverfolgung, gedacht für die Aufzeichnung von Aktionen, die nicht zu einer Seitenaktualisierung führen',
'clicktracking-title' => 'Erzeugte Benutzerklicks',
+ 'event-name' => 'Ereignisname',
+ 'expert-header' => 'Expertenklicks',
+ 'intermediate-header' => 'Klicks von Mittleren',
+ 'beginner-header' => 'Anfängerklicks',
+ 'total-header' => 'Gesamtklicks',
+ 'start-date' => 'Start (JJJJMMTT)',
+ 'end-date' => 'Ende (JJJJMMTT)',
+ 'change-graph' => 'Grafik ändern',
+ 'beginner' => 'Anfänger',
+ 'intermediate' => 'Mittlere',
+ 'expert' => 'Experte',
);
/** Lower Sorbian (Dolnoserbski)
@@ -77,9 +168,22 @@
'clicktracking' => 'Kliknjeńske pśeslědowanje iniciatiwy wužywajobnosći',
'clicktracking-desc' => 'Kliknjeńske pśeslědowanje, myslone za slědowanje tšojenjow, kótarež njezawinuju aktualizaciju boka',
'clicktracking-title' => 'Nakopjone wužywarske kliknjenja',
+ 'event-name' => 'Mě tšojenja',
+ 'expert-header' => 'Kliknjenja "ekspertow"',
+ 'intermediate-header' => 'Kliknjenja "pókšacanych"',
+ 'beginner-header' => 'Kliknjenja "zachopjeńkarjow"',
+ 'total-header' => 'Kliknjenja dogromady',
+ 'start-date' => 'Zachopny datum (YYYYMMDD)',
+ 'end-date' => 'Kóńcny datum (YYYYMMDD)',
+ 'increment-by' => 'Licba dnjow, kótaruž kuždy datowy dypk reprezentěrujo',
+ 'change-graph' => 'Grafisku liniju změniś',
+ 'beginner' => 'Zachopjeńkaŕ',
+ 'intermediate' => 'Pókšacony',
+ 'expert' => 'Ekspert',
);
/** Greek (Ελληνικά)
+ * @author Crazymadlover
* @author Omnipaedista
* @author ZaDiak
*/
@@ -87,6 +191,17 @@
'clicktracking' => 'Πατήστε παÏακολοÏθηση της Î Ïωτοβουλίας ΧÏηστικότητας',
'clicktracking-desc' => 'Πατήστε παÏακολοÏθηση, Ï€ÏοοÏίζεται για την παÏακολοÏθηση εκδηλώσεων που δεν Ï€ÏοκαλοÏν ανανÎωση σελίδας',
'clicktracking-title' => 'ΣυναθÏοισμÎνα κλικ χÏήστη',
+ 'event-name' => 'Όνομα γεγονότος',
+ 'expert-header' => 'Κλικ "ειδικοί"',
+ 'intermediate-header' => 'Κλικ "μÎÏ„Ïιοι"',
+ 'beginner-header' => 'Κλικ "αÏχάÏιοι"',
+ 'total-header' => 'Συνολικά κλικ',
+ 'start-date' => 'ΗμεÏομηνία ÎναÏξης (ΕΕΕΕΜΜΗΗ)',
+ 'end-date' => 'ΗμεÏομηνία λήξης (ΕΕΕΕΜΜΗΗ)',
+ 'change-graph' => 'Αλλαγή γÏαφήματος',
+ 'beginner' => 'ΑÏχάÏιος',
+ 'intermediate' => 'ÎœÎÏ„Ïιος',
+ 'expert' => 'Ειδικός',
);
/** Esperanto (Esperanto)
@@ -94,15 +209,43 @@
*/
$messages['eo'] = array(
'clicktracking-desc' => 'Sekvado de klakoj, por sekvi klakeventojn kiu ne kaÅzas paÄan refreÅigon',
+ 'event-name' => 'Eventa nomo',
+ 'expert-header' => 'Klakoj de "Spertuloj"',
+ 'intermediate-header' => 'Klakoj de "progresantoj"',
+ 'beginner-header' => 'Klakoj de "novuloj"',
+ 'start-date' => 'Komenca Dato (JJJJMMTT)',
+ 'end-date' => 'Fina Dato (JJJJMMTT)',
+ 'beginner' => 'Novulo',
+ 'intermediate' => 'Progresanto',
+ 'expert' => 'Spertulo',
);
/** Spanish (Español)
* @author Antur
+ * @author Crazymadlover
*/
$messages['es'] = array(
'clicktracking-title' => 'Clicks de usuario agregados',
+ 'total-header' => 'Clicks totales',
+ 'start-date' => 'Fecha de inicio (AAMMDD)',
+ 'end-date' => 'Fecha de fin (AAMMDD)',
+ 'beginner' => 'Principiante',
+ 'intermediate' => 'Intemedio',
+ 'expert' => 'Experto',
);
+/** Basque (Euskara)
+ * @author An13sa
+ */
+$messages['eu'] = array(
+ 'start-date' => 'Hasiera Data (UUUUHHEE)',
+ 'end-date' => 'Amaiera Data (UUUUHHEE)',
+ 'change-graph' => 'Grafikoa aldatu',
+ 'beginner' => 'Hasiberria',
+ 'intermediate' => 'Maila ertainekoa',
+ 'expert' => 'Aditua',
+);
+
/** Finnish (Suomi)
* @author Str4nd
*/
@@ -112,12 +255,25 @@
);
/** French (Français)
+ * @author McDutchie
* @author PieRRoMaN
*/
$messages['fr'] = array(
'clicktracking' => "Suivi de clics de l'initiative d'utilisabilité",
'clicktracking-desc' => 'Suivi de clics, visant à traquer les événements qui ne causent pas un rechargement de page',
'clicktracking-title' => "Agrégation des clics d'utilisateurs",
+ 'event-name' => "Nom de l'événement",
+ 'expert-header' => 'Clics « experts »',
+ 'intermediate-header' => 'Clics « intermédiaires »',
+ 'beginner-header' => 'Clics « débutants »',
+ 'total-header' => 'Total des clics',
+ 'start-date' => 'Date de début (AAAAMMJJ)',
+ 'end-date' => 'Date de fin (AAAAMMJJ)',
+ 'increment-by' => 'Nombre de jours que représente chaque point de donnée',
+ 'change-graph' => 'Changer le graphe',
+ 'beginner' => 'Débutant',
+ 'intermediate' => 'Intermédiaire',
+ 'expert' => 'Expert',
);
/** Galician (Galego)
@@ -127,6 +283,18 @@
'clicktracking' => 'Seguimento dos clics da Iniciativa de usabilidade',
'clicktracking-desc' => 'Seguimento dos clics, co obxectivo de seguir os acontecementos que non causan unha actualización da páxina',
'clicktracking-title' => 'Clics de usuario engadidos',
+ 'event-name' => 'Nome do evento',
+ 'expert-header' => 'Clics "expertos"',
+ 'intermediate-header' => 'Clics "intermedios"',
+ 'beginner-header' => 'Clics "principiantes"',
+ 'total-header' => 'Total de clics',
+ 'start-date' => 'Data de inicio (AAAAMMDD)',
+ 'end-date' => 'Data de fin (AAAAMMDD)',
+ 'increment-by' => 'Número de dÃas que representa cada punto de datos',
+ 'change-graph' => 'Gráfica de cambio',
+ 'beginner' => 'Principiante',
+ 'intermediate' => 'Intermedio',
+ 'expert' => 'Experto',
);
/** Swiss German (Alemannisch)
@@ -136,8 +304,41 @@
'clicktracking' => 'D Klickverfolgig vu dr Benutzerfrejndligkeits-Initiative',
'clicktracking-desc' => 'Klickverfolgig, fir Aktione, wu kei Syteaktualisierig verursache',
'clicktracking-title' => 'Zämmegfassti Benutzerklicks',
+ 'event-name' => 'Ereignis',
+ 'expert-header' => '„Experte“-Klicks',
+ 'intermediate-header' => 'Klicks vu „Mittlere“',
+ 'beginner-header' => '„Aafänger“-Klicks',
+ 'total-header' => 'Klicks insgsamt',
+ 'start-date' => 'Startdatum (JJJJMMTT)',
+ 'end-date' => 'Änddatum (JJJJMMTT)',
+ 'increment-by' => 'Aazahl vu Täg, wu ne jede Punkt derfir stoht',
+ 'change-graph' => 'Abbildig ändere',
+ 'beginner' => 'Aafänger',
+ 'intermediate' => 'Mittlere',
+ 'expert' => 'Expert',
);
+/** Hebrew (עברית)
+ * @author Rotem Liss
+ */
+$messages['he'] = array(
+ 'clicktracking' => 'מעקב לחיצות ×‘×ž×™×–× ×”×©×™×ž×•×©×™×•×ª',
+ 'clicktracking-desc' => 'מעקב לחיצות עבור בדיקת ××™×¨×•×¢×™× ×©××™× × ×’×•×¨×ž×™× ×œ×¨×¢× ×•×Ÿ דף',
+ 'clicktracking-title' => 'לחיצות ×ž×©×ª×ž×©×™× ×ž×¦×˜×‘×¨×•×ª',
+ 'event-name' => '×©× ×”×ירוע',
+ 'expert-header' => 'לחיצות של "מומחי×"',
+ 'intermediate-header' => 'לחיצות של "×‘×™× ×•× ×™×™×"',
+ 'beginner-header' => 'לחיצות של "מתחילי×"',
+ 'total-header' => 'סך כל הלחיצות',
+ 'start-date' => 'ת×ריך התחלה (YYYYMMDD)',
+ 'end-date' => 'ת×ריך ×¡×™×•× (YYYYMMDD)',
+ 'increment-by' =>'מספר ×”×™×ž×™× ×©×ž×™×™×¦×’×ª כל × ×§×•×“×ª מידע',
+ 'change-graph' =>'×©×™× ×•×™ הגרף',
+ 'beginner' => 'מתחיל',
+ 'intermediate' => '×‘×™× ×•× ×™',
+ 'expert' => 'מומחה',
+);
+
/** Croatian (Hrvatski)
* @author Suradnik13
*/
@@ -153,14 +354,32 @@
'clicktracking' => 'Kliknjenske přesćěhanje iniciatiwy wužiwajomnosće',
'clicktracking-desc' => 'Kliknjenske přesćěhanje, myslene za přesćěhowanje podawkow, kotrež aktualizaciju strony njezawinuja',
'clicktracking-title' => 'Nahromadźene wužiwarske kliknjenja',
+ 'event-name' => 'Mjenp podawka',
+ 'expert-header' => 'Kliknjenja "ekspertow"',
+ 'intermediate-header' => 'Kliknjenja "pokroÄenych"',
+ 'beginner-header' => 'Kliknjenja "zapoÄatkarjow"',
+ 'total-header' => 'Kliknjenja dohromady',
+ 'start-date' => 'SpoÄatny datum (YYYYMMDD)',
+ 'end-date' => 'KónÄny datum (YYYYMMDD)',
+ 'increment-by' => 'LiÄba dnjow, kotruž kóždy datowy dypk reprezentuje',
+ 'change-graph' => 'Grafisku liniju změnić',
+ 'beginner' => 'ZapoÄatkar',
+ 'intermediate' => 'PokroÄeny',
+ 'expert' => 'Ekspert',
);
/** Hungarian (Magyar)
* @author Dani
+ * @author Glanthor Reviol
*/
$messages['hu'] = array(
'clicktracking' => 'Usability Initiative kattintásszámláló',
'clicktracking-desc' => 'Kattintásszámláló, az olyan események rögzÃtésére, melyekhez nem szükséges a lap frissÃtése',
+ 'clicktracking-title' => 'A szerkesztÅ‘k kattintásainak összesÃtése',
+ 'event-name' => 'Esemény neve',
+ 'total-header' => 'Összes kattintás',
+ 'start-date' => 'Kezdődátum (ÉÉÉÉHHNN)',
+ 'end-date' => 'Végdátum (ÉÉÉÉHHNN)',
);
/** Interlingua (Interlingua)
@@ -170,6 +389,18 @@
'clicktracking' => 'Traciamento de clics del Initiativa de Usabilitate',
'clicktracking-desc' => 'Traciamento de clics, pro traciar eventos que non causa un recargamento de pagina',
'clicktracking-title' => 'Clics aggregate de usatores',
+ 'event-name' => 'Nomine del evento',
+ 'expert-header' => 'Clics "experte"',
+ 'intermediate-header' => 'Clics "intermedie"',
+ 'beginner-header' => 'Clics "comenciante"',
+ 'total-header' => 'Total de clics',
+ 'start-date' => 'Data de initio (AAAAMMDD)',
+ 'end-date' => 'Data de fin (AAAAMMDD)',
+ 'increment-by' => 'Numero de dies representate per cata puncto de datos',
+ 'change-graph' => 'Cambiar graphico',
+ 'beginner' => 'Comenciante',
+ 'intermediate' => 'Intermedie',
+ 'expert' => 'Experte',
);
/** Indonesian (Bahasa Indonesia)
@@ -190,6 +421,18 @@
'clicktracking' => 'Usability Initiative クリック追跡',
'clicktracking-desc' => 'クリック追跡:ページã®å†æ画を引ãèµ·ã“ã•ãªã„イベントを追跡記録ã™ã‚‹æ©Ÿèƒ½',
'clicktracking-title' => '利用者ã«ã‚ˆã‚‹ã‚¯ãƒªãƒƒã‚¯ã®ç·è¨ˆ',
+ 'event-name' => 'イベントå',
+ 'expert-header' => '「上級者ã€ã®ã‚¯ãƒªãƒƒã‚¯æ•°',
+ 'intermediate-header' => '「ä¸ç´šè€…ã€ã®ã‚¯ãƒªãƒƒã‚¯æ•°',
+ 'beginner-header' => '「åˆç´šè€…ã€ã®ã‚¯ãƒªãƒƒã‚¯æ•°',
+ 'total-header' => 'クリック回数åˆè¨ˆ',
+ 'start-date' => '開始日 (YYYYMMDD)',
+ 'end-date' => '終了日 (YYYYMMDD)',
+ 'increment-by' => 'å„データ点ãŒè¡¨ã™æ—¥æ•°',
+ 'change-graph' => 'グラフ変更',
+ 'beginner' => 'åˆç´šè€…',
+ 'intermediate' => 'ä¸ç´šè€…',
+ 'expert' => '上級者',
);
/** Ripoarisch (Ripoarisch)
@@ -199,6 +442,18 @@
'clicktracking' => 'Dä <i lang="en">Wikipedia Usability Initiative</i> ier Kleckverfolljung',
'clicktracking-desc' => 'Klecks un Akßuhne Verfollje, di kein neu Sigg afroofe donn.',
'clicktracking-title' => 'Jesammte Klecks',
+ 'event-name' => 'Da Name vun dämm, wat passeet es',
+ 'expert-header' => 'Klecks vun „{{int:Expert}}“',
+ 'intermediate-header' => 'Klecks vun „{{int:Intermediate}}“',
+ 'beginner-header' => 'Klecks vun „{{int:Beginner}}e“',
+ 'total-header' => 'Jesampzahl aan Kleks',
+ 'start-date' => 'Et Dattum vum Aanfang (en dä Forrem: JJJJMMDD)',
+ 'end-date' => 'Et Dattum vum Engk (en dä Forrem: JJJJMMDD)',
+ 'increment-by' => 'De Aanzahl Dääsch, woh jede Pungk em Diajramm daashtälle sull',
+ 'change-graph' => 'Dat Diajramm ändere',
+ 'beginner' => 'Aanfänger udder Neuling',
+ 'intermediate' => 'Meddel',
+ 'expert' => 'Mer kännt sesch uß',
);
/** Luxembourgish (Lëtzebuergesch)
@@ -206,8 +461,20 @@
*/
$messages['lb'] = array(
'clicktracking' => 'Benotzerfrëndlechkeetsinitiative Suivi vun de Klicken',
- 'clicktracking-desc' => "Suivi vun de Clicken, fir déi Aktiounen z'erfaassen déi net zu engem neie Llueden vun der Säit féieren",
+ 'clicktracking-desc' => "Suivi vun de Klicken, fir déi Aktiounen z'erfaassen déi net zu engem neie Luede vun der Säit féieren",
'clicktracking-title' => 'Vun de Benotzer gemaachte Klicken',
+ 'event-name' => 'Numm vum Evenement',
+ 'expert-header' => '"Expert"-Klicken',
+ 'intermediate-header' => '"Duerschnëtt"-Klicken',
+ 'beginner-header' => '"Ufänker"-Klicken',
+ 'total-header' => 'Total vun de Klicken',
+ 'start-date' => 'Ufanksdatum (YYYYMMDD)',
+ 'end-date' => 'Schlussdatum (YYYYMMDD)',
+ 'increment-by' => 'Zuel vun Deeg déi vun all Datepunkt duergestallt ginn',
+ 'change-graph' => 'Ännerungs-Grafik',
+ 'beginner' => 'Ufänger',
+ 'intermediate' => 'Dertëschent',
+ 'expert' => 'Expert',
);
/** Macedonian (МакедонÑки)
@@ -233,6 +500,18 @@
'clicktracking' => 'Klikvolgen voor het Bruikbaarheidsinitiatief',
'clicktracking-desc' => 'Klikvolgen voor het volgens van handelingen die niet het oproepen van een nieuwe pagina tot gevolg hebben',
'clicktracking-title' => 'Samengevoegde gebruikerskliks',
+ 'event-name' => 'Gebeurtenis',
+ 'expert-header' => '"Expert"-kliks',
+ 'intermediate-header' => '"Gemiddeld"-kliks',
+ 'beginner-header' => '"Beginner"-kliks',
+ 'total-header' => 'Kliktotaal',
+ 'start-date' => 'Startdatum (JJJJMMDD)',
+ 'end-date' => 'Einddatum (JJJJMMDD)',
+ 'increment-by' => 'Aantal dagen dat ieder punt representeert',
+ 'change-graph' => 'Grafiek wijzigen',
+ 'beginner' => 'Beginner',
+ 'intermediate' => 'Gemiddeld',
+ 'expert' => 'Expert',
);
/** Occitan (Occitan)
@@ -241,6 +520,19 @@
$messages['oc'] = array(
'clicktracking' => "Seguit de clics de l'iniciativa d'utilizabilitat",
'clicktracking-desc' => 'Seguit de clics, visant a tracar los eveniments que causan pas un recargament de pagina',
+ 'clicktracking-title' => "Agregacion dels clics d'utilizaires",
+ 'event-name' => "Nom de l'eveniment",
+ 'expert-header' => 'Clics « expèrts »',
+ 'intermediate-header' => 'Clics « intermediaris »',
+ 'beginner-header' => 'Clics « debutants »',
+ 'total-header' => 'Total dels clics',
+ 'start-date' => 'Data de començament (AAAAMMJJ)',
+ 'end-date' => 'Data de fin (AAAAMMJJ)',
+ 'increment-by' => 'Nombre de jorns que representa cada punt de donada',
+ 'change-graph' => 'Graf de cambi',
+ 'beginner' => 'Debutant',
+ 'intermediate' => 'Intermediari',
+ 'expert' => 'Expèrt',
);
/** Polish (Polski)
@@ -250,6 +542,17 @@
'clicktracking' => 'Śledzenie kliknięć dla inicjatywy użyteczności',
'clicktracking-desc' => 'Śledzenie kliknięć, przeznaczone do poszukiwania zdarzeń, które nie powodują odświeżenia strony',
'clicktracking-title' => 'Suma kliknięć użytkowników',
+ 'event-name' => 'Nazwa zdarzenia',
+ 'expert-header' => 'KlikniÄ™cia „specjalistówâ€',
+ 'intermediate-header' => 'KlikniÄ™cia „zaawansowanychâ€',
+ 'beginner-header' => 'KlikniÄ™cia „nowicjuszyâ€',
+ 'total-header' => 'Wszystkich kliknięć',
+ 'start-date' => 'Data rozpoczęcia (RRRRMMDD)',
+ 'end-date' => 'Data zakończenia (RRRRMMDD)',
+ 'change-graph' => 'Wykres zmian',
+ 'beginner' => 'Nowicjusz',
+ 'intermediate' => 'Zaawansowany',
+ 'expert' => 'Specjalista',
);
/** Piedmontese (Piemontèis)
@@ -259,8 +562,30 @@
'clicktracking' => "Trassadura dij click ëd l'Usability Initiative",
'clicktracking-desc' => "Trassadura dij click, për trassé dj'event cha a causo pa ël refresh ëd na pà gina",
'clicktracking-title' => "Click agregà dl'utent",
+ 'event-name' => "Nòm ëd l'event",
+ 'expert-header' => 'Click d\'"Espert"',
+ 'intermediate-header' => 'Click dj\'"antërmedi"',
+ 'beginner-header' => 'Click ëd "prinsipiant"',
+ 'total-header' => 'Click totaj',
+ 'start-date' => 'Data ëd partensa (AAAAMMDD)',
+ 'end-date' => 'Data ëd fin (AAAAMMDD)',
+ 'increment-by' => 'Nùmer ëd di che minca pont a arpresenta',
+ 'change-graph' => 'Cambia ël graf',
+ 'beginner' => 'Prinsipiant',
+ 'intermediate' => 'Antërmedi',
+ 'expert' => 'Espert',
);
+/** Portuguese (Português)
+ * @author Giro720
+ */
+$messages['pt'] = array(
+ 'change-graph' => 'Mudar gráfico',
+ 'beginner' => 'Iniciante',
+ 'intermediate' => 'Intermediário',
+ 'expert' => 'Experiente',
+);
+
/** Brazilian Portuguese (Português do Brasil)
* @author Eduardo.mps
*/
@@ -270,6 +595,7 @@
);
/** Russian (РуÑÑкий)
+ * @author HalanTul
* @author Kv75
* @author ÐлекÑандр Сигачёв
*/
@@ -277,14 +603,38 @@
'clicktracking' => 'ОтÑлеживание нажатий в рамках Инициативы юзабилити',
'clicktracking-desc' => 'ОтÑлеживание нажатий. ПредназначаетÑÑ Ð´Ð»Ñ Ð¾Ñ‚ÑÐ»ÐµÐ¶Ð¸Ð²Ð°Ð½Ð¸Ñ Ñобытий, не приводÑщих к обновлению Ñтраницы',
'clicktracking-title' => 'Собранные щелчки учаÑтников',
+ 'event-name' => 'Ðазвание ÑобытиÑ',
+ 'expert-header' => 'ÐÐ°Ð¶Ð°Ñ‚Ð¸Ñ Â«ÑкÑпертов»',
+ 'intermediate-header' => 'ÐÐ°Ð¶Ð°Ñ‚Ð¸Ñ Â«Ñредних учаÑтников»',
+ 'beginner-header' => 'ÐÐ°Ð¶Ð°Ñ‚Ð¸Ñ Â«Ð½Ð¾Ð²Ð¸Ñ‡ÐºÐ¾Ð²Â»',
+ 'total-header' => 'Ð’Ñего нажатий',
+ 'start-date' => 'Дата начала (ГГГГММДД)',
+ 'end-date' => 'Дата Ð¾ÐºÐ¾Ð½Ñ‡Ð°Ð½Ð¸Ñ (ГГГГММДД)',
+ 'increment-by' => 'КоличеÑтво дней, которое предÑтавлÑет ÐºÐ°Ð¶Ð´Ð°Ñ Ñ‚Ð¾Ñ‡ÐºÐ° данных',
+ 'change-graph' => 'Изменить график',
+ 'beginner' => 'Ðовичок',
+ 'intermediate' => 'Средний учаÑтник',
+ 'expert' => 'ÐкÑперт',
);
/** Yakut (Саха тыла)
* @author HalanTul
*/
$messages['sah'] = array(
+ 'clicktracking' => 'Баттааһыннары Ð¢Ð°Ð±Ñ‹Ð³Ð°Ñ Ð¡Ð¸Ñ‚Ð¸Ò»Ð¸Ð¸Ñ‚Ð¸Ð½ иһинÑн кÑÑ‚ÑÑһин',
'clicktracking-desc' => 'Баттааһыны кÑÑ‚ÑÑһин. СирÑйи Ñаҥардыбат түбÑлтÑлÑри кÑÑ‚Ð¸Ð¸Ñ€Ð³Ñ Ñ‚ÑƒÑ‚Ñ‚ÑƒÐ»Ð»Ð°Ñ€',
'clicktracking-title' => 'Кыттааччылар баттааһыннарын хомуура',
+ 'event-name' => 'ТүбÑÐ»Ñ‚Ñ Ð°Ð°Ñ‚Ð°',
+ 'expert-header' => '"ÐкÑпертар" баттааһыннара (клик)',
+ 'intermediate-header' => '"Орто кыттааччылар" баттааһыннара (клик)',
+ 'beginner-header' => '"Саҕалааччылар" баттааһыннара (клик)',
+ 'total-header' => 'Баттааһын барытын ахÑаана',
+ 'start-date' => 'Саҕаламмыт күнÑ-ыйа (ССССЫЫКК)',
+ 'end-date' => 'Бүппүт күнÑ-дьыла (ССССЫЫКК)',
+ 'change-graph' => 'Графигы уларытыы',
+ 'beginner' => 'Саҥа кыттааччы',
+ 'intermediate' => 'Бороохтуйбут кыттааччы',
+ 'expert' => 'ÐкÑперт',
);
/** Slovak (SlovenÄina)
@@ -294,6 +644,18 @@
'clicktracking' => 'Sledovanie kliknutà pre IniciatÃvu použiteľnosti',
'clicktracking-desc' => 'Sledovanie kliknutÃ, na sledovanie udalostÃ, ktoré nespôsobujú opätovné naÄÃtanie stránky',
'clicktracking-title' => 'Agregované kliknutia použÃvateľa',
+ 'event-name' => 'Názov udalosti',
+ 'expert-header' => 'Kliknutia „expertov“',
+ 'intermediate-header' => 'Kliknutia „pokroÄilých“',
+ 'beginner-header' => 'Kliknutia „zaÄiatoÄnÃkov“',
+ 'total-header' => 'Kliknutà celkom',
+ 'start-date' => 'Dátum zaÄiatku (YYYYMMDD)',
+ 'end-date' => 'Dátum konca (YYYYMMDD)',
+ 'increment-by' => 'PoÄet dnÃ, ktorý predstavuje každý z bodov v dátach',
+ 'change-graph' => 'Zmeniť graf',
+ 'beginner' => 'ZaÄiatoÄnÃk',
+ 'intermediate' => 'PokroÄilý',
+ 'expert' => 'Expert',
);
/** Slovenian (SlovenÅ¡Äina)
@@ -311,6 +673,18 @@
'clicktracking' => 'Kullanılabilirlik Girişimi tıklama izleme',
'clicktracking-desc' => 'Tıklama izleme, bir sayfa yenilemesine sebep olmadan olayları izleme amaçlı',
'clicktracking-title' => 'Toplu kullanıcı tıklamaları',
+ 'event-name' => 'Olay adı',
+ 'expert-header' => '"Deneyimli" tıklamaları',
+ 'intermediate-header' => '"Orta düzeyde" tıklamaları',
+ 'beginner-header' => '"Acemi" tıklamaları',
+ 'total-header' => 'Toplam tıklama',
+ 'start-date' => 'Başlangıç Tarihi (YYYYAAGG)',
+ 'end-date' => 'BitiÅŸ tarihi (YYYYAAGG)',
+ 'increment-by' => 'Her veri noktasının temsil ettiği gün sayısı',
+ 'change-graph' => 'GrafiÄŸi deÄŸiÅŸtir',
+ 'beginner' => 'Acemi',
+ 'intermediate' => 'Orta düzeyde',
+ 'expert' => 'Deneyimli',
);
/** Vèneto (Vèneto)
@@ -320,8 +694,27 @@
'clicktracking' => "Traciamento click de l'Inissiativa par l'Usabilità ",
'clicktracking-desc' => 'Traciamento dei click, par traciare i eventi che no provoca mia un refresh de la pagina.',
'clicktracking-title' => 'Agregassion dei clic dei utenti',
+ 'event-name' => "Nome de l'evento",
+ 'expert-header' => 'Clic de "esperti"',
+ 'intermediate-header' => 'Clic de "intermedi"',
+ 'beginner-header' => 'Clic de "prinsipianti"',
+ 'total-header' => 'Clic totali',
+ 'start-date' => 'Data de inissio (AAAAMMGG)',
+ 'end-date' => 'Data de fine(AAAAMMGG)',
+ 'change-graph' => 'Canbiar el grà fico',
+ 'beginner' => 'Prinsipiante',
+ 'intermediate' => 'Intermedio',
+ 'expert' => 'Esperto',
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'beginner' => 'Augotai',
+ 'expert' => 'Ekspert',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Vinhtantran
*/
@@ -329,6 +722,18 @@
'clicktracking' => 'Theo dõi nhấn chuột Sáng kiến Khả dụng',
'clicktracking-desc' => 'Theo dõi hà nh vi nhấn chuột, dùng để theo dõi các hoạt động không là m tươi trang',
'clicktracking-title' => 'Tổng số nhấn chuột của thà nh viên',
+ 'event-name' => 'Tên sự kiện',
+ 'expert-header' => 'Cú nhấn "chuyên gia"',
+ 'intermediate-header' => 'Cú nhấn "trung bình"',
+ 'beginner-header' => 'Cú nhấn "ngÆ°á»i má»›i"',
+ 'total-header' => 'Tổng số lần nhấn',
+ 'start-date' => 'Ngà y bắt đầu (YYYYMMDD)',
+ 'end-date' => 'Ngà y kết thúc (YYYYMMDD)',
+ 'increment-by' => 'Số ngà y mà mỗi điểm dữ liệu thể hiện',
+ 'change-graph' => 'Äồ thị thay đổi',
+ 'beginner' => 'NgÆ°á»i má»›i',
+ 'intermediate' => 'Trung bình',
+ 'expert' => 'Chuyên gia',
);
/** Yue (粵語)
Index: ClickTracking/ClickTracking.php
===================================================================
--- ClickTracking/ClickTracking.php (revision 56989)
+++ ClickTracking/ClickTracking.php (working copy)
@@ -23,6 +23,7 @@
// click throttle, should be seen as "1 out of every $wgClickTrackThrottle users will have it enabled"
// setting this to 1 means all users will have it enabled
+// setting to a negative number will disable it for all users
$wgClickTrackThrottle = 1;
// set the time window for what we consider 'recent' contributions, in days
@@ -48,21 +49,20 @@
$wgAutoloadClasses['ClickTrackingHooks'] = $dir . 'ClickTracking.hooks.php';
$wgAutoloadClasses['ApiClickTracking'] = $dir . 'ApiClickTracking.php';
$wgAutoloadClasses['SpecialClickTracking'] = $dir . 'SpecialClickTracking.php';
+$wgAutoloadClasses['ApiSpecialClickTracking'] = $dir .'ApiSpecialClickTracking.php';
-
// Hooked functions
$wgHooks['LoadExtensionSchemaUpdates'][] = 'ClickTrackingHooks::schema';
-$wgHooks['ArticleSaveComplete'][] = 'ClickTrackingHooks::storeNewContrib';
$wgHooks['EditPage::showEditForm:initial'][] = 'ClickTrackingHooks::addJS';
// Set up the new API module
$wgAPIModules['clicktracking'] = 'ApiClickTracking';
+$wgAPIModules['specialclicktracking'] = 'ApiSpecialClickTracking';
//Special page setup
$wgSpecialPages['ClickTracking'] = 'SpecialClickTracking';
+$wgSpecialPageGroups['ClickTracking'] = 'admin';
-
-
// Adds Internationalized Messages
$wgExtensionMessagesFiles['ClickTracking'] = $dir . 'ClickTracking.i18n.php';
$wgExtensionAliasesFiles['ClickTracking'] = $dir . 'ClickTracking.alias.php';
\ No newline at end of file
Index: PrefStats/PrefStats.i18n.php
===================================================================
--- PrefStats/PrefStats.i18n.php (revision 56989)
+++ PrefStats/PrefStats.i18n.php (working copy)
@@ -43,8 +43,10 @@
/** Message documentation (Message documentation)
* @author Purodha
* @author Siebrand
+ * @author Umherirrender
*/
$messages['qqq'] = array(
+ 'prefstats-desc' => '{{desc}}',
'prefstats-factors' => '$1 is a list of values with a link each, and separated by {{msg-mw|pipe-separator}}.',
'prefstats-factor-hour' => 'One hour. Used in {{msg-mw|prefstats-factors}} as part of the pipe separated list $1.',
'prefstats-factor-day' => 'One day. Used in {{msg-mw|prefstats-factors}} as part of the pipe separated list $1.',
@@ -272,6 +274,16 @@
'prefstats-factor-day' => 'дьнь',
);
+/** Welsh (Cymraeg)
+ * @author Lloffiwr
+ */
+$messages['cy'] = array(
+ 'prefstats-factor-hour' => 'awr',
+ 'prefstats-factor-sixhours' => 'chwech awr',
+ 'prefstats-factor-day' => 'diwrnod',
+ 'prefstats-factor-week' => 'wythnos',
+);
+
/** Danish (Dansk)
* @author Byrial
*/
@@ -478,13 +490,26 @@
* @author Pikne
*/
$messages['et'] = array(
+ 'prefstats' => 'Eelistuste arvandmed',
'prefstats-desc' => 'Kogub arvandmeid kindlate eelistuste kasutatavuse kohta.',
+ 'prefstats-title' => 'Eelistuste arvandmed',
+ 'prefstats-list-intro' => 'Parajasti jälgitakse järgmisi eelistusi. Klõpsa ühel, et näha selle arvandmeid.',
+ 'prefstats-noprefs' => 'Ühtegi eelistust ei jälgita parajasti.
+Eelistuse jälgimiseks redigeeri muutujat $wgPrefStatsTrackPrefs.',
+ 'prefstats-counters' => '* $1 {{PLURAL:$1|kasutaja|kasutajat}} on alates eelistuse jälgimahakust selle eelistuse kasutusele võtnud
+** $2 {{PLURAL:$2|kasutaja kasutab|kasutajat kasutavad}} seda endiselt
+** $3 {{PLURAL:$3|kasutaja|kasutajat}} on sellest loobunud',
'prefstats-xaxis' => 'Kestus (tundides)',
+ 'prefstats-factors' => 'Astmiku jaotis: $1',
'prefstats-factor-hour' => 'tund',
+ 'prefstats-factor-sixhours' => 'kuus tundi',
'prefstats-factor-day' => 'päev',
'prefstats-factor-week' => 'nädal',
'prefstats-factor-twoweeks' => 'kaks nädalat',
'prefstats-factor-fourweeks' => 'neli nädalat',
+ 'prefstats-factor-default' => 'vaikeastmik',
+ 'prefstats-legend-out' => 'Loobunud',
+ 'prefstats-legend-in' => 'Kasutanud',
);
/** Basque (Euskara)
@@ -509,6 +534,18 @@
'prefstats-legend-in' => 'Bat egin duzu',
);
+/** Persian (Ùارسی)
+ * @author Mardetanha
+ */
+$messages['fa'] = array(
+ 'prefstats-factor-hour' => 'ساعت',
+ 'prefstats-factor-sixhours' => 'شش ساعت',
+ 'prefstats-factor-day' => 'روز',
+ 'prefstats-factor-week' => 'Ù‡Ùته',
+ 'prefstats-factor-twoweeks' => 'دو Ù‡Ùته',
+ 'prefstats-factor-fourweeks' => 'چهار Ù‡Ùته',
+);
+
/** Finnish (Suomi)
* @author Cimon Avaro
* @author Crt
@@ -683,6 +720,7 @@
** {{PLURAL:$3|משתמש ×חד ביטל|$3 ×ž×©×ª×ž×©×™× ×‘×™×˜×œ×•}} ×ותה מ××–
* בסך הכול, ×ª×›×•× ×” זו מופעלת ×צל {{PLURAL:$4|משתמש ×חד|$4 משתמשי×}}',
'prefstats-xaxis' => 'משך (בשעות)',
+ 'prefstats-factors' => 'צפייה לפי: $1',
'prefstats-factor-hour' => 'שעה',
'prefstats-factor-sixhours' => 'שש שעות',
'prefstats-factor-day' => 'יו×',
@@ -690,6 +728,8 @@
'prefstats-factor-twoweeks' => 'שבועיי×',
'prefstats-factor-fourweeks' => '×רבעה שבועות',
'prefstats-factor-default' => 'חזרה למימדי ברירת המחדל',
+ 'prefstats-legend-out' => 'ביטול ההעדפה',
+ 'prefstats-legend-in' => 'הפעלת ההעדפה',
);
/** Croatian (Hrvatski)
@@ -1174,6 +1214,7 @@
);
/** Norwegian Nynorsk (‪Norsk (nynorsk)‬)
+ * @author Gunnernett
* @author Harald Khan
*/
$messages['nn'] = array(
@@ -1182,6 +1223,13 @@
'prefstats-title' => 'Statistikk over innstillingar',
'prefstats-list-intro' => 'For tida vert dei fylgjande innstillingane spora.
Trykk på éi for å sjå statistikk for ho.',
+ 'prefstats-xaxis' => 'Tid i timar',
+ 'prefstats-factor-hour' => 'time',
+ 'prefstats-factor-sixhours' => 'seks timar',
+ 'prefstats-factor-day' => 'dag',
+ 'prefstats-factor-week' => 'veke',
+ 'prefstats-factor-twoweeks' => 'to veker',
+ 'prefstats-factor-fourweeks' => 'fire veker',
);
/** Norwegian (bokmål)‬ (‪Norsk (bokmål)‬)
@@ -1276,6 +1324,18 @@
'prefstats-legend-in' => 'KorzystajÄ…',
);
+/** Pashto (پښتو)
+ * @author Ahmed-Najib-Biabani-Ibrahimkhel
+ */
+$messages['ps'] = array(
+ 'prefstats-factor-hour' => 'ساعت',
+ 'prefstats-factor-sixhours' => 'شپږ ساعته',
+ 'prefstats-factor-day' => 'ورÚ',
+ 'prefstats-factor-week' => 'اونÛ',
+ 'prefstats-factor-twoweeks' => 'دوه اونÛ',
+ 'prefstats-factor-fourweeks' => 'څلور اونÛ',
+);
+
/** Portuguese (Português)
* @author Giro720
* @author Malafaya
@@ -1396,8 +1456,8 @@
'prefstats-factor-twoweeks' => 'две недели',
'prefstats-factor-fourweeks' => 'четыре недели',
'prefstats-factor-default' => 'назад к маÑштабу по умолчанию',
- 'prefstats-legend-out' => 'ОтключитьÑÑ',
- 'prefstats-legend-in' => 'ВключитьÑÑ',
+ 'prefstats-legend-out' => 'ПодключилиÑÑŒ',
+ 'prefstats-legend-in' => 'ПодключилиÑÑŒ',
);
/** Yakut (Саха тыла)
@@ -1493,6 +1553,19 @@
'prefstats-legend-in' => 'OmogoÄeno',
);
+/** Serbian Cyrillic ekavian (СрпÑки (ћирилица))
+ * @author Sasa Stefanovic
+ */
+$messages['sr-ec'] = array(
+ 'prefstats-xaxis' => 'Трајање (Ñати)',
+ 'prefstats-factor-hour' => 'Ñат',
+ 'prefstats-factor-sixhours' => 'шеÑÑ‚ Ñати',
+ 'prefstats-factor-day' => 'дан',
+ 'prefstats-factor-week' => 'недеља',
+ 'prefstats-factor-twoweeks' => 'две недеље',
+ 'prefstats-factor-fourweeks' => '4 недеље',
+);
+
/** Swedish (Svenska)
* @author Fluff
* @author Ozp
@@ -1641,6 +1714,19 @@
'prefstats-factor-default' => 'torna a la scala predefinìa',
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'prefstats-factor-hour' => 'Äas',
+ 'prefstats-factor-sixhours' => "kuz' Äasud",
+ 'prefstats-factor-day' => 'päiv',
+ 'prefstats-factor-week' => "nedal'",
+ 'prefstats-factor-twoweeks' => "kaks' nedalid",
+ 'prefstats-factor-fourweeks' => "nell' nedalid",
+ 'prefstats-factor-default' => 'tagaze masštabannoks augotižjärgendusen mödhe',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Minh Nguyen
* @author Vinhtantran
Index: EditWarning/EditWarning.i18n.php
===================================================================
--- EditWarning/EditWarning.i18n.php (revision 56989)
+++ EditWarning/EditWarning.i18n.php (working copy)
@@ -21,9 +21,11 @@
/** Message documentation (Message documentation)
* @author McDutchie
+ * @author Umherirrender
*/
$messages['qqq'] = array(
'editwarning' => "This is the name of an extension that warns people when they try to leave an edit form without saving. So it means something like \"warning about (your) edit\", '''not''' \"edit the warning\".",
+ 'editwarning-desc' => '{{desc}}',
);
/** Arabic (العربية)
@@ -47,13 +49,14 @@
/** Belarusian (TaraÅ¡kievica orthography) (БеларуÑÐºÐ°Ñ (тарашкевіца))
* @author EugeneZelenko
* @author Jim-by
+ * @author Zedlik
*/
$messages['be-tarask'] = array(
'editwarning' => 'ПапÑÑ€Ñджаньне Ñ€ÑдагаваньнÑ',
'editwarning-desc' => 'Паказвае папÑÑ€Ñджаньне, калі ўдзельнік Ñпрабуе пакінуць форму Ñ€ÑÐ´Ð°Ð³Ð°Ð²Ð°Ð½ÑŒÐ½Ñ Ð±ÐµÐ· захаваньнÑ',
'editwarning-warning' => 'УÑе Ð·Ñ€Ð¾Ð±Ð»ÐµÐ½Ñ‹Ñ Ð’Ð°Ð¼Ñ– зьмены могуць быць ÑтрачаныÑ, калі Ð’Ñ‹ пакінеце гÑтую Ñтаронку.
Ð’Ñ‹ можаце адключыць гÑтае папÑÑ€Ñджаньне у ÑÑкцыі «{{int:prefs-editing}}» Вашых уÑтановак.',
- 'editwarning-preference' => 'ПапÑÑ€Ñджваць мÑне, калі Ñ Ð±ÑƒÐ´Ñƒ пакідаць Ñтаронку Ñ€ÑÐ´Ð°Ð³Ð°Ð²Ð°Ð½ÑŒÐ½Ñ Ð· незахаванымі зьменамі',
+ 'editwarning-preference' => 'ПапÑÑ€Ñджваць мÑне, калі Ñ Ð±ÑƒÐ´Ñƒ пакідаць Ñтаронку Ñ€ÑÐ´Ð°Ð³Ð°Ð²Ð°Ð½ÑŒÐ½Ñ Ð·ÑŒ незахаванымі зьменамі',
);
/** Bengali (বাংলা)
@@ -119,6 +122,16 @@
'editwarning-preference' => 'Upozornit, když budu opouštět editaci bez uloženà změn',
);
+/** Welsh (Cymraeg)
+ * @author Lloffiwr
+ */
+$messages['cy'] = array(
+ 'editwarning' => 'Hysbysiad golygu',
+ 'editwarning-warning' => 'Os y gadewch y dudalen hon mae\'n bosib y collwch eich newidiadau iddi.
+Gallwch ddiddymu\'r rhybudd hwn yn yr adran "{{int:prefs-editing}}" yn eich dewisiadau.',
+ 'editwarning-preference' => "Tynnwch fy sylw pan wyf ar fin gadael tudalen olygu heb roi'r newidiadau ar gadw",
+);
+
/** Danish (Dansk)
* @author Byrial
*/
@@ -383,6 +396,7 @@
/** Korean (í•œêµì–´)
* @author Klutzy
+ * @author Kwj2772
* @author ToePeu
*/
$messages['ko'] = array(
@@ -390,6 +404,7 @@
'editwarning-desc' => 'ì €ìž¥í•˜ì§€ ì•Šê³ í™”ë©´ì„ ë‹«ì„ ë•Œ ê²½ê³ ë¥¼ 표시해 ì¤ë‹ˆë‹¤.',
'editwarning-warning' => 'ì´ ì°½ì„ ë– ë‚˜ë©´ ì €ìž¥í•˜ì§€ ì•Šì€ íŽ¸ì§‘ì´ ëª¨ë‘ ì‚¬ë¼ì§‘니다.
ì´ ê²½ê³ ë¥¼ 환경 ì„¤ì •ì˜ "{{int:prefs-editing}}"ì—ì„œ 비활성화 í• ìˆ˜ 있습니다.',
+ 'editwarning-preference' => 'ìˆ˜ì •í•œ ë‚´ìš©ì„ ì €ìž¥í•˜ì§€ ì•Šê³ íŽ¸ì§‘ ì–‘ì‹ì„ 닫거나 다른 페ì´ì§€ë¡œ ì´ë™í• ë•Œ 알림',
);
/** Ripoarisch (Ripoarisch)
@@ -435,6 +450,13 @@
'editwarning-preference' => 'Предупреди ме кога Ñакам да напуштам Ñтраница за уредување без да ги имам зачувано промените',
);
+/** Malayalam (മലയാളം)
+ * @author Praveenp
+ */
+$messages['ml'] = array(
+ 'editwarning-preference' => 'സേവൠചെയàµà´¯à´¾à´¤àµà´¤ മാറàµà´±à´™àµà´™à´³àµ‹à´Ÿàµ കൂടിയ തിരàµà´¤àµà´¤à´²àµâ€ താളിൽ നിനàµà´¨àµà´‚ പോകàµà´®àµà´ªàµ‹àµ¾ à´Žà´¨àµà´¨àµ† അറിയികàµà´•àµà´•',
+);
+
/** Malay (Bahasa Melayu)
* @author Kurniasan
*/
@@ -596,6 +618,16 @@
'editwarning-preference' => 'Varna mig om jag lämnar en redigeringssida där jag gjort ändringar men inte sparat.',
);
+/** Swahili (Kiswahili)
+ * @author Lloffiwr
+ */
+$messages['sw'] = array(
+ 'editwarning' => 'Ilani ya uhariri',
+ 'editwarning-warning' => 'Ukitoka kwenye ukurasa huu labda utapoteza madabiliko uliyoyafanya.
+Unaweza kuondoa ilani hii ukienda kwenye sehemu ya "{{int:prefs-editing}}" kwenye mapendekezo yako.',
+ 'editwarning-preference' => 'Unionyeshe ilani ninapotaka kutoka kwenye ukurasa ninouhariri, bila kuhifadhi mabadiliko',
+);
+
/** Telugu (తెలà±à°—à±)
* @author Ravichandra
*/
@@ -634,6 +666,13 @@
'editwarning-preference' => 'Dime se sto lassando na pagina de modifica sensa aver salvà ',
);
+/** Veps (Vepsan kel')
+ * @author Игорь БродÑкий
+ */
+$messages['vep'] = array(
+ 'editwarning' => 'Redaktiruida varutuz',
+);
+
/** Vietnamese (Tiếng Việt)
* @author Minh Nguyen
* @author Vinhtantran
Index: js/plugins/jquery.autoEllipse.js
===================================================================
--- js/plugins/jquery.autoEllipse.js (revision 56989)
+++ js/plugins/jquery.autoEllipse.js (working copy)
@@ -3,17 +3,51 @@
*/
( function( $ ) {
-$.fn.autoEllipse = function() {
+$.fn.autoEllipse = function( options ) {
$(this).each( function() {
+ options = $.extend( {
+ 'position': 'center',
+ 'tooltip': false
+ }, options );
var text = $(this).text();
var $text = $( '<span />' ).text( text ).css( 'whiteSpace', 'nowrap' );
$(this).empty().append( $text );
- if ( $text.outerWidth() > $(this).outerWidth() ) {
- var i = text.length;
- while ( $text.outerWidth() > $(this).outerWidth() && i > 0 ) {
- $text.text( text.substr( 0, i ) + '...' );
- i--;
+ if ( $text.outerWidth() > $(this).innerWidth() ) {
+ switch ( options.position ) {
+ case 'right':
+ var l = text.length;
+ while ( $text.outerWidth() > $(this).innerWidth() && l > 0 ) {
+ $text.text( text.substr( 0, l ) + '...' );
+ l--;
+ }
+ break;
+ case 'center':
+ var i = [Math.round( text.length / 2 ), Math.round( text.length / 2 )];
+ var side = 1; // Begin with making the end shorter
+ while ( $text.outerWidth() > ( $(this).innerWidth() ) && i[0] > 0 ) {
+ $text.text( text.substr( 0, i[0] ) + '...' + text.substr( i[1] ) );
+ // Alternate between trimming the end and begining
+ if ( side == 0 ) {
+ // Make the begining shorter
+ i[0]--;
+ side = 1;
+ } else {
+ // Make the end shorter
+ i[1]++;
+ side = 0;
+ }
+ }
+ break;
+ case 'left':
+ var r = 0;
+ while ( $text.outerWidth() > $(this).innerWidth() && r < text.length ) {
+ $text.text( '...' + text.substr( r ) );
+ r++;
+ }
+ break;
}
+ if ( options.tooltip )
+ $text.attr( 'title', text );
}
} );
};
Property changes on: js/plugins/jquery.autoEllipse.js
___________________________________________________________________
Added: svn:eol-style
+ native
Index: js/plugins/jquery.suggestions.js
===================================================================
--- js/plugins/jquery.suggestions.js (revision 56989)
+++ js/plugins/jquery.suggestions.js (working copy)
@@ -119,30 +119,30 @@
} else {
// Rebuild the suggestions list
context.data.$container.show();
+ // Update the size and position of the list
+ context.data.$container.css( {
+ 'top': context.config.$region.offset().top + context.config.$region.outerHeight(),
+ 'bottom': 'auto',
+ 'width': context.config.$region.outerWidth(),
+ 'height': 'auto',
+ 'left': context.config.$region.offset().left,
+ 'right': 'auto'
+ } );
var $results = context.data.$container.children( '.suggestions-results' );
$results.empty();
for ( var i = 0; i < context.config.suggestions.length; i++ ) {
$result = $( '<div />' )
.addClass( 'suggestions-result' )
.attr( 'rel', i )
- .data( 'text', context.config.suggestions[i] );
+ .data( 'text', context.config.suggestions[i] )
+ .appendTo( $results );
// Allow custom rendering
if ( typeof context.config.result.render == 'function' ) {
context.config.result.render.call( $result, context.config.suggestions[i] );
} else {
- $result.text( context.config.suggestions[i] );
+ $result.text( context.config.suggestions[i] ).autoEllipse();
}
- $results.append( $result );
}
- // Update the size and position of the list
- context.data.$container.css( {
- 'top': context.config.$region.offset().top + context.config.$region.outerHeight(),
- 'bottom': 'auto',
- 'width': context.config.$region.outerWidth(),
- 'height': 'auto',
- 'left': context.config.$region.offset().left,
- 'right': 'auto'
- } );
}
}
break;
@@ -186,6 +186,10 @@
$.suggestions.restore( context );
} else {
context.data.$textbox.val( result.data( 'text' ) );
+
+ // .val() doesn't call any event handlers, so
+ // let the world know what happened
+ context.data.$textbox.change();
}
}
$.suggestions.special( context );
@@ -194,23 +198,27 @@
* Respond to keypress event
* @param {Integer} key Code of key pressed
*/
- keypress: function( context, key ) {
+ keypress: function( e, context, key ) {
+ var wasVisible = context.data.$container.is( ':visible' );
+ var preventDefault = false;
switch ( key ) {
// Arrow down
case 40:
- if ( context.data.$container.is( ':visible' ) ) {
+ if ( wasVisible ) {
$.suggestions.highlight( context, 'next', true );
} else {
$.suggestions.update( context, false );
}
context.data.$textbox.trigger( 'change' );
+ preventDefault = true;
break;
// Arrow up
case 38:
- if ( context.data.$container.is( ':visible' ) ) {
+ if ( wasVisible ) {
$.suggestions.highlight( context, 'prev', true );
}
context.data.$textbox.trigger( 'change' );
+ preventDefault = wasVisible;
break;
// Escape
case 27:
@@ -218,15 +226,21 @@
$.suggestions.restore( context );
$.suggestions.cancel( context );
context.data.$textbox.trigger( 'change' );
+ preventDefault = wasVisible;
break;
// Enter
case 13:
context.data.$container.hide();
+ preventDefault = wasVisible;
break;
default:
$.suggestions.update( context, true );
break;
}
+ if ( preventDefault ) {
+ e.preventDefault();
+ e.stopImmediatePropagation();
+ }
}
};
$.fn.suggestions = function() {
@@ -315,7 +329,7 @@
if ( $result.get( 0 ) != $other.get( 0 ) ) {
return;
}
- highlight( $result, true );
+ $.suggestions.highlight( context, $result, true );
context.data.$container.hide();
if ( typeof context.config.result.select == 'function' ) {
context.config.result.select.call( $result, context.data.$textbox );
@@ -352,16 +366,32 @@
// Store key pressed to handle later
context.data.keypressed = ( e.keyCode == undefined ) ? e.which : e.keyCode;
context.data.keypressedCount = 0;
+
+ switch ( context.data.keypressed ) {
+ // This preventDefault logic is duplicated from
+ // $.suggestions.keypress(), which sucks
+ case 40:
+ e.preventDefault();
+ e.stopImmediatePropagation();
+ break;
+ case 38:
+ case 27:
+ case 13:
+ if ( context.data.$container.is( ':visible' ) ) {
+ e.preventDefault();
+ e.stopImmediatePropagation();
+ }
+ }
} )
- .keypress( function() {
+ .keypress( function( e ) {
context.data.keypressedCount++;
- $.suggestions.keypress( context, context.data.keypressed );
+ $.suggestions.keypress( e, context, context.data.keypressed );
} )
- .keyup( function() {
+ .keyup( function( e ) {
// Some browsers won't throw keypress() for arrow keys. If we got a keydown and a keyup without a
// keypress in between, solve it
if ( context.data.keypressedCount == 0 ) {
- $.suggestions.keypress( context, context.data.keypressed );
+ $.suggestions.keypress( e, context, context.data.keypressed );
}
} )
.blur( function() {
Index: js/plugins/jquery.textSelection.js
===================================================================
--- js/plugins/jquery.textSelection.js (revision 56989)
+++ js/plugins/jquery.textSelection.js (working copy)
@@ -52,11 +52,6 @@
// Do nothing
} else if ( document.selection && document.selection.createRange ) {
// IE/Opera
- if ( document.documentElement && document.documentElement.scrollTop ) {
- var winScroll = document.documentElement.scrollTop;
- } else if ( document.body ) {
- var winScroll = document.body.scrollTop;
- }
$(this).focus();
var range = document.selection.createRange();
if ( ownline && range.moveStart ) {
@@ -84,14 +79,8 @@
range.moveEnd( 'character', - post.length );
}
range.select();
- if ( document.documentElement && document.documentElement.scrollTop ) {
- document.documentElement.scrollTop = winScroll
- } else if ( document.body ) {
- document.body.scrollTop = winScroll;
- }
} else if ( e.selectionStart || e.selectionStart == '0' ) {
// Mozilla
- var textScroll = e.scrollTop;
$(this).focus();
var startPos = e.selectionStart;
var endPos = e.selectionEnd;
@@ -112,8 +101,9 @@
e.selectionStart = startPos + pre.length + selText.length + post.length;
e.selectionEnd = e.selectionStart;
}
- e.scrollTop = textScroll;
}
+ // Scroll the textarea to the inserted text
+ $(this).scrollToCaretPosition();
$(this).trigger( 'encapsulateSelection', [ pre, peri, post, ownline, replace ] );
},
/**
@@ -205,18 +195,38 @@
}
return getCaret( this.get( 0 ) );
},
+setSelection: function( start, end ) {
+ if ( typeof end == 'undefined' )
+ end = start;
+ return this.each( function() {
+ if ( this.selectionStart || this.selectionStart == '0' ) {
+ this.selectionStart = start;
+ this.selectionEnd = end;
+ } else if ( document.body.createTextRange ) {
+ var selection = document.body.createTextRange;
+ selection.setToElementText( this );
+ var length = selection.text.length;
+ selection.moveStart( 'character', start );
+ selection.moveEnd( 'character', -length + end );
+ selection.select();
+ }
+ });
+},
/**
* Ported from Wikia's LinkSuggest extension
* https://svn.wikia-code.com/wikia/trunk/extensions/wikia/LinkSuggest
*
- * Scroll a textarea to a certain offset
+ * Scroll a textarea to the current cursor position. You can set the cursor
+ * position with setSelection()
* @param pos Byte offset
*/
-scrollToCaretPosition: function( pos ) {
+scrollToCaretPosition: function() {
function getLineLength( e ) {
return Math.floor( e.scrollWidth / ( $.os.name == 'linux' ? 7 : 8 ) );
}
function getCaretScrollPosition( e ) {
+ // FIXME: This functions sucks and is off by a few lines most
+ // of the time. It should be replaced by something decent.
var text = e.value.replace( /\r/g, "" );
var caret = $( e ).getCaretPosition();
var lineLength = getLineLength( e );
@@ -261,33 +271,26 @@
$(this).focus();
if ( this.selectionStart || this.selectionStart == '0' ) {
// Mozilla
- this.selectionStart = pos;
- this.selectionEnd = pos;
$(this).scrollTop( getCaretScrollPosition( this ) );
} else if ( document.selection && document.selection.createRange ) {
// IE / Opera
/*
- * IE automatically scrolls the section to the bottom of the page,
- * except if it's already in view and the cursor position hasn't
- * changed, in which case it does nothing. In that case we'll force
- * it to act by moving one character back and forth.
+ * IE automatically scrolls the selected text to the
+ * bottom of the textarea at setSelection() time, except
+ * if it was already in view and the cursor position
+ * wasn't changed, in which case it does nothing. To
+ * cover that case, we'll force it to act by moving one
+ * character back and forth.
*/
var range = document.selection.createRange();
- var oldPos = $(this).getCaretPosition();
- var goBack = false;
- if ( oldPos == pos ) {
- pos++;
- goBack = true;
- }
+ var pos = $(this).getCaretPosition();
range.moveToElementText( this );
range.collapse();
- range.move( 'character', pos );
+ range.move( 'character', pos + 1);
range.select();
this.scrollTop += range.offsetTop;
- if ( goBack ) {
- range.move( 'character', -1 );
- range.select();
- }
+ range.move( 'character', -1 );
+ range.select();
}
$(this).trigger( 'scrollToPosition' );
} );
Index: js/plugins/jquery.wikiEditor.js
===================================================================
--- js/plugins/jquery.wikiEditor.js (revision 56989)
+++ js/plugins/jquery.wikiEditor.js (working copy)
@@ -127,7 +127,7 @@
}
//Each browser seems to do this differently, so let's keep our editor
//consistent by always starting at the begining
- context.$textarea.scrollToCaretPosition( 0 );
+ context.$textarea.setSelection( 0 ).scrollToCaretPosition();
}
// If there was a configuration passed, it's assumed to be for the addModule
Index: js/plugins/jquery.wikiEditor.dialogs.js
===================================================================
--- js/plugins/jquery.wikiEditor.dialogs.js (revision 56989)
+++ js/plugins/jquery.wikiEditor.dialogs.js (working copy)
@@ -67,9 +67,67 @@
.data( 'context', context )
.appendTo( $( 'body' ) )
.each( module.init )
- .dialog( configuration );
+ .dialog( configuration )
+ .bind( 'dialogopen', $.wikiEditor.modules.dialogs.fn.resize )
+ .find( '.ui-tabs' ).bind( 'tabsshow', function() {
+ $(this).closest( '.ui-dialog-content' ).each(
+ $.wikiEditor.modules.dialogs.fn.resize );
+ });
+
+ // Add tabindexes to dialog form elements
+ // Find the highest tabindex in use
+ var maxTI = 0;
+ $j( '[tabindex]' ).each( function() {
+ var ti = parseInt( $j(this).attr( 'tabindex' ) );
+ if ( ti > maxTI )
+ maxTI = ti;
+ });
+
+ var tabIndex = maxTI + 1;
+ $j( '.ui-dialog input, .ui-dialog button' )
+ .not( '[tabindex]' )
+ .each( function() {
+ $j(this).attr( 'tabindex', tabIndex++ );
+ });
}
}
+ },
+
+ /**
+ * Resize a dialog so its contents fit
+ *
+ * Usage: dialog.each( resize ); or dialog.bind( 'blah', resize );
+ */
+ resize: function() {
+ var wrapper = $(this).closest( '.ui-dialog' );
+ // Make sure elements don't wrapped so we get an accurate idea
+ // of whether they really fit. Also temporarily show hidden
+ // elements.
+
+ // Work around jQuery bug where <div style="display:inline;" />
+ // inside a dialog is both :visible and :hidden
+ var oldHidden = $(this).find( '*' ).not( ':visible' );
+
+ // Save the style attributes of the hidden elements to restore
+ // them later. Calling hide() after show() messes up for
+ // elements hidden with a class
+ oldHidden.each( function() {
+ $(this).data( 'oldstyle', $(this).attr( 'style' ) );
+ });
+ oldHidden.show();
+ var oldWS = $(this).css( 'white-space' );
+ $(this).css( 'white-space', 'nowrap' );
+
+ if ( wrapper.width() <= $(this).get(0).scrollWidth ) {
+ $(this).width( $(this).get(0).scrollWidth );
+ wrapper.width( wrapper.get(0).scrollWidth );
+ $(this).dialog( { 'width': wrapper.width() } );
+ }
+
+ $(this).css( 'white-space', oldWS );
+ oldHidden.each( function() {
+ $(this).attr( 'style', $(this).data( 'oldstyle' ) );
+ });
}
},
'modules': {}
Index: js/plugins/jquery.namespaceSelect.js
===================================================================
--- js/plugins/jquery.namespaceSelect.js (revision 56989)
+++ js/plugins/jquery.namespaceSelect.js (working copy)
@@ -1,20 +1,20 @@
-/**
- * Plugin that fills a <select> with namespaces
- */
-
-(function ($) {
-$.fn.namespaceSelector = function( defaultNS ) {
- if ( typeof defaultNS == 'undefined' )
- defaultNS = 0;
- return this.each( function() {
- for ( var id in wgFormattedNamespaces ) {
- var opt = $( '<option />' )
- .attr( 'value', id )
- .text( wgFormattedNamespaces[id] );
- if ( id == defaultNS )
- opt.attr( 'selected', 'selected' );
- opt.appendTo( $(this) );
- }
- });
-};})(jQuery);
-
+/**
+ * Plugin that fills a <select> with namespaces
+ */
+
+(function ($) {
+$.fn.namespaceSelector = function( defaultNS ) {
+ if ( typeof defaultNS == 'undefined' )
+ defaultNS = 0;
+ return this.each( function() {
+ for ( var id in wgFormattedNamespaces ) {
+ var opt = $( '<option />' )
+ .attr( 'value', id )
+ .text( wgFormattedNamespaces[id] );
+ if ( id == defaultNS )
+ opt.attr( 'selected', 'selected' );
+ opt.appendTo( $(this) );
+ }
+ });
+};})(jQuery);
+
Property changes on: js/plugins/jquery.namespaceSelect.js
___________________________________________________________________
Added: svn:eol-style
+ native
Index: js/plugins/jquery.wikiEditor.toc.js
===================================================================
--- js/plugins/jquery.wikiEditor.toc.js (revision 56989)
+++ js/plugins/jquery.wikiEditor.toc.js (working copy)
@@ -43,7 +43,7 @@
$.wikiEditor.modules.toc.fn.build( context );
$.wikiEditor.modules.toc.fn.update( context );
context.$textarea
- .bind( 'keyup encapsulateSelection',
+ .delayedBind( 1000, 'keyup encapsulateSelection',
function( event ) {
var context = $(this).data( 'wikiEditor-context' );
$(this).eachAsync( {
@@ -55,7 +55,7 @@
} );
}
)
- .bind( 'mouseup scrollToPosition focus',
+ .bind( 'mouseup scrollToPosition focus keyup encapsulateSelection',
function( event ) {
var context = $(this).data( 'wikiEditor-context' );
$(this).eachAsync( {
@@ -144,7 +144,9 @@
.data( 'textbox', context.$textarea )
.data( 'position', structure[i].position )
.click( function( event ) {
- $(this).data( 'textbox' ).scrollToCaretPosition( $(this).data( 'position' ) );
+ $(this).data( 'textbox' )
+ .setSelection( $(this).data( 'position' ) )
+ .scrollToCaretPosition();
event.preventDefault();
} )
.text( structure[i].text )
@@ -208,7 +210,7 @@
if ( outline[i].level > lastLevel ) {
nLevel++;
}
- else if ( outline[i].level < nLevel ) {
+ else if ( outline[i].level < lastLevel ) {
nLevel -= Math.max( 1, lastLevel - outline[i].level );
}
if ( nLevel <= 0 ) {
@@ -223,6 +225,7 @@
if ( $( 'input[name=wpSection]' ).val() == '' )
structure.unshift( { 'text': wgPageName.replace(/_/g, ' '), 'level': 1, 'index': 0, 'position': 0 } );
context.modules.$toc.html( buildList( structure ) );
+ context.modules.$toc.find( 'ul a' ).autoEllipse( { 'position': 'right', 'tooltip': true } );
// Cache the outline for later use
context.data.outline = outline;
}
Property changes on: js/plugins/jquery.wikiEditor.toc.js
___________________________________________________________________
Deleted: svn:mergeinfo
Reverse-merged /trunk/extensions/UsabilityInitiative/js/plugins/jquery.wikiEditor.toc.js:r56195,56207,56209,56296,56333,56355,56417,56588,56590
Reverse-merged /trunk/phase3/extensions/UsabilityInitiative/js/plugins/jquery.wikiEditor.toc.js:r56213,56215-56216,56218,56325,56334-56336,56338,56340,56343,56345,56347,56350
Reverse-merged /branches/REL1_15/phase3/extensions/UsabilityInitiative/js/plugins/jquery.wikiEditor.toc.js:r51646
Index: js/js2.combined.js
===================================================================
--- js/js2.combined.js (revision 56989)
+++ js/js2.combined.js (working copy)
@@ -4374,6 +4374,5083 @@
});
})();
+/*
+ * jQuery UI 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;jQuery.ui || (function($) {
+
+var _remove = $.fn.remove,
+ isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.7.2",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set || !instance.element[0].parentNode) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+// WAI-ARIA normalization
+if (isFF2) {
+ var attr = $.attr,
+ removeAttr = $.fn.removeAttr,
+ ariaNS = "http://www.w3.org/2005/07/aaa",
+ ariaState = /^aria-/,
+ ariaRole = /^wairole:/;
+
+ $.attr = function(elem, name, value) {
+ var set = value !== undefined;
+
+ return (name == 'role'
+ ? (set
+ ? attr.call(this, elem, name, "wairole:" + value)
+ : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
+ : (ariaState.test(name)
+ ? (set
+ ? elem.setAttributeNS(ariaNS,
+ name.replace(ariaState, "aaa:"), value)
+ : attr.call(this, elem, name.replace(ariaState, "aaa:")))
+ : attr.apply(this, arguments)));
+ };
+
+ $.fn.removeAttr = function(name) {
+ return (ariaState.test(name)
+ ? this.each(function() {
+ this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
+ }) : removeAttr.call(this, name));
+ };
+}
+
+//jQuery plugins
+$.fn.extend({
+ remove: function() {
+ // Safari has a native remove event which actually removes DOM elements,
+ // so we have to use triggerHandler instead of trigger (#3037).
+ $("*", this).add(this).each(function() {
+ $(this).triggerHandler("remove");
+ });
+ return _remove.apply(this, arguments );
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '')
+ .unbind('selectstart.ui');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none')
+ .bind('selectstart.ui', function() { return false; });
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+
+// $.widget is a factory to create jQuery plugins
+// taking some boilerplate code out of the plugin code
+function getter(namespace, plugin, method, args) {
+ function getMethods(type) {
+ var methods = $[namespace][plugin][type] || [];
+ return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
+ }
+
+ var methods = getMethods('getter');
+ if (args.length == 1 && typeof args[0] == 'string') {
+ methods = methods.concat(getMethods('getterSetter'));
+ }
+ return ($.inArray(method, methods) != -1);
+}
+
+$.widget = function(name, prototype) {
+ var namespace = name.split(".")[0];
+ name = name.split(".")[1];
+
+ // create plugin method
+ $.fn[name] = function(options) {
+ var isMethodCall = (typeof options == 'string'),
+ args = Array.prototype.slice.call(arguments, 1);
+
+ // prevent calls to internal methods
+ if (isMethodCall && options.substring(0, 1) == '_') {
+ return this;
+ }
+
+ // handle getter methods
+ if (isMethodCall && getter(namespace, name, options, args)) {
+ var instance = $.data(this[0], name);
+ return (instance ? instance[options].apply(instance, args)
+ : undefined);
+ }
+
+ // handle initialization and non-getter methods
+ return this.each(function() {
+ var instance = $.data(this, name);
+
+ // constructor
+ (!instance && !isMethodCall &&
+ $.data(this, name, new $[namespace][name](this, options))._init());
+
+ // method call
+ (instance && isMethodCall && $.isFunction(instance[options]) &&
+ instance[options].apply(instance, args));
+ });
+ };
+
+ // create widget constructor
+ $[namespace] = $[namespace] || {};
+ $[namespace][name] = function(element, options) {
+ var self = this;
+
+ this.namespace = namespace;
+ this.widgetName = name;
+ this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
+ this.widgetBaseClass = namespace + '-' + name;
+
+ this.options = $.extend({},
+ $.widget.defaults,
+ $[namespace][name].defaults,
+ $.metadata && $.metadata.get(element)[name],
+ options);
+
+ this.element = $(element)
+ .bind('setData.' + name, function(event, key, value) {
+ if (event.target == element) {
+ return self._setData(key, value);
+ }
+ })
+ .bind('getData.' + name, function(event, key) {
+ if (event.target == element) {
+ return self._getData(key);
+ }
+ })
+ .bind('remove', function() {
+ return self.destroy();
+ });
+ };
+
+ // add widget prototype
+ $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
+
+ // TODO: merge getter and getterSetter properties from widget prototype
+ // and plugin prototype
+ $[namespace][name].getterSetter = 'option';
+};
+
+$.widget.prototype = {
+ _init: function() {},
+ destroy: function() {
+ this.element.removeData(this.widgetName)
+ .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
+ .removeAttr('aria-disabled');
+ },
+
+ option: function(key, value) {
+ var options = key,
+ self = this;
+
+ if (typeof key == "string") {
+ if (value === undefined) {
+ return this._getData(key);
+ }
+ options = {};
+ options[key] = value;
+ }
+
+ $.each(options, function(key, value) {
+ self._setData(key, value);
+ });
+ },
+ _getData: function(key) {
+ return this.options[key];
+ },
+ _setData: function(key, value) {
+ this.options[key] = value;
+
+ if (key == 'disabled') {
+ this.element
+ [value ? 'addClass' : 'removeClass'](
+ this.widgetBaseClass + '-disabled' + ' ' +
+ this.namespace + '-state-disabled')
+ .attr("aria-disabled", value);
+ }
+ },
+
+ enable: function() {
+ this._setData('disabled', false);
+ },
+ disable: function() {
+ this._setData('disabled', true);
+ },
+
+ _trigger: function(type, event, data) {
+ var callback = this.options[type],
+ eventName = (type == this.widgetEventPrefix
+ ? type : this.widgetEventPrefix + type);
+
+ event = $.Event(event);
+ event.type = eventName;
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if (event.originalEvent) {
+ for (var i = $.event.props.length, prop; i;) {
+ prop = $.event.props[--i];
+ event[prop] = event.originalEvent[prop];
+ }
+ }
+
+ this.element.trigger(event, data);
+
+ return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
+ || event.isDefaultPrevented());
+ }
+};
+
+$.widget.defaults = {
+ disabled: false
+};
+
+
+/** Mouse Interaction Plugin **/
+
+$.ui.mouse = {
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ // Prevent text selection in IE
+ if ($.browser.msie) {
+ this._mouseUnselectable = this.element.attr('unselectable');
+ this.element.attr('unselectable', 'on');
+ }
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+
+ // Restore text selection in IE
+ ($.browser.msie
+ && this.element.attr('unselectable', this._mouseUnselectable));
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ // TODO: figure out why we have to use originalEvent
+ event.originalEvent = event.originalEvent || {};
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = (event.target == this._mouseDownEvent.target);
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+};
+
+$.ui.mouse.defaults = {
+ cancel: null,
+ distance: 1,
+ delay: 0
+};
+
+})(jQuery);
+/*
+ * jQuery UI Draggable 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Call plugins and callbacks
+ this._trigger("start", event);
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ this._trigger('drag', event, ui);
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ self._trigger("stop", event);
+ self._clear();
+ });
+ } else {
+ this._trigger("stop", event);
+ this._clear();
+ }
+
+ return false;
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ absolutePosition: this.positionAbs, //deprecated
+ offset: this.positionAbs
+ };
+ }
+
+}));
+
+$.extend($.ui.draggable, {
+ version: "1.7.2",
+ eventPrefix: "drag",
+ defaults: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ cancel: ":input,option",
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ delay: 0,
+ distance: 1,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ }
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
+ });
+
+ $(group).each(function(i) {
+ this.style.zIndex = o.stack.min + i;
+ });
+
+ this[0].style.zIndex = o.stack.min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.parent().append(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).end().remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var handle = false;
+ for(var i in this.handles) {
+ if($(this.handles[i])[0] == event.target) handle = true;
+ }
+
+ return this.options.disabled || !!handle;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+}));
+
+$.extend($.ui.resizable, {
+ version: "1.7.2",
+ eventPrefix: "resize",
+ defaults: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ cancel: ":input,option",
+ containment: false,
+ delay: 0,
+ distance: 1,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ }
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+/*
+ * jQuery UI Dialog 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ * ui.resizable.js
+ */
+(function($) {
+
+var setDataSwitch = {
+ dragStart: "start.draggable",
+ drag: "drag.draggable",
+ dragStop: "stop.draggable",
+ maxHeight: "maxHeight.resizable",
+ minHeight: "minHeight.resizable",
+ maxWidth: "maxWidth.resizable",
+ minWidth: "minWidth.resizable",
+ resizeStart: "start.resizable",
+ resize: "drag.resizable",
+ resizeStop: "stop.resizable"
+ },
+
+ uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ';
+
+$.widget("ui.dialog", {
+
+ _init: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = this.options,
+
+ title = options.title || this.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(this.element),
+
+ uiDialog = (this.uiDialog = $('<div/>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ (options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = this.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"/>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .mousedown(function(ev) {
+ ev.stopPropagation();
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span/>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ (options.draggable && $.fn.draggable && this._makeDraggable());
+ (options.resizable && $.fn.resizable && this._makeResizable());
+
+ this._createButtons(options.buttons);
+ this._isOpen = false;
+
+ (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
+ (options.autoOpen && this.open());
+
+ },
+
+ destroy: function() {
+ (this.overlay && this.overlay.destroy());
+ this.uiDialog.hide();
+ this.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ this.uiDialog.remove();
+
+ (this.originalTitle && this.element.attr('title', this.originalTitle));
+ },
+
+ close: function(event) {
+ var self = this;
+
+ if (false === self._trigger('beforeclose', event)) {
+ return;
+ }
+
+ (self.overlay && self.overlay.destroy());
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ (self.options.hide
+ ? self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ })
+ : self.uiDialog.hide() && self._trigger('close', event));
+
+ $.ui.dialog.overlay.resize();
+
+ self._isOpen = false;
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ var maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this != self.uiDialog[0]) {
+ maxZ = Math.max(maxZ, $(this).css('z-index'));
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+
+ if ((this.options.modal && !force)
+ || (!this.options.stack && !this.options.modal)) {
+ return this._trigger('focus', event);
+ }
+
+ if (this.options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = this.options.zIndex;
+ }
+ (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
+ this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
+ this.element.attr(saveScroll);
+ this._trigger('focus', event);
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var options = this.options,
+ uiDialog = this.uiDialog;
+
+ this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
+ (uiDialog.next().length && uiDialog.appendTo('body'));
+ this._size();
+ this._position(options.position);
+ uiDialog.show(options.show);
+ this.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode != $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first')[0],
+ last = tabbables.filter(':last')[0];
+
+ if (event.target == last && !event.shiftKey) {
+ setTimeout(function() {
+ first.focus();
+ }, 1);
+ } else if (event.target == first && event.shiftKey) {
+ setTimeout(function() {
+ last.focus();
+ }, 1);
+ }
+ }));
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog)
+ .filter(':first')
+ .focus();
+
+ this._trigger('open');
+ this._isOpen = true;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ this.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ (typeof buttons == 'object' && buttons !== null &&
+ $.each(buttons, function() { return !(hasButtons = true); }));
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ $('<button type="button"></button>')
+ .addClass(
+ 'ui-state-default ' +
+ 'ui-corner-all'
+ )
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .hover(
+ function() {
+ $(this).addClass('ui-state-hover');
+ },
+ function() {
+ $(this).removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ $(this).addClass('ui-state-focus');
+ })
+ .blur(function() {
+ $(this).removeClass('ui-state-focus');
+ })
+ .appendTo(uiDialogButtonPane);
+ });
+ uiDialogButtonPane.appendTo(this.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = this.options,
+ heightBeforeDrag;
+
+ this.uiDialog.draggable({
+ cancel: '.ui-dialog-content',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function() {
+ heightBeforeDrag = options.height;
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ (options.dragStart && options.dragStart.apply(self.element[0], arguments));
+ },
+ drag: function() {
+ (options.drag && options.drag.apply(self.element[0], arguments));
+ },
+ stop: function() {
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ (options.dragStop && options.dragStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = this.options,
+ resizeHandles = typeof handles == 'string'
+ ? handles
+ : 'n,e,s,w,se,sw,ne,nw';
+
+ this.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ alsoResize: this.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: options.minHeight,
+ start: function() {
+ $(this).addClass("ui-dialog-resizing");
+ (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
+ },
+ resize: function() {
+ (options.resize && options.resize.apply(self.element[0], arguments));
+ },
+ handles: resizeHandles,
+ stop: function() {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _position: function(pos) {
+ var wnd = $(window), doc = $(document),
+ pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
+ minTop = pTop;
+
+ if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
+ pos = [
+ pos == 'right' || pos == 'left' ? pos : 'center',
+ pos == 'top' || pos == 'bottom' ? pos : 'middle'
+ ];
+ }
+ if (pos.constructor != Array) {
+ pos = ['center', 'middle'];
+ }
+ if (pos[0].constructor == Number) {
+ pLeft += pos[0];
+ } else {
+ switch (pos[0]) {
+ case 'left':
+ pLeft += 0;
+ break;
+ case 'right':
+ pLeft += wnd.width() - this.uiDialog.outerWidth();
+ break;
+ default:
+ case 'center':
+ pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
+ }
+ }
+ if (pos[1].constructor == Number) {
+ pTop += pos[1];
+ } else {
+ switch (pos[1]) {
+ case 'top':
+ pTop += 0;
+ break;
+ case 'bottom':
+ pTop += wnd.height() - this.uiDialog.outerHeight();
+ break;
+ default:
+ case 'middle':
+ pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
+ }
+ }
+
+ // prevent the dialog from being too high (make sure the titlebar
+ // is accessible)
+ pTop = Math.max(pTop, minTop);
+ this.uiDialog.css({top: pTop, left: pLeft});
+ },
+
+ _setData: function(key, value){
+ (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
+ switch (key) {
+ case "buttons":
+ this._createButtons(value);
+ break;
+ case "closeText":
+ this.uiDialogTitlebarCloseText.text(value);
+ break;
+ case "dialogClass":
+ this.uiDialog
+ .removeClass(this.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "draggable":
+ (value
+ ? this._makeDraggable()
+ : this.uiDialog.draggable('destroy'));
+ break;
+ case "height":
+ this.uiDialog.height(value);
+ break;
+ case "position":
+ this._position(value);
+ break;
+ case "resizable":
+ var uiDialog = this.uiDialog,
+ isResizable = this.uiDialog.is(':data(resizable)');
+
+ // currently resizable, becoming non-resizable
+ (isResizable && !value && uiDialog.resizable('destroy'));
+
+ // currently resizable, changing handles
+ (isResizable && typeof value == 'string' &&
+ uiDialog.resizable('option', 'handles', value));
+
+ // currently non-resizable, becoming resizable
+ (isResizable || this._makeResizable(value));
+ break;
+ case "title":
+ $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
+ break;
+ case "width":
+ this.uiDialog.width(value);
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options;
+
+ // reset content sizing
+ this.element.css({
+ height: 0,
+ minHeight: 0,
+ width: 'auto'
+ });
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ var nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css({
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: options.height == 'auto'
+ ? 'auto'
+ : Math.max(options.height - nonContentHeight, 0)
+ });
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.7.2",
+ defaults: {
+ autoOpen: true,
+ bgiframe: false,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ getter: 'isOpen',
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
+ return (dialogZ > $.ui.dialog.overlay.maxZ);
+ });
+ }
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ (dialog.options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = $('<div></div>').appendTo(document.body)
+ .addClass('ui-widget-overlay').css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.instances.splice($.inArray(this.instances, $el), 1);
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
+
+ height: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ var offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ var offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Tabs 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.tabs", {
+
+ _init: function() {
+ if (this.options.deselectable !== undefined) {
+ this.options.collapsible = this.options.deselectable;
+ }
+ this._tabify(true);
+ },
+
+ _setData: function(key, value) {
+ if (key == 'selected') {
+ if (this.options.collapsible && value == this.options.selected) {
+ return;
+ }
+ this.select(value);
+ }
+ else {
+ this.options[key] = value;
+ if (key == 'deselectable') {
+ this.options.collapsible = value;
+ }
+ this._tabify();
+ }
+ },
+
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+ this.options.idPrefix + $.data(a);
+ },
+
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
+
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index(tab)
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+ .find('span:data(label.tabs)')
+ .each(function() {
+ var el = $(this);
+ el.html(el.data('label.tabs')).removeData('label.tabs');
+ });
+ },
+
+ _tabify: function(init) {
+
+ this.list = this.element.children('ul:first');
+ this.lis = $('li:has(a[href])', this.list);
+ this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+ this.panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.anchors.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split('#')[0], baseEl;
+ if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+ (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if (fragmentId.test(href)) {
+ self.panels = self.panels.add(self._sanitizeSelector(href));
+ }
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
+ }
+ self.panels = self.panels.add($panel);
+ }
+
+ // invalid tab href
+ else {
+ o.disabled.push(i);
+ }
+ });
+
+ // initialization from scratch
+ if (init) {
+
+ // attach necessary classes for styling
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.lis.addClass('ui-state-default ui-corner-top');
+ this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.anchors.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ if (typeof o.selected != 'number' && o.cookie) {
+ o.selected = parseInt(self._cookie(), 10);
+ }
+ if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+ o.selected = o.selected || 0;
+ }
+ else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.lis.index(n); } )
+ )).sort();
+
+ if ($.inArray(o.selected, o.disabled) != -1) {
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+ }
+
+ // highlight selected tab
+ this.panels.addClass('ui-tabs-hide');
+ this.lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+ this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+ this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+ });
+
+ this.load(o.selected);
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.lis.add(self.anchors).unbind('.tabs');
+ self.lis = self.anchors = self.panels = null;
+ });
+
+ }
+ // update selected after add/remove
+ else {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+
+ // update collapsible
+ this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) {
+ this._cookie(o.selected, o.cookie);
+ }
+
+ // disable tabs
+ for (var i = 0, li; (li = this.lis[i]); i++) {
+ $(li)[$.inArray(i, o.disabled) != -1 &&
+ !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+ }
+
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) {
+ this.anchors.removeData('cache.tabs');
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add(this.anchors).unbind('.tabs');
+
+ if (o.event != 'mouseover') {
+ var addState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) {
+ el.addClass('ui-state-' + state);
+ }
+ };
+ var removeState = function(state, el) {
+ el.removeClass('ui-state-' + state);
+ };
+ this.lis.bind('mouseover.tabs', function() {
+ addState('hover', $(this));
+ });
+ this.lis.bind('mouseout.tabs', function() {
+ removeState('hover', $(this));
+ });
+ this.anchors.bind('focus.tabs', function() {
+ addState('focus', $(this).closest('li'));
+ });
+ this.anchors.bind('blur.tabs', function() {
+ removeState('focus', $(this).closest('li'));
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if ($.browser.msie && fx.opacity) {
+ $el[0].style.removeAttribute('filter');
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, showFx.duration || 'normal', function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ self.element.dequeue("tabs");
+ });
+ } :
+ function(clicked, $hide, $show) {
+ self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+ $hide.addClass('ui-tabs-hide');
+ self.element.dequeue("tabs");
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind(o.event + '.tabs', function() {
+ var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+ $show = $(self._sanitizeSelector(this.hash));
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+ $li.hasClass('ui-state-disabled') ||
+ $li.hasClass('ui-state-processing') ||
+ self._trigger('select', null, self._ui(this, $show[0])) === false) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index(this);
+
+ self.abort();
+
+ // if tab may be closed
+ if (o.collapsible) {
+ if ($li.hasClass('ui-tabs-selected')) {
+ o.selected = -1;
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ }).dequeue("tabs");
+
+ this.blur();
+ return false;
+ }
+ else if (!$hide.length) {
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ // show new tab
+ if ($show.length) {
+ if ($hide.length) {
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ });
+ }
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this));
+ }
+ else {
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) {
+ this.blur();
+ }
+
+ });
+
+ // disable click in any case
+ this.anchors.bind('click.tabs', function(){return false;});
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element.unbind('.tabs')
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+ .removeData('tabs');
+
+ this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+ this.anchors.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href) {
+ this.href = href;
+ }
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.lis.unbind('.tabs').add(this.panels).each(function() {
+ if ($.data(this, 'destroy.tabs')) {
+ $(this).remove();
+ }
+ else {
+ $(this).removeClass([
+ 'ui-state-default',
+ 'ui-corner-top',
+ 'ui-tabs-selected',
+ 'ui-state-active',
+ 'ui-state-hover',
+ 'ui-state-focus',
+ 'ui-state-disabled',
+ 'ui-tabs-panel',
+ 'ui-widget-content',
+ 'ui-corner-bottom',
+ 'ui-tabs-hide'
+ ].join(' '));
+ }
+ });
+
+ if (o.cookie) {
+ this._cookie(null, o.cookie);
+ }
+ },
+
+ add: function(url, label, index) {
+ if (index === undefined) {
+ index = this.anchors.length; // append by default
+ }
+
+ var self = this, o = this.options,
+ $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+ id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+ }
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+ if (index >= this.lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.lis[index]);
+ $panel.insertBefore(this.panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n; });
+
+ this._tabify();
+
+ if (this.anchors.length == 1) { // after tabify
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ this.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+ });
+
+ this.load(0);
+ }
+
+ // callback
+ this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+ },
+
+ remove: function(index) {
+ var o = this.options, $li = this.lis.eq(index).remove(),
+ $panel = this.panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+ this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ }
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n; });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ },
+
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1) {
+ return;
+ }
+
+ this.lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+ },
+
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
+ }
+ },
+
+ select: function(index) {
+ if (typeof index == 'string') {
+ index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+ }
+ else if (index === null) { // usage of null is deprecated, TODO remove in next release
+ index = -1;
+ }
+ if (index == -1 && this.options.collapsible) {
+ index = this.options.selected;
+ }
+
+ this.anchors.eq(index).trigger(this.options.event + '.tabs');
+ },
+
+ load: function(index) {
+ var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+ this.abort();
+
+ // not remote or from cache
+ if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+ this.element.dequeue("tabs");
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq(index).addClass('ui-state-processing');
+
+ if (o.spinner) {
+ var span = $('span', a);
+ span.data('label.tabs', span.html()).html(o.spinner);
+ }
+
+ this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+
+ // take care of tab labels
+ self._cleanup();
+
+ if (o.cache) {
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+ }
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (e) {}
+
+ // last, so that load event is fired before show...
+ self.element.dequeue("tabs");
+ }
+ }));
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue([]);
+ this.panels.stop(false, true);
+
+ // terminate pending requests from other tabs
+ if (this.xhr) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+
+ },
+
+ url: function(index, url) {
+ this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.7.2',
+ getter: 'length',
+ defaults: {
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disabled: [],
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ panelTemplate: '<div></div>',
+ spinner: '<em>Loading…</em>',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ }
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, o = this.options;
+
+ var rotate = self._rotate || (self._rotate = function(e) {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms);
+
+ if (e) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || (self._unrotate = !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ } :
+ function(e) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate);
+ this.anchors.bind(o.event + '.tabs', stop);
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.anchors.unbind(o.event + '.tabs', stop);
+ delete this._rotate;
+ delete this._unrotate;
+ }
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Datepicker 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.7.2" } });
+
+var PROP_NAME = 'datepicker';
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false // True if right-to-left language, false if left-to-right
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearRange: '-10:+10', // Range of years to display in drop-down,
+ // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'normal', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false // True to show button panel, false to not show it
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(target);
+ return false;
+ });
+ }
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst));
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param dateText string - the initial date to display (in the current format)
+ @param onSelect function - the function(dateText) to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" size="1" style="position: absolute; top: -100px;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ this._dialogInput.val(dateText);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
+ var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker(null);
+ }
+ var date = this._getDateDatepicker(target);
+ extendRemove(inst.settings, settings);
+ this._setDateDatepicker(target, date);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date
+ @param endDate Date - the new end date for a range (optional) */
+ _setDateDatepicker: function(target, date, endDate) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date, endDate);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @return Date - the current date or
+ Date[2] - the current dates for a range */
+ _getDateDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker(null, '');
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass +
+ ', td.' + $.datepicker._currentClass, inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ $.datepicker._hideDatepicker(null, '');
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ inst.rangeStart = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
+ $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4});
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim](duration, postProcess);
+ if (duration == '')
+ postProcess();
+ if (inst.input[0].type != 'hidden')
+ inst.input[0].focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var dims = {width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4};
+ var self = this;
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover').
+ css({width: dims.width, height: dims.height})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1) {
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ } else {
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ }
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
+ $(inst.input[0]).focus();
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
+ var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
+ offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj.nextSibling;
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker
+ @param duration string - the duration over which to close the date picker */
+ _hideDatepicker: function(input, duration) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (inst.stayOpen)
+ this._selectDate('#' + inst.id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ inst.stayOpen = false;
+ if (this._datepickerShowing) {
+ duration = (duration != null ? duration : this._get(inst, 'duration'));
+ var showAnim = this._get(inst, 'showAnim');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ };
+ if (duration != '' && $.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
+ duration, postProcess);
+ else
+ inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
+ if (duration == '')
+ this._tidyDialog(inst);
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ this._curInst = null;
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker(null, '');
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input[0].focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ if (inst.stayOpen) {
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ }
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ if (inst.stayOpen) {
+ inst.rangeStart = this._daylightSavingAdjust(
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst.stayOpen = false;
+ inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else if (!inst.stayOpen) {
+ this._hideDatepicker(null, this._get(inst, 'duration'));
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input[0].focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
+ var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
+ var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
+ firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
+ if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
+ checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
+ return $.datepicker.iso8601Week(checkDate);
+ } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
+ firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
+ if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
+ return 1;
+ }
+ }
+ return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
+ var size = origSize;
+ var num = 0;
+ while (size > 0 && iValue < value.length &&
+ value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
+ num = num * 10 + parseInt(value.charAt(iValue++),10);
+ size--;
+ }
+ if (size == origSize)
+ throw 'Missing number at position ' + iValue;
+ return num;
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ var size = 0;
+ for (var j = 0; j < names.length; j++)
+ size = Math.max(size, names[j].length);
+ var name = '';
+ var iInit = iValue;
+ while (size > 0 && iValue < value.length) {
+ name += value.charAt(iValue++);
+ for (var i = 0; i < names.length; i++)
+ if (name == names[i])
+ return i + 1;
+ size--;
+ }
+ throw 'Unknown name at position ' + iInit;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ var doy = date.getDate();
+ for (var m = date.getMonth() - 1; m >= 0; m--)
+ doy += this._getDaysInMonth(date.getFullYear(), m);
+ output += formatNumber('o', doy, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst) {
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.input ? inst.input.val() : null;
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ var date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ date = defaultDate;
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset, getDaysInMonth) {
+ var date = new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate :
+ (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, endDate) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._determineDate(date, new Date());
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var stepBigMonths = this._get(inst, 'stepBigMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var endDate = inst.endDay ? this._daylightSavingAdjust(
+ new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group ui-datepicker-group-';
+ switch (col) {
+ case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += 'middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = '';
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = '';
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = otherMonth || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
+ inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
+ (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ui-state-active' : '') + // highlight selected day
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, secondary, monthNames, monthNamesShort) {
+ minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var year = 0;
+ var endYear = 0;
+ if (years.length != 2) {
+ year = drawYear - 10;
+ endYear = drawYear + 10;
+ } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
+ year = drawYear + parseInt(years[0], 10);
+ endYear = drawYear + parseInt(years[1], 10);
+ } else {
+ year = parseInt(years[0], 10);
+ endYear = parseInt(years[1], 10);
+ }
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ if (showMonthAfterYear)
+ html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._daylightSavingAdjust(new Date(year, month, day));
+ // ensure it is within the bounds set
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
+ _getMinMaxDate: function(inst, minMax, checkRange) {
+ var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
+ return (!checkRange || !inst.rangeStart ? date :
+ (!date || inst.rangeStart > date ? inst.rangeStart : date));
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(
+ curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ // during range selection, use minimum of selected date and range start
+ var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
+ new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
+ newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
+ var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.7.2";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window.DP_jQuery = $;
+
+})(jQuery);
/* JavaScript for MediaWIki JS2 */
/**
Index: js/js2.combined.min.js
===================================================================
--- js/js2.combined.min.js (revision 56989)
+++ js/js2.combined.min.js (working copy)
@@ -429,7 +429,353 @@
top+=Math.max(docElem.scrollTop,body.scrollTop),left+=Math.max(docElem.scrollLeft,body.scrollLeft);return{top:top,left:left};};jQuery.offset={initialize:function(){if(this.initialized)return;var body=document.body,container=document.createElement('div'),innerDiv,checkDiv,table,td,rules,prop,bodyMarginTop=body.style.marginTop,html='<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';rules={position:'absolute',top:0,left:0,margin:0,border:0,width:'1px',height:'1px',visibility:'hidden'};for(prop in rules)container.style[prop]=rules[prop];container.innerHTML=html;body.insertBefore(container,body.firstChild);innerDiv=container.firstChild,checkDiv=innerDiv.firstChild,td=innerDiv.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(checkDiv.offsetTop!==5);this.doesAddBorderForTableAndCells=(td.offsetTop===5);innerDiv.style.overflow='hidden',innerDiv.style.position='relative';this.subtractsBorderForOverflowNotVisible=(checkDiv.offsetTop===-5);body.style.marginTop='1px';this.doesNotIncludeMarginInBodyOffset=(body.offsetTop===0);body.style.marginTop=bodyMarginTop;body.removeChild(container);this.initialized=true;},bodyOffset:function(body){jQuery.offset.initialized||jQuery.offset.initialize();var top=body.offsetTop,left=body.offsetLeft;if(jQuery.offset.doesNotIncludeMarginInBodyOffset)
top+=parseInt(jQuery.curCSS(body,'marginTop',true),10)||0,left+=parseInt(jQuery.curCSS(body,'marginLeft',true),10)||0;return{top:top,left:left};}};jQuery.fn.extend({position:function(){var left=0,top=0,results;if(this[0]){var offsetParent=this.offsetParent(),offset=this.offset(),parentOffset=/^body|html$/i.test(offsetParent[0].tagName)?{top:0,left:0}:offsetParent.offset();offset.top-=num(this,'marginTop');offset.left-=num(this,'marginLeft');parentOffset.top+=num(offsetParent,'borderTopWidth');parentOffset.left+=num(offsetParent,'borderLeftWidth');results={top:offset.top-parentOffset.top,left:offset.left-parentOffset.left};}
return results;},offsetParent:function(){var offsetParent=this[0].offsetParent||document.body;while(offsetParent&&(!/^body|html$/i.test(offsetParent.tagName)&&jQuery.css(offsetParent,'position')=='static'))
-offsetParent=offsetParent.offsetParent;return jQuery(offsetParent);}});jQuery.each(['Left','Top'],function(i,name){var method='scroll'+name;jQuery.fn[method]=function(val){if(!this[0])return null;return val!==undefined?this.each(function(){this==window||this==document?window.scrollTo(!i?val:jQuery(window).scrollLeft(),i?val:jQuery(window).scrollTop()):this[method]=val;}):this[0]==window||this[0]==document?self[i?'pageYOffset':'pageXOffset']||jQuery.boxModel&&document.documentElement[method]||document.body[method]:this[0][method];};});jQuery.each(["Height","Width"],function(i,name){var tl=i?"Left":"Top",br=i?"Right":"Bottom",lower=name.toLowerCase();jQuery.fn["inner"+name]=function(){return this[0]?jQuery.css(this[0],lower,false,"padding"):null;};jQuery.fn["outer"+name]=function(margin){return this[0]?jQuery.css(this[0],lower,false,margin?"margin":"border"):null;};var type=name.toLowerCase();jQuery.fn[type]=function(size){return this[0]==window?document.compatMode=="CSS1Compat"&&document.documentElement["client"+name]||document.body["client"+name]:this[0]==document?Math.max(document.documentElement["client"+name],document.body["scroll"+name],document.documentElement["scroll"+name],document.body["offset"+name],document.documentElement["offset"+name]):size===undefined?(this.length?jQuery.css(this[0],type):null):this.css(type,typeof size==="string"?size:size+"px");};});})();if(!gMsg)var gMsg={};function loadGM(msgSet){for(var i in msgSet){gMsg[i]=msgSet[i];}}
+offsetParent=offsetParent.offsetParent;return jQuery(offsetParent);}});jQuery.each(['Left','Top'],function(i,name){var method='scroll'+name;jQuery.fn[method]=function(val){if(!this[0])return null;return val!==undefined?this.each(function(){this==window||this==document?window.scrollTo(!i?val:jQuery(window).scrollLeft(),i?val:jQuery(window).scrollTop()):this[method]=val;}):this[0]==window||this[0]==document?self[i?'pageYOffset':'pageXOffset']||jQuery.boxModel&&document.documentElement[method]||document.body[method]:this[0][method];};});jQuery.each(["Height","Width"],function(i,name){var tl=i?"Left":"Top",br=i?"Right":"Bottom",lower=name.toLowerCase();jQuery.fn["inner"+name]=function(){return this[0]?jQuery.css(this[0],lower,false,"padding"):null;};jQuery.fn["outer"+name]=function(margin){return this[0]?jQuery.css(this[0],lower,false,margin?"margin":"border"):null;};var type=name.toLowerCase();jQuery.fn[type]=function(size){return this[0]==window?document.compatMode=="CSS1Compat"&&document.documentElement["client"+name]||document.body["client"+name]:this[0]==document?Math.max(document.documentElement["client"+name],document.body["scroll"+name],document.documentElement["scroll"+name],document.body["offset"+name],document.documentElement["offset"+name]):size===undefined?(this.length?jQuery.css(this[0],type):null):this.css(type,typeof size==="string"?size:size+"px");};});})();;jQuery.ui||(function($){var _remove=$.fn.remove,isFF2=$.browser.mozilla&&(parseFloat($.browser.version)<1.9);$.ui={version:"1.7.2",plugin:{add:function(module,option,set){var proto=$.ui[module].prototype;for(var i in set){proto.plugins[i]=proto.plugins[i]||[];proto.plugins[i].push([option,set[i]]);}},call:function(instance,name,args){var set=instance.plugins[name];if(!set||!instance.element[0].parentNode){return;}
+for(var i=0;i<set.length;i++){if(instance.options[set[i][0]]){set[i][1].apply(instance.element,args);}}}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b);},hasScroll:function(el,a){if($(el).css('overflow')=='hidden'){return false;}
+var scroll=(a&&a=='left')?'scrollLeft':'scrollTop',has=false;if(el[scroll]>0){return true;}
+el[scroll]=1;has=(el[scroll]>0);el[scroll]=0;return has;},isOverAxis:function(x,reference,size){return(x>reference)&&(x<(reference+size));},isOver:function(y,x,top,left,height,width){return $.ui.isOverAxis(y,top,height)&&$.ui.isOverAxis(x,left,width);},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(isFF2){var attr=$.attr,removeAttr=$.fn.removeAttr,ariaNS="http://www.w3.org/2005/07/aaa",ariaState=/^aria-/,ariaRole=/^wairole:/;$.attr=function(elem,name,value){var set=value!==undefined;return(name=='role'?(set?attr.call(this,elem,name,"wairole:"+value):(attr.apply(this,arguments)||"").replace(ariaRole,"")):(ariaState.test(name)?(set?elem.setAttributeNS(ariaNS,name.replace(ariaState,"aaa:"),value):attr.call(this,elem,name.replace(ariaState,"aaa:"))):attr.apply(this,arguments)));};$.fn.removeAttr=function(name){return(ariaState.test(name)?this.each(function(){this.removeAttributeNS(ariaNS,name.replace(ariaState,""));}):removeAttr.call(this,name));};}
+$.fn.extend({remove:function(){$("*",this).add(this).each(function(){$(this).triggerHandler("remove");});return _remove.apply(this,arguments);},enableSelection:function(){return this.attr('unselectable','off').css('MozUserSelect','').unbind('selectstart.ui');},disableSelection:function(){return this.attr('unselectable','on').css('MozUserSelect','none').bind('selectstart.ui',function(){return false;});},scrollParent:function(){var scrollParent;if(($.browser.msie&&(/(static|relative)/).test(this.css('position')))||(/absolute/).test(this.css('position'))){scrollParent=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test($.curCSS(this,'position',1))&&(/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));}).eq(0);}else{scrollParent=this.parents().filter(function(){return(/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));}).eq(0);}
+return(/fixed/).test(this.css('position'))||!scrollParent.length?$(document):scrollParent;}});$.extend($.expr[':'],{data:function(elem,i,match){return!!$.data(elem,match[3]);},focusable:function(element){var nodeName=element.nodeName.toLowerCase(),tabIndex=$.attr(element,'tabindex');return(/input|select|textarea|button|object/.test(nodeName)?!element.disabled:'a'==nodeName||'area'==nodeName?element.href||!isNaN(tabIndex):!isNaN(tabIndex))&&!$(element)['area'==nodeName?'parents':'closest'](':hidden').length;},tabbable:function(element){var tabIndex=$.attr(element,'tabindex');return(isNaN(tabIndex)||tabIndex>=0)&&$(element).is(':focusable');}});function getter(namespace,plugin,method,args){function getMethods(type){var methods=$[namespace][plugin][type]||[];return(typeof methods=='string'?methods.split(/,?\s+/):methods);}
+var methods=getMethods('getter');if(args.length==1&&typeof args[0]=='string'){methods=methods.concat(getMethods('getterSetter'));}
+return($.inArray(method,methods)!=-1);}
+$.widget=function(name,prototype){var namespace=name.split(".")[0];name=name.split(".")[1];$.fn[name]=function(options){var isMethodCall=(typeof options=='string'),args=Array.prototype.slice.call(arguments,1);if(isMethodCall&&options.substring(0,1)=='_'){return this;}
+if(isMethodCall&&getter(namespace,name,options,args)){var instance=$.data(this[0],name);return(instance?instance[options].apply(instance,args):undefined);}
+return this.each(function(){var instance=$.data(this,name);(!instance&&!isMethodCall&&$.data(this,name,new $[namespace][name](this,options))._init());(instance&&isMethodCall&&$.isFunction(instance[options])&&instance[options].apply(instance,args));});};$[namespace]=$[namespace]||{};$[namespace][name]=function(element,options){var self=this;this.namespace=namespace;this.widgetName=name;this.widgetEventPrefix=$[namespace][name].eventPrefix||name;this.widgetBaseClass=namespace+'-'+name;this.options=$.extend({},$.widget.defaults,$[namespace][name].defaults,$.metadata&&$.metadata.get(element)[name],options);this.element=$(element).bind('setData.'+name,function(event,key,value){if(event.target==element){return self._setData(key,value);}}).bind('getData.'+name,function(event,key){if(event.target==element){return self._getData(key);}}).bind('remove',function(){return self.destroy();});};$[namespace][name].prototype=$.extend({},$.widget.prototype,prototype);$[namespace][name].getterSetter='option';};$.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+'-disabled'+' '+this.namespace+'-state-disabled').removeAttr('aria-disabled');},option:function(key,value){var options=key,self=this;if(typeof key=="string"){if(value===undefined){return this._getData(key);}
+options={};options[key]=value;}
+$.each(options,function(key,value){self._setData(key,value);});},_getData:function(key){return this.options[key];},_setData:function(key,value){this.options[key]=value;if(key=='disabled'){this.element
+[value?'addClass':'removeClass'](this.widgetBaseClass+'-disabled'+' '+
+this.namespace+'-state-disabled').attr("aria-disabled",value);}},enable:function(){this._setData('disabled',false);},disable:function(){this._setData('disabled',true);},_trigger:function(type,event,data){var callback=this.options[type],eventName=(type==this.widgetEventPrefix?type:this.widgetEventPrefix+type);event=$.Event(event);event.type=eventName;if(event.originalEvent){for(var i=$.event.props.length,prop;i;){prop=$.event.props[--i];event[prop]=event.originalEvent[prop];}}
+this.element.trigger(event,data);return!($.isFunction(callback)&&callback.call(this.element[0],event,data)===false||event.isDefaultPrevented());}};$.widget.defaults={disabled:false};$.ui.mouse={_mouseInit:function(){var self=this;this.element.bind('mousedown.'+this.widgetName,function(event){return self._mouseDown(event);}).bind('click.'+this.widgetName,function(event){if(self._preventClickEvent){self._preventClickEvent=false;event.stopImmediatePropagation();return false;}});if($.browser.msie){this._mouseUnselectable=this.element.attr('unselectable');this.element.attr('unselectable','on');}
+this.started=false;},_mouseDestroy:function(){this.element.unbind('.'+this.widgetName);($.browser.msie&&this.element.attr('unselectable',this._mouseUnselectable));},_mouseDown:function(event){event.originalEvent=event.originalEvent||{};if(event.originalEvent.mouseHandled){return;}
+(this._mouseStarted&&this._mouseUp(event));this._mouseDownEvent=event;var self=this,btnIsLeft=(event.which==1),elIsCancel=(typeof this.options.cancel=="string"?$(event.target).parents().add(event.target).filter(this.options.cancel).length:false);if(!btnIsLeft||elIsCancel||!this._mouseCapture(event)){return true;}
+this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){self.mouseDelayMet=true;},this.options.delay);}
+if(this._mouseDistanceMet(event)&&this._mouseDelayMet(event)){this._mouseStarted=(this._mouseStart(event)!==false);if(!this._mouseStarted){event.preventDefault();return true;}}
+this._mouseMoveDelegate=function(event){return self._mouseMove(event);};this._mouseUpDelegate=function(event){return self._mouseUp(event);};$(document).bind('mousemove.'+this.widgetName,this._mouseMoveDelegate).bind('mouseup.'+this.widgetName,this._mouseUpDelegate);($.browser.safari||event.preventDefault());event.originalEvent.mouseHandled=true;return true;},_mouseMove:function(event){if($.browser.msie&&!event.button){return this._mouseUp(event);}
+if(this._mouseStarted){this._mouseDrag(event);return event.preventDefault();}
+if(this._mouseDistanceMet(event)&&this._mouseDelayMet(event)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,event)!==false);(this._mouseStarted?this._mouseDrag(event):this._mouseUp(event));}
+return!this._mouseStarted;},_mouseUp:function(event){$(document).unbind('mousemove.'+this.widgetName,this._mouseMoveDelegate).unbind('mouseup.'+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=(event.target==this._mouseDownEvent.target);this._mouseStop(event);}
+return false;},_mouseDistanceMet:function(event){return(Math.max(Math.abs(this._mouseDownEvent.pageX-event.pageX),Math.abs(this._mouseDownEvent.pageY-event.pageY))>=this.options.distance);},_mouseDelayMet:function(event){return this.mouseDelayMet;},_mouseStart:function(event){},_mouseDrag:function(event){},_mouseStop:function(event){},_mouseCapture:function(event){return true;}};$.ui.mouse.defaults={cancel:null,distance:1,delay:0};})(jQuery);(function($){$.widget("ui.draggable",$.extend({},$.ui.mouse,{_init:function(){if(this.options.helper=='original'&&!(/^(?:r|a|f)/).test(this.element.css("position")))
+this.element[0].style.position='relative';(this.options.addClasses&&this.element.addClass("ui-draggable"));(this.options.disabled&&this.element.addClass("ui-draggable-disabled"));this._mouseInit();},destroy:function(){if(!this.element.data('draggable'))return;this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable"
++" ui-draggable-dragging"
++" ui-draggable-disabled");this._mouseDestroy();},_mouseCapture:function(event){var o=this.options;if(this.helper||o.disabled||$(event.target).is('.ui-resizable-handle'))
+return false;this.handle=this._getHandle(event);if(!this.handle)
+return false;return true;},_mouseStart:function(event){var o=this.options;this.helper=this._createHelper(event);this._cacheHelperProportions();if($.ui.ddmanager)
+$.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};$.extend(this.offset,{click:{left:event.pageX-this.offset.left,top:event.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(event);this.originalPageX=event.pageX;this.originalPageY=event.pageY;if(o.cursorAt)
+this._adjustOffsetFromHelper(o.cursorAt);if(o.containment)
+this._setContainment();this._trigger("start",event);this._cacheHelperProportions();if($.ui.ddmanager&&!o.dropBehaviour)
+$.ui.ddmanager.prepareOffsets(this,event);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(event,true);return true;},_mouseDrag:function(event,noPropagation){this.position=this._generatePosition(event);this.positionAbs=this._convertPositionTo("absolute");if(!noPropagation){var ui=this._uiHash();this._trigger('drag',event,ui);this.position=ui.position;}
+if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+'px';if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+'px';if($.ui.ddmanager)$.ui.ddmanager.drag(this,event);return false;},_mouseStop:function(event){var dropped=false;if($.ui.ddmanager&&!this.options.dropBehaviour)
+dropped=$.ui.ddmanager.drop(this,event);if(this.dropped){dropped=this.dropped;this.dropped=false;}
+if((this.options.revert=="invalid"&&!dropped)||(this.options.revert=="valid"&&dropped)||this.options.revert===true||($.isFunction(this.options.revert)&&this.options.revert.call(this.element,dropped))){var self=this;$(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){self._trigger("stop",event);self._clear();});}else{this._trigger("stop",event);this._clear();}
+return false;},_getHandle:function(event){var handle=!this.options.handle||!$(this.options.handle,this.element).length?true:false;$(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==event.target)handle=true;});return handle;},_createHelper:function(event){var o=this.options;var helper=$.isFunction(o.helper)?$(o.helper.apply(this.element[0],[event])):(o.helper=='clone'?this.element.clone():this.element);if(!helper.parents('body').length)
+helper.appendTo((o.appendTo=='parent'?this.element[0].parentNode:o.appendTo));if(helper[0]!=this.element[0]&&!(/(fixed|absolute)/).test(helper.css("position")))
+helper.css("position","absolute");return helper;},_adjustOffsetFromHelper:function(obj){if(obj.left!=undefined)this.offset.click.left=obj.left+this.margins.left;if(obj.right!=undefined)this.offset.click.left=this.helperProportions.width-obj.right+this.margins.left;if(obj.top!=undefined)this.offset.click.top=obj.top+this.margins.top;if(obj.bottom!=undefined)this.offset.click.top=this.helperProportions.height-obj.bottom+this.margins.top;},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var po=this.offsetParent.offset();if(this.cssPosition=='absolute'&&this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0])){po.left+=this.scrollParent.scrollLeft();po.top+=this.scrollParent.scrollTop();}
+if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=='html'&&$.browser.msie))
+po={top:0,left:0};return{top:po.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:po.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)};},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var p=this.element.position();return{top:p.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:p.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()};}else{return{top:0,left:0};}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)};},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()};},_setContainment:function(){var o=this.options;if(o.containment=='parent')o.containment=this.helper[0].parentNode;if(o.containment=='document'||o.containment=='window')this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,$(o.containment=='document'?document:window).width()-this.helperProportions.width-this.margins.left,($(o.containment=='document'?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!(/^(document|window|parent)$/).test(o.containment)&&o.containment.constructor!=Array){var ce=$(o.containment)[0];if(!ce)return;var co=$(o.containment).offset();var over=($(ce).css("overflow")!='hidden');this.containment=[co.left+(parseInt($(ce).css("borderLeftWidth"),10)||0)+(parseInt($(ce).css("paddingLeft"),10)||0)-this.margins.left,co.top+(parseInt($(ce).css("borderTopWidth"),10)||0)+(parseInt($(ce).css("paddingTop"),10)||0)-this.margins.top,co.left+(over?Math.max(ce.scrollWidth,ce.offsetWidth):ce.offsetWidth)-(parseInt($(ce).css("borderLeftWidth"),10)||0)-(parseInt($(ce).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,co.top+(over?Math.max(ce.scrollHeight,ce.offsetHeight):ce.offsetHeight)-(parseInt($(ce).css("borderTopWidth"),10)||0)-(parseInt($(ce).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top];}else if(o.containment.constructor==Array){this.containment=o.containment;}},_convertPositionTo:function(d,pos){if(!pos)pos=this.position;var mod=d=="absolute"?1:-1;var o=this.options,scroll=this.cssPosition=='absolute'&&!(this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,scrollIsRootNode=(/(html|body)/i).test(scroll[0].tagName);return{top:(pos.top
++this.offset.relative.top*mod
++this.offset.parent.top*mod
+-($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollTop():(scrollIsRootNode?0:scroll.scrollTop()))*mod)),left:(pos.left
++this.offset.relative.left*mod
++this.offset.parent.left*mod
+-($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollLeft():scrollIsRootNode?0:scroll.scrollLeft())*mod))};},_generatePosition:function(event){var o=this.options,scroll=this.cssPosition=='absolute'&&!(this.scrollParent[0]!=document&&$.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,scrollIsRootNode=(/(html|body)/i).test(scroll[0].tagName);if(this.cssPosition=='relative'&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset();}
+var pageX=event.pageX;var pageY=event.pageY;if(this.originalPosition){if(this.containment){if(event.pageX-this.offset.click.left<this.containment[0])pageX=this.containment[0]+this.offset.click.left;if(event.pageY-this.offset.click.top<this.containment[1])pageY=this.containment[1]+this.offset.click.top;if(event.pageX-this.offset.click.left>this.containment[2])pageX=this.containment[2]+this.offset.click.left;if(event.pageY-this.offset.click.top>this.containment[3])pageY=this.containment[3]+this.offset.click.top;}
+if(o.grid){var top=this.originalPageY+Math.round((pageY-this.originalPageY)/o.grid[1])*o.grid[1];pageY=this.containment?(!(top-this.offset.click.top<this.containment[1]||top-this.offset.click.top>this.containment[3])?top:(!(top-this.offset.click.top<this.containment[1])?top-o.grid[1]:top+o.grid[1])):top;var left=this.originalPageX+Math.round((pageX-this.originalPageX)/o.grid[0])*o.grid[0];pageX=this.containment?(!(left-this.offset.click.left<this.containment[0]||left-this.offset.click.left>this.containment[2])?left:(!(left-this.offset.click.left<this.containment[0])?left-o.grid[0]:left+o.grid[0])):left;}}
+return{top:(pageY
+-this.offset.click.top
+-this.offset.relative.top
+-this.offset.parent.top
++($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollTop():(scrollIsRootNode?0:scroll.scrollTop())))),left:(pageX
+-this.offset.click.left
+-this.offset.relative.left
+-this.offset.parent.left
++($.browser.safari&&this.cssPosition=='fixed'?0:(this.cssPosition=='fixed'?-this.scrollParent.scrollLeft():scrollIsRootNode?0:scroll.scrollLeft())))};},_clear:function(){this.helper.removeClass("ui-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval)this.helper.remove();this.helper=null;this.cancelHelperRemoval=false;},_trigger:function(type,event,ui){ui=ui||this._uiHash();$.ui.plugin.call(this,type,[event,ui]);if(type=="drag")this.positionAbs=this._convertPositionTo("absolute");return $.widget.prototype._trigger.call(this,type,event,ui);},plugins:{},_uiHash:function(event){return{helper:this.helper,position:this.position,absolutePosition:this.positionAbs,offset:this.positionAbs};}}));$.extend($.ui.draggable,{version:"1.7.2",eventPrefix:"drag",defaults:{addClasses:true,appendTo:"parent",axis:false,cancel:":input,option",connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,delay:0,distance:1,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false}});$.ui.plugin.add("draggable","connectToSortable",{start:function(event,ui){var inst=$(this).data("draggable"),o=inst.options,uiSortable=$.extend({},ui,{item:inst.element});inst.sortables=[];$(o.connectToSortable).each(function(){var sortable=$.data(this,'sortable');if(sortable&&!sortable.options.disabled){inst.sortables.push({instance:sortable,shouldRevert:sortable.options.revert});sortable._refreshItems();sortable._trigger("activate",event,uiSortable);}});},stop:function(event,ui){var inst=$(this).data("draggable"),uiSortable=$.extend({},ui,{item:inst.element});$.each(inst.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;inst.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(event);this.instance.options.helper=this.instance.options._helper;if(inst.options.helper=='original')
+this.instance.currentItem.css({top:'auto',left:'auto'});}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",event,uiSortable);}});},drag:function(event,ui){var inst=$(this).data("draggable"),self=this;var checkPos=function(o){var dyClick=this.offset.click.top,dxClick=this.offset.click.left;var helperTop=this.positionAbs.top,helperLeft=this.positionAbs.left;var itemHeight=o.height,itemWidth=o.width;var itemTop=o.top,itemLeft=o.left;return $.ui.isOver(helperTop+dyClick,helperLeft+dxClick,itemTop,itemLeft,itemHeight,itemWidth);};$.each(inst.sortables,function(i){this.instance.positionAbs=inst.positionAbs;this.instance.helperProportions=inst.helperProportions;this.instance.offset.click=inst.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=$(self).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return ui.helper[0];};event.target=this.instance.currentItem[0];this.instance._mouseCapture(event,true);this.instance._mouseStart(event,true,true);this.instance.offset.click.top=inst.offset.click.top;this.instance.offset.click.left=inst.offset.click.left;this.instance.offset.parent.left-=inst.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=inst.offset.parent.top-this.instance.offset.parent.top;inst._trigger("toSortable",event);inst.dropped=this.instance.element;inst.currentItem=inst.element;this.instance.fromOutside=inst;}
+if(this.instance.currentItem)this.instance._mouseDrag(event);}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger('out',event,this.instance._uiHash(this.instance));this.instance._mouseStop(event,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder)this.instance.placeholder.remove();inst._trigger("fromSortable",event);inst.dropped=false;}};});}});$.ui.plugin.add("draggable","cursor",{start:function(event,ui){var t=$('body'),o=$(this).data('draggable').options;if(t.css("cursor"))o._cursor=t.css("cursor");t.css("cursor",o.cursor);},stop:function(event,ui){var o=$(this).data('draggable').options;if(o._cursor)$('body').css("cursor",o._cursor);}});$.ui.plugin.add("draggable","iframeFix",{start:function(event,ui){var o=$(this).data('draggable').options;$(o.iframeFix===true?"iframe":o.iframeFix).each(function(){$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css($(this).offset()).appendTo("body");});},stop:function(event,ui){$("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this);});}});$.ui.plugin.add("draggable","opacity",{start:function(event,ui){var t=$(ui.helper),o=$(this).data('draggable').options;if(t.css("opacity"))o._opacity=t.css("opacity");t.css('opacity',o.opacity);},stop:function(event,ui){var o=$(this).data('draggable').options;if(o._opacity)$(ui.helper).css('opacity',o._opacity);}});$.ui.plugin.add("draggable","scroll",{start:function(event,ui){var i=$(this).data("draggable");if(i.scrollParent[0]!=document&&i.scrollParent[0].tagName!='HTML')i.overflowOffset=i.scrollParent.offset();},drag:function(event,ui){var i=$(this).data("draggable"),o=i.options,scrolled=false;if(i.scrollParent[0]!=document&&i.scrollParent[0].tagName!='HTML'){if(!o.axis||o.axis!='x'){if((i.overflowOffset.top+i.scrollParent[0].offsetHeight)-event.pageY<o.scrollSensitivity)
+i.scrollParent[0].scrollTop=scrolled=i.scrollParent[0].scrollTop+o.scrollSpeed;else if(event.pageY-i.overflowOffset.top<o.scrollSensitivity)
+i.scrollParent[0].scrollTop=scrolled=i.scrollParent[0].scrollTop-o.scrollSpeed;}
+if(!o.axis||o.axis!='y'){if((i.overflowOffset.left+i.scrollParent[0].offsetWidth)-event.pageX<o.scrollSensitivity)
+i.scrollParent[0].scrollLeft=scrolled=i.scrollParent[0].scrollLeft+o.scrollSpeed;else if(event.pageX-i.overflowOffset.left<o.scrollSensitivity)
+i.scrollParent[0].scrollLeft=scrolled=i.scrollParent[0].scrollLeft-o.scrollSpeed;}}else{if(!o.axis||o.axis!='x'){if(event.pageY-$(document).scrollTop()<o.scrollSensitivity)
+scrolled=$(document).scrollTop($(document).scrollTop()-o.scrollSpeed);else if($(window).height()-(event.pageY-$(document).scrollTop())<o.scrollSensitivity)
+scrolled=$(document).scrollTop($(document).scrollTop()+o.scrollSpeed);}
+if(!o.axis||o.axis!='y'){if(event.pageX-$(document).scrollLeft()<o.scrollSensitivity)
+scrolled=$(document).scrollLeft($(document).scrollLeft()-o.scrollSpeed);else if($(window).width()-(event.pageX-$(document).scrollLeft())<o.scrollSensitivity)
+scrolled=$(document).scrollLeft($(document).scrollLeft()+o.scrollSpeed);}}
+if(scrolled!==false&&$.ui.ddmanager&&!o.dropBehaviour)
+$.ui.ddmanager.prepareOffsets(i,event);}});$.ui.plugin.add("draggable","snap",{start:function(event,ui){var i=$(this).data("draggable"),o=i.options;i.snapElements=[];$(o.snap.constructor!=String?(o.snap.items||':data(draggable)'):o.snap).each(function(){var $t=$(this);var $o=$t.offset();if(this!=i.element[0])i.snapElements.push({item:this,width:$t.outerWidth(),height:$t.outerHeight(),top:$o.top,left:$o.left});});},drag:function(event,ui){var inst=$(this).data("draggable"),o=inst.options;var d=o.snapTolerance;var x1=ui.offset.left,x2=x1+inst.helperProportions.width,y1=ui.offset.top,y2=y1+inst.helperProportions.height;for(var i=inst.snapElements.length-1;i>=0;i--){var l=inst.snapElements[i].left,r=l+inst.snapElements[i].width,t=inst.snapElements[i].top,b=t+inst.snapElements[i].height;if(!((l-d<x1&&x1<r+d&&t-d<y1&&y1<b+d)||(l-d<x1&&x1<r+d&&t-d<y2&&y2<b+d)||(l-d<x2&&x2<r+d&&t-d<y1&&y1<b+d)||(l-d<x2&&x2<r+d&&t-d<y2&&y2<b+d))){if(inst.snapElements[i].snapping)(inst.options.snap.release&&inst.options.snap.release.call(inst.element,event,$.extend(inst._uiHash(),{snapItem:inst.snapElements[i].item})));inst.snapElements[i].snapping=false;continue;}
+if(o.snapMode!='inner'){var ts=Math.abs(t-y2)<=d;var bs=Math.abs(b-y1)<=d;var ls=Math.abs(l-x2)<=d;var rs=Math.abs(r-x1)<=d;if(ts)ui.position.top=inst._convertPositionTo("relative",{top:t-inst.helperProportions.height,left:0}).top-inst.margins.top;if(bs)ui.position.top=inst._convertPositionTo("relative",{top:b,left:0}).top-inst.margins.top;if(ls)ui.position.left=inst._convertPositionTo("relative",{top:0,left:l-inst.helperProportions.width}).left-inst.margins.left;if(rs)ui.position.left=inst._convertPositionTo("relative",{top:0,left:r}).left-inst.margins.left;}
+var first=(ts||bs||ls||rs);if(o.snapMode!='outer'){var ts=Math.abs(t-y1)<=d;var bs=Math.abs(b-y2)<=d;var ls=Math.abs(l-x1)<=d;var rs=Math.abs(r-x2)<=d;if(ts)ui.position.top=inst._convertPositionTo("relative",{top:t,left:0}).top-inst.margins.top;if(bs)ui.position.top=inst._convertPositionTo("relative",{top:b-inst.helperProportions.height,left:0}).top-inst.margins.top;if(ls)ui.position.left=inst._convertPositionTo("relative",{top:0,left:l}).left-inst.margins.left;if(rs)ui.position.left=inst._convertPositionTo("relative",{top:0,left:r-inst.helperProportions.width}).left-inst.margins.left;}
+if(!inst.snapElements[i].snapping&&(ts||bs||ls||rs||first))
+(inst.options.snap.snap&&inst.options.snap.snap.call(inst.element,event,$.extend(inst._uiHash(),{snapItem:inst.snapElements[i].item})));inst.snapElements[i].snapping=(ts||bs||ls||rs||first);};}});$.ui.plugin.add("draggable","stack",{start:function(event,ui){var o=$(this).data("draggable").options;var group=$.makeArray($(o.stack.group)).sort(function(a,b){return(parseInt($(a).css("zIndex"),10)||o.stack.min)-(parseInt($(b).css("zIndex"),10)||o.stack.min);});$(group).each(function(i){this.style.zIndex=o.stack.min+i;});this[0].style.zIndex=o.stack.min+group.length;}});$.ui.plugin.add("draggable","zIndex",{start:function(event,ui){var t=$(ui.helper),o=$(this).data("draggable").options;if(t.css("zIndex"))o._zIndex=t.css("zIndex");t.css('zIndex',o.zIndex);},stop:function(event,ui){var o=$(this).data("draggable").options;if(o._zIndex)$(ui.helper).css('zIndex',o._zIndex);}});})(jQuery);(function($){$.widget("ui.resizable",$.extend({},$.ui.mouse,{_init:function(){var self=this,o=this.options;this.element.addClass("ui-resizable");$.extend(this,{_aspectRatio:!!(o.aspectRatio),aspectRatio:o.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:o.helper||o.ghost||o.animate?o.helper||'ui-resizable-helper':null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css('position'))&&$.browser.opera)
+this.element.css({position:'relative',top:'auto',left:'auto'});this.element.wrap($('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css('position'),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css('top'),left:this.element.css('left')}));this.element=this.element.parent().data("resizable",this.element.data('resizable'));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css('resize');this.originalElement.css('resize','none');this._proportionallyResizeElements.push(this.originalElement.css({position:'static',zoom:1,display:'block'}));this.originalElement.css({margin:this.originalElement.css('margin')});this._proportionallyResize();}
+this.handles=o.handles||(!$('.ui-resizable-handle',this.element).length?"e,s,se":{n:'.ui-resizable-n',e:'.ui-resizable-e',s:'.ui-resizable-s',w:'.ui-resizable-w',se:'.ui-resizable-se',sw:'.ui-resizable-sw',ne:'.ui-resizable-ne',nw:'.ui-resizable-nw'});if(this.handles.constructor==String){if(this.handles=='all')this.handles='n,e,s,w,se,sw,ne,nw';var n=this.handles.split(",");this.handles={};for(var i=0;i<n.length;i++){var handle=$.trim(n[i]),hname='ui-resizable-'+handle;var axis=$('<div class="ui-resizable-handle '+hname+'"></div>');if(/sw|se|ne|nw/.test(handle))axis.css({zIndex:++o.zIndex});if('se'==handle){axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');};this.handles[handle]='.ui-resizable-'+handle;this.element.append(axis);}}
+this._renderAxis=function(target){target=target||this.element;for(var i in this.handles){if(this.handles[i].constructor==String)
+this.handles[i]=$(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var axis=$(this.handles[i],this.element),padWrapper=0;padWrapper=/sw|ne|nw|se|n|s/.test(i)?axis.outerHeight():axis.outerWidth();var padPos=['padding',/ne|nw|n/.test(i)?'Top':/se|sw|s/.test(i)?'Bottom':/^e$/.test(i)?'Right':'Left'].join("");target.css(padPos,padWrapper);this._proportionallyResize();}
+if(!$(this.handles[i]).length)
+continue;}};this._renderAxis(this.element);this._handles=$('.ui-resizable-handle',this.element).disableSelection();this._handles.mouseover(function(){if(!self.resizing){if(this.className)
+var axis=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);self.axis=axis&&axis[1]?axis[1]:'se';}});if(o.autoHide){this._handles.hide();$(this.element).addClass("ui-resizable-autohide").hover(function(){$(this).removeClass("ui-resizable-autohide");self._handles.show();},function(){if(!self.resizing){$(this).addClass("ui-resizable-autohide");self._handles.hide();}});}
+this._mouseInit();},destroy:function(){this._mouseDestroy();var _destroy=function(exp){$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();};if(this.elementIsWrapper){_destroy(this.element);var wrapper=this.element;wrapper.parent().append(this.originalElement.css({position:wrapper.css('position'),width:wrapper.outerWidth(),height:wrapper.outerHeight(),top:wrapper.css('top'),left:wrapper.css('left')})).end().remove();}
+this.originalElement.css('resize',this.originalResizeStyle);_destroy(this.originalElement);},_mouseCapture:function(event){var handle=false;for(var i in this.handles){if($(this.handles[i])[0]==event.target)handle=true;}
+return this.options.disabled||!!handle;},_mouseStart:function(event){var o=this.options,iniPos=this.element.position(),el=this.element;this.resizing=true;this.documentScroll={top:$(document).scrollTop(),left:$(document).scrollLeft()};if(el.is('.ui-draggable')||(/absolute/).test(el.css('position'))){el.css({position:'absolute',top:iniPos.top,left:iniPos.left});}
+if($.browser.opera&&(/relative/).test(el.css('position')))
+el.css({position:'relative',top:'auto',left:'auto'});this._renderProxy();var curleft=num(this.helper.css('left')),curtop=num(this.helper.css('top'));if(o.containment){curleft+=$(o.containment).scrollLeft()||0;curtop+=$(o.containment).scrollTop()||0;}
+this.offset=this.helper.offset();this.position={left:curleft,top:curtop};this.size=this._helper?{width:el.outerWidth(),height:el.outerHeight()}:{width:el.width(),height:el.height()};this.originalSize=this._helper?{width:el.outerWidth(),height:el.outerHeight()}:{width:el.width(),height:el.height()};this.originalPosition={left:curleft,top:curtop};this.sizeDiff={width:el.outerWidth()-el.width(),height:el.outerHeight()-el.height()};this.originalMousePosition={left:event.pageX,top:event.pageY};this.aspectRatio=(typeof o.aspectRatio=='number')?o.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var cursor=$('.ui-resizable-'+this.axis).css('cursor');$('body').css('cursor',cursor=='auto'?this.axis+'-resize':cursor);el.addClass("ui-resizable-resizing");this._propagate("start",event);return true;},_mouseDrag:function(event){var el=this.helper,o=this.options,props={},self=this,smp=this.originalMousePosition,a=this.axis;var dx=(event.pageX-smp.left)||0,dy=(event.pageY-smp.top)||0;var trigger=this._change[a];if(!trigger)return false;var data=trigger.apply(this,[event,dx,dy]),ie6=$.browser.msie&&$.browser.version<7,csdif=this.sizeDiff;if(this._aspectRatio||event.shiftKey)
+data=this._updateRatio(data,event);data=this._respectSize(data,event);this._propagate("resize",event);el.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length)
+this._proportionallyResize();this._updateCache(data);this._trigger('resize',event,this.ui());return false;},_mouseStop:function(event){this.resizing=false;var o=this.options,self=this;if(this._helper){var pr=this._proportionallyResizeElements,ista=pr.length&&(/textarea/i).test(pr[0].nodeName),soffseth=ista&&$.ui.hasScroll(pr[0],'left')?0:self.sizeDiff.height,soffsetw=ista?0:self.sizeDiff.width;var s={width:(self.size.width-soffsetw),height:(self.size.height-soffseth)},left=(parseInt(self.element.css('left'),10)+(self.position.left-self.originalPosition.left))||null,top=(parseInt(self.element.css('top'),10)+(self.position.top-self.originalPosition.top))||null;if(!o.animate)
+this.element.css($.extend(s,{top:top,left:left}));self.helper.height(self.size.height);self.helper.width(self.size.width);if(this._helper&&!o.animate)this._proportionallyResize();}
+$('body').css('cursor','auto');this.element.removeClass("ui-resizable-resizing");this._propagate("stop",event);if(this._helper)this.helper.remove();return false;},_updateCache:function(data){var o=this.options;this.offset=this.helper.offset();if(isNumber(data.left))this.position.left=data.left;if(isNumber(data.top))this.position.top=data.top;if(isNumber(data.height))this.size.height=data.height;if(isNumber(data.width))this.size.width=data.width;},_updateRatio:function(data,event){var o=this.options,cpos=this.position,csize=this.size,a=this.axis;if(data.height)data.width=(csize.height*this.aspectRatio);else if(data.width)data.height=(csize.width/this.aspectRatio);if(a=='sw'){data.left=cpos.left+(csize.width-data.width);data.top=null;}
+if(a=='nw'){data.top=cpos.top+(csize.height-data.height);data.left=cpos.left+(csize.width-data.width);}
+return data;},_respectSize:function(data,event){var el=this.helper,o=this.options,pRatio=this._aspectRatio||event.shiftKey,a=this.axis,ismaxw=isNumber(data.width)&&o.maxWidth&&(o.maxWidth<data.width),ismaxh=isNumber(data.height)&&o.maxHeight&&(o.maxHeight<data.height),isminw=isNumber(data.width)&&o.minWidth&&(o.minWidth>data.width),isminh=isNumber(data.height)&&o.minHeight&&(o.minHeight>data.height);if(isminw)data.width=o.minWidth;if(isminh)data.height=o.minHeight;if(ismaxw)data.width=o.maxWidth;if(ismaxh)data.height=o.maxHeight;var dw=this.originalPosition.left+this.originalSize.width,dh=this.position.top+this.size.height;var cw=/sw|nw|w/.test(a),ch=/nw|ne|n/.test(a);if(isminw&&cw)data.left=dw-o.minWidth;if(ismaxw&&cw)data.left=dw-o.maxWidth;if(isminh&&ch)data.top=dh-o.minHeight;if(ismaxh&&ch)data.top=dh-o.maxHeight;var isNotwh=!data.width&&!data.height;if(isNotwh&&!data.left&&data.top)data.top=null;else if(isNotwh&&!data.top&&data.left)data.left=null;return data;},_proportionallyResize:function(){var o=this.options;if(!this._proportionallyResizeElements.length)return;var element=this.helper||this.element;for(var i=0;i<this._proportionallyResizeElements.length;i++){var prel=this._proportionallyResizeElements[i];if(!this.borderDif){var b=[prel.css('borderTopWidth'),prel.css('borderRightWidth'),prel.css('borderBottomWidth'),prel.css('borderLeftWidth')],p=[prel.css('paddingTop'),prel.css('paddingRight'),prel.css('paddingBottom'),prel.css('paddingLeft')];this.borderDif=$.map(b,function(v,i){var border=parseInt(v,10)||0,padding=parseInt(p[i],10)||0;return border+padding;});}
+if($.browser.msie&&!(!($(element).is(':hidden')||$(element).parents(':hidden').length)))
+continue;prel.css({height:(element.height()-this.borderDif[0]-this.borderDif[2])||0,width:(element.width()-this.borderDif[1]-this.borderDif[3])||0});};},_renderProxy:function(){var el=this.element,o=this.options;this.elementOffset=el.offset();if(this._helper){this.helper=this.helper||$('<div style="overflow:hidden;"></div>');var ie6=$.browser.msie&&$.browser.version<7,ie6offset=(ie6?1:0),pxyoffset=(ie6?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+pxyoffset,height:this.element.outerHeight()+pxyoffset,position:'absolute',left:this.elementOffset.left-ie6offset+'px',top:this.elementOffset.top-ie6offset+'px',zIndex:++o.zIndex});this.helper.appendTo("body").disableSelection();}else{this.helper=this.element;}},_change:{e:function(event,dx,dy){return{width:this.originalSize.width+dx};},w:function(event,dx,dy){var o=this.options,cs=this.originalSize,sp=this.originalPosition;return{left:sp.left+dx,width:cs.width-dx};},n:function(event,dx,dy){var o=this.options,cs=this.originalSize,sp=this.originalPosition;return{top:sp.top+dy,height:cs.height-dy};},s:function(event,dx,dy){return{height:this.originalSize.height+dy};},se:function(event,dx,dy){return $.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[event,dx,dy]));},sw:function(event,dx,dy){return $.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[event,dx,dy]));},ne:function(event,dx,dy){return $.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[event,dx,dy]));},nw:function(event,dx,dy){return $.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[event,dx,dy]));}},_propagate:function(n,event){$.ui.plugin.call(this,n,[event,this.ui()]);(n!="resize"&&this._trigger(n,event,this.ui()));},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition};}}));$.extend($.ui.resizable,{version:"1.7.2",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000}});$.ui.plugin.add("resizable","alsoResize",{start:function(event,ui){var self=$(this).data("resizable"),o=self.options;_store=function(exp){$(exp).each(function(){$(this).data("resizable-alsoresize",{width:parseInt($(this).width(),10),height:parseInt($(this).height(),10),left:parseInt($(this).css('left'),10),top:parseInt($(this).css('top'),10)});});};if(typeof(o.alsoResize)=='object'&&!o.alsoResize.parentNode){if(o.alsoResize.length){o.alsoResize=o.alsoResize[0];_store(o.alsoResize);}
+else{$.each(o.alsoResize,function(exp,c){_store(exp);});}}else{_store(o.alsoResize);}},resize:function(event,ui){var self=$(this).data("resizable"),o=self.options,os=self.originalSize,op=self.originalPosition;var delta={height:(self.size.height-os.height)||0,width:(self.size.width-os.width)||0,top:(self.position.top-op.top)||0,left:(self.position.left-op.left)||0},_alsoResize=function(exp,c){$(exp).each(function(){var el=$(this),start=$(this).data("resizable-alsoresize"),style={},css=c&&c.length?c:['width','height','top','left'];$.each(css||['width','height','top','left'],function(i,prop){var sum=(start[prop]||0)+(delta[prop]||0);if(sum&&sum>=0)
+style[prop]=sum||null;});if(/relative/.test(el.css('position'))&&$.browser.opera){self._revertToRelativePosition=true;el.css({position:'absolute',top:'auto',left:'auto'});}
+el.css(style);});};if(typeof(o.alsoResize)=='object'&&!o.alsoResize.nodeType){$.each(o.alsoResize,function(exp,c){_alsoResize(exp,c);});}else{_alsoResize(o.alsoResize);}},stop:function(event,ui){var self=$(this).data("resizable");if(self._revertToRelativePosition&&$.browser.opera){self._revertToRelativePosition=false;el.css({position:'relative'});}
+$(this).removeData("resizable-alsoresize-start");}});$.ui.plugin.add("resizable","animate",{stop:function(event,ui){var self=$(this).data("resizable"),o=self.options;var pr=self._proportionallyResizeElements,ista=pr.length&&(/textarea/i).test(pr[0].nodeName),soffseth=ista&&$.ui.hasScroll(pr[0],'left')?0:self.sizeDiff.height,soffsetw=ista?0:self.sizeDiff.width;var style={width:(self.size.width-soffsetw),height:(self.size.height-soffseth)},left=(parseInt(self.element.css('left'),10)+(self.position.left-self.originalPosition.left))||null,top=(parseInt(self.element.css('top'),10)+(self.position.top-self.originalPosition.top))||null;self.element.animate($.extend(style,top&&left?{top:top,left:left}:{}),{duration:o.animateDuration,easing:o.animateEasing,step:function(){var data={width:parseInt(self.element.css('width'),10),height:parseInt(self.element.css('height'),10),top:parseInt(self.element.css('top'),10),left:parseInt(self.element.css('left'),10)};if(pr&&pr.length)$(pr[0]).css({width:data.width,height:data.height});self._updateCache(data);self._propagate("resize",event);}});}});$.ui.plugin.add("resizable","containment",{start:function(event,ui){var self=$(this).data("resizable"),o=self.options,el=self.element;var oc=o.containment,ce=(oc instanceof $)?oc.get(0):(/parent/.test(oc))?el.parent().get(0):oc;if(!ce)return;self.containerElement=$(ce);if(/document/.test(oc)||oc==document){self.containerOffset={left:0,top:0};self.containerPosition={left:0,top:0};self.parentData={element:$(document),left:0,top:0,width:$(document).width(),height:$(document).height()||document.body.parentNode.scrollHeight};}
+else{var element=$(ce),p=[];$(["Top","Right","Left","Bottom"]).each(function(i,name){p[i]=num(element.css("padding"+name));});self.containerOffset=element.offset();self.containerPosition=element.position();self.containerSize={height:(element.innerHeight()-p[3]),width:(element.innerWidth()-p[1])};var co=self.containerOffset,ch=self.containerSize.height,cw=self.containerSize.width,width=($.ui.hasScroll(ce,"left")?ce.scrollWidth:cw),height=($.ui.hasScroll(ce)?ce.scrollHeight:ch);self.parentData={element:ce,left:co.left,top:co.top,width:width,height:height};}},resize:function(event,ui){var self=$(this).data("resizable"),o=self.options,ps=self.containerSize,co=self.containerOffset,cs=self.size,cp=self.position,pRatio=self._aspectRatio||event.shiftKey,cop={top:0,left:0},ce=self.containerElement;if(ce[0]!=document&&(/static/).test(ce.css('position')))cop=co;if(cp.left<(self._helper?co.left:0)){self.size.width=self.size.width+(self._helper?(self.position.left-co.left):(self.position.left-cop.left));if(pRatio)self.size.height=self.size.width/o.aspectRatio;self.position.left=o.helper?co.left:0;}
+if(cp.top<(self._helper?co.top:0)){self.size.height=self.size.height+(self._helper?(self.position.top-co.top):self.position.top);if(pRatio)self.size.width=self.size.height*o.aspectRatio;self.position.top=self._helper?co.top:0;}
+self.offset.left=self.parentData.left+self.position.left;self.offset.top=self.parentData.top+self.position.top;var woset=Math.abs((self._helper?self.offset.left-cop.left:(self.offset.left-cop.left))+self.sizeDiff.width),hoset=Math.abs((self._helper?self.offset.top-cop.top:(self.offset.top-co.top))+self.sizeDiff.height);var isParent=self.containerElement.get(0)==self.element.parent().get(0),isOffsetRelative=/relative|absolute/.test(self.containerElement.css('position'));if(isParent&&isOffsetRelative)woset-=self.parentData.left;if(woset+self.size.width>=self.parentData.width){self.size.width=self.parentData.width-woset;if(pRatio)self.size.height=self.size.width/self.aspectRatio;}
+if(hoset+self.size.height>=self.parentData.height){self.size.height=self.parentData.height-hoset;if(pRatio)self.size.width=self.size.height*self.aspectRatio;}},stop:function(event,ui){var self=$(this).data("resizable"),o=self.options,cp=self.position,co=self.containerOffset,cop=self.containerPosition,ce=self.containerElement;var helper=$(self.helper),ho=helper.offset(),w=helper.outerWidth()-self.sizeDiff.width,h=helper.outerHeight()-self.sizeDiff.height;if(self._helper&&!o.animate&&(/relative/).test(ce.css('position')))
+$(this).css({left:ho.left-cop.left-co.left,width:w,height:h});if(self._helper&&!o.animate&&(/static/).test(ce.css('position')))
+$(this).css({left:ho.left-cop.left-co.left,width:w,height:h});}});$.ui.plugin.add("resizable","ghost",{start:function(event,ui){var self=$(this).data("resizable"),o=self.options,cs=self.size;self.ghost=self.originalElement.clone();self.ghost.css({opacity:.25,display:'block',position:'relative',height:cs.height,width:cs.width,margin:0,left:0,top:0}).addClass('ui-resizable-ghost').addClass(typeof o.ghost=='string'?o.ghost:'');self.ghost.appendTo(self.helper);},resize:function(event,ui){var self=$(this).data("resizable"),o=self.options;if(self.ghost)self.ghost.css({position:'relative',height:self.size.height,width:self.size.width});},stop:function(event,ui){var self=$(this).data("resizable"),o=self.options;if(self.ghost&&self.helper)self.helper.get(0).removeChild(self.ghost.get(0));}});$.ui.plugin.add("resizable","grid",{resize:function(event,ui){var self=$(this).data("resizable"),o=self.options,cs=self.size,os=self.originalSize,op=self.originalPosition,a=self.axis,ratio=o._aspectRatio||event.shiftKey;o.grid=typeof o.grid=="number"?[o.grid,o.grid]:o.grid;var ox=Math.round((cs.width-os.width)/(o.grid[0]||1))*(o.grid[0]||1),oy=Math.round((cs.height-os.height)/(o.grid[1]||1))*(o.grid[1]||1);if(/^(se|s|e)$/.test(a)){self.size.width=os.width+ox;self.size.height=os.height+oy;}
+else if(/^(ne)$/.test(a)){self.size.width=os.width+ox;self.size.height=os.height+oy;self.position.top=op.top-oy;}
+else if(/^(sw)$/.test(a)){self.size.width=os.width+ox;self.size.height=os.height+oy;self.position.left=op.left-ox;}
+else{self.size.width=os.width+ox;self.size.height=os.height+oy;self.position.top=op.top-oy;self.position.left=op.left-ox;}}});var num=function(v){return parseInt(v,10)||0;};var isNumber=function(value){return!isNaN(parseInt(value,10));};})(jQuery);(function($){var setDataSwitch={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"},uiDialogClasses='ui-dialog '+'ui-widget '+'ui-widget-content '+'ui-corner-all ';$.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr('title');var self=this,options=this.options,title=options.title||this.originalTitle||' ',titleId=$.ui.dialog.getTitleId(this.element),uiDialog=(this.uiDialog=$('<div/>')).appendTo(document.body).hide().addClass(uiDialogClasses+options.dialogClass).css({position:'absolute',overflow:'hidden',zIndex:options.zIndex}).attr('tabIndex',-1).css('outline',0).keydown(function(event){(options.closeOnEscape&&event.keyCode&&event.keyCode==$.ui.keyCode.ESCAPE&&self.close(event));}).attr({role:'dialog','aria-labelledby':titleId}).mousedown(function(event){self.moveToTop(false,event);}),uiDialogContent=this.element.show().removeAttr('title').addClass('ui-dialog-content '+'ui-widget-content').appendTo(uiDialog),uiDialogTitlebar=(this.uiDialogTitlebar=$('<div></div>')).addClass('ui-dialog-titlebar '+'ui-widget-header '+'ui-corner-all '+'ui-helper-clearfix').prependTo(uiDialog),uiDialogTitlebarClose=$('<a href="#"/>').addClass('ui-dialog-titlebar-close '+'ui-corner-all').attr('role','button').hover(function(){uiDialogTitlebarClose.addClass('ui-state-hover');},function(){uiDialogTitlebarClose.removeClass('ui-state-hover');}).focus(function(){uiDialogTitlebarClose.addClass('ui-state-focus');}).blur(function(){uiDialogTitlebarClose.removeClass('ui-state-focus');}).mousedown(function(ev){ev.stopPropagation();}).click(function(event){self.close(event);return false;}).appendTo(uiDialogTitlebar),uiDialogTitlebarCloseText=(this.uiDialogTitlebarCloseText=$('<span/>')).addClass('ui-icon '+'ui-icon-closethick').text(options.closeText).appendTo(uiDialogTitlebarClose),uiDialogTitle=$('<span/>').addClass('ui-dialog-title').attr('id',titleId).html(title).prependTo(uiDialogTitlebar);uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();(options.draggable&&$.fn.draggable&&this._makeDraggable());(options.resizable&&$.fn.resizable&&this._makeResizable());this._createButtons(options.buttons);this._isOpen=false;(options.bgiframe&&$.fn.bgiframe&&uiDialog.bgiframe());(options.autoOpen&&this.open());},destroy:function(){(this.overlay&&this.overlay.destroy());this.uiDialog.hide();this.element.unbind('.dialog').removeData('dialog').removeClass('ui-dialog-content ui-widget-content').hide().appendTo('body');this.uiDialog.remove();(this.originalTitle&&this.element.attr('title',this.originalTitle));},close:function(event){var self=this;if(false===self._trigger('beforeclose',event)){return;}
+(self.overlay&&self.overlay.destroy());self.uiDialog.unbind('keypress.ui-dialog');(self.options.hide?self.uiDialog.hide(self.options.hide,function(){self._trigger('close',event);}):self.uiDialog.hide()&&self._trigger('close',event));$.ui.dialog.overlay.resize();self._isOpen=false;if(self.options.modal){var maxZ=0;$('.ui-dialog').each(function(){if(this!=self.uiDialog[0]){maxZ=Math.max(maxZ,$(this).css('z-index'));}});$.ui.dialog.maxZ=maxZ;}},isOpen:function(){return this._isOpen;},moveToTop:function(force,event){if((this.options.modal&&!force)||(!this.options.stack&&!this.options.modal)){return this._trigger('focus',event);}
+if(this.options.zIndex>$.ui.dialog.maxZ){$.ui.dialog.maxZ=this.options.zIndex;}
+(this.overlay&&this.overlay.$el.css('z-index',$.ui.dialog.overlay.maxZ=++$.ui.dialog.maxZ));var saveScroll={scrollTop:this.element.attr('scrollTop'),scrollLeft:this.element.attr('scrollLeft')};this.uiDialog.css('z-index',++$.ui.dialog.maxZ);this.element.attr(saveScroll);this._trigger('focus',event);},open:function(){if(this._isOpen){return;}
+var options=this.options,uiDialog=this.uiDialog;this.overlay=options.modal?new $.ui.dialog.overlay(this):null;(uiDialog.next().length&&uiDialog.appendTo('body'));this._size();this._position(options.position);uiDialog.show(options.show);this.moveToTop(true);(options.modal&&uiDialog.bind('keypress.ui-dialog',function(event){if(event.keyCode!=$.ui.keyCode.TAB){return;}
+var tabbables=$(':tabbable',this),first=tabbables.filter(':first')[0],last=tabbables.filter(':last')[0];if(event.target==last&&!event.shiftKey){setTimeout(function(){first.focus();},1);}else if(event.target==first&&event.shiftKey){setTimeout(function(){last.focus();},1);}}));$([]).add(uiDialog.find('.ui-dialog-content :tabbable:first')).add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')).add(uiDialog).filter(':first').focus();this._trigger('open');this._isOpen=true;},_createButtons:function(buttons){var self=this,hasButtons=false,uiDialogButtonPane=$('<div></div>').addClass('ui-dialog-buttonpane '+'ui-widget-content '+'ui-helper-clearfix');this.uiDialog.find('.ui-dialog-buttonpane').remove();(typeof buttons=='object'&&buttons!==null&&$.each(buttons,function(){return!(hasButtons=true);}));if(hasButtons){$.each(buttons,function(name,fn){$('<button type="button"></button>').addClass('ui-state-default '+'ui-corner-all').text(name).click(function(){fn.apply(self.element[0],arguments);}).hover(function(){$(this).addClass('ui-state-hover');},function(){$(this).removeClass('ui-state-hover');}).focus(function(){$(this).addClass('ui-state-focus');}).blur(function(){$(this).removeClass('ui-state-focus');}).appendTo(uiDialogButtonPane);});uiDialogButtonPane.appendTo(this.uiDialog);}},_makeDraggable:function(){var self=this,options=this.options,heightBeforeDrag;this.uiDialog.draggable({cancel:'.ui-dialog-content',handle:'.ui-dialog-titlebar',containment:'document',start:function(){heightBeforeDrag=options.height;$(this).height($(this).height()).addClass("ui-dialog-dragging");(options.dragStart&&options.dragStart.apply(self.element[0],arguments));},drag:function(){(options.drag&&options.drag.apply(self.element[0],arguments));},stop:function(){$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);(options.dragStop&&options.dragStop.apply(self.element[0],arguments));$.ui.dialog.overlay.resize();}});},_makeResizable:function(handles){handles=(handles===undefined?this.options.resizable:handles);var self=this,options=this.options,resizeHandles=typeof handles=='string'?handles:'n,e,s,w,se,sw,ne,nw';this.uiDialog.resizable({cancel:'.ui-dialog-content',alsoResize:this.element,maxWidth:options.maxWidth,maxHeight:options.maxHeight,minWidth:options.minWidth,minHeight:options.minHeight,start:function(){$(this).addClass("ui-dialog-resizing");(options.resizeStart&&options.resizeStart.apply(self.element[0],arguments));},resize:function(){(options.resize&&options.resize.apply(self.element[0],arguments));},handles:resizeHandles,stop:function(){$(this).removeClass("ui-dialog-resizing");options.height=$(this).height();options.width=$(this).width();(options.resizeStop&&options.resizeStop.apply(self.element[0],arguments));$.ui.dialog.overlay.resize();}}).find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');},_position:function(pos){var wnd=$(window),doc=$(document),pTop=doc.scrollTop(),pLeft=doc.scrollLeft(),minTop=pTop;if($.inArray(pos,['center','top','right','bottom','left'])>=0){pos=[pos=='right'||pos=='left'?pos:'center',pos=='top'||pos=='bottom'?pos:'middle'];}
+if(pos.constructor!=Array){pos=['center','middle'];}
+if(pos[0].constructor==Number){pLeft+=pos[0];}else{switch(pos[0]){case'left':pLeft+=0;break;case'right':pLeft+=wnd.width()-this.uiDialog.outerWidth();break;default:case'center':pLeft+=(wnd.width()-this.uiDialog.outerWidth())/2;}}
+if(pos[1].constructor==Number){pTop+=pos[1];}else{switch(pos[1]){case'top':pTop+=0;break;case'bottom':pTop+=wnd.height()-this.uiDialog.outerHeight();break;default:case'middle':pTop+=(wnd.height()-this.uiDialog.outerHeight())/2;}}
+pTop=Math.max(pTop,minTop);this.uiDialog.css({top:pTop,left:pLeft});},_setData:function(key,value){(setDataSwitch[key]&&this.uiDialog.data(setDataSwitch[key],value));switch(key){case"buttons":this._createButtons(value);break;case"closeText":this.uiDialogTitlebarCloseText.text(value);break;case"dialogClass":this.uiDialog.removeClass(this.options.dialogClass).addClass(uiDialogClasses+value);break;case"draggable":(value?this._makeDraggable():this.uiDialog.draggable('destroy'));break;case"height":this.uiDialog.height(value);break;case"position":this._position(value);break;case"resizable":var uiDialog=this.uiDialog,isResizable=this.uiDialog.is(':data(resizable)');(isResizable&&!value&&uiDialog.resizable('destroy'));(isResizable&&typeof value=='string'&&uiDialog.resizable('option','handles',value));(isResizable||this._makeResizable(value));break;case"title":$(".ui-dialog-title",this.uiDialogTitlebar).html(value||' ');break;case"width":this.uiDialog.width(value);break;}
+$.widget.prototype._setData.apply(this,arguments);},_size:function(){var options=this.options;this.element.css({height:0,minHeight:0,width:'auto'});var nonContentHeight=this.uiDialog.css({height:'auto',width:options.width}).height();this.element.css({minHeight:Math.max(options.minHeight-nonContentHeight,0),height:options.height=='auto'?'auto':Math.max(options.height-nonContentHeight,0)});}});$.extend($.ui.dialog,{version:"1.7.2",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:'close',dialogClass:'',draggable:true,hide:null,height:'auto',maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:'center',resizable:true,show:null,stack:true,title:'',width:300,zIndex:1000},getter:'isOpen',uuid:0,maxZ:0,getTitleId:function($el){return'ui-dialog-title-'+($el.attr('id')||++this.uuid);},overlay:function(dialog){this.$el=$.ui.dialog.overlay.create(dialog);}});$.extend($.ui.dialog.overlay,{instances:[],maxZ:0,events:$.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),function(event){return event+'.dialog-overlay';}).join(' '),create:function(dialog){if(this.instances.length===0){setTimeout(function(){if($.ui.dialog.overlay.instances.length){$(document).bind($.ui.dialog.overlay.events,function(event){var dialogZ=$(event.target).parents('.ui-dialog').css('zIndex')||0;return(dialogZ>$.ui.dialog.overlay.maxZ);});}},1);$(document).bind('keydown.dialog-overlay',function(event){(dialog.options.closeOnEscape&&event.keyCode&&event.keyCode==$.ui.keyCode.ESCAPE&&dialog.close(event));});$(window).bind('resize.dialog-overlay',$.ui.dialog.overlay.resize);}
+var $el=$('<div></div>').appendTo(document.body).addClass('ui-widget-overlay').css({width:this.width(),height:this.height()});(dialog.options.bgiframe&&$.fn.bgiframe&&$el.bgiframe());this.instances.push($el);return $el;},destroy:function($el){this.instances.splice($.inArray(this.instances,$el),1);if(this.instances.length===0){$([document,window]).unbind('.dialog-overlay');}
+$el.remove();var maxZ=0;$.each(this.instances,function(){maxZ=Math.max(maxZ,this.css('z-index'));});this.maxZ=maxZ;},height:function(){if($.browser.msie&&$.browser.version<7){var scrollHeight=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var offsetHeight=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(scrollHeight<offsetHeight){return $(window).height()+'px';}else{return scrollHeight+'px';}}else{return $(document).height()+'px';}},width:function(){if($.browser.msie&&$.browser.version<7){var scrollWidth=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);var offsetWidth=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(scrollWidth<offsetWidth){return $(window).width()+'px';}else{return scrollWidth+'px';}}else{return $(document).width()+'px';}},resize:function(){var $overlays=$([]);$.each($.ui.dialog.overlay.instances,function(){$overlays=$overlays.add(this);});$overlays.css({width:0,height:0}).css({width:$.ui.dialog.overlay.width(),height:$.ui.dialog.overlay.height()});}});$.extend($.ui.dialog.overlay.prototype,{destroy:function(){$.ui.dialog.overlay.destroy(this.$el);}});})(jQuery);(function($){$.widget("ui.tabs",{_init:function(){if(this.options.deselectable!==undefined){this.options.collapsible=this.options.deselectable;}
+this._tabify(true);},_setData:function(key,value){if(key=='selected'){if(this.options.collapsible&&value==this.options.selected){return;}
+this.select(value);}
+else{this.options[key]=value;if(key=='deselectable'){this.options.collapsible=value;}
+this._tabify();}},_tabId:function(a){return a.title&&a.title.replace(/\s/g,'_').replace(/[^A-Za-z0-9\-_:\.]/g,'')||this.options.idPrefix+$.data(a);},_sanitizeSelector:function(hash){return hash.replace(/:/g,'\\:');},_cookie:function(){var cookie=this.cookie||(this.cookie=this.options.cookie.name||'ui-tabs-'+$.data(this.list[0]));return $.cookie.apply(null,[cookie].concat($.makeArray(arguments)));},_ui:function(tab,panel){return{tab:tab,panel:panel,index:this.anchors.index(tab)};},_cleanup:function(){this.lis.filter('.ui-state-processing').removeClass('ui-state-processing').find('span:data(label.tabs)').each(function(){var el=$(this);el.html(el.data('label.tabs')).removeData('label.tabs');});},_tabify:function(init){this.list=this.element.children('ul:first');this.lis=$('li:has(a[href])',this.list);this.anchors=this.lis.map(function(){return $('a',this)[0];});this.panels=$([]);var self=this,o=this.options;var fragmentId=/^#.+/;this.anchors.each(function(i,a){var href=$(a).attr('href');var hrefBase=href.split('#')[0],baseEl;if(hrefBase&&(hrefBase===location.toString().split('#')[0]||(baseEl=$('base')[0])&&hrefBase===baseEl.href)){href=a.hash;a.href=href;}
+if(fragmentId.test(href)){self.panels=self.panels.add(self._sanitizeSelector(href));}
+else if(href!='#'){$.data(a,'href.tabs',href);$.data(a,'load.tabs',href.replace(/#.*$/,''));var id=self._tabId(a);a.href='#'+id;var $panel=$('#'+id);if(!$panel.length){$panel=$(o.panelTemplate).attr('id',id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom').insertAfter(self.panels[i-1]||self.list);$panel.data('destroy.tabs',true);}
+self.panels=self.panels.add($panel);}
+else{o.disabled.push(i);}});if(init){this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');this.lis.addClass('ui-state-default ui-corner-top');this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');if(o.selected===undefined){if(location.hash){this.anchors.each(function(i,a){if(a.hash==location.hash){o.selected=i;return false;}});}
+if(typeof o.selected!='number'&&o.cookie){o.selected=parseInt(self._cookie(),10);}
+if(typeof o.selected!='number'&&this.lis.filter('.ui-tabs-selected').length){o.selected=this.lis.index(this.lis.filter('.ui-tabs-selected'));}
+o.selected=o.selected||0;}
+else if(o.selected===null){o.selected=-1;}
+o.selected=((o.selected>=0&&this.anchors[o.selected])||o.selected<0)?o.selected:0;o.disabled=$.unique(o.disabled.concat($.map(this.lis.filter('.ui-state-disabled'),function(n,i){return self.lis.index(n);}))).sort();if($.inArray(o.selected,o.disabled)!=-1){o.disabled.splice($.inArray(o.selected,o.disabled),1);}
+this.panels.addClass('ui-tabs-hide');this.lis.removeClass('ui-tabs-selected ui-state-active');if(o.selected>=0&&this.anchors.length){this.panels.eq(o.selected).removeClass('ui-tabs-hide');this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');self.element.queue("tabs",function(){self._trigger('show',null,self._ui(self.anchors[o.selected],self.panels[o.selected]));});this.load(o.selected);}
+$(window).bind('unload',function(){self.lis.add(self.anchors).unbind('.tabs');self.lis=self.anchors=self.panels=null;});}
+else{o.selected=this.lis.index(this.lis.filter('.ui-tabs-selected'));}
+this.element[o.collapsible?'addClass':'removeClass']('ui-tabs-collapsible');if(o.cookie){this._cookie(o.selected,o.cookie);}
+for(var i=0,li;(li=this.lis[i]);i++){$(li)[$.inArray(i,o.disabled)!=-1&&!$(li).hasClass('ui-tabs-selected')?'addClass':'removeClass']('ui-state-disabled');}
+if(o.cache===false){this.anchors.removeData('cache.tabs');}
+this.lis.add(this.anchors).unbind('.tabs');if(o.event!='mouseover'){var addState=function(state,el){if(el.is(':not(.ui-state-disabled)')){el.addClass('ui-state-'+state);}};var removeState=function(state,el){el.removeClass('ui-state-'+state);};this.lis.bind('mouseover.tabs',function(){addState('hover',$(this));});this.lis.bind('mouseout.tabs',function(){removeState('hover',$(this));});this.anchors.bind('focus.tabs',function(){addState('focus',$(this).closest('li'));});this.anchors.bind('blur.tabs',function(){removeState('focus',$(this).closest('li'));});}
+var hideFx,showFx;if(o.fx){if($.isArray(o.fx)){hideFx=o.fx[0];showFx=o.fx[1];}
+else{hideFx=showFx=o.fx;}}
+function resetStyle($el,fx){$el.css({display:''});if($.browser.msie&&fx.opacity){$el[0].style.removeAttribute('filter');}}
+var showTab=showFx?function(clicked,$show){$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');$show.hide().removeClass('ui-tabs-hide').animate(showFx,showFx.duration||'normal',function(){resetStyle($show,showFx);self._trigger('show',null,self._ui(clicked,$show[0]));});}:function(clicked,$show){$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');$show.removeClass('ui-tabs-hide');self._trigger('show',null,self._ui(clicked,$show[0]));};var hideTab=hideFx?function(clicked,$hide){$hide.animate(hideFx,hideFx.duration||'normal',function(){self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');$hide.addClass('ui-tabs-hide');resetStyle($hide,hideFx);self.element.dequeue("tabs");});}:function(clicked,$hide,$show){self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');$hide.addClass('ui-tabs-hide');self.element.dequeue("tabs");};this.anchors.bind(o.event+'.tabs',function(){var el=this,$li=$(this).closest('li'),$hide=self.panels.filter(':not(.ui-tabs-hide)'),$show=$(self._sanitizeSelector(this.hash));if(($li.hasClass('ui-tabs-selected')&&!o.collapsible)||$li.hasClass('ui-state-disabled')||$li.hasClass('ui-state-processing')||self._trigger('select',null,self._ui(this,$show[0]))===false){this.blur();return false;}
+o.selected=self.anchors.index(this);self.abort();if(o.collapsible){if($li.hasClass('ui-tabs-selected')){o.selected=-1;if(o.cookie){self._cookie(o.selected,o.cookie);}
+self.element.queue("tabs",function(){hideTab(el,$hide);}).dequeue("tabs");this.blur();return false;}
+else if(!$hide.length){if(o.cookie){self._cookie(o.selected,o.cookie);}
+self.element.queue("tabs",function(){showTab(el,$show);});self.load(self.anchors.index(this));this.blur();return false;}}
+if(o.cookie){self._cookie(o.selected,o.cookie);}
+if($show.length){if($hide.length){self.element.queue("tabs",function(){hideTab(el,$hide);});}
+self.element.queue("tabs",function(){showTab(el,$show);});self.load(self.anchors.index(this));}
+else{throw'jQuery UI Tabs: Mismatching fragment identifier.';}
+if($.browser.msie){this.blur();}});this.anchors.bind('click.tabs',function(){return false;});},destroy:function(){var o=this.options;this.abort();this.element.unbind('.tabs').removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible').removeData('tabs');this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');this.anchors.each(function(){var href=$.data(this,'href.tabs');if(href){this.href=href;}
+var $this=$(this).unbind('.tabs');$.each(['href','load','cache'],function(i,prefix){$this.removeData(prefix+'.tabs');});});this.lis.unbind('.tabs').add(this.panels).each(function(){if($.data(this,'destroy.tabs')){$(this).remove();}
+else{$(this).removeClass(['ui-state-default','ui-corner-top','ui-tabs-selected','ui-state-active','ui-state-hover','ui-state-focus','ui-state-disabled','ui-tabs-panel','ui-widget-content','ui-corner-bottom','ui-tabs-hide'].join(' '));}});if(o.cookie){this._cookie(null,o.cookie);}},add:function(url,label,index){if(index===undefined){index=this.anchors.length;}
+var self=this,o=this.options,$li=$(o.tabTemplate.replace(/#\{href\}/g,url).replace(/#\{label\}/g,label)),id=!url.indexOf('#')?url.replace('#',''):this._tabId($('a',$li)[0]);$li.addClass('ui-state-default ui-corner-top').data('destroy.tabs',true);var $panel=$('#'+id);if(!$panel.length){$panel=$(o.panelTemplate).attr('id',id).data('destroy.tabs',true);}
+$panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');if(index>=this.lis.length){$li.appendTo(this.list);$panel.appendTo(this.list[0].parentNode);}
+else{$li.insertBefore(this.lis[index]);$panel.insertBefore(this.panels[index]);}
+o.disabled=$.map(o.disabled,function(n,i){return n>=index?++n:n;});this._tabify();if(this.anchors.length==1){$li.addClass('ui-tabs-selected ui-state-active');$panel.removeClass('ui-tabs-hide');this.element.queue("tabs",function(){self._trigger('show',null,self._ui(self.anchors[0],self.panels[0]));});this.load(0);}
+this._trigger('add',null,this._ui(this.anchors[index],this.panels[index]));},remove:function(index){var o=this.options,$li=this.lis.eq(index).remove(),$panel=this.panels.eq(index).remove();if($li.hasClass('ui-tabs-selected')&&this.anchors.length>1){this.select(index+(index+1<this.anchors.length?1:-1));}
+o.disabled=$.map($.grep(o.disabled,function(n,i){return n!=index;}),function(n,i){return n>=index?--n:n;});this._tabify();this._trigger('remove',null,this._ui($li.find('a')[0],$panel[0]));},enable:function(index){var o=this.options;if($.inArray(index,o.disabled)==-1){return;}
+this.lis.eq(index).removeClass('ui-state-disabled');o.disabled=$.grep(o.disabled,function(n,i){return n!=index;});this._trigger('enable',null,this._ui(this.anchors[index],this.panels[index]));},disable:function(index){var self=this,o=this.options;if(index!=o.selected){this.lis.eq(index).addClass('ui-state-disabled');o.disabled.push(index);o.disabled.sort();this._trigger('disable',null,this._ui(this.anchors[index],this.panels[index]));}},select:function(index){if(typeof index=='string'){index=this.anchors.index(this.anchors.filter('[href$='+index+']'));}
+else if(index===null){index=-1;}
+if(index==-1&&this.options.collapsible){index=this.options.selected;}
+this.anchors.eq(index).trigger(this.options.event+'.tabs');},load:function(index){var self=this,o=this.options,a=this.anchors.eq(index)[0],url=$.data(a,'load.tabs');this.abort();if(!url||this.element.queue("tabs").length!==0&&$.data(a,'cache.tabs')){this.element.dequeue("tabs");return;}
+this.lis.eq(index).addClass('ui-state-processing');if(o.spinner){var span=$('span',a);span.data('label.tabs',span.html()).html(o.spinner);}
+this.xhr=$.ajax($.extend({},o.ajaxOptions,{url:url,success:function(r,s){$(self._sanitizeSelector(a.hash)).html(r);self._cleanup();if(o.cache){$.data(a,'cache.tabs',true);}
+self._trigger('load',null,self._ui(self.anchors[index],self.panels[index]));try{o.ajaxOptions.success(r,s);}
+catch(e){}
+self.element.dequeue("tabs");}}));},abort:function(){this.element.queue([]);this.panels.stop(false,true);if(this.xhr){this.xhr.abort();delete this.xhr;}
+this._cleanup();},url:function(index,url){this.anchors.eq(index).removeData('cache.tabs').data('load.tabs',url);},length:function(){return this.anchors.length;}});$.extend($.ui.tabs,{version:'1.7.2',getter:'length',defaults:{ajaxOptions:null,cache:false,cookie:null,collapsible:false,disabled:[],event:'click',fx:null,idPrefix:'ui-tabs-',panelTemplate:'<div></div>',spinner:'<em>Loading…</em>',tabTemplate:'<li><a href="#{href}"><span>#{label}</span></a></li>'}});$.extend($.ui.tabs.prototype,{rotation:null,rotate:function(ms,continuing){var self=this,o=this.options;var rotate=self._rotate||(self._rotate=function(e){clearTimeout(self.rotation);self.rotation=setTimeout(function(){var t=o.selected;self.select(++t<self.anchors.length?t:0);},ms);if(e){e.stopPropagation();}});var stop=self._unrotate||(self._unrotate=!continuing?function(e){if(e.clientX){self.rotate(null);}}:function(e){t=o.selected;rotate();});if(ms){this.element.bind('tabsshow',rotate);this.anchors.bind(o.event+'.tabs',stop);rotate();}
+else{clearTimeout(self.rotation);this.element.unbind('tabsshow',rotate);this.anchors.unbind(o.event+'.tabs',stop);delete this._rotate;delete this._unrotate;}}});})(jQuery);(function($){$.extend($.ui,{datepicker:{version:"1.7.2"}});var PROP_NAME='datepicker';function Datepicker(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId='ui-datepicker-div';this._inlineClass='ui-datepicker-inline';this._appendClass='ui-datepicker-append';this._triggerClass='ui-datepicker-trigger';this._dialogClass='ui-datepicker-dialog';this._disableClass='ui-datepicker-disabled';this._unselectableClass='ui-datepicker-unselectable';this._currentClass='ui-datepicker-current-day';this._dayOverClass='ui-datepicker-days-cell-over';this.regional=[];this.regional['']={closeText:'Done',prevText:'Prev',nextText:'Next',currentText:'Today',monthNames:['January','February','March','April','May','June','July','August','September','October','November','December'],monthNamesShort:['Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec'],dayNames:['Sunday','Monday','Tuesday','Wednesday','Thursday','Friday','Saturday'],dayNamesShort:['Sun','Mon','Tue','Wed','Thu','Fri','Sat'],dayNamesMin:['Su','Mo','Tu','We','Th','Fr','Sa'],dateFormat:'mm/dd/yy',firstDay:0,isRTL:false};this._defaults={showOn:'focus',showAnim:'show',showOptions:{},defaultDate:null,appendText:'',buttonText:'...',buttonImage:'',buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,showMonthAfterYear:false,yearRange:'-10:+10',showOtherMonths:false,calculateWeek:this.iso8601Week,shortYearCutoff:'+10',minDate:null,maxDate:null,duration:'normal',beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:'',altFormat:'',constrainInput:true,showButtonPanel:false};$.extend(this._defaults,this.regional['']);this.dpDiv=$('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');}
+$.extend(Datepicker.prototype,{markerClassName:'hasDatepicker',log:function(){if(this.debug)
+console.log.apply('',arguments);},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this;},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute('date:'+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue);}catch(err){inlineSettings[attrName]=attrValue;}}}
+var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=='div'||nodeName=='span');if(!target.id)
+target.id='dp'+(++this.uuid);var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=='input'){this._connectDatepicker(target,inst);}else if(inline){this._inlineDatepicker(target,inst);}},_newInst:function(target,inline){var id=target[0].id.replace(/([:\[\]\.])/g,'\\\\$1');return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};},_connectDatepicker:function(target,inst){var input=$(target);inst.append=$([]);inst.trigger=$([]);if(input.hasClass(this.markerClassName))
+return;var appendText=this._get(inst,'appendText');var isRTL=this._get(inst,'isRTL');if(appendText){inst.append=$('<span class="'+this._appendClass+'">'+appendText+'</span>');input[isRTL?'before':'after'](inst.append);}
+var showOn=this._get(inst,'showOn');if(showOn=='focus'||showOn=='both')
+input.focus(this._showDatepicker);if(showOn=='button'||showOn=='both'){var buttonText=this._get(inst,'buttonText');var buttonImage=this._get(inst,'buttonImage');inst.trigger=$(this._get(inst,'buttonImageOnly')?$('<img/>').addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('<button type="button"></button>').addClass(this._triggerClass).html(buttonImage==''?buttonText:$('<img/>').attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?'before':'after'](inst.trigger);inst.trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==target)
+$.datepicker._hideDatepicker();else
+$.datepicker._showDatepicker(target);return false;});}
+input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value;}).bind("getData.datepicker",function(event,key){return this._get(inst,key);});$.data(target,PROP_NAME,inst);},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName))
+return;divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value;}).bind("getData.datepicker",function(event,key){return this._get(inst,key);});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst));this._updateDatepicker(inst);this._updateAlternate(inst);},_dialogDatepicker:function(input,dateText,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){var id='dp'+(++this.uuid);this._dialogInput=$('<input type="text" id="'+id+'" size="1" style="position: absolute; top: -100px;"/>');this._dialogInput.keydown(this._doKeyDown);$('body').append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst);}
+extendRemove(inst.settings,settings||{});this._dialogInput.val(dateText);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth;var browserHeight=window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY];}
+this._dialogInput.css('left',this._pos[0]+'px').css('top',this._pos[1]+'px');inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI)
+$.blockUI(this.dpDiv);$.data(this._dialogInput[0],PROP_NAME,inst);return this;},_destroyDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return;}
+var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=='input'){inst.append.remove();inst.trigger.remove();$target.removeClass(this.markerClassName).unbind('focus',this._showDatepicker).unbind('keydown',this._doKeyDown).unbind('keypress',this._doKeyPress);}else if(nodeName=='div'||nodeName=='span')
+$target.removeClass(this.markerClassName).empty();},_enableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return;}
+var nodeName=target.nodeName.toLowerCase();if(nodeName=='input'){target.disabled=false;inst.trigger.filter('button').each(function(){this.disabled=false;}).end().filter('img').css({opacity:'1.0',cursor:''});}
+else if(nodeName=='div'||nodeName=='span'){var inline=$target.children('.'+this._inlineClass);inline.children().removeClass('ui-state-disabled');}
+this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value);});},_disableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return;}
+var nodeName=target.nodeName.toLowerCase();if(nodeName=='input'){target.disabled=true;inst.trigger.filter('button').each(function(){this.disabled=true;}).end().filter('img').css({opacity:'0.5',cursor:'default'});}
+else if(nodeName=='div'||nodeName=='span'){var inline=$target.children('.'+this._inlineClass);inline.children().addClass('ui-state-disabled');}
+this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value);});this._disabledInputs[this._disabledInputs.length]=target;},_isDisabledDatepicker:function(target){if(!target){return false;}
+for(var i=0;i<this._disabledInputs.length;i++){if(this._disabledInputs[i]==target)
+return true;}
+return false;},_getInst:function(target){try{return $.data(target,PROP_NAME);}
+catch(err){throw'Missing instance data for this datepicker';}},_optionDatepicker:function(target,name,value){var inst=this._getInst(target);if(arguments.length==2&&typeof name=='string'){return(name=='defaults'?$.extend({},$.datepicker._defaults):(inst?(name=='all'?$.extend({},inst.settings):this._get(inst,name)):null));}
+var settings=name||{};if(typeof name=='string'){settings={};settings[name]=value;}
+if(inst){if(this._curInst==inst){this._hideDatepicker(null);}
+var date=this._getDateDatepicker(target);extendRemove(inst.settings,settings);this._setDateDatepicker(target,date);this._updateDatepicker(inst);}},_changeDatepicker:function(target,name,value){this._optionDatepicker(target,name,value);},_refreshDatepicker:function(target){var inst=this._getInst(target);if(inst){this._updateDatepicker(inst);}},_setDateDatepicker:function(target,date,endDate){var inst=this._getInst(target);if(inst){this._setDate(inst,date,endDate);this._updateDatepicker(inst);this._updateAlternate(inst);}},_getDateDatepicker:function(target){var inst=this._getInst(target);if(inst&&!inst.inline)
+this._setDateFromField(inst);return(inst?this._getDate(inst):null);},_doKeyDown:function(event){var inst=$.datepicker._getInst(event.target);var handled=true;var isRTL=inst.dpDiv.is('.ui-datepicker-rtl');inst._keyEvent=true;if($.datepicker._datepickerShowing)
+switch(event.keyCode){case 9:$.datepicker._hideDatepicker(null,'');break;case 13:var sel=$('td.'+$.datepicker._dayOverClass+', td.'+$.datepicker._currentClass,inst.dpDiv);if(sel[0])
+$.datepicker._selectDay(event.target,inst.selectedMonth,inst.selectedYear,sel[0]);else
+$.datepicker._hideDatepicker(null,$.datepicker._get(inst,'duration'));return false;break;case 27:$.datepicker._hideDatepicker(null,$.datepicker._get(inst,'duration'));break;case 33:$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,'stepBigMonths'):-$.datepicker._get(inst,'stepMonths')),'M');break;case 34:$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,'stepBigMonths'):+$.datepicker._get(inst,'stepMonths')),'M');break;case 35:if(event.ctrlKey||event.metaKey)$.datepicker._clearDate(event.target);handled=event.ctrlKey||event.metaKey;break;case 36:if(event.ctrlKey||event.metaKey)$.datepicker._gotoToday(event.target);handled=event.ctrlKey||event.metaKey;break;case 37:if(event.ctrlKey||event.metaKey)$.datepicker._adjustDate(event.target,(isRTL?+1:-1),'D');handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey)$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,'stepBigMonths'):-$.datepicker._get(inst,'stepMonths')),'M');break;case 38:if(event.ctrlKey||event.metaKey)$.datepicker._adjustDate(event.target,-7,'D');handled=event.ctrlKey||event.metaKey;break;case 39:if(event.ctrlKey||event.metaKey)$.datepicker._adjustDate(event.target,(isRTL?-1:+1),'D');handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey)$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,'stepBigMonths'):+$.datepicker._get(inst,'stepMonths')),'M');break;case 40:if(event.ctrlKey||event.metaKey)$.datepicker._adjustDate(event.target,+7,'D');handled=event.ctrlKey||event.metaKey;break;default:handled=false;}
+else if(event.keyCode==36&&event.ctrlKey)
+$.datepicker._showDatepicker(this);else{handled=false;}
+if(handled){event.preventDefault();event.stopPropagation();}},_doKeyPress:function(event){var inst=$.datepicker._getInst(event.target);if($.datepicker._get(inst,'constrainInput')){var chars=$.datepicker._possibleChars($.datepicker._get(inst,'dateFormat'));var chr=String.fromCharCode(event.charCode==undefined?event.keyCode:event.charCode);return event.ctrlKey||(chr<' '||!chars||chars.indexOf(chr)>-1);}},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!='input')
+input=$('input',input.parentNode)[0];if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input)
+return;var inst=$.datepicker._getInst(input);var beforeShow=$.datepicker._get(inst,'beforeShow');extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));$.datepicker._hideDatepicker(null,'');$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog)
+input.value='';if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight;}
+var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css('position')=='fixed';return!isFixed;});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop;}
+var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.rangeStart=null;inst.dpDiv.css({position:'absolute',display:'block',top:'-1000px'});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?'static':(isFixed?'fixed':'absolute')),display:'none',left:offset.left+'px',top:offset.top+'px'});if(!inst.inline){var showAnim=$.datepicker._get(inst,'showAnim')||'show';var duration=$.datepicker._get(inst,'duration');var postProcess=function(){$.datepicker._datepickerShowing=true;if($.browser.msie&&parseInt($.browser.version,10)<7)
+$('iframe.ui-datepicker-cover').css({width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4});};if($.effects&&$.effects[showAnim])
+inst.dpDiv.show(showAnim,$.datepicker._get(inst,'showOptions'),duration,postProcess);else
+inst.dpDiv[showAnim](duration,postProcess);if(duration=='')
+postProcess();if(inst.input[0].type!='hidden')
+inst.input[0].focus();$.datepicker._curInst=inst;}},_updateDatepicker:function(inst){var dims={width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4};var self=this;inst.dpDiv.empty().append(this._generateHTML(inst)).find('iframe.ui-datepicker-cover').css({width:dims.width,height:dims.height}).end().find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a').bind('mouseout',function(){$(this).removeClass('ui-state-hover');if(this.className.indexOf('ui-datepicker-prev')!=-1)$(this).removeClass('ui-datepicker-prev-hover');if(this.className.indexOf('ui-datepicker-next')!=-1)$(this).removeClass('ui-datepicker-next-hover');}).bind('mouseover',function(){if(!self._isDisabledDatepicker(inst.inline?inst.dpDiv.parent()[0]:inst.input[0])){$(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');$(this).addClass('ui-state-hover');if(this.className.indexOf('ui-datepicker-prev')!=-1)$(this).addClass('ui-datepicker-prev-hover');if(this.className.indexOf('ui-datepicker-next')!=-1)$(this).addClass('ui-datepicker-next-hover');}}).end().find('.'+this._dayOverClass+' a').trigger('mouseover').end();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;if(cols>1){inst.dpDiv.addClass('ui-datepicker-multi-'+cols).css('width',(width*cols)+'em');}else{inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');}
+inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?'add':'remove')+'Class']('ui-datepicker-multi');inst.dpDiv[(this._get(inst,'isRTL')?'add':'remove')+'Class']('ui-datepicker-rtl');if(inst.input&&inst.input[0].type!='hidden'&&inst==$.datepicker._curInst)
+$(inst.input[0]).focus();},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=(window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth)+$(document).scrollLeft();var viewHeight=(window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight)+$(document).scrollTop();offset.left-=(this._get(inst,'isRTL')?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0;offset.top-=(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(offset.top+dpHeight+inputHeight*2-viewHeight):0;return offset;},_findPos:function(obj){while(obj&&(obj.type=='hidden'||obj.nodeType!=1)){obj=obj.nextSibling;}
+var position=$(obj).offset();return[position.left,position.top];},_hideDatepicker:function(input,duration){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME)))
+return;if(inst.stayOpen)
+this._selectDate('#'+inst.id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));inst.stayOpen=false;if(this._datepickerShowing){duration=(duration!=null?duration:this._get(inst,'duration'));var showAnim=this._get(inst,'showAnim');var postProcess=function(){$.datepicker._tidyDialog(inst);};if(duration!=''&&$.effects&&$.effects[showAnim])
+inst.dpDiv.hide(showAnim,$.datepicker._get(inst,'showOptions'),duration,postProcess);else
+inst.dpDiv[(duration==''?'hide':(showAnim=='slideDown'?'slideUp':(showAnim=='fadeIn'?'fadeOut':'hide')))](duration,postProcess);if(duration=='')
+this._tidyDialog(inst);var onClose=this._get(inst,'onClose');if(onClose)
+onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():''),inst]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:'absolute',left:'0',top:'-100px'});if($.blockUI){$.unblockUI();$('body').append(this.dpDiv);}}
+this._inDialog=false;}
+this._curInst=null;},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');},_checkExternalClick:function(event){if(!$.datepicker._curInst)
+return;var $target=$(event.target);if(($target.parents('#'+$.datepicker._mainDivId).length==0)&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI))
+$.datepicker._hideDatepicker(null,'');},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return;}
+this._adjustInstDate(inst,offset+
+(period=='M'?this._get(inst,'showCurrentAtPos'):0),period);this._updateDatepicker(inst);},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,'gotoCurrent')&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear;}
+else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();}
+this._notifyChange(inst);this._adjustDate(target);},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst['selected'+(period=='M'?'Month':'Year')]=inst['draw'+(period=='M'?'Month':'Year')]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target);},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear&&!$.browser.msie)
+inst.input[0].focus();inst._selectingMonthYear=!inst._selectingMonthYear;},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return;}
+var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$('a',td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;if(inst.stayOpen){inst.endDay=inst.endMonth=inst.endYear=null;}
+this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));if(inst.stayOpen){inst.rangeStart=this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay));this._updateDatepicker(inst);}},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);inst.stayOpen=false;inst.endDay=inst.endMonth=inst.endYear=inst.rangeStart=null;this._selectDate(target,'');},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input)
+inst.input.val(dateStr);this._updateAlternate(inst);var onSelect=this._get(inst,'onSelect');if(onSelect)
+onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst]);else if(inst.input)
+inst.input.trigger('change');if(inst.inline)
+this._updateDatepicker(inst);else if(!inst.stayOpen){this._hideDatepicker(null,this._get(inst,'duration'));this._lastInput=inst.input[0];if(typeof(inst.input[0])!='object')
+inst.input[0].focus();this._lastInput=null;}},_updateAlternate:function(inst){var altField=this._get(inst,'altField');if(altField){var altFormat=this._get(inst,'altFormat')||this._get(inst,'dateFormat');var date=this._getDate(inst);dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr);});}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),''];},iso8601Week:function(date){var checkDate=new Date(date.getFullYear(),date.getMonth(),date.getDate());var firstMon=new Date(checkDate.getFullYear(),1-1,4);var firstDay=firstMon.getDay()||7;firstMon.setDate(firstMon.getDate()+1-firstDay);if(firstDay<4&&checkDate<firstMon){checkDate.setDate(checkDate.getDate()-3);return $.datepicker.iso8601Week(checkDate);}else if(checkDate>new Date(checkDate.getFullYear(),12-1,28)){firstDay=new Date(checkDate.getFullYear()+1,1-1,4).getDay()||7;if(firstDay>4&&(checkDate.getDay()||7)<firstDay-3){return 1;}}
+return Math.floor(((checkDate-firstMon)/86400000)/7)+1;},parseDate:function(format,value,settings){if(format==null||value==null)
+throw'Invalid arguments';value=(typeof value=='object'?value.toString():value+'');if(value=='')
+return null;var shortYearCutoff=(settings?settings.shortYearCutoff:null)||this._defaults.shortYearCutoff;var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var year=-1;var month=-1;var day=-1;var doy=-1;var literal=false;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches)
+iFormat++;return matches;};var getNumber=function(match){lookAhead(match);var origSize=(match=='@'?14:(match=='y'?4:(match=='o'?3:2)));var size=origSize;var num=0;while(size>0&&iValue<value.length&&value.charAt(iValue)>='0'&&value.charAt(iValue)<='9'){num=num*10+parseInt(value.charAt(iValue++),10);size--;}
+if(size==origSize)
+throw'Missing number at position '+iValue;return num;};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);var size=0;for(var j=0;j<names.length;j++)
+size=Math.max(size,names[j].length);var name='';var iInit=iValue;while(size>0&&iValue<value.length){name+=value.charAt(iValue++);for(var i=0;i<names.length;i++)
+if(name==names[i])
+return i+1;size--;}
+throw'Unknown name at position '+iInit;};var checkLiteral=function(){if(value.charAt(iValue)!=format.charAt(iFormat))
+throw'Unexpected literal at position '+iValue;iValue++;};var iValue=0;for(var iFormat=0;iFormat<format.length;iFormat++){if(literal)
+if(format.charAt(iFormat)=="'"&&!lookAhead("'"))
+literal=false;else
+checkLiteral();else
+switch(format.charAt(iFormat)){case'd':day=getNumber('d');break;case'D':getName('D',dayNamesShort,dayNames);break;case'o':doy=getNumber('o');break;case'm':month=getNumber('m');break;case'M':month=getName('M',monthNamesShort,monthNames);break;case'y':year=getNumber('y');break;case'@':var date=new Date(getNumber('@'));year=date.getFullYear();month=date.getMonth()+1;day=date.getDate();break;case"'":if(lookAhead("'"))
+checkLiteral();else
+literal=true;break;default:checkLiteral();}}
+if(year==-1)
+year=new Date().getFullYear();else if(year<100)
+year+=new Date().getFullYear()-new Date().getFullYear()%100+
+(year<=shortYearCutoff?0:-100);if(doy>-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim)
+break;month++;day-=dim;}while(true);}
+var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day)
+throw'Invalid date';return date;},ATOM:'yy-mm-dd',COOKIE:'D, dd M yy',ISO_8601:'yy-mm-dd',RFC_822:'D, d M y',RFC_850:'DD, dd-M-y',RFC_1036:'D, d M y',RFC_1123:'D, d M yy',RFC_2822:'D, d M yy',RSS:'D, d M y',TIMESTAMP:'@',W3C:'yy-mm-dd',formatDate:function(format,date,settings){if(!date)
+return'';var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches)
+iFormat++;return matches;};var formatNumber=function(match,value,len){var num=''+value;if(lookAhead(match))
+while(num.length<len)
+num='0'+num;return num;};var formatName=function(match,value,shortNames,longNames){return(lookAhead(match)?longNames[value]:shortNames[value]);};var output='';var literal=false;if(date)
+for(var iFormat=0;iFormat<format.length;iFormat++){if(literal)
+if(format.charAt(iFormat)=="'"&&!lookAhead("'"))
+literal=false;else
+output+=format.charAt(iFormat);else
+switch(format.charAt(iFormat)){case'd':output+=formatNumber('d',date.getDate(),2);break;case'D':output+=formatName('D',date.getDay(),dayNamesShort,dayNames);break;case'o':var doy=date.getDate();for(var m=date.getMonth()-1;m>=0;m--)
+doy+=this._getDaysInMonth(date.getFullYear(),m);output+=formatNumber('o',doy,3);break;case'm':output+=formatNumber('m',date.getMonth()+1,2);break;case'M':output+=formatName('M',date.getMonth(),monthNamesShort,monthNames);break;case'y':output+=(lookAhead('y')?date.getFullYear():(date.getYear()%100<10?'0':'')+date.getYear()%100);break;case'@':output+=date.getTime();break;case"'":if(lookAhead("'"))
+output+="'";else
+literal=true;break;default:output+=format.charAt(iFormat);}}
+return output;},_possibleChars:function(format){var chars='';var literal=false;for(var iFormat=0;iFormat<format.length;iFormat++)
+if(literal)
+if(format.charAt(iFormat)=="'"&&!lookAhead("'"))
+literal=false;else
+chars+=format.charAt(iFormat);else
+switch(format.charAt(iFormat)){case'd':case'm':case'y':case'@':chars+='0123456789';break;case'D':case'M':return null;case"'":if(lookAhead("'"))
+chars+="'";else
+literal=true;break;default:chars+=format.charAt(iFormat);}
+return chars;},_get:function(inst,name){return inst.settings[name]!==undefined?inst.settings[name]:this._defaults[name];},_setDateFromField:function(inst){var dateFormat=this._get(inst,'dateFormat');var dates=inst.input?inst.input.val():null;inst.endDay=inst.endMonth=inst.endYear=null;var date=defaultDate=this._getDefaultDate(inst);var settings=this._getFormatConfig(inst);try{date=this.parseDate(dateFormat,dates,settings)||defaultDate;}catch(event){this.log(event);date=defaultDate;}
+inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();inst.currentDay=(dates?date.getDate():0);inst.currentMonth=(dates?date.getMonth():0);inst.currentYear=(dates?date.getFullYear():0);this._adjustInstDate(inst);},_getDefaultDate:function(inst){var date=this._determineDate(this._get(inst,'defaultDate'),new Date());var minDate=this._getMinMaxDate(inst,'min',true);var maxDate=this._getMinMaxDate(inst,'max');date=(minDate&&date<minDate?minDate:date);date=(maxDate&&date>maxDate?maxDate:date);return date;},_determineDate:function(date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date;};var offsetString=function(offset,getDaysInMonth){var date=new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||'d'){case'd':case'D':day+=parseInt(matches[1],10);break;case'w':case'W':day+=parseInt(matches[1],10)*7;break;case'm':case'M':month+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;case'y':case'Y':year+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;}
+matches=pattern.exec(offset);}
+return new Date(year,month,day);};date=(date==null?defaultDate:(typeof date=='string'?offsetString(date,this._getDaysInMonth):(typeof date=='number'?(isNaN(date)?defaultDate:offsetNumeric(date)):date)));date=(date&&date.toString()=='Invalid Date'?defaultDate:date);if(date){date.setHours(0);date.setMinutes(0);date.setSeconds(0);date.setMilliseconds(0);}
+return this._daylightSavingAdjust(date);},_daylightSavingAdjust:function(date){if(!date)return null;date.setHours(date.getHours()>12?date.getHours()+2:0);return date;},_setDate:function(inst,date,endDate){var clear=!(date);var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;date=this._determineDate(date,new Date());inst.selectedDay=inst.currentDay=date.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=date.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=date.getFullYear();if(origMonth!=inst.selectedMonth||origYear!=inst.selectedYear)
+this._notifyChange(inst);this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?'':this._formatDate(inst));}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=='')?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate;},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,'isRTL');var showButtonPanel=this._get(inst,'showButtonPanel');var hideIfNoPrevNext=this._get(inst,'hideIfNoPrevNext');var navigationAsDateFormat=this._get(inst,'navigationAsDateFormat');var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,'showCurrentAtPos');var stepMonths=this._get(inst,'stepMonths');var stepBigMonths=this._get(inst,'stepBigMonths');var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,'min',true);var maxDate=this._getMinMaxDate(inst,'max');var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--;}
+if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-numMonths[1]+1,maxDate.getDate()));maxDraw=(minDate&&maxDraw<minDate?minDate:maxDraw);while(this._daylightSavingAdjust(new Date(drawYear,drawMonth,1))>maxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--;}}}
+inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,'prevText');prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#'+inst.id+'\', -'+stepMonths+', \'M\');"'+' title="'+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?'e':'w')+'">'+prevText+'</span></a>':(hideIfNoPrevNext?'':'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?'e':'w')+'">'+prevText+'</span></a>'));var nextText=this._get(inst,'nextText');nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,this._daylightSavingAdjust(new Date(drawYear,drawMonth+stepMonths,1)),this._getFormatConfig(inst)));var next=(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#'+inst.id+'\', +'+stepMonths+', \'M\');"'+' title="'+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?'w':'e')+'">'+nextText+'</span></a>':(hideIfNoPrevNext?'':'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?'w':'e')+'">'+nextText+'</span></a>'));var currentText=this._get(inst,'currentText');var gotoDate=(this._get(inst,'gotoCurrent')&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var controls=(!inst.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">'+this._get(inst,'closeText')+'</button>':'');var buttonPanel=(showButtonPanel)?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(isRTL?controls:'')+
+(this._isInRange(inst,gotoDate)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#'+inst.id+'\');"'+'>'+currentText+'</button>':'')+(isRTL?'':controls)+'</div>':'';var firstDay=parseInt(this._get(inst,'firstDay'),10);firstDay=(isNaN(firstDay)?0:firstDay);var dayNames=this._get(inst,'dayNames');var dayNamesShort=this._get(inst,'dayNamesShort');var dayNamesMin=this._get(inst,'dayNamesMin');var monthNames=this._get(inst,'monthNames');var monthNamesShort=this._get(inst,'monthNamesShort');var beforeShowDay=this._get(inst,'beforeShowDay');var showOtherMonths=this._get(inst,'showOtherMonths');var calculateWeek=this._get(inst,'calculateWeek')||this.iso8601Week;var endDate=inst.endDay?this._daylightSavingAdjust(new Date(inst.endYear,inst.endMonth,inst.endDay)):currentDate;var defaultDate=this._getDefaultDate(inst);var html='';for(var row=0;row<numMonths[0];row++){var group='';for(var col=0;col<numMonths[1];col++){var selectedDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,inst.selectedDay));var cornerClass=' ui-corner-all';var calender='';if(isMultiMonth){calender+='<div class="ui-datepicker-group ui-datepicker-group-';switch(col){case 0:calender+='first';cornerClass=' ui-corner-'+(isRTL?'right':'left');break;case numMonths[1]-1:calender+='last';cornerClass=' ui-corner-'+(isRTL?'left':'right');break;default:calender+='middle';cornerClass='';break;}
+calender+='">';}
+calender+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+cornerClass+'">'+
+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):'')+
+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):'')+
+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,row>0||col>0,monthNames,monthNamesShort)+'</div><table class="ui-datepicker-calendar"><thead>'+'<tr>';var thead='';for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+='<th'+((dow+firstDay+6)%7>=5?' class="ui-datepicker-week-end"':'')+'>'+'<span title="'+dayNames[day]+'">'+dayNamesMin[day]+'</span></th>';}
+calender+=thead+'</tr></thead><tbody>';var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth)
+inst.selectedDay=Math.min(inst.selectedDay,daysInMonth);var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow<numRows;dRow++){calender+='<tr>';var tbody='';for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,'']);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=otherMonth||!daySettings[0]||(minDate&&printDate<minDate)||(maxDate&&printDate>maxDate);tbody+='<td class="'+
+((dow+firstDay+6)%7>=5?' ui-datepicker-week-end':'')+
+(otherMonth?' ui-datepicker-other-month':'')+
+((printDate.getTime()==selectedDate.getTime()&&drawMonth==inst.selectedMonth&&inst._keyEvent)||(defaultDate.getTime()==printDate.getTime()&&defaultDate.getTime()==selectedDate.getTime())?' '+this._dayOverClass:'')+
+(unselectable?' '+this._unselectableClass+' ui-state-disabled':'')+
+(otherMonth&&!showOtherMonths?'':' '+daySettings[1]+
+(printDate.getTime()>=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?' '+this._currentClass:'')+
+(printDate.getTime()==today.getTime()?' ui-datepicker-today':''))+'"'+
+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':'')+
+(unselectable?'':' onclick="DP_jQuery.datepicker._selectDay(\'#'+
+inst.id+'\','+drawMonth+','+drawYear+', this);return false;"')+'>'+
+(otherMonth?(showOtherMonths?printDate.getDate():' '):(unselectable?'<span class="ui-state-default">'+printDate.getDate()+'</span>':'<a class="ui-state-default'+
+(printDate.getTime()==today.getTime()?' ui-state-highlight':'')+
+(printDate.getTime()>=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?' ui-state-active':'')+'" href="#">'+printDate.getDate()+'</a>'))+'</td>';printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate);}
+calender+=tbody+'</tr>';}
+drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++;}
+calender+='</tbody></table>'+(isMultiMonth?'</div>'+
+((numMonths[0]>0&&col==numMonths[1]-1)?'<div class="ui-datepicker-row-break"></div>':''):'');group+=calender;}
+html+=group;}
+html+=buttonPanel+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':'');inst._keyEvent=false;return html;},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,secondary,monthNames,monthNamesShort){minDate=(inst.rangeStart&&minDate&&selectedDate<minDate?selectedDate:minDate);var changeMonth=this._get(inst,'changeMonth');var changeYear=this._get(inst,'changeYear');var showMonthAfterYear=this._get(inst,'showMonthAfterYear');var html='<div class="ui-datepicker-title">';var monthHtml='';if(secondary||!changeMonth)
+monthHtml+='<span class="ui-datepicker-month">'+monthNames[drawMonth]+'</span> ';else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='<select class="ui-datepicker-month" '+'onchange="DP_jQuery.datepicker._selectMonthYear(\'#'+inst.id+'\', this, \'M\');" '+'onclick="DP_jQuery.datepicker._clickMonthYear(\'#'+inst.id+'\');"'+'>';for(var month=0;month<12;month++){if((!inMinYear||month>=minDate.getMonth())&&(!inMaxYear||month<=maxDate.getMonth()))
+monthHtml+='<option value="'+month+'"'+
+(month==drawMonth?' selected="selected"':'')+'>'+monthNamesShort[month]+'</option>';}
+monthHtml+='</select>';}
+if(!showMonthAfterYear)
+html+=monthHtml+((secondary||changeMonth||changeYear)&&(!(changeMonth&&changeYear))?' ':'');if(secondary||!changeYear)
+html+='<span class="ui-datepicker-year">'+drawYear+'</span>';else{var years=this._get(inst,'yearRange').split(':');var year=0;var endYear=0;if(years.length!=2){year=drawYear-10;endYear=drawYear+10;}else if(years[0].charAt(0)=='+'||years[0].charAt(0)=='-'){year=drawYear+parseInt(years[0],10);endYear=drawYear+parseInt(years[1],10);}else{year=parseInt(years[0],10);endYear=parseInt(years[1],10);}
+year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);html+='<select class="ui-datepicker-year" '+'onchange="DP_jQuery.datepicker._selectMonthYear(\'#'+inst.id+'\', this, \'Y\');" '+'onclick="DP_jQuery.datepicker._clickMonthYear(\'#'+inst.id+'\');"'+'>';for(;year<=endYear;year++){html+='<option value="'+year+'"'+
+(year==drawYear?' selected="selected"':'')+'>'+year+'</option>';}
+html+='</select>';}
+if(showMonthAfterYear)
+html+=(secondary||changeMonth||changeYear?' ':'')+monthHtml;html+='</div>';return html;},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=='Y'?offset:0);var month=inst.drawMonth+(period=='M'?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+
+(period=='D'?offset:0);var date=this._daylightSavingAdjust(new Date(year,month,day));var minDate=this._getMinMaxDate(inst,'min',true);var maxDate=this._getMinMaxDate(inst,'max');date=(minDate&&date<minDate?minDate:date);date=(maxDate&&date>maxDate?maxDate:date);inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=='M'||period=='Y')
+this._notifyChange(inst);},_notifyChange:function(inst){var onChange=this._get(inst,'onChangeMonthYear');if(onChange)
+onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst]);},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,'numberOfMonths');return(numMonths==null?[1,1]:(typeof numMonths=='number'?[1,numMonths]:numMonths));},_getMinMaxDate:function(inst,minMax,checkRange){var date=this._determineDate(this._get(inst,minMax+'Date'),null);return(!checkRange||!inst.rangeStart?date:(!date||inst.rangeStart>date?inst.rangeStart:date));},_getDaysInMonth:function(year,month){return 32-new Date(year,month,32).getDate();},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay();},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[1]),1));if(offset<0)
+date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()));return this._isInRange(inst,date);},_isInRange:function(inst,date){var newMinDate=(!inst.rangeStart?null:this._daylightSavingAdjust(new Date(inst.selectedYear,inst.selectedMonth,inst.selectedDay)));newMinDate=(newMinDate&&inst.rangeStart<newMinDate?inst.rangeStart:newMinDate);var minDate=newMinDate||this._getMinMaxDate(inst,'min');var maxDate=this._getMinMaxDate(inst,'max');return((!minDate||date>=minDate)&&(!maxDate||date<=maxDate));},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,'shortYearCutoff');shortYearCutoff=(typeof shortYearCutoff!='string'?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,'dayNamesShort'),dayNames:this._get(inst,'dayNames'),monthNamesShort:this._get(inst,'monthNamesShort'),monthNames:this._get(inst,'monthNames')};},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear;}
+var date=(day?(typeof day=='object'?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,'dateFormat'),date,this._getFormatConfig(inst));}});function extendRemove(target,props){$.extend(target,props);for(var name in props)
+if(props[name]==null||props[name]==undefined)
+target[name]=props[name];return target;};function isArray(a){return(a&&(($.browser.safari&&typeof a=='object'&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))));};$.fn.datepicker=function(options){if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find('body').append($.datepicker.dpDiv);$.datepicker.initialized=true;}
+var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=='string'&&(options=='isDisabled'||options=='getDate'))
+return $.datepicker['_'+options+'Datepicker'].apply($.datepicker,[this[0]].concat(otherArgs));if(options=='option'&&arguments.length==2&&typeof arguments[1]=='string')
+return $.datepicker['_'+options+'Datepicker'].apply($.datepicker,[this[0]].concat(otherArgs));return this.each(function(){typeof options=='string'?$.datepicker['_'+options+'Datepicker'].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options);});};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.7.2";window.DP_jQuery=$;})(jQuery);if(!gMsg)var gMsg={};function loadGM(msgSet){for(var i in msgSet){gMsg[i]=msgSet[i];}}
function gM(key,args){var ms='';if(key in gMsg){ms=gMsg[key];if(typeof args=='object'||typeof args=='array'){for(var v in args){var rep='\$'+(parseInt(v)+1);ms=ms.replace(rep,args[v]);}}else if(typeof args=='string'||typeof args=='number'){ms=ms.replace(/\$1/,args);}
return ms;}else{return'['+key+']';}}
$j=jQuery.noConflict();function js2AddOnloadHook(func){$j(document).ready(func);}
\ No newline at end of file
Index: js/plugins.combined.js
===================================================================
--- js/plugins.combined.js (revision 56989)
+++ js/plugins.combined.js (working copy)
@@ -76,8 +76,62 @@
})(jQuery);
-/*
+/**
+ * Plugin that automatically truncates the plain text contents of an element and adds an ellipsis
+ */
+( function( $ ) {
+$.fn.autoEllipse = function( options ) {
+ $(this).each( function() {
+ options = $.extend( {
+ 'position': 'center',
+ 'tooltip': false
+ }, options );
+ var text = $(this).text();
+ var $text = $( '<span />' ).text( text ).css( 'whiteSpace', 'nowrap' );
+ $(this).empty().append( $text );
+ if ( $text.outerWidth() > $(this).innerWidth() ) {
+ switch ( options.position ) {
+ case 'right':
+ var l = text.length;
+ while ( $text.outerWidth() > $(this).innerWidth() && l > 0 ) {
+ $text.text( text.substr( 0, l ) + '...' );
+ l--;
+ }
+ break;
+ case 'center':
+ var i = [Math.round( text.length / 2 ), Math.round( text.length / 2 )];
+ var side = 1; // Begin with making the end shorter
+ while ( $text.outerWidth() > ( $(this).innerWidth() ) && i[0] > 0 ) {
+ $text.text( text.substr( 0, i[0] ) + '...' + text.substr( i[1] ) );
+ // Alternate between trimming the end and begining
+ if ( side == 0 ) {
+ // Make the begining shorter
+ i[0]--;
+ side = 1;
+ } else {
+ // Make the end shorter
+ i[1]++;
+ side = 0;
+ }
+ }
+ break;
+ case 'left':
+ var r = 0;
+ while ( $text.outerWidth() > $(this).innerWidth() && r < text.length ) {
+ $text.text( '...' + text.substr( r ) );
+ r++;
+ }
+ break;
+ }
+ if ( options.tooltip )
+ $text.attr( 'title', text );
+ }
+ } );
+};
+
+} )( jQuery );/*
+
jQuery Browser Plugin
* Version 2.3
* 2008-09-17 19:27:05
@@ -255,7 +309,508 @@
}
};
+(function( $ ) {
/**
+ * Function that escapes spaces in event names. This is needed because
+ * "_delayedBind-foo bar-1000" refers to two events
+ */
+function encodeEvent( event ) {
+ return event.replace( /-/g, '--' ).replace( / /g, '-' );
+}
+
+$.fn.extend( {
+ /**
+ * Bind a callback to an event in a delayed fashion.
+ * In detail, this means that the callback will be called a certain
+ * time after the event fires, but the timer is reset every time
+ * the event fires.
+ * @param timeout Number of milliseconds to wait
+ * @param event Name of the event (string)
+ * @param data Data to pass to the event handler (optional)
+ * @param callback Function to call
+ */
+ delayedBind: function( timeout, event, data, callback ) {
+ var encEvent = encodeEvent( event );
+ return this.each( function() {
+ var that = this;
+ // Bind the top half
+ // Do this only once for every (event, timeout) pair
+ if ( !( $(this).data( '_delayedBindBound-' + encEvent + '-' + timeout ) ) ) {
+ $(this).data( '_delayedBindBound-' + encEvent + '-' + timeout, true );
+ $(this).bind( event, function() {
+ var timerID = $(this).data( '_delayedBindTimerID-' + encEvent + '-' + timeout );
+ // Cancel the running timer
+ if ( typeof timerID != 'undefined' )
+ clearTimeout( timerID );
+ timerID = setTimeout( function() {
+ $(that).trigger( '_delayedBind-' + encEvent + '-' + timeout );
+ }, timeout );
+ $(this).data( '_delayedBindTimerID-' + encEvent + '-' + timeout, timerID );
+ } );
+ }
+
+ // Bottom half
+ $(this).bind( '_delayedBind-' + encEvent + '-' + timeout, data, callback );
+ } );
+ },
+
+ /**
+ * Cancel the timers for delayed events on the selected elements.
+ */
+ delayedBindCancel: function( timeout, event ) {
+ var encEvent = encodeEvent( event );
+ return this.each( function() {
+ var timerID = $(this).data( '_delayedBindTimerID-' + encEvent + '-' + timeout );
+ if ( typeof timerID != 'undefined' )
+ clearTimeout( timerID );
+ } );
+ },
+
+ /**
+ * Unbind an event bound with delayedBind()
+ */
+ delayedBindUnbind: function( timeout, event, callback ) {
+ var encEvent = encodeEvent( event );
+ return this.each( function() {
+ $(this).unbind( '_delayedBind-' + encEvent + '-' + timeout, callback );
+ } );
+ }
+} );
+} )( jQuery );
+/**
+ * Plugin that fills a <select> with namespaces
+ */
+
+(function ($) {
+$.fn.namespaceSelector = function( defaultNS ) {
+ if ( typeof defaultNS == 'undefined' )
+ defaultNS = 0;
+ return this.each( function() {
+ for ( var id in wgFormattedNamespaces ) {
+ var opt = $( '<option />' )
+ .attr( 'value', id )
+ .text( wgFormattedNamespaces[id] );
+ if ( id == defaultNS )
+ opt.attr( 'selected', 'selected' );
+ opt.appendTo( $(this) );
+ }
+ });
+};})(jQuery);
+
+/**
+ * This plugin provides a generic way to add suggestions to a text box.
+ *
+ * Usage:
+ *
+ * Set options:
+ * $('#textbox').suggestions( { option1: value1, option2: value2 } );
+ * $('#textbox').suggestions( option, value );
+ * Get option:
+ * value = $('#textbox').suggestions( option );
+ * Initialize:
+ * $('#textbox').suggestions();
+ *
+ * Options:
+ *
+ * fetch(query): Callback that should fetch suggestions and set the suggestions property. Executed in the context of the
+ * textbox
+ * Type: Function
+ * cancel: Callback function to call when any pending asynchronous suggestions fetches should be canceled.
+ * Executed in the context of the textbox
+ * Type: Function
+ * special: Set of callbacks for rendering and selecting
+ * Type: Object of Functions 'render' and 'select'
+ * result: Set of callbacks for rendering and selecting
+ * Type: Object of Functions 'render' and 'select'
+ * $region: jQuery selection of element to place the suggestions below and match width of
+ * Type: jQuery Object, Default: $(this)
+ * suggestions: Suggestions to display
+ * Type: Array of strings
+ * maxRows: Maximum number of suggestions to display at one time
+ * Type: Number, Range: 1 - 100, Default: 7
+ * delay: Number of ms to wait for the user to stop typing
+ * Type: Number, Range: 0 - 1200, Default: 120
+ */
+( function( $ ) {
+
+$.suggestions = {
+ /**
+ * Cancel any delayed updateSuggestions() call and inform the user so
+ * they can cancel their result fetching if they use AJAX or something
+ */
+ cancel: function( context ) {
+ if ( context.data.timerID != null ) {
+ clearTimeout( context.data.timerID );
+ }
+ if ( typeof context.config.cancel == 'function' ) {
+ context.config.cancel.call( context.data.$textbox );
+ }
+ },
+ /**
+ * Restore the text the user originally typed in the textbox, before it was overwritten by highlight(). This
+ * restores the value the currently displayed suggestions are based on, rather than the value just before
+ * highlight() overwrote it; the former is arguably slightly more sensible.
+ */
+ restore: function( context ) {
+ context.data.$textbox.val( context.data.prevText );
+ },
+ /**
+ * Ask the user-specified callback for new suggestions. Any previous delayed call to this function still pending
+ * will be canceled. If the value in the textbox hasn't changed since the last time suggestions were fetched, this
+ * function does nothing.
+ * @param {Boolean} delayed Whether or not to delay this by the currently configured amount of time
+ */
+ update: function( context, delayed ) {
+ // Only fetch if the value in the textbox changed
+ function maybeFetch() {
+ if ( context.data.$textbox.val() !== context.data.prevText ) {
+ context.data.prevText = context.data.$textbox.val();
+ if ( typeof context.config.fetch == 'function' ) {
+ context.config.fetch.call( context.data.$textbox, context.data.$textbox.val() );
+ }
+ }
+ }
+ // Cancel previous call
+ if ( context.data.timerID != null ) {
+ clearTimeout( context.data.timerID );
+ }
+ if ( delayed ) {
+ // Start a new asynchronous call
+ context.data.timerID = setTimeout( maybeFetch, context.config.delay );
+ } else {
+ maybeFetch();
+ }
+ $.suggestions.special( context );
+ },
+ special: function( context ) {
+ // Allow custom rendering - but otherwise don't do any rendering
+ if ( typeof context.config.special.render == 'function' ) {
+ // Wait for the browser to update the value
+ setTimeout( function() {
+ // Render special
+ $special = context.data.$container.find( '.suggestions-special' );
+ context.config.special.render.call( $special, context.data.$textbox.val() );
+ }, 1 );
+ }
+ },
+ /**
+ * Sets the value of a property, and updates the widget accordingly
+ * @param {String} property Name of property
+ * @param {Mixed} value Value to set property with
+ */
+ configure: function( context, property, value ) {
+ // Validate ccontextration using fallback values
+ switch( property ) {
+ case 'fetch':
+ case 'cancel':
+ case 'special':
+ case 'result':
+ case '$region':
+ context.config[property] = value;
+ break;
+ case 'suggestions':
+ context.config[property] = value;
+ // Update suggestions
+ if ( typeof context.data !== 'undefined' ) {
+ if ( context.config.suggestions.length == 0 ) {
+ // Hide the dive when no suggestion exist
+ context.data.$container.hide();
+ } else {
+ // Rebuild the suggestions list
+ context.data.$container.show();
+ // Update the size and position of the list
+ context.data.$container.css( {
+ 'top': context.config.$region.offset().top + context.config.$region.outerHeight(),
+ 'bottom': 'auto',
+ 'width': context.config.$region.outerWidth(),
+ 'height': 'auto',
+ 'left': context.config.$region.offset().left,
+ 'right': 'auto'
+ } );
+ var $results = context.data.$container.children( '.suggestions-results' );
+ $results.empty();
+ for ( var i = 0; i < context.config.suggestions.length; i++ ) {
+ $result = $( '<div />' )
+ .addClass( 'suggestions-result' )
+ .attr( 'rel', i )
+ .data( 'text', context.config.suggestions[i] )
+ .appendTo( $results );
+ // Allow custom rendering
+ if ( typeof context.config.result.render == 'function' ) {
+ context.config.result.render.call( $result, context.config.suggestions[i] );
+ } else {
+ $result.text( context.config.suggestions[i] ).autoEllipse();
+ }
+ }
+ }
+ }
+ break;
+ case 'maxRows':
+ context.config[property] = Math.max( 1, Math.min( 100, value ) );
+ break;
+ case 'delay':
+ context.config[property] = Math.max( 0, Math.min( 12000, value ) );
+ break;
+ case 'submitOnClick':
+ context.config[property] = value ? true : false;
+ break;
+ }
+ },
+ /**
+ * Highlight a result in the results table
+ * @param result <tr> to highlight: jQuery object, or 'prev' or 'next'
+ * @param updateTextbox If true, put the suggestion in the textbox
+ */
+ highlight: function( context, result, updateTextbox ) {
+ var selected = context.data.$container.find( '.suggestions-result-current' )
+ if ( !result.get || selected.get( 0 ) != result.get( 0 ) ) {
+ if ( result == 'prev' ) {
+ result = selected.prev();
+ } else if ( result == 'next' ) {
+ if ( selected.size() == 0 )
+ // No item selected, go to the first one
+ result = context.data.$container.find( '.suggestions-results div:first' );
+ else {
+ result = selected.next();
+ if ( result.size() == 0 )
+ // We were at the last item, stay there
+ result = selected;
+ }
+ }
+ selected.removeClass( 'suggestions-result-current' );
+ result.addClass( 'suggestions-result-current' );
+ }
+ if ( updateTextbox ) {
+ if ( result.size() == 0 ) {
+ $.suggestions.restore( context );
+ } else {
+ context.data.$textbox.val( result.data( 'text' ) );
+
+ // .val() doesn't call any event handlers, so
+ // let the world know what happened
+ context.data.$textbox.change();
+ }
+ }
+ $.suggestions.special( context );
+ },
+ /**
+ * Respond to keypress event
+ * @param {Integer} key Code of key pressed
+ */
+ keypress: function( e, context, key ) {
+ var wasVisible = context.data.$container.is( ':visible' );
+ var preventDefault = false;
+ switch ( key ) {
+ // Arrow down
+ case 40:
+ if ( wasVisible ) {
+ $.suggestions.highlight( context, 'next', true );
+ } else {
+ $.suggestions.update( context, false );
+ }
+ context.data.$textbox.trigger( 'change' );
+ preventDefault = true;
+ break;
+ // Arrow up
+ case 38:
+ if ( wasVisible ) {
+ $.suggestions.highlight( context, 'prev', true );
+ }
+ context.data.$textbox.trigger( 'change' );
+ preventDefault = wasVisible;
+ break;
+ // Escape
+ case 27:
+ context.data.$container.hide();
+ $.suggestions.restore( context );
+ $.suggestions.cancel( context );
+ context.data.$textbox.trigger( 'change' );
+ preventDefault = wasVisible;
+ break;
+ // Enter
+ case 13:
+ context.data.$container.hide();
+ preventDefault = wasVisible;
+ break;
+ default:
+ $.suggestions.update( context, true );
+ break;
+ }
+ if ( preventDefault ) {
+ e.preventDefault();
+ e.stopImmediatePropagation();
+ }
+ }
+};
+$.fn.suggestions = function() {
+
+ // Multi-context fields
+ var returnValue = null;
+ var args = arguments;
+
+ $(this).each( function() {
+
+ /* Construction / Loading */
+
+ var context = $(this).data( 'suggestions-context' );
+ if ( typeof context == 'undefined' ) {
+ context = {
+ config: {
+ 'fetch' : function() {},
+ 'cancel': function() {},
+ 'special': {},
+ 'result': {},
+ '$region': $(this),
+ 'suggestions': [],
+ 'maxRows': 7,
+ 'delay': 1200,
+ 'submitOnClick': false
+ }
+ };
+ }
+
+ /* API */
+
+ // Handle various calling styles
+ if ( args.length > 0 ) {
+ if ( typeof args[0] == 'object' ) {
+ // Apply set of properties
+ for ( key in args[0] ) {
+ $.suggestions.configure( context, key, args[0][key] );
+ }
+ } else if ( typeof args[0] == 'string' ) {
+ if ( args.length > 1 ) {
+ // Set property values
+ $.suggestions.configure( context, args[0], args[1] );
+ } else if ( returnValue == null ) {
+ // Get property values, but don't give access to internal data - returns only the first
+ returnValue = ( args[0] in context.config ? undefined : context.config[args[0]] );
+ }
+ }
+ }
+
+ /* Initialization */
+
+ if ( typeof context.data == 'undefined' ) {
+ context.data = {
+ // ID of running timer
+ 'timerID': null,
+ // Text in textbox when suggestions were last fetched
+ 'prevText': null,
+ // Number of results visible without scrolling
+ 'visibleResults': 0,
+ // Suggestion the last mousedown event occured on
+ 'mouseDownOn': $( [] ),
+ '$textbox': $(this)
+ };
+ context.data.$container = $( '<div />' )
+ .css( {
+ 'top': Math.round( context.data.$textbox.offset().top + context.data.$textbox.outerHeight() ),
+ 'left': Math.round( context.data.$textbox.offset().left ),
+ 'width': context.data.$textbox.outerWidth(),
+ 'display': 'none'
+ } )
+ .mouseover( function( e ) {
+ $.suggestions.highlight( context, $( e.target ).closest( '.suggestions-results div' ), false );
+ } )
+ .addClass( 'suggestions' )
+ .append(
+ $( '<div />' ).addClass( 'suggestions-results' )
+ // Can't use click() because the container div is hidden when the textbox loses focus. Instead,
+ // listen for a mousedown followed by a mouseup on the same div
+ .mousedown( function( e ) {
+ context.data.mouseDownOn = $( e.target ).closest( '.suggestions-results div' );
+ } )
+ .mouseup( function( e ) {
+ var $result = $( e.target ).closest( '.suggestions-results div' );
+ var $other = context.data.mouseDownOn;
+ context.data.mouseDownOn = $( [] );
+ if ( $result.get( 0 ) != $other.get( 0 ) ) {
+ return;
+ }
+ $.suggestions.highlight( context, $result, true );
+ context.data.$container.hide();
+ if ( typeof context.config.result.select == 'function' ) {
+ context.config.result.select.call( $result, context.data.$textbox );
+ }
+ context.data.$textbox.focus();
+ } )
+ )
+ .append(
+ $( '<div />' ).addClass( 'suggestions-special' )
+ // Can't use click() because the container div is hidden when the textbox loses focus. Instead,
+ // listen for a mousedown followed by a mouseup on the same div
+ .mousedown( function( e ) {
+ context.data.mouseDownOn = $( e.target ).closest( '.suggestions-special' );
+ } )
+ .mouseup( function( e ) {
+ var $special = $( e.target ).closest( '.suggestions-special' );
+ var $other = context.data.mouseDownOn;
+ context.data.mouseDownOn = $( [] );
+ if ( $special.get( 0 ) != $other.get( 0 ) ) {
+ return;
+ }
+ context.data.$container.hide();
+ if ( typeof context.config.special.select == 'function' ) {
+ context.config.special.select.call( $special, context.data.$textbox );
+ }
+ context.data.$textbox.focus();
+ } )
+ )
+ .appendTo( $( 'body' ) );
+ $(this)
+ // Stop browser autocomplete from interfering
+ .attr( 'autocomplete', 'off')
+ .keydown( function( e ) {
+ // Store key pressed to handle later
+ context.data.keypressed = ( e.keyCode == undefined ) ? e.which : e.keyCode;
+ context.data.keypressedCount = 0;
+
+ switch ( context.data.keypressed ) {
+ // This preventDefault logic is duplicated from
+ // $.suggestions.keypress(), which sucks
+ case 40:
+ e.preventDefault();
+ e.stopImmediatePropagation();
+ break;
+ case 38:
+ case 27:
+ case 13:
+ if ( context.data.$container.is( ':visible' ) ) {
+ e.preventDefault();
+ e.stopImmediatePropagation();
+ }
+ }
+ } )
+ .keypress( function( e ) {
+ context.data.keypressedCount++;
+ $.suggestions.keypress( e, context, context.data.keypressed );
+ } )
+ .keyup( function( e ) {
+ // Some browsers won't throw keypress() for arrow keys. If we got a keydown and a keyup without a
+ // keypress in between, solve it
+ if ( context.data.keypressedCount == 0 ) {
+ $.suggestions.keypress( e, context, context.data.keypressed );
+ }
+ } )
+ .blur( function() {
+ // When losing focus because of a mousedown
+ // on a suggestion, don't hide the suggestions
+ if ( context.data.mouseDownOn.size() > 0 ) {
+ return;
+ }
+ context.data.$container.hide();
+ $.suggestions.cancel( context );
+ } );
+ }
+ // Store the context for next time
+ $(this).data( 'suggestions-context', context );
+ } );
+ return returnValue !== null ? returnValue : $(this);
+};
+
+} )( jQuery );
+/**
* These plugins provide extra functionality for interaction with textareas.
*/
( function( $ ) { $.fn.extend( {
@@ -309,11 +864,6 @@
// Do nothing
} else if ( document.selection && document.selection.createRange ) {
// IE/Opera
- if ( document.documentElement && document.documentElement.scrollTop ) {
- var winScroll = document.documentElement.scrollTop;
- } else if ( document.body ) {
- var winScroll = document.body.scrollTop;
- }
$(this).focus();
var range = document.selection.createRange();
if ( ownline && range.moveStart ) {
@@ -341,14 +891,8 @@
range.moveEnd( 'character', - post.length );
}
range.select();
- if ( document.documentElement && document.documentElement.scrollTop ) {
- document.documentElement.scrollTop = winScroll
- } else if ( document.body ) {
- document.body.scrollTop = winScroll;
- }
} else if ( e.selectionStart || e.selectionStart == '0' ) {
// Mozilla
- var textScroll = e.scrollTop;
$(this).focus();
var startPos = e.selectionStart;
var endPos = e.selectionEnd;
@@ -369,8 +913,9 @@
e.selectionStart = startPos + pre.length + selText.length + post.length;
e.selectionEnd = e.selectionStart;
}
- e.scrollTop = textScroll;
}
+ // Scroll the textarea to the inserted text
+ $(this).scrollToCaretPosition();
$(this).trigger( 'encapsulateSelection', [ pre, peri, post, ownline, replace ] );
},
/**
@@ -462,18 +1007,38 @@
}
return getCaret( this.get( 0 ) );
},
+setSelection: function( start, end ) {
+ if ( typeof end == 'undefined' )
+ end = start;
+ return this.each( function() {
+ if ( this.selectionStart || this.selectionStart == '0' ) {
+ this.selectionStart = start;
+ this.selectionEnd = end;
+ } else if ( document.body.createTextRange ) {
+ var selection = document.body.createTextRange;
+ selection.setToElementText( this );
+ var length = selection.text.length;
+ selection.moveStart( 'character', start );
+ selection.moveEnd( 'character', -length + end );
+ selection.select();
+ }
+ });
+},
/**
* Ported from Wikia's LinkSuggest extension
* https://svn.wikia-code.com/wikia/trunk/extensions/wikia/LinkSuggest
*
- * Scroll a textarea to a certain offset
+ * Scroll a textarea to the current cursor position. You can set the cursor
+ * position with setSelection()
* @param pos Byte offset
*/
-scrollToCaretPosition: function( pos ) {
+scrollToCaretPosition: function() {
function getLineLength( e ) {
return Math.floor( e.scrollWidth / ( $.os.name == 'linux' ? 7 : 8 ) );
}
function getCaretScrollPosition( e ) {
+ // FIXME: This functions sucks and is off by a few lines most
+ // of the time. It should be replaced by something decent.
var text = e.value.replace( /\r/g, "" );
var caret = $( e ).getCaretPosition();
var lineLength = getLineLength( e );
@@ -518,33 +1083,26 @@
$(this).focus();
if ( this.selectionStart || this.selectionStart == '0' ) {
// Mozilla
- this.selectionStart = pos;
- this.selectionEnd = pos;
$(this).scrollTop( getCaretScrollPosition( this ) );
} else if ( document.selection && document.selection.createRange ) {
// IE / Opera
/*
- * IE automatically scrolls the section to the bottom of the page,
- * except if it's already in view and the cursor position hasn't
- * changed, in which case it does nothing. In that case we'll force
- * it to act by moving one character back and forth.
+ * IE automatically scrolls the selected text to the
+ * bottom of the textarea at setSelection() time, except
+ * if it was already in view and the cursor position
+ * wasn't changed, in which case it does nothing. To
+ * cover that case, we'll force it to act by moving one
+ * character back and forth.
*/
var range = document.selection.createRange();
- var oldPos = $(this).getCaretPosition();
- var goBack = false;
- if ( oldPos == pos ) {
- pos++;
- goBack = true;
- }
+ var pos = $(this).getCaretPosition();
range.moveToElementText( this );
range.collapse();
- range.move( 'character', pos );
+ range.move( 'character', pos + 1);
range.select();
this.scrollTop += range.offsetTop;
- if ( goBack ) {
- range.move( 'character', -1 );
- range.select();
- }
+ range.move( 'character', -1 );
+ range.select();
}
$(this).trigger( 'scrollToPosition' );
} );
@@ -679,7 +1237,7 @@
}
//Each browser seems to do this differently, so let's keep our editor
//consistent by always starting at the begining
- context.$textarea.scrollToCaretPosition( 0 );
+ context.$textarea.setSelection( 0 ).scrollToCaretPosition();
}
// If there was a configuration passed, it's assumed to be for the addModule
@@ -703,6 +1261,141 @@
return $(this).data( 'wikiEditor-context', context );
};})(jQuery);/**
+ * Extend the RegExp object with an escaping function
+ * From http://simonwillison.net/2006/Jan/20/escape/
+ */
+RegExp.escape = function( s ) { return s.replace(/([.*+?^${}()|\/\\[\]])/g, '\\$1'); };
+
+/**
+ * Dialog Module for wikiEditor
+ */
+( function( $ ) { $.wikiEditor.modules.dialogs = {
+
+/**
+ * API accessible functions
+ */
+api: {
+ addDialog: function( context, data ) {
+ $.wikiEditor.modules.dialogs.fn.create( context, { 'modules': data } )
+ },
+ openDialog: function( context, data ) {
+ if ( data.dialog in $.wikiEditor.modules.dialogs.modules ) {
+ $( '#' + $.wikiEditor.modules.dialogs.modules[data.dialog].id ).dialog( 'open' );
+ }
+ },
+ closeDialog: function( context, data ) {
+ if ( data.dialog in $.wikiEditor.modules.dialogs.modules ) {
+ $( '#' + $.wikiEditor.modules.dialogs.modules[data.dialog].id ).dialog( 'close' );
+ }
+ }
+},
+/**
+ * Internally used functions
+ */
+fn: {
+ /**
+ * Creates a dialog module within a wikiEditor
+ *
+ * @param {Object} context Context object of editor to create module in
+ * @param {Object} config Configuration object to create module from
+ */
+ create: function( context, config ) {
+ // Add modules
+ for ( module in config ) {
+ $.wikiEditor.modules.dialogs.modules[module] = config[module];
+ }
+ // Build out modules immediately
+ for ( module in $.wikiEditor.modules.dialogs.modules ) {
+ var module = $.wikiEditor.modules.dialogs.modules[module];
+ // Only create the dialog if it doesn't exist yet
+ if ( $( '#' + module.id ).size() == 0 ) {
+ var configuration = module.dialog;
+ // Add some stuff to configuration
+ configuration.bgiframe = true;
+ configuration.autoOpen = false;
+ configuration.modal = true;
+ configuration.title = $.wikiEditor.autoMsg( module, 'title' );
+ // Transform messages in keys
+ // Stupid JS won't let us do stuff like
+ // foo = { gM ('bar'): baz }
+ configuration.newButtons = {};
+ for ( msg in configuration.buttons )
+ configuration.newButtons[gM( msg )] = configuration.buttons[msg];
+ configuration.buttons = configuration.newButtons;
+ // Create the dialog <div>
+ $( '<div /> ' )
+ .attr( 'id', module.id )
+ .html( module.html )
+ .data( 'context', context )
+ .appendTo( $( 'body' ) )
+ .each( module.init )
+ .dialog( configuration )
+ .bind( 'dialogopen', $.wikiEditor.modules.dialogs.fn.resize )
+ .find( '.ui-tabs' ).bind( 'tabsshow', function() {
+ $(this).closest( '.ui-dialog-content' ).each(
+ $.wikiEditor.modules.dialogs.fn.resize );
+ });
+
+ // Add tabindexes to dialog form elements
+ // Find the highest tabindex in use
+ var maxTI = 0;
+ $j( '[tabindex]' ).each( function() {
+ var ti = parseInt( $j(this).attr( 'tabindex' ) );
+ if ( ti > maxTI )
+ maxTI = ti;
+ });
+
+ var tabIndex = maxTI + 1;
+ $j( '.ui-dialog input, .ui-dialog button' )
+ .not( '[tabindex]' )
+ .each( function() {
+ $j(this).attr( 'tabindex', tabIndex++ );
+ });
+ }
+ }
+ },
+
+ /**
+ * Resize a dialog so its contents fit
+ *
+ * Usage: dialog.each( resize ); or dialog.bind( 'blah', resize );
+ */
+ resize: function() {
+ var wrapper = $(this).closest( '.ui-dialog' );
+ // Make sure elements don't wrapped so we get an accurate idea
+ // of whether they really fit. Also temporarily show hidden
+ // elements.
+
+ // Work around jQuery bug where <div style="display:inline;" />
+ // inside a dialog is both :visible and :hidden
+ var oldHidden = $(this).find( '*' ).not( ':visible' );
+
+ // Save the style attributes of the hidden elements to restore
+ // them later. Calling hide() after show() messes up for
+ // elements hidden with a class
+ oldHidden.each( function() {
+ $(this).data( 'oldstyle', $(this).attr( 'style' ) );
+ });
+ oldHidden.show();
+ var oldWS = $(this).css( 'white-space' );
+ $(this).css( 'white-space', 'nowrap' );
+
+ if ( wrapper.width() <= $(this).get(0).scrollWidth ) {
+ $(this).width( $(this).get(0).scrollWidth );
+ wrapper.width( wrapper.get(0).scrollWidth );
+ $(this).dialog( { 'width': wrapper.width() } );
+ }
+
+ $(this).css( 'white-space', oldWS );
+ oldHidden.each( function() {
+ $(this).attr( 'style', $(this).data( 'oldstyle' ) );
+ });
+ }
+},
+'modules': {}
+
+}; } ) ( jQuery );
+/**
* Toolbar module for wikiEditor
*/
( function( $ ) { $.wikiEditor.modules.toolbar = {
@@ -1313,7 +2006,7 @@
$.wikiEditor.modules.toc.fn.build( context );
$.wikiEditor.modules.toc.fn.update( context );
context.$textarea
- .bind( 'keyup encapsulateSelection',
+ .delayedBind( 1000, 'keyup encapsulateSelection',
function( event ) {
var context = $(this).data( 'wikiEditor-context' );
$(this).eachAsync( {
@@ -1325,7 +2018,7 @@
} );
}
)
- .bind( 'mouseup scrollToPosition focus',
+ .bind( 'mouseup scrollToPosition focus keyup encapsulateSelection',
function( event ) {
var context = $(this).data( 'wikiEditor-context' );
$(this).eachAsync( {
@@ -1414,7 +2107,9 @@
.data( 'textbox', context.$textarea )
.data( 'position', structure[i].position )
.click( function( event ) {
- $(this).data( 'textbox' ).scrollToCaretPosition( $(this).data( 'position' ) );
+ $(this).data( 'textbox' )
+ .setSelection( $(this).data( 'position' ) )
+ .scrollToCaretPosition();
event.preventDefault();
} )
.text( structure[i].text )
@@ -1478,7 +2173,7 @@
if ( outline[i].level > lastLevel ) {
nLevel++;
}
- else if ( outline[i].level < nLevel ) {
+ else if ( outline[i].level < lastLevel ) {
nLevel -= Math.max( 1, lastLevel - outline[i].level );
}
if ( nLevel <= 0 ) {
@@ -1493,6 +2188,7 @@
if ( $( 'input[name=wpSection]' ).val() == '' )
structure.unshift( { 'text': wgPageName.replace(/_/g, ' '), 'level': 1, 'index': 0, 'position': 0 } );
context.modules.$toc.html( buildList( structure ) );
+ context.modules.$toc.find( 'ul a' ).autoEllipse( { 'position': 'right', 'tooltip': true } );
// Cache the outline for later use
context.data.outline = outline;
}
Index: js/plugins.combined.min.js
===================================================================
--- js/plugins.combined.min.js (revision 56989)
+++ js/plugins.combined.min.js (working copy)
@@ -11,45 +11,80 @@
{var i=0,l=array.length,loop=opts.loop||function(){};$.whileAsync($.extend(opts,{test:function(){return i<l;},loop:function()
{var val=array[i];return loop.call(val,i++,val);}}));}
$.fn.eachAsync=function(opts)
-{$.eachAsync(this,opts);return this;}})(jQuery);(function($){$.browserTest=function(a,z){var u='unknown',x='X',m=function(r,h){for(var i=0;i<h.length;i=i+1){r=r.replace(h[i][0],h[i][1]);}
+{$.eachAsync(this,opts);return this;}})(jQuery);(function($){$.fn.autoEllipse=function(options){$(this).each(function(){options=$.extend({'position':'center','tooltip':false},options);var text=$(this).text();var $text=$('<span />').text(text).css('whiteSpace','nowrap');$(this).empty().append($text);if($text.outerWidth()>$(this).innerWidth()){switch(options.position){case'right':var l=text.length;while($text.outerWidth()>$(this).innerWidth()&&l>0){$text.text(text.substr(0,l)+'...');l--;}
+break;case'center':var i=[Math.round(text.length/2),Math.round(text.length/2)];var side=1;while($text.outerWidth()>($(this).innerWidth())&&i[0]>0){$text.text(text.substr(0,i[0])+'...'+text.substr(i[1]));if(side==0){i[0]--;side=1;}else{i[1]++;side=0;}}
+break;case'left':var r=0;while($text.outerWidth()>$(this).innerWidth()&&r<text.length){$text.text('...'+text.substr(r));r++;}
+break;}
+if(options.tooltip)
+$text.attr('title',text);}});};})(jQuery);(function($){$.browserTest=function(a,z){var u='unknown',x='X',m=function(r,h){for(var i=0;i<h.length;i=i+1){r=r.replace(h[i][0],h[i][1]);}
return r;},c=function(i,a,b,c){var r={name:m((a.exec(i)||[u,u])[1],b)};r[r.name]=true;r.version=(c.exec(i)||[x,x,x,x])[3];if(r.name.match(/safari/)&&r.version>400){r.version='2.0';}
if(r.name==='presto'){r.version=($.browser.version>9.27)?'futhark':'linear_b';}
r.versionNumber=parseFloat(r.version,10)||0;r.versionX=(r.version!==x)?(r.version+'').substr(0,1):x;r.className=r.name+r.versionX;return r;};a=(a.match(/Opera|Navigator|Minefield|KHTML|Chrome/)?m(a,[[/(Firefox|MSIE|KHTML,\slike\sGecko|Konqueror)/,''],['Chrome Safari','Chrome'],['KHTML','Konqueror'],['Minefield','Firefox'],['Navigator','Netscape']]):a).toLowerCase();$.browser=$.extend((!z)?$.browser:{},c(a,/(camino|chrome|firefox|netscape|konqueror|lynx|msie|opera|safari)/,[],/(camino|chrome|firefox|netscape|netscape6|opera|version|konqueror|lynx|msie|safari)(\/|\s)([a-z0-9\.\+]*?)(\;|dev|rel|\s|$)/));$.layout=c(a,/(gecko|konqueror|msie|opera|webkit)/,[['konqueror','khtml'],['msie','trident'],['opera','presto']],/(applewebkit|rv|konqueror|msie)(\:|\/|\s)([a-z0-9\.]*?)(\;|\)|\s)/);$.os={name:(/(win|mac|linux|sunos|solaris|iphone)/.exec(navigator.platform.toLowerCase())||[u])[0].replace('sunos','solaris')};if(!z){$('html').addClass([$.os.name,$.browser.name,$.browser.className,$.layout.name,$.layout.className].join(' '));}};$.browserTest(navigator.userAgent);})(jQuery);jQuery.cookie=function(name,value,options){if(typeof value!='undefined'){options=options||{};if(value===null){value='';options.expires=-1;}
var expires='';if(options.expires&&(typeof options.expires=='number'||options.expires.toUTCString)){var date;if(typeof options.expires=='number'){date=new Date();date.setTime(date.getTime()+(options.expires*24*60*60*1000));}else{date=options.expires;}
expires='; expires='+date.toUTCString();}
var path=options.path?'; path='+(options.path):'';var domain=options.domain?'; domain='+(options.domain):'';var secure=options.secure?'; secure':'';document.cookie=[name,'=',encodeURIComponent(value),expires,path,domain,secure].join('');}else{var cookieValue=null;if(document.cookie&&document.cookie!=''){var cookies=document.cookie.split(';');for(var i=0;i<cookies.length;i++){var cookie=jQuery.trim(cookies[i]);if(cookie.substring(0,name.length+1)==(name+'=')){cookieValue=decodeURIComponent(cookie.substring(name.length+1));break;}}}
-return cookieValue;}};(function($){$.fn.extend({getSelection:function(){var e=this.jquery?this[0]:this;var retval='';if(e.style.display=='none'){}else if(document.selection&&document.selection.createRange){var range=document.selection.createRange();retval=range.text;}else if(e.selectionStart||e.selectionStart=='0'){retval=e.value.substring(e.selectionStart,e.selectionEnd);}
+return cookieValue;}};(function($){function encodeEvent(event){return event.replace(/-/g,'--').replace(/ /g,'-');}
+$.fn.extend({delayedBind:function(timeout,event,data,callback){var encEvent=encodeEvent(event);return this.each(function(){var that=this;if(!($(this).data('_delayedBindBound-'+encEvent+'-'+timeout))){$(this).data('_delayedBindBound-'+encEvent+'-'+timeout,true);$(this).bind(event,function(){var timerID=$(this).data('_delayedBindTimerID-'+encEvent+'-'+timeout);if(typeof timerID!='undefined')
+clearTimeout(timerID);timerID=setTimeout(function(){$(that).trigger('_delayedBind-'+encEvent+'-'+timeout);},timeout);$(this).data('_delayedBindTimerID-'+encEvent+'-'+timeout,timerID);});}
+$(this).bind('_delayedBind-'+encEvent+'-'+timeout,data,callback);});},delayedBindCancel:function(timeout,event){var encEvent=encodeEvent(event);return this.each(function(){var timerID=$(this).data('_delayedBindTimerID-'+encEvent+'-'+timeout);if(typeof timerID!='undefined')
+clearTimeout(timerID);});},delayedBindUnbind:function(timeout,event,callback){var encEvent=encodeEvent(event);return this.each(function(){$(this).unbind('_delayedBind-'+encEvent+'-'+timeout,callback);});}});})(jQuery);(function($){$.fn.namespaceSelector=function(defaultNS){if(typeof defaultNS=='undefined')
+defaultNS=0;return this.each(function(){for(var id in wgFormattedNamespaces){var opt=$('<option />').attr('value',id).text(wgFormattedNamespaces[id]);if(id==defaultNS)
+opt.attr('selected','selected');opt.appendTo($(this));}});};})(jQuery);(function($){$.suggestions={cancel:function(context){if(context.data.timerID!=null){clearTimeout(context.data.timerID);}
+if(typeof context.config.cancel=='function'){context.config.cancel.call(context.data.$textbox);}},restore:function(context){context.data.$textbox.val(context.data.prevText);},update:function(context,delayed){function maybeFetch(){if(context.data.$textbox.val()!==context.data.prevText){context.data.prevText=context.data.$textbox.val();if(typeof context.config.fetch=='function'){context.config.fetch.call(context.data.$textbox,context.data.$textbox.val());}}}
+if(context.data.timerID!=null){clearTimeout(context.data.timerID);}
+if(delayed){context.data.timerID=setTimeout(maybeFetch,context.config.delay);}else{maybeFetch();}
+$.suggestions.special(context);},special:function(context){if(typeof context.config.special.render=='function'){setTimeout(function(){$special=context.data.$container.find('.suggestions-special');context.config.special.render.call($special,context.data.$textbox.val());},1);}},configure:function(context,property,value){switch(property){case'fetch':case'cancel':case'special':case'result':case'$region':context.config[property]=value;break;case'suggestions':context.config[property]=value;if(typeof context.data!=='undefined'){if(context.config.suggestions.length==0){context.data.$container.hide();}else{context.data.$container.show();context.data.$container.css({'top':context.config.$region.offset().top+context.config.$region.outerHeight(),'bottom':'auto','width':context.config.$region.outerWidth(),'height':'auto','left':context.config.$region.offset().left,'right':'auto'});var $results=context.data.$container.children('.suggestions-results');$results.empty();for(var i=0;i<context.config.suggestions.length;i++){$result=$('<div />').addClass('suggestions-result').attr('rel',i).data('text',context.config.suggestions[i]).appendTo($results);if(typeof context.config.result.render=='function'){context.config.result.render.call($result,context.config.suggestions[i]);}else{$result.text(context.config.suggestions[i]).autoEllipse();}}}}
+break;case'maxRows':context.config[property]=Math.max(1,Math.min(100,value));break;case'delay':context.config[property]=Math.max(0,Math.min(12000,value));break;case'submitOnClick':context.config[property]=value?true:false;break;}},highlight:function(context,result,updateTextbox){var selected=context.data.$container.find('.suggestions-result-current')
+if(!result.get||selected.get(0)!=result.get(0)){if(result=='prev'){result=selected.prev();}else if(result=='next'){if(selected.size()==0)
+result=context.data.$container.find('.suggestions-results div:first');else{result=selected.next();if(result.size()==0)
+result=selected;}}
+selected.removeClass('suggestions-result-current');result.addClass('suggestions-result-current');}
+if(updateTextbox){if(result.size()==0){$.suggestions.restore(context);}else{context.data.$textbox.val(result.data('text'));context.data.$textbox.change();}}
+$.suggestions.special(context);},keypress:function(e,context,key){var wasVisible=context.data.$container.is(':visible');var preventDefault=false;switch(key){case 40:if(wasVisible){$.suggestions.highlight(context,'next',true);}else{$.suggestions.update(context,false);}
+context.data.$textbox.trigger('change');preventDefault=true;break;case 38:if(wasVisible){$.suggestions.highlight(context,'prev',true);}
+context.data.$textbox.trigger('change');preventDefault=wasVisible;break;case 27:context.data.$container.hide();$.suggestions.restore(context);$.suggestions.cancel(context);context.data.$textbox.trigger('change');preventDefault=wasVisible;break;case 13:context.data.$container.hide();preventDefault=wasVisible;break;default:$.suggestions.update(context,true);break;}
+if(preventDefault){e.preventDefault();e.stopImmediatePropagation();}}};$.fn.suggestions=function(){var returnValue=null;var args=arguments;$(this).each(function(){var context=$(this).data('suggestions-context');if(typeof context=='undefined'){context={config:{'fetch':function(){},'cancel':function(){},'special':{},'result':{},'$region':$(this),'suggestions':[],'maxRows':7,'delay':1200,'submitOnClick':false}};}
+if(args.length>0){if(typeof args[0]=='object'){for(key in args[0]){$.suggestions.configure(context,key,args[0][key]);}}else if(typeof args[0]=='string'){if(args.length>1){$.suggestions.configure(context,args[0],args[1]);}else if(returnValue==null){returnValue=(args[0]in context.config?undefined:context.config[args[0]]);}}}
+if(typeof context.data=='undefined'){context.data={'timerID':null,'prevText':null,'visibleResults':0,'mouseDownOn':$([]),'$textbox':$(this)};context.data.$container=$('<div />').css({'top':Math.round(context.data.$textbox.offset().top+context.data.$textbox.outerHeight()),'left':Math.round(context.data.$textbox.offset().left),'width':context.data.$textbox.outerWidth(),'display':'none'}).mouseover(function(e){$.suggestions.highlight(context,$(e.target).closest('.suggestions-results div'),false);}).addClass('suggestions').append($('<div />').addClass('suggestions-results').mousedown(function(e){context.data.mouseDownOn=$(e.target).closest('.suggestions-results div');}).mouseup(function(e){var $result=$(e.target).closest('.suggestions-results div');var $other=context.data.mouseDownOn;context.data.mouseDownOn=$([]);if($result.get(0)!=$other.get(0)){return;}
+$.suggestions.highlight(context,$result,true);context.data.$container.hide();if(typeof context.config.result.select=='function'){context.config.result.select.call($result,context.data.$textbox);}
+context.data.$textbox.focus();})).append($('<div />').addClass('suggestions-special').mousedown(function(e){context.data.mouseDownOn=$(e.target).closest('.suggestions-special');}).mouseup(function(e){var $special=$(e.target).closest('.suggestions-special');var $other=context.data.mouseDownOn;context.data.mouseDownOn=$([]);if($special.get(0)!=$other.get(0)){return;}
+context.data.$container.hide();if(typeof context.config.special.select=='function'){context.config.special.select.call($special,context.data.$textbox);}
+context.data.$textbox.focus();})).appendTo($('body'));$(this).attr('autocomplete','off').keydown(function(e){context.data.keypressed=(e.keyCode==undefined)?e.which:e.keyCode;context.data.keypressedCount=0;switch(context.data.keypressed){case 40:e.preventDefault();e.stopImmediatePropagation();break;case 38:case 27:case 13:if(context.data.$container.is(':visible')){e.preventDefault();e.stopImmediatePropagation();}}}).keypress(function(e){context.data.keypressedCount++;$.suggestions.keypress(e,context,context.data.keypressed);}).keyup(function(e){if(context.data.keypressedCount==0){$.suggestions.keypress(e,context,context.data.keypressed);}}).blur(function(){if(context.data.mouseDownOn.size()>0){return;}
+context.data.$container.hide();$.suggestions.cancel(context);});}
+$(this).data('suggestions-context',context);});return returnValue!==null?returnValue:$(this);};})(jQuery);(function($){$.fn.extend({getSelection:function(){var e=this.jquery?this[0]:this;var retval='';if(e.style.display=='none'){}else if(document.selection&&document.selection.createRange){var range=document.selection.createRange();retval=range.text;}else if(e.selectionStart||e.selectionStart=='0'){retval=e.value.substring(e.selectionStart,e.selectionEnd);}
return retval;},encapsulateSelection:function(pre,peri,post,ownline,replace){function checkSelectedText(){if(!selText){selText=peri;isSample=true;}else if(replace){selText=peri;}else if(selText.charAt(selText.length-1)==' '){selText=selText.substring(0,selText.length-1);post+=' '}}
-var e=this.jquery?this[0]:this;var selText=$(this).getSelection();var isSample=false;if(e.style.display=='none'){}else if(document.selection&&document.selection.createRange){if(document.documentElement&&document.documentElement.scrollTop){var winScroll=document.documentElement.scrollTop;}else if(document.body){var winScroll=document.body.scrollTop;}
-$(this).focus();var range=document.selection.createRange();if(ownline&&range.moveStart){var range2=document.selection.createRange();range2.collapse();range2.moveStart('character',-1);if(range2.text!="\r"&&range2.text!="\n"&&range3.text!=""){pre="\n"+pre;}
+var e=this.jquery?this[0]:this;var selText=$(this).getSelection();var isSample=false;if(e.style.display=='none'){}else if(document.selection&&document.selection.createRange){$(this).focus();var range=document.selection.createRange();if(ownline&&range.moveStart){var range2=document.selection.createRange();range2.collapse();range2.moveStart('character',-1);if(range2.text!="\r"&&range2.text!="\n"&&range3.text!=""){pre="\n"+pre;}
var range3=document.selection.createRange();range3.collapse(false);range3.moveEnd('character',1);if(range3.text!="\r"&&range3.text!="\n"&&range3.text!=""){post+="\n";}}
checkSelectedText();range.text=pre+selText+post;if(isSample&&range.moveStart){if(window.opera){post=post.replace(/\n/g,'');}
range.moveStart('character',-post.length-selText.length);range.moveEnd('character',-post.length);}
-range.select();if(document.documentElement&&document.documentElement.scrollTop){document.documentElement.scrollTop=winScroll}else if(document.body){document.body.scrollTop=winScroll;}}else if(e.selectionStart||e.selectionStart=='0'){var textScroll=e.scrollTop;$(this).focus();var startPos=e.selectionStart;var endPos=e.selectionEnd;checkSelectedText();if(ownline){if(startPos!=0&&e.value.charAt(startPos-1)!="\n"){pre="\n"+pre;}
+range.select();}else if(e.selectionStart||e.selectionStart=='0'){$(this).focus();var startPos=e.selectionStart;var endPos=e.selectionEnd;checkSelectedText();if(ownline){if(startPos!=0&&e.value.charAt(startPos-1)!="\n"){pre="\n"+pre;}
if(e.value.charAt(endPos)!="\n"){post+="\n";}}
-e.value=e.value.substring(0,startPos)+pre+selText+post+e.value.substring(endPos,e.value.length);if(isSample){e.selectionStart=startPos+pre.length;e.selectionEnd=startPos+pre.length+selText.length;}else{e.selectionStart=startPos+pre.length+selText.length+post.length;e.selectionEnd=e.selectionStart;}
-e.scrollTop=textScroll;}
-$(this).trigger('encapsulateSelection',[pre,peri,post,ownline,replace]);},getCaretPosition:function(){function getCaret(e){var caretPos=0;if($.browser.msie){var postFinished=false;var periFinished=false;var postFinished=false;var preText,rawPreText,periText;var rawPeriText,postText,rawPostText;var periRange=document.selection.createRange().duplicate();var preRange=document.body.createTextRange();preRange.moveToElementText(e);preRange.setEndPoint("EndToStart",periRange);var postRange=document.body.createTextRange();postRange.moveToElementText(e);postRange.setEndPoint("StartToEnd",periRange);preText=rawPreText=preRange.text;periText=rawPeriText=periRange.text;postText=rawPostText=postRange.text;do{if(!postFinished){if(preRange.compareEndPoints("StartToEnd",preRange)==0){postFinished=true;}else{preRange.moveEnd("character",-1)
+e.value=e.value.substring(0,startPos)+pre+selText+post+e.value.substring(endPos,e.value.length);if(isSample){e.selectionStart=startPos+pre.length;e.selectionEnd=startPos+pre.length+selText.length;}else{e.selectionStart=startPos+pre.length+selText.length+post.length;e.selectionEnd=e.selectionStart;}}
+$(this).scrollToCaretPosition();$(this).trigger('encapsulateSelection',[pre,peri,post,ownline,replace]);},getCaretPosition:function(){function getCaret(e){var caretPos=0;if($.browser.msie){var postFinished=false;var periFinished=false;var postFinished=false;var preText,rawPreText,periText;var rawPeriText,postText,rawPostText;var periRange=document.selection.createRange().duplicate();var preRange=document.body.createTextRange();preRange.moveToElementText(e);preRange.setEndPoint("EndToStart",periRange);var postRange=document.body.createTextRange();postRange.moveToElementText(e);postRange.setEndPoint("StartToEnd",periRange);preText=rawPreText=preRange.text;periText=rawPeriText=periRange.text;postText=rawPostText=postRange.text;do{if(!postFinished){if(preRange.compareEndPoints("StartToEnd",preRange)==0){postFinished=true;}else{preRange.moveEnd("character",-1)
if(preRange.text==preText){rawPreText+="\r\n";}else{postFinished=true;}}}
if(!periFinished){if(periRange.compareEndPoints("StartToEnd",periRange)==0){periFinished=true;}else{periRange.moveEnd("character",-1)
if(periRange.text==periText){rawPeriText+="\r\n";}else{periFinished=true;}}}
if(!postFinished){if(postRange.compareEndPoints("StartToEnd",postRange)==0){postFinished=true;}else{postRange.moveEnd("character",-1)
if(postRange.text==postText){rawPostText+="\r\n";}else{postFinished=true;}}}}while((!postFinished||!periFinished||!postFinished));caretPos=rawPreText.replace(/\r\n/g,"\n").length;}else if(e.selectionStart||e.selectionStart=='0'){caretPos=e.selectionStart;}
return caretPos;}
-return getCaret(this.get(0));},scrollToCaretPosition:function(pos){function getLineLength(e){return Math.floor(e.scrollWidth/($.os.name=='linux'?7:8));}
+return getCaret(this.get(0));},setSelection:function(start,end){if(typeof end=='undefined')
+end=start;return this.each(function(){if(this.selectionStart||this.selectionStart=='0'){this.selectionStart=start;this.selectionEnd=end;}else if(document.body.createTextRange){var selection=document.body.createTextRange;selection.setToElementText(this);var length=selection.text.length;selection.moveStart('character',start);selection.moveEnd('character',-length+end);selection.select();}});},scrollToCaretPosition:function(){function getLineLength(e){return Math.floor(e.scrollWidth/($.os.name=='linux'?7:8));}
function getCaretScrollPosition(e){var text=e.value.replace(/\r/g,"");var caret=$(e).getCaretPosition();var lineLength=getLineLength(e);var row=0;var charInLine=0;var lastSpaceInLine=0;for(i=0;i<caret;i++){charInLine++;if(text.charAt(i)==" "){lastSpaceInLine=charInLine;}else if(text.charAt(i)=="\n"){lastSpaceInLine=0;charInLine=0;row++;}
if(charInLine>lineLength){if(lastSpaceInLine>0){charInLine=charInLine-lastSpaceInLine;lastSpaceInLine=0;row++;}}}
var nextSpace=0;for(j=caret;j<caret+lineLength;j++){if(text.charAt(j)==" "||text.charAt(j)=="\n"||caret==text.length){nextSpace=j;break;}}
if(nextSpace>lineLength&&caret<=lineLength){charInLine=caret-lastSpaceInLine;row++;}
return($.os.name=='mac'?13:($.os.name=='linux'?15:16))*row;}
-return this.each(function(){$(this).focus();if(this.selectionStart||this.selectionStart=='0'){this.selectionStart=pos;this.selectionEnd=pos;$(this).scrollTop(getCaretScrollPosition(this));}else if(document.selection&&document.selection.createRange){var range=document.selection.createRange();var oldPos=$(this).getCaretPosition();var goBack=false;if(oldPos==pos){pos++;goBack=true;}
-range.moveToElementText(this);range.collapse();range.move('character',pos);range.select();this.scrollTop+=range.offsetTop;if(goBack){range.move('character',-1);range.select();}}
+return this.each(function(){$(this).focus();if(this.selectionStart||this.selectionStart=='0'){$(this).scrollTop(getCaretScrollPosition(this));}else if(document.selection&&document.selection.createRange){var range=document.selection.createRange();var pos=$(this).getCaretPosition();range.moveToElementText(this);range.collapse();range.move('character',pos+1);range.select();this.scrollTop+=range.offsetTop;range.move('character',-1);range.select();}
$(this).trigger('scrollToPosition');});}});})(jQuery);(function($){$.wikiEditor={'modules':{},'instances':[],'supportedBrowsers':{'ltr':{'msie':7,'firefox':2,'opera':9,'safari':3,'chrome':1,'camino':1},'rtl':{'msie':8,'firefox':2,'opera':9,'safari':3,'chrome':1,'camino':1}},imgPath:wgScriptPath+'/extensions/UsabilityInitiative/images/wikiEditor/'};$.wikiEditor.isSupportKnown=function(){return(function(supportedBrowsers){return $.browser.name in supportedBrowsers;})($.wikiEditor.supportedBrowsers[$('body.rtl').size()?'rtl':'ltr']);};$.wikiEditor.isSupported=function(){return(function(supportedBrowsers){return $.browser.name in supportedBrowsers&&$.browser.versionNumber>=supportedBrowsers[$.browser.name];})($.wikiEditor.supportedBrowsers[$('body.rtl').size()?'rtl':'ltr']);};$.wikiEditor.autoMsg=function(object,property){if(typeof property=='object'){for(i in property){if(property[i]in object||property[i]+'Msg'in object){property=property[i];break;}}}
if(property in object){return object[property];}else if(property+'Msg'in object){return gM(object[property+'Msg']);}else{return'';}};$.fn.wikiEditor=function(){var context=$(this).data('wikiEditor-context');if(typeof context=='undefined'){var instance=$.wikiEditor.instances.length;context={'$textarea':$(this),'modules':{},'data':{},'instance':instance};$.wikiEditor.instances[instance]=$(this);$(this).wrap($('<div></div>').addClass('wikiEditor-ui').attr('id','wikiEditor-ui')).wrap($('<div></div>').addClass('wikiEditor-ui-bottom').attr('id','wikiEditor-ui-bottom')).wrap($('<div></div>').addClass('wikiEditor-ui-text').attr('id','wikiEditor-ui-text'));context.$ui=$(this).parent().parent().parent();context.$ui.after($('<div style="clear:both;"></div>'));context.$ui.prepend($('<div></div>').addClass('wikiEditor-ui-top').attr('id','wikiEditor-ui-top'));context.api={addModule:function(context,data){function callModuleApi(module,call,data){if(module in $.wikiEditor.modules&&'fn'in $.wikiEditor.modules[module]&&call in $.wikiEditor.modules[module].fn){$.wikiEditor.modules[module].fn[call](context,data);}}
if(typeof data=='string'){callModuleApi(data,'create',{});}else if(typeof data=='object'){for(module in data){if(typeof module=='string'){callModuleApi(module,'create',data[module]);}}}}};for(module in $.wikiEditor.modules){if('api'in $.wikiEditor.modules[module]){for(call in $.wikiEditor.modules[module].api){if(!(call in context.api)){context.api[call]=$.wikiEditor.modules[module].api[call];}}}}
-context.$textarea.scrollToCaretPosition(0);}
+context.$textarea.setSelection(0).scrollToCaretPosition();}
if(arguments.length>0&&typeof arguments[0]=='object'){context.api.addModule(context,arguments[0]);}else{arguments=$.makeArray(arguments);if(arguments.length>0){var call=arguments.shift();if(call in context.api){context.api[call](context,arguments[0]==undefined?{}:arguments[0]);}}}
-return $(this).data('wikiEditor-context',context);};})(jQuery);(function($){$.wikiEditor.modules.toolbar={api:{addToToolbar:function(context,data){for(type in data){switch(type){case'sections':var $sections=context.modules.$toolbar.find('div.sections');var $tabs=context.modules.$toolbar.find('div.tabs');for(section in data[type]){if(section=='main'){context.modules.$toolbar.prepend($.wikiEditor.modules.toolbar.fn.buildSection(context,section,data[type][section]));continue;}
+return $(this).data('wikiEditor-context',context);};})(jQuery);RegExp.escape=function(s){return s.replace(/([.*+?^${}()|\/\\[\]])/g,'\\$1');};(function($){$.wikiEditor.modules.dialogs={api:{addDialog:function(context,data){$.wikiEditor.modules.dialogs.fn.create(context,{'modules':data})},openDialog:function(context,data){if(data.dialog in $.wikiEditor.modules.dialogs.modules){$('#'+$.wikiEditor.modules.dialogs.modules[data.dialog].id).dialog('open');}},closeDialog:function(context,data){if(data.dialog in $.wikiEditor.modules.dialogs.modules){$('#'+$.wikiEditor.modules.dialogs.modules[data.dialog].id).dialog('close');}}},fn:{create:function(context,config){for(module in config){$.wikiEditor.modules.dialogs.modules[module]=config[module];}
+for(module in $.wikiEditor.modules.dialogs.modules){var module=$.wikiEditor.modules.dialogs.modules[module];if($('#'+module.id).size()==0){var configuration=module.dialog;configuration.bgiframe=true;configuration.autoOpen=false;configuration.modal=true;configuration.title=$.wikiEditor.autoMsg(module,'title');configuration.newButtons={};for(msg in configuration.buttons)
+configuration.newButtons[gM(msg)]=configuration.buttons[msg];configuration.buttons=configuration.newButtons;$('<div /> ').attr('id',module.id).html(module.html).data('context',context).appendTo($('body')).each(module.init).dialog(configuration).bind('dialogopen',$.wikiEditor.modules.dialogs.fn.resize).find('.ui-tabs').bind('tabsshow',function(){$(this).closest('.ui-dialog-content').each($.wikiEditor.modules.dialogs.fn.resize);});var maxTI=0;$j('[tabindex]').each(function(){var ti=parseInt($j(this).attr('tabindex'));if(ti>maxTI)
+maxTI=ti;});var tabIndex=maxTI+1;$j('.ui-dialog input, .ui-dialog button').not('[tabindex]').each(function(){$j(this).attr('tabindex',tabIndex++);});}}},resize:function(){var wrapper=$(this).closest('.ui-dialog');var oldHidden=$(this).find('*').not(':visible');oldHidden.each(function(){$(this).data('oldstyle',$(this).attr('style'));});oldHidden.show();var oldWS=$(this).css('white-space');$(this).css('white-space','nowrap');if(wrapper.width()<=$(this).get(0).scrollWidth){$(this).width($(this).get(0).scrollWidth);wrapper.width(wrapper.get(0).scrollWidth);$(this).dialog({'width':wrapper.width()});}
+$(this).css('white-space',oldWS);oldHidden.each(function(){$(this).attr('style',$(this).data('oldstyle'));});}},'modules':{}};})(jQuery);(function($){$.wikiEditor.modules.toolbar={api:{addToToolbar:function(context,data){for(type in data){switch(type){case'sections':var $sections=context.modules.$toolbar.find('div.sections');var $tabs=context.modules.$toolbar.find('div.tabs');for(section in data[type]){if(section=='main'){context.modules.$toolbar.prepend($.wikiEditor.modules.toolbar.fn.buildSection(context,section,data[type][section]));continue;}
$sections.append($.wikiEditor.modules.toolbar.fn.buildSection(context,section,data[type][section]));$tabs.append($.wikiEditor.modules.toolbar.fn.buildTab(context,section,data[type][section]));}
break;case'groups':if(!('section'in data)){continue;}
var $section=context.modules.$toolbar.find('div[rel='+data.section+'].section');for(group in data[type]){$section.append($.wikiEditor.modules.toolbar.fn.buildGroup(context,group,data[type][group]));}
@@ -96,12 +131,12 @@
return $section;},updateBookletSelection:function(context,id,$pages,$index){var cookie='wikiEditor-'+context.instance+'-booklet-'+id+'-page';var selected=$.cookie(cookie);var $selectedIndex=$index.find('*[rel='+selected+']');if($selectedIndex.size()==0){selected=$index.children().eq(0).attr('rel');$.cookie(cookie,selected);}
$pages.children().hide();$pages.find('*[rel='+selected+']').show();$index.children().removeClass('current');$selectedIndex.addClass('current');},build:function(context,config){var $tabs=$('<div />').addClass('tabs').appendTo(context.modules.$toolbar);var $sections=$('<div />').addClass('sections').appendTo(context.modules.$toolbar);context.modules.$toolbar.append($('<div />').css('clear','both'));var sectionQueue=[];for(section in config){if(section=='main'){context.modules.$toolbar.prepend($.wikiEditor.modules.toolbar.fn.buildSection(context,section,config[section]));}else{sectionQueue.push({'$sections':$sections,'context':context,'id':section,'config':config[section]});$tabs.append($.wikiEditor.modules.toolbar.fn.buildTab(context,section,config[section]));}}
$.eachAsync(sectionQueue,{'bulk':0,'end':function(){$('body').css('position','static');$('body').css('position','relative');},'loop':function(i,s){s.$sections.append($.wikiEditor.modules.toolbar.fn.buildSection(s.context,s.id,s.config));}});}}};})(jQuery);(function($){$.wikiEditor.modules.toc={api:{},fn:{create:function(context,config){if('$toc'in context.modules){return;}
-context.modules.$toc=$('<div></div>').addClass('wikiEditor-ui-toc').attr('id','wikiEditor-ui-toc');$.wikiEditor.modules.toc.fn.build(context,config);context.$ui.find('.wikiEditor-ui-bottom').append(context.modules.$toc);context.modules.$toc.height(context.$ui.find('.wikiEditor-ui-bottom').height());context.modules.$toc.css('width','12em').css('marginTop',-(context.$ui.find('.wikiEditor-ui-bottom').height()));context.$ui.find('.wikiEditor-ui-text').css(($('body.rtl').size()?'marginLeft':'marginRight'),'12em');$.wikiEditor.modules.toc.fn.build(context);$.wikiEditor.modules.toc.fn.update(context);context.$textarea.bind('keyup encapsulateSelection',function(event){var context=$(this).data('wikiEditor-context');$(this).eachAsync({bulk:0,loop:function(){$.wikiEditor.modules.toc.fn.build(context);$.wikiEditor.modules.toc.fn.update(context);}});}).bind('mouseup scrollToPosition focus',function(event){var context=$(this).data('wikiEditor-context');$(this).eachAsync({bulk:0,loop:function(){$.wikiEditor.modules.toc.fn.update(context);}});}).blur(function(){var context=$(this).data('wikiEditor-context');$.wikiEditor.modules.toc.fn.unhighlight(context);});},unhighlight:function(context){context.modules.$toc.find('a').removeClass('currentSelection');},update:function(context){$.wikiEditor.modules.toc.fn.unhighlight(context);var position=context.$textarea.getCaretPosition();var section=0;if(context.data.outline.length>0){if(!(position<context.data.outline[0].position-1)){while(section<context.data.outline.length&&context.data.outline[section].position-1<position){section++;}
+context.modules.$toc=$('<div></div>').addClass('wikiEditor-ui-toc').attr('id','wikiEditor-ui-toc');$.wikiEditor.modules.toc.fn.build(context,config);context.$ui.find('.wikiEditor-ui-bottom').append(context.modules.$toc);context.modules.$toc.height(context.$ui.find('.wikiEditor-ui-bottom').height());context.modules.$toc.css('width','12em').css('marginTop',-(context.$ui.find('.wikiEditor-ui-bottom').height()));context.$ui.find('.wikiEditor-ui-text').css(($('body.rtl').size()?'marginLeft':'marginRight'),'12em');$.wikiEditor.modules.toc.fn.build(context);$.wikiEditor.modules.toc.fn.update(context);context.$textarea.delayedBind(1000,'keyup encapsulateSelection',function(event){var context=$(this).data('wikiEditor-context');$(this).eachAsync({bulk:0,loop:function(){$.wikiEditor.modules.toc.fn.build(context);$.wikiEditor.modules.toc.fn.update(context);}});}).bind('mouseup scrollToPosition focus keyup encapsulateSelection',function(event){var context=$(this).data('wikiEditor-context');$(this).eachAsync({bulk:0,loop:function(){$.wikiEditor.modules.toc.fn.update(context);}});}).blur(function(){var context=$(this).data('wikiEditor-context');$.wikiEditor.modules.toc.fn.unhighlight(context);});},unhighlight:function(context){context.modules.$toc.find('a').removeClass('currentSelection');},update:function(context){$.wikiEditor.modules.toc.fn.unhighlight(context);var position=context.$textarea.getCaretPosition();var section=0;if(context.data.outline.length>0){if(!(position<context.data.outline[0].position-1)){while(section<context.data.outline.length&&context.data.outline[section].position-1<position){section++;}
section=Math.max(0,section);}
context.modules.$toc.find('a.section-'+section).addClass('currentSelection');}},build:function(context){function buildStructure(outline,offset,level){if(offset==undefined)offset=0;if(level==undefined)level=1;var sections=[];for(var i=offset;i<outline.length;i++){if(outline[i].nLevel==level){var sub=buildStructure(outline,i+1,level+1);if(sub.length){outline[i].sections=sub;}
sections[sections.length]=outline[i];}else if(outline[i].nLevel<level){break;}}
return sections;}
-function buildList(structure){var list=$('<ul></ul>');for(i in structure){var item=$('<li></li>').append($('<a></a>').attr('href','#').addClass('section-'+structure[i].index).data('textbox',context.$textarea).data('position',structure[i].position).click(function(event){$(this).data('textbox').scrollToCaretPosition($(this).data('position'));event.preventDefault();}).text(structure[i].text));if(structure[i].sections!==undefined){item.append(buildList(structure[i].sections));}
+function buildList(structure){var list=$('<ul></ul>');for(i in structure){var item=$('<li></li>').append($('<a></a>').attr('href','#').addClass('section-'+structure[i].index).data('textbox',context.$textarea).data('position',structure[i].position).click(function(event){$(this).data('textbox').setSelection($(this).data('position')).scrollToCaretPosition();event.preventDefault();}).text(structure[i].text));if(structure[i].sections!==undefined){item.append(buildList(structure[i].sections));}
list.append(item);}
return list;}
var outline=[];var wikitext='\n'+context.$textarea.val()+'\n';var headings=wikitext.match(/\n={1,5}.*={1,5}(?=\n)/g);var offset=0;headings=$.makeArray(headings);for(var h=0;h<headings.length;h++){text=headings[h];var position=wikitext.indexOf(text,offset);if(position>offset){offset=position+1;}else if(position==-1){continue;}
@@ -109,8 +144,8 @@
var endLevel=0;for(var c=text.length-1;c>=0;c--){if(text.charAt(c)=='='){endLevel++;}else{break;}}
var level=Math.min(startLevel,endLevel);text=$.trim(text.substr(level,text.length-(level*2)));outline[h]={'text':text,'position':position,'level':level,'index':h+1};}
var lastLevel=0;var nLevel=0;for(var i=0;i<outline.length;i++){if(outline[i].level>lastLevel){nLevel++;}
-else if(outline[i].level<nLevel){nLevel-=Math.max(1,lastLevel-outline[i].level);}
+else if(outline[i].level<lastLevel){nLevel-=Math.max(1,lastLevel-outline[i].level);}
if(nLevel<=0){nLevel=1;}
outline[i].nLevel=nLevel;lastLevel=outline[i].level;}
var structure=buildStructure(outline);if($('input[name=wpSection]').val()=='')
-structure.unshift({'text':wgPageName.replace(/_/g,' '),'level':1,'index':0,'position':0});context.modules.$toc.html(buildList(structure));context.data.outline=outline;}}};})(jQuery);
\ No newline at end of file
+structure.unshift({'text':wgPageName.replace(/_/g,' '),'level':1,'index':0,'position':0});context.modules.$toc.html(buildList(structure));context.modules.$toc.find('ul a').autoEllipse({'position':'right','tooltip':true});context.data.outline=outline;}}};})(jQuery);
\ No newline at end of file
Index: js/js2/jquery-ui-1.7.2.js
===================================================================
--- js/js2/jquery-ui-1.7.2.js (revision 56989)
+++ js/js2/jquery-ui-1.7.2.js (working copy)
@@ -3439,3 +3439,1639 @@
});
})(jQuery);
+/*
+ * jQuery UI Datepicker 1.7.2
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.7.2" } });
+
+var PROP_NAME = 'datepicker';
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false // True if right-to-left language, false if left-to-right
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearRange: '-10:+10', // Range of years to display in drop-down,
+ // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'normal', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false // True to show button panel, false to not show it
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(target);
+ return false;
+ });
+ }
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst));
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param dateText string - the initial date to display (in the current format)
+ @param onSelect function - the function(dateText) to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" size="1" style="position: absolute; top: -100px;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ this._dialogInput.val(dateText);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
+ var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker(null);
+ }
+ var date = this._getDateDatepicker(target);
+ extendRemove(inst.settings, settings);
+ this._setDateDatepicker(target, date);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date
+ @param endDate Date - the new end date for a range (optional) */
+ _setDateDatepicker: function(target, date, endDate) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date, endDate);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @return Date - the current date or
+ Date[2] - the current dates for a range */
+ _getDateDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker(null, '');
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass +
+ ', td.' + $.datepicker._currentClass, inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ $.datepicker._hideDatepicker(null, '');
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ inst.rangeStart = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
+ $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4});
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim](duration, postProcess);
+ if (duration == '')
+ postProcess();
+ if (inst.input[0].type != 'hidden')
+ inst.input[0].focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var dims = {width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4};
+ var self = this;
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover').
+ css({width: dims.width, height: dims.height})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1) {
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ } else {
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ }
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
+ $(inst.input[0]).focus();
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
+ var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
+ offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj.nextSibling;
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker
+ @param duration string - the duration over which to close the date picker */
+ _hideDatepicker: function(input, duration) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (inst.stayOpen)
+ this._selectDate('#' + inst.id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ inst.stayOpen = false;
+ if (this._datepickerShowing) {
+ duration = (duration != null ? duration : this._get(inst, 'duration'));
+ var showAnim = this._get(inst, 'showAnim');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ };
+ if (duration != '' && $.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
+ duration, postProcess);
+ else
+ inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
+ if (duration == '')
+ this._tidyDialog(inst);
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ this._curInst = null;
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker(null, '');
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input[0].focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ if (inst.stayOpen) {
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ }
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ if (inst.stayOpen) {
+ inst.rangeStart = this._daylightSavingAdjust(
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst.stayOpen = false;
+ inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else if (!inst.stayOpen) {
+ this._hideDatepicker(null, this._get(inst, 'duration'));
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input[0].focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
+ var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
+ var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
+ firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
+ if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
+ checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
+ return $.datepicker.iso8601Week(checkDate);
+ } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
+ firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
+ if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
+ return 1;
+ }
+ }
+ return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
+ var size = origSize;
+ var num = 0;
+ while (size > 0 && iValue < value.length &&
+ value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
+ num = num * 10 + parseInt(value.charAt(iValue++),10);
+ size--;
+ }
+ if (size == origSize)
+ throw 'Missing number at position ' + iValue;
+ return num;
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ var size = 0;
+ for (var j = 0; j < names.length; j++)
+ size = Math.max(size, names[j].length);
+ var name = '';
+ var iInit = iValue;
+ while (size > 0 && iValue < value.length) {
+ name += value.charAt(iValue++);
+ for (var i = 0; i < names.length; i++)
+ if (name == names[i])
+ return i + 1;
+ size--;
+ }
+ throw 'Unknown name at position ' + iInit;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ var doy = date.getDate();
+ for (var m = date.getMonth() - 1; m >= 0; m--)
+ doy += this._getDaysInMonth(date.getFullYear(), m);
+ output += formatNumber('o', doy, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst) {
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.input ? inst.input.val() : null;
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ var date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ date = defaultDate;
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset, getDaysInMonth) {
+ var date = new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate :
+ (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, endDate) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._determineDate(date, new Date());
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var stepBigMonths = this._get(inst, 'stepBigMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var endDate = inst.endDay ? this._daylightSavingAdjust(
+ new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group ui-datepicker-group-';
+ switch (col) {
+ case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += 'middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = '';
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = '';
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = otherMonth || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
+ inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
+ (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ui-state-active' : '') + // highlight selected day
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, secondary, monthNames, monthNamesShort) {
+ minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var year = 0;
+ var endYear = 0;
+ if (years.length != 2) {
+ year = drawYear - 10;
+ endYear = drawYear + 10;
+ } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
+ year = drawYear + parseInt(years[0], 10);
+ endYear = drawYear + parseInt(years[1], 10);
+ } else {
+ year = parseInt(years[0], 10);
+ endYear = parseInt(years[1], 10);
+ }
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ if (showMonthAfterYear)
+ html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._daylightSavingAdjust(new Date(year, month, day));
+ // ensure it is within the bounds set
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
+ _getMinMaxDate: function(inst, minMax, checkRange) {
+ var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
+ return (!checkRange || !inst.rangeStart ? date :
+ (!date || inst.rangeStart > date ? inst.rangeStart : date));
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(
+ curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ // during range selection, use minimum of selected date and range start
+ var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
+ new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
+ newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
+ var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.7.2";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window.DP_jQuery = $;
+
+})(jQuery);